Initial commit

This commit is contained in:
Arnaud Nelissen
2021-07-16 10:18:13 +02:00
commit 3af7ddab06
5894 changed files with 590836 additions and 0 deletions

294
node_modules/mongodb/lib/admin.js generated vendored Normal file
View File

@@ -0,0 +1,294 @@
'use strict';
const applyWriteConcern = require('./utils').applyWriteConcern;
const AddUserOperation = require('./operations/add_user');
const ExecuteDbAdminCommandOperation = require('./operations/execute_db_admin_command');
const RemoveUserOperation = require('./operations/remove_user');
const ValidateCollectionOperation = require('./operations/validate_collection');
const ListDatabasesOperation = require('./operations/list_databases');
const executeOperation = require('./operations/execute_operation');
/**
* @fileOverview The **Admin** class is an internal class that allows convenient access to
* the admin functionality and commands for MongoDB.
*
* **ADMIN Cannot directly be instantiated**
* @example
* const MongoClient = require('mongodb').MongoClient;
* const test = require('assert');
* // Connection url
* const url = 'mongodb://localhost:27017';
* // Database Name
* const dbName = 'test';
*
* // Connect using MongoClient
* MongoClient.connect(url, function(err, client) {
* // Use the admin database for the operation
* const adminDb = client.db(dbName).admin();
*
* // List all the available databases
* adminDb.listDatabases(function(err, dbs) {
* test.equal(null, err);
* test.ok(dbs.databases.length > 0);
* client.close();
* });
* });
*/
/**
* Create a new Admin instance (INTERNAL TYPE, do not instantiate directly)
* @class
* @return {Admin} a collection instance.
*/
function Admin(db, topology, promiseLibrary) {
if (!(this instanceof Admin)) return new Admin(db, topology);
// Internal state
this.s = {
db: db,
topology: topology,
promiseLibrary: promiseLibrary
};
}
/**
* The callback format for results
* @callback Admin~resultCallback
* @param {MongoError} error An error instance representing the error during the execution.
* @param {object} result The result object if the command was executed successfully.
*/
/**
* Execute a command
* @method
* @param {object} command The command hash
* @param {object} [options] Optional settings.
* @param {(ReadPreference|string)} [options.readPreference] The preferred read preference (ReadPreference.PRIMARY, ReadPreference.PRIMARY_PREFERRED, ReadPreference.SECONDARY, ReadPreference.SECONDARY_PREFERRED, ReadPreference.NEAREST).
* @param {number} [options.maxTimeMS] Number of milliseconds to wait before aborting the query.
* @param {Admin~resultCallback} [callback] The command result callback
* @return {Promise} returns Promise if no callback passed
*/
Admin.prototype.command = function(command, options, callback) {
const args = Array.prototype.slice.call(arguments, 1);
callback = typeof args[args.length - 1] === 'function' ? args.pop() : undefined;
options = args.length ? args.shift() : {};
const commandOperation = new ExecuteDbAdminCommandOperation(this.s.db, command, options);
return executeOperation(this.s.db.s.topology, commandOperation, callback);
};
/**
* Retrieve the server information for the current
* instance of the db client
*
* @param {Object} [options] optional parameters for this operation
* @param {ClientSession} [options.session] optional session to use for this operation
* @param {Admin~resultCallback} [callback] The command result callback
* @return {Promise} returns Promise if no callback passed
*/
Admin.prototype.buildInfo = function(options, callback) {
if (typeof options === 'function') (callback = options), (options = {});
options = options || {};
const cmd = { buildinfo: 1 };
const buildInfoOperation = new ExecuteDbAdminCommandOperation(this.s.db, cmd, options);
return executeOperation(this.s.db.s.topology, buildInfoOperation, callback);
};
/**
* Retrieve the server information for the current
* instance of the db client
*
* @param {Object} [options] optional parameters for this operation
* @param {ClientSession} [options.session] optional session to use for this operation
* @param {Admin~resultCallback} [callback] The command result callback
* @return {Promise} returns Promise if no callback passed
*/
Admin.prototype.serverInfo = function(options, callback) {
if (typeof options === 'function') (callback = options), (options = {});
options = options || {};
const cmd = { buildinfo: 1 };
const serverInfoOperation = new ExecuteDbAdminCommandOperation(this.s.db, cmd, options);
return executeOperation(this.s.db.s.topology, serverInfoOperation, callback);
};
/**
* Retrieve this db's server status.
*
* @param {Object} [options] optional parameters for this operation
* @param {ClientSession} [options.session] optional session to use for this operation
* @param {Admin~resultCallback} [callback] The command result callback
* @return {Promise} returns Promise if no callback passed
*/
Admin.prototype.serverStatus = function(options, callback) {
if (typeof options === 'function') (callback = options), (options = {});
options = options || {};
const serverStatusOperation = new ExecuteDbAdminCommandOperation(
this.s.db,
{ serverStatus: 1 },
options
);
return executeOperation(this.s.db.s.topology, serverStatusOperation, callback);
};
/**
* Ping the MongoDB server and retrieve results
*
* @param {Object} [options] optional parameters for this operation
* @param {ClientSession} [options.session] optional session to use for this operation
* @param {Admin~resultCallback} [callback] The command result callback
* @return {Promise} returns Promise if no callback passed
*/
Admin.prototype.ping = function(options, callback) {
if (typeof options === 'function') (callback = options), (options = {});
options = options || {};
const cmd = { ping: 1 };
const pingOperation = new ExecuteDbAdminCommandOperation(this.s.db, cmd, options);
return executeOperation(this.s.db.s.topology, pingOperation, callback);
};
/**
* Add a user to the database.
* @method
* @param {string} username The username.
* @param {string} password The password.
* @param {object} [options] Optional settings.
* @param {(number|string)} [options.w] The write concern.
* @param {number} [options.wtimeout] The write concern timeout.
* @param {boolean} [options.j=false] Specify a journal write concern.
* @param {boolean} [options.fsync=false] Specify a file sync write concern.
* @param {object} [options.customData] Custom data associated with the user (only Mongodb 2.6 or higher)
* @param {object[]} [options.roles] Roles associated with the created user (only Mongodb 2.6 or higher)
* @param {ClientSession} [options.session] optional session to use for this operation
* @param {Admin~resultCallback} [callback] The command result callback
* @return {Promise} returns Promise if no callback passed
*/
Admin.prototype.addUser = function(username, password, options, callback) {
const args = Array.prototype.slice.call(arguments, 2);
callback = typeof args[args.length - 1] === 'function' ? args.pop() : undefined;
// Special case where there is no password ($external users)
if (typeof username === 'string' && password != null && typeof password === 'object') {
options = password;
password = null;
}
options = args.length ? args.shift() : {};
options = Object.assign({}, options);
// Get the options
options = applyWriteConcern(options, { db: this.s.db });
// Set the db name to admin
options.dbName = 'admin';
const addUserOperation = new AddUserOperation(this.s.db, username, password, options);
return executeOperation(this.s.db.s.topology, addUserOperation, callback);
};
/**
* Remove a user from a database
* @method
* @param {string} username The username.
* @param {object} [options] Optional settings.
* @param {(number|string)} [options.w] The write concern.
* @param {number} [options.wtimeout] The write concern timeout.
* @param {boolean} [options.j=false] Specify a journal write concern.
* @param {boolean} [options.fsync=false] Specify a file sync write concern.
* @param {ClientSession} [options.session] optional session to use for this operation
* @param {Admin~resultCallback} [callback] The command result callback
* @return {Promise} returns Promise if no callback passed
*/
Admin.prototype.removeUser = function(username, options, callback) {
const args = Array.prototype.slice.call(arguments, 1);
callback = typeof args[args.length - 1] === 'function' ? args.pop() : undefined;
options = args.length ? args.shift() : {};
options = Object.assign({}, options);
// Get the options
options = applyWriteConcern(options, { db: this.s.db });
// Set the db name
options.dbName = 'admin';
const removeUserOperation = new RemoveUserOperation(this.s.db, username, options);
return executeOperation(this.s.db.s.topology, removeUserOperation, callback);
};
/**
* Validate an existing collection
*
* @param {string} collectionName The name of the collection to validate.
* @param {object} [options] Optional settings.
* @param {boolean} [options.background] Validates a collection in the background, without interrupting read or write traffic (only in MongoDB 4.4+)
* @param {ClientSession} [options.session] optional session to use for this operation
* @param {Admin~resultCallback} [callback] The command result callback.
* @return {Promise} returns Promise if no callback passed
*/
Admin.prototype.validateCollection = function(collectionName, options, callback) {
if (typeof options === 'function') (callback = options), (options = {});
options = options || {};
const validateCollectionOperation = new ValidateCollectionOperation(
this,
collectionName,
options
);
return executeOperation(this.s.db.s.topology, validateCollectionOperation, callback);
};
/**
* List the available databases
*
* @param {object} [options] Optional settings.
* @param {boolean} [options.nameOnly=false] Whether the command should return only db names, or names and size info.
* @param {ClientSession} [options.session] optional session to use for this operation
* @param {Admin~resultCallback} [callback] The command result callback.
* @return {Promise} returns Promise if no callback passed
*/
Admin.prototype.listDatabases = function(options, callback) {
if (typeof options === 'function') (callback = options), (options = {});
options = options || {};
return executeOperation(
this.s.db.s.topology,
new ListDatabasesOperation(this.s.db, options),
callback
);
};
/**
* Get ReplicaSet status
*
* @param {Object} [options] optional parameters for this operation
* @param {ClientSession} [options.session] optional session to use for this operation
* @param {Admin~resultCallback} [callback] The command result callback.
* @return {Promise} returns Promise if no callback passed
*/
Admin.prototype.replSetGetStatus = function(options, callback) {
if (typeof options === 'function') (callback = options), (options = {});
options = options || {};
const replSetGetStatusOperation = new ExecuteDbAdminCommandOperation(
this.s.db,
{ replSetGetStatus: 1 },
options
);
return executeOperation(this.s.db.s.topology, replSetGetStatusOperation, callback);
};
module.exports = Admin;

370
node_modules/mongodb/lib/aggregation_cursor.js generated vendored Normal file
View File

@@ -0,0 +1,370 @@
'use strict';
const MongoError = require('./core').MongoError;
const Cursor = require('./cursor');
const CursorState = require('./core/cursor').CursorState;
const deprecate = require('util').deprecate;
/**
* @fileOverview The **AggregationCursor** class is an internal class that embodies an aggregation cursor on MongoDB
* allowing for iteration over the results returned from the underlying query. It supports
* one by one document iteration, conversion to an array or can be iterated as a Node 4.X
* or higher stream
*
* **AGGREGATIONCURSOR Cannot directly be instantiated**
* @example
* const MongoClient = require('mongodb').MongoClient;
* const test = require('assert');
* // Connection url
* const url = 'mongodb://localhost:27017';
* // Database Name
* const dbName = 'test';
* // Connect using MongoClient
* MongoClient.connect(url, function(err, client) {
* // Create a collection we want to drop later
* const col = client.db(dbName).collection('createIndexExample1');
* // Insert a bunch of documents
* col.insert([{a:1, b:1}
* , {a:2, b:2}, {a:3, b:3}
* , {a:4, b:4}], {w:1}, function(err, result) {
* test.equal(null, err);
* // Show that duplicate records got dropped
* col.aggregation({}, {cursor: {}}).toArray(function(err, items) {
* test.equal(null, err);
* test.equal(4, items.length);
* client.close();
* });
* });
* });
*/
/**
* Namespace provided by the browser.
* @external Readable
*/
/**
* Creates a new Aggregation Cursor instance (INTERNAL TYPE, do not instantiate directly)
* @class AggregationCursor
* @extends external:Readable
* @fires AggregationCursor#data
* @fires AggregationCursor#end
* @fires AggregationCursor#close
* @fires AggregationCursor#readable
* @return {AggregationCursor} an AggregationCursor instance.
*/
class AggregationCursor extends Cursor {
constructor(topology, operation, options) {
super(topology, operation, options);
}
/**
* Set the batch size for the cursor.
* @method
* @param {number} value The number of documents to return per batch. See {@link https://docs.mongodb.com/manual/reference/command/aggregate|aggregation documentation}.
* @throws {MongoError}
* @return {AggregationCursor}
*/
batchSize(value) {
if (this.s.state === CursorState.CLOSED || this.isDead()) {
throw MongoError.create({ message: 'Cursor is closed', driver: true });
}
if (typeof value !== 'number') {
throw MongoError.create({ message: 'batchSize requires an integer', driver: true });
}
this.operation.options.batchSize = value;
this.setCursorBatchSize(value);
return this;
}
/**
* Add a geoNear stage to the aggregation pipeline
* @method
* @param {object} document The geoNear stage document.
* @return {AggregationCursor}
*/
geoNear(document) {
this.operation.addToPipeline({ $geoNear: document });
return this;
}
/**
* Add a group stage to the aggregation pipeline
* @method
* @param {object} document The group stage document.
* @return {AggregationCursor}
*/
group(document) {
this.operation.addToPipeline({ $group: document });
return this;
}
/**
* Add a limit stage to the aggregation pipeline
* @method
* @param {number} value The state limit value.
* @return {AggregationCursor}
*/
limit(value) {
this.operation.addToPipeline({ $limit: value });
return this;
}
/**
* Add a match stage to the aggregation pipeline
* @method
* @param {object} document The match stage document.
* @return {AggregationCursor}
*/
match(document) {
this.operation.addToPipeline({ $match: document });
return this;
}
/**
* Add a maxTimeMS stage to the aggregation pipeline
* @method
* @param {number} value The state maxTimeMS value.
* @return {AggregationCursor}
*/
maxTimeMS(value) {
this.operation.options.maxTimeMS = value;
return this;
}
/**
* Add a out stage to the aggregation pipeline
* @method
* @param {number} destination The destination name.
* @return {AggregationCursor}
*/
out(destination) {
this.operation.addToPipeline({ $out: destination });
return this;
}
/**
* Add a project stage to the aggregation pipeline
* @method
* @param {object} document The project stage document.
* @return {AggregationCursor}
*/
project(document) {
this.operation.addToPipeline({ $project: document });
return this;
}
/**
* Add a lookup stage to the aggregation pipeline
* @method
* @param {object} document The lookup stage document.
* @return {AggregationCursor}
*/
lookup(document) {
this.operation.addToPipeline({ $lookup: document });
return this;
}
/**
* Add a redact stage to the aggregation pipeline
* @method
* @param {object} document The redact stage document.
* @return {AggregationCursor}
*/
redact(document) {
this.operation.addToPipeline({ $redact: document });
return this;
}
/**
* Add a skip stage to the aggregation pipeline
* @method
* @param {number} value The state skip value.
* @return {AggregationCursor}
*/
skip(value) {
this.operation.addToPipeline({ $skip: value });
return this;
}
/**
* Add a sort stage to the aggregation pipeline
* @method
* @param {object} document The sort stage document.
* @return {AggregationCursor}
*/
sort(document) {
this.operation.addToPipeline({ $sort: document });
return this;
}
/**
* Add a unwind stage to the aggregation pipeline
* @method
* @param {number} field The unwind field name.
* @return {AggregationCursor}
*/
unwind(field) {
this.operation.addToPipeline({ $unwind: field });
return this;
}
/**
* Return the cursor logger
* @method
* @return {Logger} return the cursor logger
* @ignore
*/
getLogger() {
return this.logger;
}
}
// aliases
AggregationCursor.prototype.get = AggregationCursor.prototype.toArray;
// deprecated methods
deprecate(
AggregationCursor.prototype.geoNear,
'The `$geoNear` stage is deprecated in MongoDB 4.0, and removed in version 4.2.'
);
/**
* AggregationCursor stream data event, fired for each document in the cursor.
*
* @event AggregationCursor#data
* @type {object}
*/
/**
* AggregationCursor stream end event
*
* @event AggregationCursor#end
* @type {null}
*/
/**
* AggregationCursor stream close event
*
* @event AggregationCursor#close
* @type {null}
*/
/**
* AggregationCursor stream readable event
*
* @event AggregationCursor#readable
* @type {null}
*/
/**
* Get the next available document from the cursor, returns null if no more documents are available.
* @function AggregationCursor.prototype.next
* @param {AggregationCursor~resultCallback} [callback] The result callback.
* @throws {MongoError}
* @return {Promise} returns Promise if no callback passed
*/
/**
* Check if there is any document still available in the cursor
* @function AggregationCursor.prototype.hasNext
* @param {AggregationCursor~resultCallback} [callback] The result callback.
* @throws {MongoError}
* @return {Promise} returns Promise if no callback passed
*/
/**
* The callback format for results
* @callback AggregationCursor~toArrayResultCallback
* @param {MongoError} error An error instance representing the error during the execution.
* @param {object[]} documents All the documents the satisfy the cursor.
*/
/**
* Returns an array of documents. The caller is responsible for making sure that there
* is enough memory to store the results. Note that the array only contain partial
* results when this cursor had been previously accessed. In that case,
* cursor.rewind() can be used to reset the cursor.
* @method AggregationCursor.prototype.toArray
* @param {AggregationCursor~toArrayResultCallback} [callback] The result callback.
* @throws {MongoError}
* @return {Promise} returns Promise if no callback passed
*/
/**
* The callback format for results
* @callback AggregationCursor~resultCallback
* @param {MongoError} error An error instance representing the error during the execution.
* @param {(object|null)} result The result object if the command was executed successfully.
*/
/**
* Iterates over all the documents for this cursor. As with **{cursor.toArray}**,
* not all of the elements will be iterated if this cursor had been previously accessed.
* In that case, **{cursor.rewind}** can be used to reset the cursor. However, unlike
* **{cursor.toArray}**, the cursor will only hold a maximum of batch size elements
* at any given time if batch size is specified. Otherwise, the caller is responsible
* for making sure that the entire result can fit the memory.
* @method AggregationCursor.prototype.each
* @deprecated
* @param {AggregationCursor~resultCallback} callback The result callback.
* @throws {MongoError}
* @return {null}
*/
/**
* Close the cursor, sending a AggregationCursor command and emitting close.
* @method AggregationCursor.prototype.close
* @param {AggregationCursor~resultCallback} [callback] The result callback.
* @return {Promise} returns Promise if no callback passed
*/
/**
* Is the cursor closed
* @method AggregationCursor.prototype.isClosed
* @return {boolean}
*/
/**
* Execute the explain for the cursor
* @method AggregationCursor.prototype.explain
* @param {AggregationCursor~resultCallback} [callback] The result callback.
* @return {Promise} returns Promise if no callback passed
*/
/**
* Clone the cursor
* @function AggregationCursor.prototype.clone
* @return {AggregationCursor}
*/
/**
* Resets the cursor
* @function AggregationCursor.prototype.rewind
* @return {AggregationCursor}
*/
/**
* The callback format for the forEach iterator method
* @callback AggregationCursor~iteratorCallback
* @param {Object} doc An emitted document for the iterator
*/
/**
* The callback error format for the forEach iterator method
* @callback AggregationCursor~endCallback
* @param {MongoError} error An error instance representing the error during the execution.
*/
/**
* Iterates over all the documents for this cursor using the iterator, callback pattern.
* @method AggregationCursor.prototype.forEach
* @param {AggregationCursor~iteratorCallback} iterator The iteration callback.
* @param {AggregationCursor~endCallback} callback The end callback.
* @throws {MongoError}
* @return {null}
*/
module.exports = AggregationCursor;

31
node_modules/mongodb/lib/apm.js generated vendored Normal file
View File

@@ -0,0 +1,31 @@
'use strict';
const EventEmitter = require('events').EventEmitter;
class Instrumentation extends EventEmitter {
constructor() {
super();
}
instrument(MongoClient, callback) {
// store a reference to the original functions
this.$MongoClient = MongoClient;
const $prototypeConnect = (this.$prototypeConnect = MongoClient.prototype.connect);
const instrumentation = this;
MongoClient.prototype.connect = function(callback) {
this.s.options.monitorCommands = true;
this.on('commandStarted', event => instrumentation.emit('started', event));
this.on('commandSucceeded', event => instrumentation.emit('succeeded', event));
this.on('commandFailed', event => instrumentation.emit('failed', event));
return $prototypeConnect.call(this, callback);
};
if (typeof callback === 'function') callback(null, this);
}
uninstrument() {
this.$MongoClient.prototype.connect = this.$prototypeConnect;
}
}
module.exports = Instrumentation;

5
node_modules/mongodb/lib/async/.eslintrc generated vendored Normal file
View File

@@ -0,0 +1,5 @@
{
"parserOptions": {
"ecmaVersion": 2018
}
}

33
node_modules/mongodb/lib/async/async_iterator.js generated vendored Normal file
View File

@@ -0,0 +1,33 @@
'use strict';
// async function* asyncIterator() {
// while (true) {
// const value = await this.next();
// if (!value) {
// await this.close();
// return;
// }
// yield value;
// }
// }
// TODO: change this to the async generator function above
function asyncIterator() {
const cursor = this;
return {
next: function() {
return Promise.resolve()
.then(() => cursor.next())
.then(value => {
if (!value) {
return cursor.close().then(() => ({ value, done: true }));
}
return { value, done: false };
});
}
};
}
exports.asyncIterator = asyncIterator;

1297
node_modules/mongodb/lib/bulk/common.js generated vendored Normal file

File diff suppressed because it is too large Load Diff

110
node_modules/mongodb/lib/bulk/ordered.js generated vendored Normal file
View File

@@ -0,0 +1,110 @@
'use strict';
const common = require('./common');
const BulkOperationBase = common.BulkOperationBase;
const Batch = common.Batch;
const bson = common.bson;
const utils = require('../utils');
const toError = utils.toError;
/**
* Add to internal list of Operations
*
* @ignore
* @param {OrderedBulkOperation} bulkOperation
* @param {number} docType number indicating the document type
* @param {object} document
* @return {OrderedBulkOperation}
*/
function addToOperationsList(bulkOperation, docType, document) {
// Get the bsonSize
const bsonSize = bson.calculateObjectSize(document, {
checkKeys: false,
// Since we don't know what the user selected for BSON options here,
// err on the safe side, and check the size with ignoreUndefined: false.
ignoreUndefined: false
});
// Throw error if the doc is bigger than the max BSON size
if (bsonSize >= bulkOperation.s.maxBsonObjectSize)
throw toError('document is larger than the maximum size ' + bulkOperation.s.maxBsonObjectSize);
// Create a new batch object if we don't have a current one
if (bulkOperation.s.currentBatch == null)
bulkOperation.s.currentBatch = new Batch(docType, bulkOperation.s.currentIndex);
const maxKeySize = bulkOperation.s.maxKeySize;
// Check if we need to create a new batch
if (
// New batch if we exceed the max batch op size
bulkOperation.s.currentBatchSize + 1 >= bulkOperation.s.maxWriteBatchSize ||
// New batch if we exceed the maxBatchSizeBytes. Only matters if batch already has a doc,
// since we can't sent an empty batch
(bulkOperation.s.currentBatchSize > 0 &&
bulkOperation.s.currentBatchSizeBytes + maxKeySize + bsonSize >=
bulkOperation.s.maxBatchSizeBytes) ||
// New batch if the new op does not have the same op type as the current batch
bulkOperation.s.currentBatch.batchType !== docType
) {
// Save the batch to the execution stack
bulkOperation.s.batches.push(bulkOperation.s.currentBatch);
// Create a new batch
bulkOperation.s.currentBatch = new Batch(docType, bulkOperation.s.currentIndex);
// Reset the current size trackers
bulkOperation.s.currentBatchSize = 0;
bulkOperation.s.currentBatchSizeBytes = 0;
}
if (docType === common.INSERT) {
bulkOperation.s.bulkResult.insertedIds.push({
index: bulkOperation.s.currentIndex,
_id: document._id
});
}
// We have an array of documents
if (Array.isArray(document)) {
throw toError('operation passed in cannot be an Array');
}
bulkOperation.s.currentBatch.originalIndexes.push(bulkOperation.s.currentIndex);
bulkOperation.s.currentBatch.operations.push(document);
bulkOperation.s.currentBatchSize += 1;
bulkOperation.s.currentBatchSizeBytes += maxKeySize + bsonSize;
bulkOperation.s.currentIndex += 1;
// Return bulkOperation
return bulkOperation;
}
/**
* Create a new OrderedBulkOperation instance (INTERNAL TYPE, do not instantiate directly)
* @class
* @extends BulkOperationBase
* @property {number} length Get the number of operations in the bulk.
* @return {OrderedBulkOperation} a OrderedBulkOperation instance.
*/
class OrderedBulkOperation extends BulkOperationBase {
constructor(topology, collection, options) {
options = options || {};
options = Object.assign(options, { addToOperationsList });
super(topology, collection, options, true);
}
}
/**
* Returns an unordered batch object
* @ignore
*/
function initializeOrderedBulkOp(topology, collection, options) {
return new OrderedBulkOperation(topology, collection, options);
}
initializeOrderedBulkOp.OrderedBulkOperation = OrderedBulkOperation;
module.exports = initializeOrderedBulkOp;
module.exports.Bulk = OrderedBulkOperation;

131
node_modules/mongodb/lib/bulk/unordered.js generated vendored Normal file
View File

@@ -0,0 +1,131 @@
'use strict';
const common = require('./common');
const BulkOperationBase = common.BulkOperationBase;
const Batch = common.Batch;
const bson = common.bson;
const utils = require('../utils');
const toError = utils.toError;
/**
* Add to internal list of Operations
*
* @ignore
* @param {UnorderedBulkOperation} bulkOperation
* @param {number} docType number indicating the document type
* @param {object} document
* @return {UnorderedBulkOperation}
*/
function addToOperationsList(bulkOperation, docType, document) {
// Get the bsonSize
const bsonSize = bson.calculateObjectSize(document, {
checkKeys: false,
// Since we don't know what the user selected for BSON options here,
// err on the safe side, and check the size with ignoreUndefined: false.
ignoreUndefined: false
});
// Throw error if the doc is bigger than the max BSON size
if (bsonSize >= bulkOperation.s.maxBsonObjectSize)
throw toError('document is larger than the maximum size ' + bulkOperation.s.maxBsonObjectSize);
// Holds the current batch
bulkOperation.s.currentBatch = null;
// Get the right type of batch
if (docType === common.INSERT) {
bulkOperation.s.currentBatch = bulkOperation.s.currentInsertBatch;
} else if (docType === common.UPDATE) {
bulkOperation.s.currentBatch = bulkOperation.s.currentUpdateBatch;
} else if (docType === common.REMOVE) {
bulkOperation.s.currentBatch = bulkOperation.s.currentRemoveBatch;
}
const maxKeySize = bulkOperation.s.maxKeySize;
// Create a new batch object if we don't have a current one
if (bulkOperation.s.currentBatch == null)
bulkOperation.s.currentBatch = new Batch(docType, bulkOperation.s.currentIndex);
// Check if we need to create a new batch
if (
// New batch if we exceed the max batch op size
bulkOperation.s.currentBatch.size + 1 >= bulkOperation.s.maxWriteBatchSize ||
// New batch if we exceed the maxBatchSizeBytes. Only matters if batch already has a doc,
// since we can't sent an empty batch
(bulkOperation.s.currentBatch.size > 0 &&
bulkOperation.s.currentBatch.sizeBytes + maxKeySize + bsonSize >=
bulkOperation.s.maxBatchSizeBytes) ||
// New batch if the new op does not have the same op type as the current batch
bulkOperation.s.currentBatch.batchType !== docType
) {
// Save the batch to the execution stack
bulkOperation.s.batches.push(bulkOperation.s.currentBatch);
// Create a new batch
bulkOperation.s.currentBatch = new Batch(docType, bulkOperation.s.currentIndex);
}
// We have an array of documents
if (Array.isArray(document)) {
throw toError('operation passed in cannot be an Array');
}
bulkOperation.s.currentBatch.operations.push(document);
bulkOperation.s.currentBatch.originalIndexes.push(bulkOperation.s.currentIndex);
bulkOperation.s.currentIndex = bulkOperation.s.currentIndex + 1;
// Save back the current Batch to the right type
if (docType === common.INSERT) {
bulkOperation.s.currentInsertBatch = bulkOperation.s.currentBatch;
bulkOperation.s.bulkResult.insertedIds.push({
index: bulkOperation.s.bulkResult.insertedIds.length,
_id: document._id
});
} else if (docType === common.UPDATE) {
bulkOperation.s.currentUpdateBatch = bulkOperation.s.currentBatch;
} else if (docType === common.REMOVE) {
bulkOperation.s.currentRemoveBatch = bulkOperation.s.currentBatch;
}
// Update current batch size
bulkOperation.s.currentBatch.size += 1;
bulkOperation.s.currentBatch.sizeBytes += maxKeySize + bsonSize;
// Return bulkOperation
return bulkOperation;
}
/**
* Create a new UnorderedBulkOperation instance (INTERNAL TYPE, do not instantiate directly)
* @class
* @extends BulkOperationBase
* @property {number} length Get the number of operations in the bulk.
* @return {UnorderedBulkOperation} a UnorderedBulkOperation instance.
*/
class UnorderedBulkOperation extends BulkOperationBase {
constructor(topology, collection, options) {
options = options || {};
options = Object.assign(options, { addToOperationsList });
super(topology, collection, options, false);
}
handleWriteError(callback, writeResult) {
if (this.s.batches.length) {
return false;
}
return super.handleWriteError(callback, writeResult);
}
}
/**
* Returns an unordered batch object
* @ignore
*/
function initializeUnorderedBulkOp(topology, collection, options) {
return new UnorderedBulkOperation(topology, collection, options);
}
initializeUnorderedBulkOp.UnorderedBulkOperation = UnorderedBulkOperation;
module.exports = initializeUnorderedBulkOp;
module.exports.Bulk = UnorderedBulkOperation;

623
node_modules/mongodb/lib/change_stream.js generated vendored Normal file
View File

@@ -0,0 +1,623 @@
'use strict';
const Denque = require('denque');
const EventEmitter = require('events');
const isResumableError = require('./error').isResumableError;
const MongoError = require('./core').MongoError;
const Cursor = require('./cursor');
const relayEvents = require('./core/utils').relayEvents;
const maxWireVersion = require('./core/utils').maxWireVersion;
const maybePromise = require('./utils').maybePromise;
const now = require('./utils').now;
const calculateDurationInMs = require('./utils').calculateDurationInMs;
const AggregateOperation = require('./operations/aggregate');
const kResumeQueue = Symbol('resumeQueue');
const CHANGE_STREAM_OPTIONS = ['resumeAfter', 'startAfter', 'startAtOperationTime', 'fullDocument'];
const CURSOR_OPTIONS = ['batchSize', 'maxAwaitTimeMS', 'collation', 'readPreference'].concat(
CHANGE_STREAM_OPTIONS
);
const CHANGE_DOMAIN_TYPES = {
COLLECTION: Symbol('Collection'),
DATABASE: Symbol('Database'),
CLUSTER: Symbol('Cluster')
};
/**
* @typedef ResumeToken
* @description Represents the logical starting point for a new or resuming {@link ChangeStream} on the server.
* @see https://docs.mongodb.com/master/changeStreams/#change-stream-resume-token
*/
/**
* @typedef OperationTime
* @description Represents a specific point in time on a server. Can be retrieved by using {@link Db#command}
* @see https://docs.mongodb.com/manual/reference/method/db.runCommand/#response
*/
/**
* @typedef ChangeStreamOptions
* @description Options that can be passed to a ChangeStream. Note that startAfter, resumeAfter, and startAtOperationTime are all mutually exclusive, and the server will error if more than one is specified.
* @property {string} [fullDocument='default'] Allowed values: default, updateLookup. When set to updateLookup, the change stream will include both a delta describing the changes to the document, as well as a copy of the entire document that was changed from some time after the change occurred.
* @property {number} [maxAwaitTimeMS] The maximum amount of time for the server to wait on new documents to satisfy a change stream query.
* @property {ResumeToken} [resumeAfter] Allows you to start a changeStream after a specified event. See {@link https://docs.mongodb.com/master/changeStreams/#resumeafter-for-change-streams|ChangeStream documentation}.
* @property {ResumeToken} [startAfter] Similar to resumeAfter, but will allow you to start after an invalidated event. See {@link https://docs.mongodb.com/master/changeStreams/#startafter-for-change-streams|ChangeStream documentation}.
* @property {OperationTime} [startAtOperationTime] Will start the changeStream after the specified operationTime.
* @property {number} [batchSize=1000] The number of documents to return per batch. See {@link https://docs.mongodb.com/manual/reference/command/aggregate|aggregation documentation}.
* @property {object} [collation] Specify collation settings for operation. See {@link https://docs.mongodb.com/manual/reference/command/aggregate|aggregation documentation}.
* @property {ReadPreference} [readPreference] The read preference. Defaults to the read preference of the database or collection. See {@link https://docs.mongodb.com/manual/reference/read-preference|read preference documentation}.
*/
/**
* Creates a new Change Stream instance. Normally created using {@link Collection#watch|Collection.watch()}.
* @class ChangeStream
* @since 3.0.0
* @param {(MongoClient|Db|Collection)} parent The parent object that created this change stream
* @param {Array} pipeline An array of {@link https://docs.mongodb.com/manual/reference/operator/aggregation-pipeline/|aggregation pipeline stages} through which to pass change stream documents
* @param {ChangeStreamOptions} [options] Optional settings
* @fires ChangeStream#close
* @fires ChangeStream#change
* @fires ChangeStream#end
* @fires ChangeStream#error
* @fires ChangeStream#resumeTokenChanged
* @return {ChangeStream} a ChangeStream instance.
*/
class ChangeStream extends EventEmitter {
constructor(parent, pipeline, options) {
super();
const Collection = require('./collection');
const Db = require('./db');
const MongoClient = require('./mongo_client');
this.pipeline = pipeline || [];
this.options = options || {};
this.parent = parent;
this.namespace = parent.s.namespace;
if (parent instanceof Collection) {
this.type = CHANGE_DOMAIN_TYPES.COLLECTION;
this.topology = parent.s.db.serverConfig;
} else if (parent instanceof Db) {
this.type = CHANGE_DOMAIN_TYPES.DATABASE;
this.topology = parent.serverConfig;
} else if (parent instanceof MongoClient) {
this.type = CHANGE_DOMAIN_TYPES.CLUSTER;
this.topology = parent.topology;
} else {
throw new TypeError(
'parent provided to ChangeStream constructor is not an instance of Collection, Db, or MongoClient'
);
}
this.promiseLibrary = parent.s.promiseLibrary;
if (!this.options.readPreference && parent.s.readPreference) {
this.options.readPreference = parent.s.readPreference;
}
this[kResumeQueue] = new Denque();
// Create contained Change Stream cursor
this.cursor = createChangeStreamCursor(this, options);
this.closed = false;
// Listen for any `change` listeners being added to ChangeStream
this.on('newListener', eventName => {
if (eventName === 'change' && this.cursor && this.listenerCount('change') === 0) {
this.cursor.on('data', change => processNewChange(this, change));
}
});
// Listen for all `change` listeners being removed from ChangeStream
this.on('removeListener', eventName => {
if (eventName === 'change' && this.listenerCount('change') === 0 && this.cursor) {
this.cursor.removeAllListeners('data');
}
});
}
/**
* @property {ResumeToken} resumeToken
* The cached resume token that will be used to resume
* after the most recently returned change.
*/
get resumeToken() {
return this.cursor.resumeToken;
}
/**
* Check if there is any document still available in the Change Stream
* @function ChangeStream.prototype.hasNext
* @param {ChangeStream~resultCallback} [callback] The result callback.
* @throws {MongoError}
* @returns {Promise|void} returns Promise if no callback passed
*/
hasNext(callback) {
return maybePromise(this.parent, callback, cb => {
getCursor(this, (err, cursor) => {
if (err) return cb(err); // failed to resume, raise an error
cursor.hasNext(cb);
});
});
}
/**
* Get the next available document from the Change Stream, returns null if no more documents are available.
* @function ChangeStream.prototype.next
* @param {ChangeStream~resultCallback} [callback] The result callback.
* @throws {MongoError}
* @returns {Promise|void} returns Promise if no callback passed
*/
next(callback) {
return maybePromise(this.parent, callback, cb => {
getCursor(this, (err, cursor) => {
if (err) return cb(err); // failed to resume, raise an error
cursor.next((error, change) => {
if (error) {
this[kResumeQueue].push(() => this.next(cb));
processError(this, error, cb);
return;
}
processNewChange(this, change, cb);
});
});
});
}
/**
* Is the change stream closed
* @method ChangeStream.prototype.isClosed
* @return {boolean}
*/
isClosed() {
return this.closed || (this.cursor && this.cursor.isClosed());
}
/**
* Close the Change Stream
* @method ChangeStream.prototype.close
* @param {ChangeStream~resultCallback} [callback] The result callback.
* @return {Promise} returns Promise if no callback passed
*/
close(callback) {
return maybePromise(this.parent, callback, cb => {
if (this.closed) return cb();
// flag the change stream as explicitly closed
this.closed = true;
if (!this.cursor) return cb();
// Tidy up the existing cursor
const cursor = this.cursor;
return cursor.close(err => {
['data', 'close', 'end', 'error'].forEach(event => cursor.removeAllListeners(event));
this.cursor = undefined;
return cb(err);
});
});
}
/**
* This method pulls all the data out of a readable stream, and writes it to the supplied destination, automatically managing the flow so that the destination is not overwhelmed by a fast readable stream.
* @method
* @param {Writable} destination The destination for writing data
* @param {object} [options] {@link https://nodejs.org/api/stream.html#stream_readable_pipe_destination_options|Pipe options}
* @return {null}
*/
pipe(destination, options) {
if (!this.pipeDestinations) {
this.pipeDestinations = [];
}
this.pipeDestinations.push(destination);
return this.cursor.pipe(destination, options);
}
/**
* This method will remove the hooks set up for a previous pipe() call.
* @param {Writable} [destination] The destination for writing data
* @return {null}
*/
unpipe(destination) {
if (this.pipeDestinations && this.pipeDestinations.indexOf(destination) > -1) {
this.pipeDestinations.splice(this.pipeDestinations.indexOf(destination), 1);
}
return this.cursor.unpipe(destination);
}
/**
* Return a modified Readable stream including a possible transform method.
* @method
* @param {object} [options] Optional settings.
* @param {function} [options.transform] A transformation method applied to each document emitted by the stream.
* @return {Cursor}
*/
stream(options) {
this.streamOptions = options;
return this.cursor.stream(options);
}
/**
* This method will cause a stream in flowing mode to stop emitting data events. Any data that becomes available will remain in the internal buffer.
* @return {null}
*/
pause() {
return this.cursor.pause();
}
/**
* This method will cause the readable stream to resume emitting data events.
* @return {null}
*/
resume() {
return this.cursor.resume();
}
}
class ChangeStreamCursor extends Cursor {
constructor(topology, operation, options) {
super(topology, operation, options);
options = options || {};
this._resumeToken = null;
this.startAtOperationTime = options.startAtOperationTime;
if (options.startAfter) {
this.resumeToken = options.startAfter;
} else if (options.resumeAfter) {
this.resumeToken = options.resumeAfter;
}
}
set resumeToken(token) {
this._resumeToken = token;
this.emit('resumeTokenChanged', token);
}
get resumeToken() {
return this._resumeToken;
}
get resumeOptions() {
const result = {};
for (const optionName of CURSOR_OPTIONS) {
if (this.options[optionName]) result[optionName] = this.options[optionName];
}
if (this.resumeToken || this.startAtOperationTime) {
['resumeAfter', 'startAfter', 'startAtOperationTime'].forEach(key => delete result[key]);
if (this.resumeToken) {
const resumeKey =
this.options.startAfter && !this.hasReceived ? 'startAfter' : 'resumeAfter';
result[resumeKey] = this.resumeToken;
} else if (this.startAtOperationTime && maxWireVersion(this.server) >= 7) {
result.startAtOperationTime = this.startAtOperationTime;
}
}
return result;
}
cacheResumeToken(resumeToken) {
if (this.bufferedCount() === 0 && this.cursorState.postBatchResumeToken) {
this.resumeToken = this.cursorState.postBatchResumeToken;
} else {
this.resumeToken = resumeToken;
}
this.hasReceived = true;
}
_processBatch(batchName, response) {
const cursor = response.cursor;
if (cursor.postBatchResumeToken) {
this.cursorState.postBatchResumeToken = cursor.postBatchResumeToken;
if (cursor[batchName].length === 0) {
this.resumeToken = cursor.postBatchResumeToken;
}
}
}
_initializeCursor(callback) {
super._initializeCursor((err, result) => {
if (err || result == null) {
callback(err, result);
return;
}
const response = result.documents[0];
if (
this.startAtOperationTime == null &&
this.resumeAfter == null &&
this.startAfter == null &&
maxWireVersion(this.server) >= 7
) {
this.startAtOperationTime = response.operationTime;
}
this._processBatch('firstBatch', response);
this.emit('init', result);
this.emit('response');
callback(err, result);
});
}
_getMore(callback) {
super._getMore((err, response) => {
if (err) {
callback(err);
return;
}
this._processBatch('nextBatch', response);
this.emit('more', response);
this.emit('response');
callback(err, response);
});
}
}
/**
* @event ChangeStreamCursor#response
* internal event DO NOT USE
* @ignore
*/
// Create a new change stream cursor based on self's configuration
function createChangeStreamCursor(self, options) {
const changeStreamStageOptions = { fullDocument: options.fullDocument || 'default' };
applyKnownOptions(changeStreamStageOptions, options, CHANGE_STREAM_OPTIONS);
if (self.type === CHANGE_DOMAIN_TYPES.CLUSTER) {
changeStreamStageOptions.allChangesForCluster = true;
}
const pipeline = [{ $changeStream: changeStreamStageOptions }].concat(self.pipeline);
const cursorOptions = applyKnownOptions({}, options, CURSOR_OPTIONS);
const changeStreamCursor = new ChangeStreamCursor(
self.topology,
new AggregateOperation(self.parent, pipeline, options),
cursorOptions
);
relayEvents(changeStreamCursor, self, ['resumeTokenChanged', 'end', 'close']);
/**
* Fired for each new matching change in the specified namespace. Attaching a `change`
* event listener to a Change Stream will switch the stream into flowing mode. Data will
* then be passed as soon as it is available.
*
* @event ChangeStream#change
* @type {object}
*/
if (self.listenerCount('change') > 0) {
changeStreamCursor.on('data', function(change) {
processNewChange(self, change);
});
}
/**
* Change stream close event
*
* @event ChangeStream#close
* @type {null}
*/
/**
* Change stream end event
*
* @event ChangeStream#end
* @type {null}
*/
/**
* Emitted each time the change stream stores a new resume token.
*
* @event ChangeStream#resumeTokenChanged
* @type {ResumeToken}
*/
/**
* Fired when the stream encounters an error.
*
* @event ChangeStream#error
* @type {Error}
*/
changeStreamCursor.on('error', function(error) {
processError(self, error);
});
if (self.pipeDestinations) {
const cursorStream = changeStreamCursor.stream(self.streamOptions);
for (let pipeDestination in self.pipeDestinations) {
cursorStream.pipe(pipeDestination);
}
}
return changeStreamCursor;
}
function applyKnownOptions(target, source, optionNames) {
optionNames.forEach(name => {
if (source[name]) {
target[name] = source[name];
}
});
return target;
}
// This method performs a basic server selection loop, satisfying the requirements of
// ChangeStream resumability until the new SDAM layer can be used.
const SELECTION_TIMEOUT = 30000;
function waitForTopologyConnected(topology, options, callback) {
setTimeout(() => {
if (options && options.start == null) {
options.start = now();
}
const start = options.start || now();
const timeout = options.timeout || SELECTION_TIMEOUT;
const readPreference = options.readPreference;
if (topology.isConnected({ readPreference })) {
return callback();
}
if (calculateDurationInMs(start) > timeout) {
return callback(new MongoError('Timed out waiting for connection'));
}
waitForTopologyConnected(topology, options, callback);
}, 500); // this is an arbitrary wait time to allow SDAM to transition
}
function processNewChange(changeStream, change, callback) {
const cursor = changeStream.cursor;
// a null change means the cursor has been notified, implicitly closing the change stream
if (change == null) {
changeStream.closed = true;
}
if (changeStream.closed) {
if (callback) callback(new MongoError('ChangeStream is closed'));
return;
}
if (change && !change._id) {
const noResumeTokenError = new Error(
'A change stream document has been received that lacks a resume token (_id).'
);
if (!callback) return changeStream.emit('error', noResumeTokenError);
return callback(noResumeTokenError);
}
// cache the resume token
cursor.cacheResumeToken(change._id);
// wipe the startAtOperationTime if there was one so that there won't be a conflict
// between resumeToken and startAtOperationTime if we need to reconnect the cursor
changeStream.options.startAtOperationTime = undefined;
// Return the change
if (!callback) return changeStream.emit('change', change);
return callback(undefined, change);
}
function processError(changeStream, error, callback) {
const topology = changeStream.topology;
const cursor = changeStream.cursor;
// If the change stream has been closed explictly, do not process error.
if (changeStream.closed) {
if (callback) callback(new MongoError('ChangeStream is closed'));
return;
}
// if the resume succeeds, continue with the new cursor
function resumeWithCursor(newCursor) {
changeStream.cursor = newCursor;
processResumeQueue(changeStream);
}
// otherwise, raise an error and close the change stream
function unresumableError(err) {
if (!callback) {
changeStream.emit('error', err);
changeStream.emit('close');
}
processResumeQueue(changeStream, err);
changeStream.closed = true;
}
if (cursor && isResumableError(error, maxWireVersion(cursor.server))) {
changeStream.cursor = undefined;
// stop listening to all events from old cursor
['data', 'close', 'end', 'error'].forEach(event => cursor.removeAllListeners(event));
// close internal cursor, ignore errors
cursor.close();
waitForTopologyConnected(topology, { readPreference: cursor.options.readPreference }, err => {
// if the topology can't reconnect, close the stream
if (err) return unresumableError(err);
// create a new cursor, preserving the old cursor's options
const newCursor = createChangeStreamCursor(changeStream, cursor.resumeOptions);
// attempt to continue in emitter mode
if (!callback) return resumeWithCursor(newCursor);
// attempt to continue in iterator mode
newCursor.hasNext(err => {
// if there's an error immediately after resuming, close the stream
if (err) return unresumableError(err);
resumeWithCursor(newCursor);
});
});
return;
}
if (!callback) return changeStream.emit('error', error);
return callback(error);
}
/**
* Safely provides a cursor across resume attempts
*
* @param {ChangeStream} changeStream the parent ChangeStream
* @param {function} callback gets the cursor or error
* @param {ChangeStreamCursor} [oldCursor] when resuming from an error, carry over options from previous cursor
*/
function getCursor(changeStream, callback) {
if (changeStream.isClosed()) {
callback(new MongoError('ChangeStream is closed.'));
return;
}
// if a cursor exists and it is open, return it
if (changeStream.cursor) {
callback(undefined, changeStream.cursor);
return;
}
// no cursor, queue callback until topology reconnects
changeStream[kResumeQueue].push(callback);
}
/**
* Drain the resume queue when a new has become available
*
* @param {ChangeStream} changeStream the parent ChangeStream
* @param {ChangeStreamCursor?} changeStream.cursor the new cursor
* @param {Error} [err] error getting a new cursor
*/
function processResumeQueue(changeStream, err) {
while (changeStream[kResumeQueue].length) {
const request = changeStream[kResumeQueue].pop();
if (changeStream.isClosed() && !err) {
request(new MongoError('Change Stream is not open.'));
return;
}
request(err, changeStream.cursor);
}
}
/**
* The callback format for results
* @callback ChangeStream~resultCallback
* @param {MongoError} error An error instance representing the error during the execution.
* @param {(object|null)} result The result object if the command was executed successfully.
*/
module.exports = ChangeStream;

384
node_modules/mongodb/lib/cmap/connection.js generated vendored Normal file
View File

@@ -0,0 +1,384 @@
'use strict';
const EventEmitter = require('events');
const MessageStream = require('./message_stream');
const MongoError = require('../core/error').MongoError;
const MongoNetworkError = require('../core/error').MongoNetworkError;
const MongoNetworkTimeoutError = require('../core/error').MongoNetworkTimeoutError;
const MongoWriteConcernError = require('../core/error').MongoWriteConcernError;
const CommandResult = require('../core/connection/command_result');
const StreamDescription = require('./stream_description').StreamDescription;
const wp = require('../core/wireprotocol');
const apm = require('../core/connection/apm');
const updateSessionFromResponse = require('../core/sessions').updateSessionFromResponse;
const uuidV4 = require('../core/utils').uuidV4;
const now = require('../utils').now;
const calculateDurationInMs = require('../utils').calculateDurationInMs;
const kStream = Symbol('stream');
const kQueue = Symbol('queue');
const kMessageStream = Symbol('messageStream');
const kGeneration = Symbol('generation');
const kLastUseTime = Symbol('lastUseTime');
const kClusterTime = Symbol('clusterTime');
const kDescription = Symbol('description');
const kIsMaster = Symbol('ismaster');
const kAutoEncrypter = Symbol('autoEncrypter');
class Connection extends EventEmitter {
constructor(stream, options) {
super(options);
this.id = options.id;
this.address = streamIdentifier(stream);
this.bson = options.bson;
this.socketTimeout = typeof options.socketTimeout === 'number' ? options.socketTimeout : 360000;
this.host = options.host || 'localhost';
this.port = options.port || 27017;
this.monitorCommands =
typeof options.monitorCommands === 'boolean' ? options.monitorCommands : false;
this.closed = false;
this.destroyed = false;
this[kDescription] = new StreamDescription(this.address, options);
this[kGeneration] = options.generation;
this[kLastUseTime] = now();
// retain a reference to an `AutoEncrypter` if present
if (options.autoEncrypter) {
this[kAutoEncrypter] = options.autoEncrypter;
}
// setup parser stream and message handling
this[kQueue] = new Map();
this[kMessageStream] = new MessageStream(options);
this[kMessageStream].on('message', messageHandler(this));
this[kStream] = stream;
stream.on('error', () => {
/* ignore errors, listen to `close` instead */
});
stream.on('close', () => {
if (this.closed) {
return;
}
this.closed = true;
this[kQueue].forEach(op =>
op.cb(new MongoNetworkError(`connection ${this.id} to ${this.address} closed`))
);
this[kQueue].clear();
this.emit('close');
});
stream.on('timeout', () => {
if (this.closed) {
return;
}
stream.destroy();
this.closed = true;
this[kQueue].forEach(op =>
op.cb(
new MongoNetworkTimeoutError(`connection ${this.id} to ${this.address} timed out`, {
beforeHandshake: this[kIsMaster] == null
})
)
);
this[kQueue].clear();
this.emit('close');
});
// hook the message stream up to the passed in stream
stream.pipe(this[kMessageStream]);
this[kMessageStream].pipe(stream);
}
get description() {
return this[kDescription];
}
get ismaster() {
return this[kIsMaster];
}
// the `connect` method stores the result of the handshake ismaster on the connection
set ismaster(response) {
this[kDescription].receiveResponse(response);
// TODO: remove this, and only use the `StreamDescription` in the future
this[kIsMaster] = response;
}
get generation() {
return this[kGeneration] || 0;
}
get idleTime() {
return calculateDurationInMs(this[kLastUseTime]);
}
get clusterTime() {
return this[kClusterTime];
}
get stream() {
return this[kStream];
}
markAvailable() {
this[kLastUseTime] = now();
}
destroy(options, callback) {
if (typeof options === 'function') {
callback = options;
options = {};
}
options = Object.assign({ force: false }, options);
if (this[kStream] == null || this.destroyed) {
this.destroyed = true;
if (typeof callback === 'function') {
callback();
}
return;
}
if (options.force) {
this[kStream].destroy();
this.destroyed = true;
if (typeof callback === 'function') {
callback();
}
return;
}
this[kStream].end(err => {
this.destroyed = true;
if (typeof callback === 'function') {
callback(err);
}
});
}
// Wire protocol methods
command(ns, cmd, options, callback) {
wp.command(makeServerTrampoline(this), ns, cmd, options, callback);
}
query(ns, cmd, cursorState, options, callback) {
wp.query(makeServerTrampoline(this), ns, cmd, cursorState, options, callback);
}
getMore(ns, cursorState, batchSize, options, callback) {
wp.getMore(makeServerTrampoline(this), ns, cursorState, batchSize, options, callback);
}
killCursors(ns, cursorState, callback) {
wp.killCursors(makeServerTrampoline(this), ns, cursorState, callback);
}
insert(ns, ops, options, callback) {
wp.insert(makeServerTrampoline(this), ns, ops, options, callback);
}
update(ns, ops, options, callback) {
wp.update(makeServerTrampoline(this), ns, ops, options, callback);
}
remove(ns, ops, options, callback) {
wp.remove(makeServerTrampoline(this), ns, ops, options, callback);
}
}
/// This lets us emulate a legacy `Server` instance so we can work with the existing wire
/// protocol methods. Eventually, the operation executor will return a `Connection` to execute
/// against.
function makeServerTrampoline(connection) {
const server = {
description: connection.description,
clusterTime: connection[kClusterTime],
s: {
bson: connection.bson,
pool: { write: write.bind(connection), isConnected: () => true }
}
};
if (connection[kAutoEncrypter]) {
server.autoEncrypter = connection[kAutoEncrypter];
}
return server;
}
function messageHandler(conn) {
return function messageHandler(message) {
// always emit the message, in case we are streaming
conn.emit('message', message);
if (!conn[kQueue].has(message.responseTo)) {
return;
}
const operationDescription = conn[kQueue].get(message.responseTo);
const callback = operationDescription.cb;
// SERVER-45775: For exhaust responses we should be able to use the same requestId to
// track response, however the server currently synthetically produces remote requests
// making the `responseTo` change on each response
conn[kQueue].delete(message.responseTo);
if (message.moreToCome) {
// requeue the callback for next synthetic request
conn[kQueue].set(message.requestId, operationDescription);
} else if (operationDescription.socketTimeoutOverride) {
conn[kStream].setTimeout(conn.socketTimeout);
}
try {
// Pass in the entire description because it has BSON parsing options
message.parse(operationDescription);
} catch (err) {
callback(new MongoError(err));
return;
}
if (message.documents[0]) {
const document = message.documents[0];
const session = operationDescription.session;
if (session) {
updateSessionFromResponse(session, document);
}
if (document.$clusterTime) {
conn[kClusterTime] = document.$clusterTime;
conn.emit('clusterTimeReceived', document.$clusterTime);
}
if (operationDescription.command) {
if (document.writeConcernError) {
callback(new MongoWriteConcernError(document.writeConcernError, document));
return;
}
if (document.ok === 0 || document.$err || document.errmsg || document.code) {
callback(new MongoError(document));
return;
}
}
}
// NODE-2382: reenable in our glorious non-leaky abstraction future
// callback(null, operationDescription.fullResult ? message : message.documents[0]);
callback(
undefined,
new CommandResult(
operationDescription.fullResult ? message : message.documents[0],
conn,
message
)
);
};
}
function streamIdentifier(stream) {
if (typeof stream.address === 'function') {
return `${stream.remoteAddress}:${stream.remotePort}`;
}
return uuidV4().toString('hex');
}
// Not meant to be called directly, the wire protocol methods call this assuming it is a `Pool` instance
function write(command, options, callback) {
if (typeof options === 'function') {
callback = options;
}
options = options || {};
const operationDescription = {
requestId: command.requestId,
cb: callback,
session: options.session,
fullResult: typeof options.fullResult === 'boolean' ? options.fullResult : false,
noResponse: typeof options.noResponse === 'boolean' ? options.noResponse : false,
documentsReturnedIn: options.documentsReturnedIn,
command: !!options.command,
// for BSON parsing
promoteLongs: typeof options.promoteLongs === 'boolean' ? options.promoteLongs : true,
promoteValues: typeof options.promoteValues === 'boolean' ? options.promoteValues : true,
promoteBuffers: typeof options.promoteBuffers === 'boolean' ? options.promoteBuffers : false,
raw: typeof options.raw === 'boolean' ? options.raw : false
};
if (this[kDescription] && this[kDescription].compressor) {
operationDescription.agreedCompressor = this[kDescription].compressor;
if (this[kDescription].zlibCompressionLevel) {
operationDescription.zlibCompressionLevel = this[kDescription].zlibCompressionLevel;
}
}
if (typeof options.socketTimeout === 'number') {
operationDescription.socketTimeoutOverride = true;
this[kStream].setTimeout(options.socketTimeout);
}
// if command monitoring is enabled we need to modify the callback here
if (this.monitorCommands) {
this.emit('commandStarted', new apm.CommandStartedEvent(this, command));
operationDescription.started = now();
operationDescription.cb = (err, reply) => {
if (err) {
this.emit(
'commandFailed',
new apm.CommandFailedEvent(this, command, err, operationDescription.started)
);
} else {
if (reply && reply.result && (reply.result.ok === 0 || reply.result.$err)) {
this.emit(
'commandFailed',
new apm.CommandFailedEvent(this, command, reply.result, operationDescription.started)
);
} else {
this.emit(
'commandSucceeded',
new apm.CommandSucceededEvent(this, command, reply, operationDescription.started)
);
}
}
if (typeof callback === 'function') {
callback(err, reply);
}
};
}
if (!operationDescription.noResponse) {
this[kQueue].set(operationDescription.requestId, operationDescription);
}
try {
this[kMessageStream].writeCommand(command, operationDescription);
} catch (e) {
if (!operationDescription.noResponse) {
this[kQueue].delete(operationDescription.requestId);
operationDescription.cb(e);
return;
}
}
if (operationDescription.noResponse) {
operationDescription.cb();
}
}
module.exports = {
Connection
};

595
node_modules/mongodb/lib/cmap/connection_pool.js generated vendored Normal file
View File

@@ -0,0 +1,595 @@
'use strict';
const Denque = require('denque');
const EventEmitter = require('events').EventEmitter;
const Logger = require('../core/connection/logger');
const makeCounter = require('../utils').makeCounter;
const MongoError = require('../core/error').MongoError;
const Connection = require('./connection').Connection;
const eachAsync = require('../core/utils').eachAsync;
const connect = require('../core/connection/connect');
const relayEvents = require('../core/utils').relayEvents;
const errors = require('./errors');
const PoolClosedError = errors.PoolClosedError;
const WaitQueueTimeoutError = errors.WaitQueueTimeoutError;
const events = require('./events');
const ConnectionPoolCreatedEvent = events.ConnectionPoolCreatedEvent;
const ConnectionPoolClosedEvent = events.ConnectionPoolClosedEvent;
const ConnectionCreatedEvent = events.ConnectionCreatedEvent;
const ConnectionReadyEvent = events.ConnectionReadyEvent;
const ConnectionClosedEvent = events.ConnectionClosedEvent;
const ConnectionCheckOutStartedEvent = events.ConnectionCheckOutStartedEvent;
const ConnectionCheckOutFailedEvent = events.ConnectionCheckOutFailedEvent;
const ConnectionCheckedOutEvent = events.ConnectionCheckedOutEvent;
const ConnectionCheckedInEvent = events.ConnectionCheckedInEvent;
const ConnectionPoolClearedEvent = events.ConnectionPoolClearedEvent;
const kLogger = Symbol('logger');
const kConnections = Symbol('connections');
const kPermits = Symbol('permits');
const kMinPoolSizeTimer = Symbol('minPoolSizeTimer');
const kGeneration = Symbol('generation');
const kConnectionCounter = Symbol('connectionCounter');
const kCancellationToken = Symbol('cancellationToken');
const kWaitQueue = Symbol('waitQueue');
const kCancelled = Symbol('cancelled');
const VALID_POOL_OPTIONS = new Set([
// `connect` options
'ssl',
'bson',
'connectionType',
'monitorCommands',
'socketTimeout',
'credentials',
'compression',
// node Net options
'host',
'port',
'localAddress',
'localPort',
'family',
'hints',
'lookup',
'path',
// node TLS options
'ca',
'cert',
'sigalgs',
'ciphers',
'clientCertEngine',
'crl',
'dhparam',
'ecdhCurve',
'honorCipherOrder',
'key',
'privateKeyEngine',
'privateKeyIdentifier',
'maxVersion',
'minVersion',
'passphrase',
'pfx',
'secureOptions',
'secureProtocol',
'sessionIdContext',
'allowHalfOpen',
'rejectUnauthorized',
'pskCallback',
'ALPNProtocols',
'servername',
'checkServerIdentity',
'session',
'minDHSize',
'secureContext',
// spec options
'maxPoolSize',
'minPoolSize',
'maxIdleTimeMS',
'waitQueueTimeoutMS'
]);
function resolveOptions(options, defaults) {
const newOptions = Array.from(VALID_POOL_OPTIONS).reduce((obj, key) => {
if (options.hasOwnProperty(key)) {
obj[key] = options[key];
}
return obj;
}, {});
return Object.freeze(Object.assign({}, defaults, newOptions));
}
/**
* Configuration options for drivers wrapping the node driver.
*
* @typedef {Object} ConnectionPoolOptions
* @property
* @property {string} [host] The host to connect to
* @property {number} [port] The port to connect to
* @property {bson} [bson] The BSON instance to use for new connections
* @property {number} [maxPoolSize=100] The maximum number of connections that may be associated with a pool at a given time. This includes in use and available connections.
* @property {number} [minPoolSize=0] The minimum number of connections that MUST exist at any moment in a single connection pool.
* @property {number} [maxIdleTimeMS] The maximum amount of time a connection should remain idle in the connection pool before being marked idle.
* @property {number} [waitQueueTimeoutMS=0] The maximum amount of time operation execution should wait for a connection to become available. The default is 0 which means there is no limit.
*/
/**
* A pool of connections which dynamically resizes, and emit events related to pool activity
*
* @property {number} generation An integer representing the SDAM generation of the pool
* @property {number} totalConnectionCount An integer expressing how many total connections (active + in use) the pool currently has
* @property {number} availableConnectionCount An integer expressing how many connections are currently available in the pool.
* @property {string} address The address of the endpoint the pool is connected to
*
* @emits ConnectionPool#connectionPoolCreated
* @emits ConnectionPool#connectionPoolClosed
* @emits ConnectionPool#connectionCreated
* @emits ConnectionPool#connectionReady
* @emits ConnectionPool#connectionClosed
* @emits ConnectionPool#connectionCheckOutStarted
* @emits ConnectionPool#connectionCheckOutFailed
* @emits ConnectionPool#connectionCheckedOut
* @emits ConnectionPool#connectionCheckedIn
* @emits ConnectionPool#connectionPoolCleared
*/
class ConnectionPool extends EventEmitter {
/**
* Create a new Connection Pool
*
* @param {ConnectionPoolOptions} options
*/
constructor(options) {
super();
options = options || {};
this.closed = false;
this.options = resolveOptions(options, {
connectionType: Connection,
maxPoolSize: typeof options.maxPoolSize === 'number' ? options.maxPoolSize : 100,
minPoolSize: typeof options.minPoolSize === 'number' ? options.minPoolSize : 0,
maxIdleTimeMS: typeof options.maxIdleTimeMS === 'number' ? options.maxIdleTimeMS : 0,
waitQueueTimeoutMS:
typeof options.waitQueueTimeoutMS === 'number' ? options.waitQueueTimeoutMS : 0,
autoEncrypter: options.autoEncrypter,
metadata: options.metadata
});
if (options.minSize > options.maxSize) {
throw new TypeError(
'Connection pool minimum size must not be greater than maxiumum pool size'
);
}
this[kLogger] = Logger('ConnectionPool', options);
this[kConnections] = new Denque();
this[kPermits] = this.options.maxPoolSize;
this[kMinPoolSizeTimer] = undefined;
this[kGeneration] = 0;
this[kConnectionCounter] = makeCounter(1);
this[kCancellationToken] = new EventEmitter();
this[kCancellationToken].setMaxListeners(Infinity);
this[kWaitQueue] = new Denque();
process.nextTick(() => {
this.emit('connectionPoolCreated', new ConnectionPoolCreatedEvent(this));
ensureMinPoolSize(this);
});
}
get address() {
return `${this.options.host}:${this.options.port}`;
}
get generation() {
return this[kGeneration];
}
get totalConnectionCount() {
return this[kConnections].length + (this.options.maxPoolSize - this[kPermits]);
}
get availableConnectionCount() {
return this[kConnections].length;
}
get waitQueueSize() {
return this[kWaitQueue].length;
}
/**
* Check a connection out of this pool. The connection will continue to be tracked, but no reference to it
* will be held by the pool. This means that if a connection is checked out it MUST be checked back in or
* explicitly destroyed by the new owner.
*
* @param {ConnectionPool~checkOutCallback} callback
*/
checkOut(callback) {
this.emit('connectionCheckOutStarted', new ConnectionCheckOutStartedEvent(this));
if (this.closed) {
this.emit('connectionCheckOutFailed', new ConnectionCheckOutFailedEvent(this, 'poolClosed'));
callback(new PoolClosedError(this));
return;
}
const waitQueueMember = { callback };
const pool = this;
const waitQueueTimeoutMS = this.options.waitQueueTimeoutMS;
if (waitQueueTimeoutMS) {
waitQueueMember.timer = setTimeout(() => {
waitQueueMember[kCancelled] = true;
waitQueueMember.timer = undefined;
pool.emit('connectionCheckOutFailed', new ConnectionCheckOutFailedEvent(pool, 'timeout'));
waitQueueMember.callback(new WaitQueueTimeoutError(pool));
}, waitQueueTimeoutMS);
}
this[kWaitQueue].push(waitQueueMember);
setImmediate(() => processWaitQueue(this));
}
/**
* Check a connection into the pool.
*
* @param {Connection} connection The connection to check in
*/
checkIn(connection) {
const poolClosed = this.closed;
const stale = connectionIsStale(this, connection);
const willDestroy = !!(poolClosed || stale || connection.closed);
if (!willDestroy) {
connection.markAvailable();
this[kConnections].push(connection);
}
this.emit('connectionCheckedIn', new ConnectionCheckedInEvent(this, connection));
if (willDestroy) {
const reason = connection.closed ? 'error' : poolClosed ? 'poolClosed' : 'stale';
destroyConnection(this, connection, reason);
}
setImmediate(() => processWaitQueue(this));
}
/**
* Clear the pool
*
* Pool reset is handled by incrementing the pool's generation count. Any existing connection of a
* previous generation will eventually be pruned during subsequent checkouts.
*/
clear() {
this[kGeneration] += 1;
this.emit('connectionPoolCleared', new ConnectionPoolClearedEvent(this));
}
/**
* Close the pool
*
* @param {object} [options] Optional settings
* @param {boolean} [options.force] Force close connections
* @param {Function} callback
*/
close(options, callback) {
if (typeof options === 'function') {
callback = options;
}
options = Object.assign({ force: false }, options);
if (this.closed) {
return callback();
}
// immediately cancel any in-flight connections
this[kCancellationToken].emit('cancel');
// drain the wait queue
while (this.waitQueueSize) {
const waitQueueMember = this[kWaitQueue].pop();
clearTimeout(waitQueueMember.timer);
if (!waitQueueMember[kCancelled]) {
waitQueueMember.callback(new MongoError('connection pool closed'));
}
}
// clear the min pool size timer
if (this[kMinPoolSizeTimer]) {
clearTimeout(this[kMinPoolSizeTimer]);
}
// end the connection counter
if (typeof this[kConnectionCounter].return === 'function') {
this[kConnectionCounter].return();
}
// mark the pool as closed immediately
this.closed = true;
eachAsync(
this[kConnections].toArray(),
(conn, cb) => {
this.emit('connectionClosed', new ConnectionClosedEvent(this, conn, 'poolClosed'));
conn.destroy(options, cb);
},
err => {
this[kConnections].clear();
this.emit('connectionPoolClosed', new ConnectionPoolClosedEvent(this));
callback(err);
}
);
}
/**
* Runs a lambda with an implicitly checked out connection, checking that connection back in when the lambda
* has completed by calling back.
*
* NOTE: please note the required signature of `fn`
*
* @param {ConnectionPool~withConnectionCallback} fn A function which operates on a managed connection
* @param {Function} callback The original callback
* @return {Promise}
*/
withConnection(fn, callback) {
this.checkOut((err, conn) => {
// don't callback with `err` here, we might want to act upon it inside `fn`
fn(err, conn, (fnErr, result) => {
if (typeof callback === 'function') {
if (fnErr) {
callback(fnErr);
} else {
callback(undefined, result);
}
}
if (conn) {
this.checkIn(conn);
}
});
});
}
}
function ensureMinPoolSize(pool) {
if (pool.closed || pool.options.minPoolSize === 0) {
return;
}
const minPoolSize = pool.options.minPoolSize;
for (let i = pool.totalConnectionCount; i < minPoolSize; ++i) {
createConnection(pool);
}
pool[kMinPoolSizeTimer] = setTimeout(() => ensureMinPoolSize(pool), 10);
}
function connectionIsStale(pool, connection) {
return connection.generation !== pool[kGeneration];
}
function connectionIsIdle(pool, connection) {
return !!(pool.options.maxIdleTimeMS && connection.idleTime > pool.options.maxIdleTimeMS);
}
function createConnection(pool, callback) {
const connectOptions = Object.assign(
{
id: pool[kConnectionCounter].next().value,
generation: pool[kGeneration]
},
pool.options
);
pool[kPermits]--;
connect(connectOptions, pool[kCancellationToken], (err, connection) => {
if (err) {
pool[kPermits]++;
pool[kLogger].debug(`connection attempt failed with error [${JSON.stringify(err)}]`);
if (typeof callback === 'function') {
callback(err);
}
return;
}
// The pool might have closed since we started trying to create a connection
if (pool.closed) {
connection.destroy({ force: true });
return;
}
// forward all events from the connection to the pool
relayEvents(connection, pool, [
'commandStarted',
'commandFailed',
'commandSucceeded',
'clusterTimeReceived'
]);
pool.emit('connectionCreated', new ConnectionCreatedEvent(pool, connection));
connection.markAvailable();
pool.emit('connectionReady', new ConnectionReadyEvent(pool, connection));
// if a callback has been provided, check out the connection immediately
if (typeof callback === 'function') {
callback(undefined, connection);
return;
}
// otherwise add it to the pool for later acquisition, and try to process the wait queue
pool[kConnections].push(connection);
setImmediate(() => processWaitQueue(pool));
});
}
function destroyConnection(pool, connection, reason) {
pool.emit('connectionClosed', new ConnectionClosedEvent(pool, connection, reason));
// allow more connections to be created
pool[kPermits]++;
// destroy the connection
setImmediate(() => connection.destroy());
}
function processWaitQueue(pool) {
if (pool.closed) {
return;
}
while (pool.waitQueueSize) {
const waitQueueMember = pool[kWaitQueue].peekFront();
if (waitQueueMember[kCancelled]) {
pool[kWaitQueue].shift();
continue;
}
if (!pool.availableConnectionCount) {
break;
}
const connection = pool[kConnections].shift();
const isStale = connectionIsStale(pool, connection);
const isIdle = connectionIsIdle(pool, connection);
if (!isStale && !isIdle && !connection.closed) {
pool.emit('connectionCheckedOut', new ConnectionCheckedOutEvent(pool, connection));
clearTimeout(waitQueueMember.timer);
pool[kWaitQueue].shift();
waitQueueMember.callback(undefined, connection);
return;
}
const reason = connection.closed ? 'error' : isStale ? 'stale' : 'idle';
destroyConnection(pool, connection, reason);
}
const maxPoolSize = pool.options.maxPoolSize;
if (pool.waitQueueSize && (maxPoolSize <= 0 || pool.totalConnectionCount < maxPoolSize)) {
createConnection(pool, (err, connection) => {
const waitQueueMember = pool[kWaitQueue].shift();
if (waitQueueMember == null) {
if (err == null) {
pool[kConnections].push(connection);
}
return;
}
if (waitQueueMember[kCancelled]) {
return;
}
if (err) {
pool.emit('connectionCheckOutFailed', new ConnectionCheckOutFailedEvent(pool, err));
} else {
pool.emit('connectionCheckedOut', new ConnectionCheckedOutEvent(pool, connection));
}
clearTimeout(waitQueueMember.timer);
waitQueueMember.callback(err, connection);
});
return;
}
}
/**
* A callback provided to `withConnection`
*
* @callback ConnectionPool~withConnectionCallback
* @param {MongoError} error An error instance representing the error during the execution.
* @param {Connection} connection The managed connection which was checked out of the pool.
* @param {Function} callback A function to call back after connection management is complete
*/
/**
* A callback provided to `checkOut`
*
* @callback ConnectionPool~checkOutCallback
* @param {MongoError} error An error instance representing the error during checkout
* @param {Connection} connection A connection from the pool
*/
/**
* Emitted once when the connection pool is created
*
* @event ConnectionPool#connectionPoolCreated
* @type {PoolCreatedEvent}
*/
/**
* Emitted once when the connection pool is closed
*
* @event ConnectionPool#connectionPoolClosed
* @type {PoolClosedEvent}
*/
/**
* Emitted each time a connection is created
*
* @event ConnectionPool#connectionCreated
* @type {ConnectionCreatedEvent}
*/
/**
* Emitted when a connection becomes established, and is ready to use
*
* @event ConnectionPool#connectionReady
* @type {ConnectionReadyEvent}
*/
/**
* Emitted when a connection is closed
*
* @event ConnectionPool#connectionClosed
* @type {ConnectionClosedEvent}
*/
/**
* Emitted when an attempt to check out a connection begins
*
* @event ConnectionPool#connectionCheckOutStarted
* @type {ConnectionCheckOutStartedEvent}
*/
/**
* Emitted when an attempt to check out a connection fails
*
* @event ConnectionPool#connectionCheckOutFailed
* @type {ConnectionCheckOutFailedEvent}
*/
/**
* Emitted each time a connection is successfully checked out of the connection pool
*
* @event ConnectionPool#connectionCheckedOut
* @type {ConnectionCheckedOutEvent}
*/
/**
* Emitted each time a connection is successfully checked into the connection pool
*
* @event ConnectionPool#connectionCheckedIn
* @type {ConnectionCheckedInEvent}
*/
/**
* Emitted each time the connection pool is cleared and it's generation incremented
*
* @event ConnectionPool#connectionPoolCleared
* @type {PoolClearedEvent}
*/
module.exports = {
ConnectionPool
};

35
node_modules/mongodb/lib/cmap/errors.js generated vendored Normal file
View File

@@ -0,0 +1,35 @@
'use strict';
const MongoError = require('../core/error').MongoError;
/**
* An error indicating a connection pool is closed
*
* @property {string} address The address of the connection pool
* @extends MongoError
*/
class PoolClosedError extends MongoError {
constructor(pool) {
super('Attempted to check out a connection from closed connection pool');
this.name = 'MongoPoolClosedError';
this.address = pool.address;
}
}
/**
* An error thrown when a request to check out a connection times out
*
* @property {string} address The address of the connection pool
* @extends MongoError
*/
class WaitQueueTimeoutError extends MongoError {
constructor(pool) {
super('Timed out while checking out a connection from connection pool');
this.name = 'MongoWaitQueueTimeoutError';
this.address = pool.address;
}
}
module.exports = {
PoolClosedError,
WaitQueueTimeoutError
};

154
node_modules/mongodb/lib/cmap/events.js generated vendored Normal file
View File

@@ -0,0 +1,154 @@
'use strict';
/**
* The base class for all monitoring events published from the connection pool
*
* @property {number} time A timestamp when the event was created
* @property {string} address The address (host/port pair) of the pool
*/
class ConnectionPoolMonitoringEvent {
constructor(pool) {
this.time = new Date();
this.address = pool.address;
}
}
/**
* An event published when a connection pool is created
*
* @property {Object} options The options used to create this connection pool
*/
class ConnectionPoolCreatedEvent extends ConnectionPoolMonitoringEvent {
constructor(pool) {
super(pool);
this.options = pool.options;
}
}
/**
* An event published when a connection pool is closed
*/
class ConnectionPoolClosedEvent extends ConnectionPoolMonitoringEvent {
constructor(pool) {
super(pool);
}
}
/**
* An event published when a connection pool creates a new connection
*
* @property {number} connectionId A monotonically increasing, per-pool id for the newly created connection
*/
class ConnectionCreatedEvent extends ConnectionPoolMonitoringEvent {
constructor(pool, connection) {
super(pool);
this.connectionId = connection.id;
}
}
/**
* An event published when a connection is ready for use
*
* @property {number} connectionId The id of the connection
*/
class ConnectionReadyEvent extends ConnectionPoolMonitoringEvent {
constructor(pool, connection) {
super(pool);
this.connectionId = connection.id;
}
}
/**
* An event published when a connection is closed
*
* @property {number} connectionId The id of the connection
* @property {string} reason The reason the connection was closed
*/
class ConnectionClosedEvent extends ConnectionPoolMonitoringEvent {
constructor(pool, connection, reason) {
super(pool);
this.connectionId = connection.id;
this.reason = reason || 'unknown';
}
}
/**
* An event published when a request to check a connection out begins
*/
class ConnectionCheckOutStartedEvent extends ConnectionPoolMonitoringEvent {
constructor(pool) {
super(pool);
}
}
/**
* An event published when a request to check a connection out fails
*
* @property {string} reason The reason the attempt to check out failed
*/
class ConnectionCheckOutFailedEvent extends ConnectionPoolMonitoringEvent {
constructor(pool, reason) {
super(pool);
this.reason = reason;
}
}
/**
* An event published when a connection is checked out of the connection pool
*
* @property {number} connectionId The id of the connection
*/
class ConnectionCheckedOutEvent extends ConnectionPoolMonitoringEvent {
constructor(pool, connection) {
super(pool);
this.connectionId = connection.id;
}
}
/**
* An event published when a connection is checked into the connection pool
*
* @property {number} connectionId The id of the connection
*/
class ConnectionCheckedInEvent extends ConnectionPoolMonitoringEvent {
constructor(pool, connection) {
super(pool);
this.connectionId = connection.id;
}
}
/**
* An event published when a connection pool is cleared
*/
class ConnectionPoolClearedEvent extends ConnectionPoolMonitoringEvent {
constructor(pool) {
super(pool);
}
}
const CMAP_EVENT_NAMES = [
'connectionPoolCreated',
'connectionPoolClosed',
'connectionCreated',
'connectionReady',
'connectionClosed',
'connectionCheckOutStarted',
'connectionCheckOutFailed',
'connectionCheckedOut',
'connectionCheckedIn',
'connectionPoolCleared'
];
module.exports = {
CMAP_EVENT_NAMES,
ConnectionPoolCreatedEvent,
ConnectionPoolClosedEvent,
ConnectionCreatedEvent,
ConnectionReadyEvent,
ConnectionClosedEvent,
ConnectionCheckOutStartedEvent,
ConnectionCheckOutFailedEvent,
ConnectionCheckedOutEvent,
ConnectionCheckedInEvent,
ConnectionPoolClearedEvent
};

196
node_modules/mongodb/lib/cmap/message_stream.js generated vendored Normal file
View File

@@ -0,0 +1,196 @@
'use strict';
const Duplex = require('stream').Duplex;
const BufferList = require('bl');
const MongoParseError = require('../core/error').MongoParseError;
const decompress = require('../core/wireprotocol/compression').decompress;
const Response = require('../core/connection/commands').Response;
const BinMsg = require('../core/connection/msg').BinMsg;
const MongoError = require('../core/error').MongoError;
const OP_COMPRESSED = require('../core/wireprotocol/shared').opcodes.OP_COMPRESSED;
const OP_MSG = require('../core/wireprotocol/shared').opcodes.OP_MSG;
const MESSAGE_HEADER_SIZE = require('../core/wireprotocol/shared').MESSAGE_HEADER_SIZE;
const COMPRESSION_DETAILS_SIZE = require('../core/wireprotocol/shared').COMPRESSION_DETAILS_SIZE;
const opcodes = require('../core/wireprotocol/shared').opcodes;
const compress = require('../core/wireprotocol/compression').compress;
const compressorIDs = require('../core/wireprotocol/compression').compressorIDs;
const uncompressibleCommands = require('../core/wireprotocol/compression').uncompressibleCommands;
const Msg = require('../core/connection/msg').Msg;
const kDefaultMaxBsonMessageSize = 1024 * 1024 * 16 * 4;
const kBuffer = Symbol('buffer');
/**
* A duplex stream that is capable of reading and writing raw wire protocol messages, with
* support for optional compression
*/
class MessageStream extends Duplex {
constructor(options) {
options = options || {};
super(options);
this.bson = options.bson;
this.maxBsonMessageSize = options.maxBsonMessageSize || kDefaultMaxBsonMessageSize;
this[kBuffer] = new BufferList();
}
_write(chunk, _, callback) {
const buffer = this[kBuffer];
buffer.append(chunk);
processIncomingData(this, callback);
}
_read(/* size */) {
// NOTE: This implementation is empty because we explicitly push data to be read
// when `writeMessage` is called.
return;
}
writeCommand(command, operationDescription) {
// TODO: agreed compressor should live in `StreamDescription`
const shouldCompress = operationDescription && !!operationDescription.agreedCompressor;
if (!shouldCompress || !canCompress(command)) {
const data = command.toBin();
this.push(Array.isArray(data) ? Buffer.concat(data) : data);
return;
}
// otherwise, compress the message
const concatenatedOriginalCommandBuffer = Buffer.concat(command.toBin());
const messageToBeCompressed = concatenatedOriginalCommandBuffer.slice(MESSAGE_HEADER_SIZE);
// Extract information needed for OP_COMPRESSED from the uncompressed message
const originalCommandOpCode = concatenatedOriginalCommandBuffer.readInt32LE(12);
// Compress the message body
compress({ options: operationDescription }, messageToBeCompressed, (err, compressedMessage) => {
if (err) {
operationDescription.cb(err, null);
return;
}
// Create the msgHeader of OP_COMPRESSED
const msgHeader = Buffer.alloc(MESSAGE_HEADER_SIZE);
msgHeader.writeInt32LE(
MESSAGE_HEADER_SIZE + COMPRESSION_DETAILS_SIZE + compressedMessage.length,
0
); // messageLength
msgHeader.writeInt32LE(command.requestId, 4); // requestID
msgHeader.writeInt32LE(0, 8); // responseTo (zero)
msgHeader.writeInt32LE(opcodes.OP_COMPRESSED, 12); // opCode
// Create the compression details of OP_COMPRESSED
const compressionDetails = Buffer.alloc(COMPRESSION_DETAILS_SIZE);
compressionDetails.writeInt32LE(originalCommandOpCode, 0); // originalOpcode
compressionDetails.writeInt32LE(messageToBeCompressed.length, 4); // Size of the uncompressed compressedMessage, excluding the MsgHeader
compressionDetails.writeUInt8(compressorIDs[operationDescription.agreedCompressor], 8); // compressorID
this.push(Buffer.concat([msgHeader, compressionDetails, compressedMessage]));
});
}
}
// Return whether a command contains an uncompressible command term
// Will return true if command contains no uncompressible command terms
function canCompress(command) {
const commandDoc = command instanceof Msg ? command.command : command.query;
const commandName = Object.keys(commandDoc)[0];
return !uncompressibleCommands.has(commandName);
}
function processIncomingData(stream, callback) {
const buffer = stream[kBuffer];
if (buffer.length < 4) {
callback();
return;
}
const sizeOfMessage = buffer.readInt32LE(0);
if (sizeOfMessage < 0) {
callback(new MongoParseError(`Invalid message size: ${sizeOfMessage}`));
return;
}
if (sizeOfMessage > stream.maxBsonMessageSize) {
callback(
new MongoParseError(
`Invalid message size: ${sizeOfMessage}, max allowed: ${stream.maxBsonMessageSize}`
)
);
return;
}
if (sizeOfMessage > buffer.length) {
callback();
return;
}
const message = buffer.slice(0, sizeOfMessage);
buffer.consume(sizeOfMessage);
const messageHeader = {
length: message.readInt32LE(0),
requestId: message.readInt32LE(4),
responseTo: message.readInt32LE(8),
opCode: message.readInt32LE(12)
};
let ResponseType = messageHeader.opCode === OP_MSG ? BinMsg : Response;
const responseOptions = stream.responseOptions;
if (messageHeader.opCode !== OP_COMPRESSED) {
const messageBody = message.slice(MESSAGE_HEADER_SIZE);
stream.emit(
'message',
new ResponseType(stream.bson, message, messageHeader, messageBody, responseOptions)
);
if (buffer.length >= 4) {
processIncomingData(stream, callback);
} else {
callback();
}
return;
}
messageHeader.fromCompressed = true;
messageHeader.opCode = message.readInt32LE(MESSAGE_HEADER_SIZE);
messageHeader.length = message.readInt32LE(MESSAGE_HEADER_SIZE + 4);
const compressorID = message[MESSAGE_HEADER_SIZE + 8];
const compressedBuffer = message.slice(MESSAGE_HEADER_SIZE + 9);
// recalculate based on wrapped opcode
ResponseType = messageHeader.opCode === OP_MSG ? BinMsg : Response;
decompress(compressorID, compressedBuffer, (err, messageBody) => {
if (err) {
callback(err);
return;
}
if (messageBody.length !== messageHeader.length) {
callback(
new MongoError(
'Decompressing a compressed message from the server failed. The message is corrupt.'
)
);
return;
}
stream.emit(
'message',
new ResponseType(stream.bson, message, messageHeader, messageBody, responseOptions)
);
if (buffer.length >= 4) {
processIncomingData(stream, callback);
} else {
callback();
}
});
}
module.exports = MessageStream;

45
node_modules/mongodb/lib/cmap/stream_description.js generated vendored Normal file
View File

@@ -0,0 +1,45 @@
'use strict';
const parseServerType = require('../core/sdam/server_description').parseServerType;
const RESPONSE_FIELDS = [
'minWireVersion',
'maxWireVersion',
'maxBsonObjectSize',
'maxMessageSizeBytes',
'maxWriteBatchSize',
'__nodejs_mock_server__'
];
class StreamDescription {
constructor(address, options) {
this.address = address;
this.type = parseServerType(null);
this.minWireVersion = undefined;
this.maxWireVersion = undefined;
this.maxBsonObjectSize = 16777216;
this.maxMessageSizeBytes = 48000000;
this.maxWriteBatchSize = 100000;
this.compressors =
options && options.compression && Array.isArray(options.compression.compressors)
? options.compression.compressors
: [];
}
receiveResponse(response) {
this.type = parseServerType(response);
RESPONSE_FIELDS.forEach(field => {
if (typeof response[field] !== 'undefined') {
this[field] = response[field];
}
});
if (response.compression) {
this.compressor = this.compressors.filter(c => response.compression.indexOf(c) !== -1)[0];
}
}
}
module.exports = {
StreamDescription
};

2178
node_modules/mongodb/lib/collection.js generated vendored Normal file

File diff suppressed because it is too large Load Diff

269
node_modules/mongodb/lib/command_cursor.js generated vendored Normal file
View File

@@ -0,0 +1,269 @@
'use strict';
const ReadPreference = require('./core').ReadPreference;
const MongoError = require('./core').MongoError;
const Cursor = require('./cursor');
const CursorState = require('./core/cursor').CursorState;
/**
* @fileOverview The **CommandCursor** class is an internal class that embodies a
* generalized cursor based on a MongoDB command allowing for iteration over the
* results returned. It supports one by one document iteration, conversion to an
* array or can be iterated as a Node 0.10.X or higher stream
*
* **CommandCursor Cannot directly be instantiated**
* @example
* const MongoClient = require('mongodb').MongoClient;
* const test = require('assert');
* // Connection url
* const url = 'mongodb://localhost:27017';
* // Database Name
* const dbName = 'test';
* // Connect using MongoClient
* MongoClient.connect(url, function(err, client) {
* // Create a collection we want to drop later
* const col = client.db(dbName).collection('listCollectionsExample1');
* // Insert a bunch of documents
* col.insert([{a:1, b:1}
* , {a:2, b:2}, {a:3, b:3}
* , {a:4, b:4}], {w:1}, function(err, result) {
* test.equal(null, err);
* // List the database collections available
* db.listCollections().toArray(function(err, items) {
* test.equal(null, err);
* client.close();
* });
* });
* });
*/
/**
* Namespace provided by the browser.
* @external Readable
*/
/**
* Creates a new Command Cursor instance (INTERNAL TYPE, do not instantiate directly)
* @class CommandCursor
* @extends external:Readable
* @fires CommandCursor#data
* @fires CommandCursor#end
* @fires CommandCursor#close
* @fires CommandCursor#readable
* @return {CommandCursor} an CommandCursor instance.
*/
class CommandCursor extends Cursor {
constructor(topology, ns, cmd, options) {
super(topology, ns, cmd, options);
}
/**
* Set the ReadPreference for the cursor.
* @method
* @param {(string|ReadPreference)} readPreference The new read preference for the cursor.
* @throws {MongoError}
* @return {Cursor}
*/
setReadPreference(readPreference) {
if (this.s.state === CursorState.CLOSED || this.isDead()) {
throw MongoError.create({ message: 'Cursor is closed', driver: true });
}
if (this.s.state !== CursorState.INIT) {
throw MongoError.create({
message: 'cannot change cursor readPreference after cursor has been accessed',
driver: true
});
}
if (readPreference instanceof ReadPreference) {
this.options.readPreference = readPreference;
} else if (typeof readPreference === 'string') {
this.options.readPreference = new ReadPreference(readPreference);
} else {
throw new TypeError('Invalid read preference: ' + readPreference);
}
return this;
}
/**
* Set the batch size for the cursor.
* @method
* @param {number} value The number of documents to return per batch. See {@link https://docs.mongodb.com/manual/reference/command/find/|find command documentation}.
* @throws {MongoError}
* @return {CommandCursor}
*/
batchSize(value) {
if (this.s.state === CursorState.CLOSED || this.isDead()) {
throw MongoError.create({ message: 'Cursor is closed', driver: true });
}
if (typeof value !== 'number') {
throw MongoError.create({ message: 'batchSize requires an integer', driver: true });
}
if (this.cmd.cursor) {
this.cmd.cursor.batchSize = value;
}
this.setCursorBatchSize(value);
return this;
}
/**
* Add a maxTimeMS stage to the aggregation pipeline
* @method
* @param {number} value The state maxTimeMS value.
* @return {CommandCursor}
*/
maxTimeMS(value) {
if (this.topology.lastIsMaster().minWireVersion > 2) {
this.cmd.maxTimeMS = value;
}
return this;
}
/**
* Return the cursor logger
* @method
* @return {Logger} return the cursor logger
* @ignore
*/
getLogger() {
return this.logger;
}
}
// aliases
CommandCursor.prototype.get = CommandCursor.prototype.toArray;
/**
* CommandCursor stream data event, fired for each document in the cursor.
*
* @event CommandCursor#data
* @type {object}
*/
/**
* CommandCursor stream end event
*
* @event CommandCursor#end
* @type {null}
*/
/**
* CommandCursor stream close event
*
* @event CommandCursor#close
* @type {null}
*/
/**
* CommandCursor stream readable event
*
* @event CommandCursor#readable
* @type {null}
*/
/**
* Get the next available document from the cursor, returns null if no more documents are available.
* @function CommandCursor.prototype.next
* @param {CommandCursor~resultCallback} [callback] The result callback.
* @throws {MongoError}
* @return {Promise} returns Promise if no callback passed
*/
/**
* Check if there is any document still available in the cursor
* @function CommandCursor.prototype.hasNext
* @param {CommandCursor~resultCallback} [callback] The result callback.
* @throws {MongoError}
* @return {Promise} returns Promise if no callback passed
*/
/**
* The callback format for results
* @callback CommandCursor~toArrayResultCallback
* @param {MongoError} error An error instance representing the error during the execution.
* @param {object[]} documents All the documents the satisfy the cursor.
*/
/**
* Returns an array of documents. The caller is responsible for making sure that there
* is enough memory to store the results. Note that the array only contain partial
* results when this cursor had been previously accessed.
* @method CommandCursor.prototype.toArray
* @param {CommandCursor~toArrayResultCallback} [callback] The result callback.
* @throws {MongoError}
* @return {Promise} returns Promise if no callback passed
*/
/**
* The callback format for results
* @callback CommandCursor~resultCallback
* @param {MongoError} error An error instance representing the error during the execution.
* @param {(object|null)} result The result object if the command was executed successfully.
*/
/**
* Iterates over all the documents for this cursor. As with **{cursor.toArray}**,
* not all of the elements will be iterated if this cursor had been previously accessed.
* In that case, **{cursor.rewind}** can be used to reset the cursor. However, unlike
* **{cursor.toArray}**, the cursor will only hold a maximum of batch size elements
* at any given time if batch size is specified. Otherwise, the caller is responsible
* for making sure that the entire result can fit the memory.
* @method CommandCursor.prototype.each
* @param {CommandCursor~resultCallback} callback The result callback.
* @throws {MongoError}
* @return {null}
*/
/**
* Close the cursor, sending a KillCursor command and emitting close.
* @method CommandCursor.prototype.close
* @param {CommandCursor~resultCallback} [callback] The result callback.
* @return {Promise} returns Promise if no callback passed
*/
/**
* Is the cursor closed
* @method CommandCursor.prototype.isClosed
* @return {boolean}
*/
/**
* Clone the cursor
* @function CommandCursor.prototype.clone
* @return {CommandCursor}
*/
/**
* Resets the cursor
* @function CommandCursor.prototype.rewind
* @return {CommandCursor}
*/
/**
* The callback format for the forEach iterator method
* @callback CommandCursor~iteratorCallback
* @param {Object} doc An emitted document for the iterator
*/
/**
* The callback error format for the forEach iterator method
* @callback CommandCursor~endCallback
* @param {MongoError} error An error instance representing the error during the execution.
*/
/*
* Iterates over all the documents for this cursor using the iterator, callback pattern.
* @method CommandCursor.prototype.forEach
* @param {CommandCursor~iteratorCallback} iterator The iteration callback.
* @param {CommandCursor~endCallback} callback The end callback.
* @throws {MongoError}
* @return {null}
*/
module.exports = CommandCursor;

10
node_modules/mongodb/lib/constants.js generated vendored Normal file
View File

@@ -0,0 +1,10 @@
'use strict';
module.exports = {
SYSTEM_NAMESPACE_COLLECTION: 'system.namespaces',
SYSTEM_INDEX_COLLECTION: 'system.indexes',
SYSTEM_PROFILE_COLLECTION: 'system.profile',
SYSTEM_USER_COLLECTION: 'system.users',
SYSTEM_COMMAND_COLLECTION: '$cmd',
SYSTEM_JS_COLLECTION: 'system.js'
};

55
node_modules/mongodb/lib/core/auth/auth_provider.js generated vendored Normal file
View File

@@ -0,0 +1,55 @@
'use strict';
/**
* Context used during authentication
*
* @property {Connection} connection The connection to authenticate
* @property {MongoCredentials} credentials The credentials to use for authentication
* @property {object} options The options passed to the `connect` method
* @property {object?} response The response of the initial handshake
* @property {Buffer?} nonce A random nonce generated for use in an authentication conversation
*/
class AuthContext {
constructor(connection, credentials, options) {
this.connection = connection;
this.credentials = credentials;
this.options = options;
}
}
class AuthProvider {
constructor(bson) {
this.bson = bson;
}
/**
* Prepare the handshake document before the initial handshake.
*
* @param {object} handshakeDoc The document used for the initial handshake on a connection
* @param {AuthContext} authContext Context for authentication flow
* @param {function} callback
*/
prepare(handshakeDoc, context, callback) {
callback(undefined, handshakeDoc);
}
/**
* Authenticate
*
* @param {AuthContext} context A shared context for authentication flow
* @param {authResultCallback} callback The callback to return the result from the authentication
*/
auth(context, callback) {
callback(new TypeError('`auth` method must be overridden by subclass'));
}
}
/**
* This is a result from an authentication provider
*
* @callback authResultCallback
* @param {error} error An error object. Set to null if no error present
* @param {boolean} result The result of the authentication process
*/
module.exports = { AuthContext, AuthProvider };

View File

@@ -0,0 +1,29 @@
'use strict';
const MongoCR = require('./mongocr');
const X509 = require('./x509');
const Plain = require('./plain');
const GSSAPI = require('./gssapi');
const ScramSHA1 = require('./scram').ScramSHA1;
const ScramSHA256 = require('./scram').ScramSHA256;
const MongoDBAWS = require('./mongodb_aws');
/**
* Returns the default authentication providers.
*
* @param {BSON} bson Bson definition
* @returns {Object} a mapping of auth names to auth types
*/
function defaultAuthProviders(bson) {
return {
'mongodb-aws': new MongoDBAWS(bson),
mongocr: new MongoCR(bson),
x509: new X509(bson),
plain: new Plain(bson),
gssapi: new GSSAPI(bson),
'scram-sha-1': new ScramSHA1(bson),
'scram-sha-256': new ScramSHA256(bson)
};
}
module.exports = { defaultAuthProviders };

151
node_modules/mongodb/lib/core/auth/gssapi.js generated vendored Normal file
View File

@@ -0,0 +1,151 @@
'use strict';
const dns = require('dns');
const AuthProvider = require('./auth_provider').AuthProvider;
const retrieveKerberos = require('../utils').retrieveKerberos;
const MongoError = require('../error').MongoError;
const kGssapiClient = Symbol('GSSAPI_CLIENT');
let kerberos;
class GSSAPI extends AuthProvider {
prepare(handshakeDoc, authContext, callback) {
const host = authContext.options.host;
const port = authContext.options.port;
const credentials = authContext.credentials;
if (!host || !port || !credentials) {
return callback(
new MongoError(
`Connection must specify: ${host ? 'host' : ''}, ${port ? 'port' : ''}, ${
credentials ? 'host' : 'credentials'
}.`
)
);
}
if (kerberos == null) {
try {
kerberos = retrieveKerberos();
} catch (e) {
return callback(e);
}
}
const username = credentials.username;
const password = credentials.password;
const mechanismProperties = credentials.mechanismProperties;
const serviceName =
mechanismProperties['gssapiservicename'] ||
mechanismProperties['gssapiServiceName'] ||
'mongodb';
performGssapiCanonicalizeHostName(host, mechanismProperties, (err, host) => {
if (err) return callback(err);
const initOptions = {};
if (password != null) {
Object.assign(initOptions, { user: username, password: password });
}
kerberos.initializeClient(
`${serviceName}${process.platform === 'win32' ? '/' : '@'}${host}`,
initOptions,
(err, client) => {
if (err) return callback(new MongoError(err));
if (client == null) return callback();
this[kGssapiClient] = client;
callback(undefined, handshakeDoc);
}
);
});
}
auth(authContext, callback) {
const connection = authContext.connection;
const credentials = authContext.credentials;
if (credentials == null) return callback(new MongoError('credentials required'));
const username = credentials.username;
const client = this[kGssapiClient];
if (client == null) return callback(new MongoError('gssapi client missing'));
function externalCommand(command, cb) {
return connection.command('$external.$cmd', command, cb);
}
client.step('', (err, payload) => {
if (err) return callback(err);
externalCommand(saslStart(payload), (err, response) => {
const result = response.result;
if (err) return callback(err);
negotiate(client, 10, result.payload, (err, payload) => {
if (err) return callback(err);
externalCommand(saslContinue(payload, result.conversationId), (err, response) => {
const result = response.result;
if (err) return callback(err);
finalize(client, username, result.payload, (err, payload) => {
if (err) return callback(err);
externalCommand(
{
saslContinue: 1,
conversationId: result.conversationId,
payload
},
(err, result) => {
if (err) return callback(err);
callback(undefined, result);
}
);
});
});
});
});
});
}
}
module.exports = GSSAPI;
function saslStart(payload) {
return {
saslStart: 1,
mechanism: 'GSSAPI',
payload,
autoAuthorize: 1
};
}
function saslContinue(payload, conversationId) {
return {
saslContinue: 1,
conversationId,
payload
};
}
function negotiate(client, retries, payload, callback) {
client.step(payload, (err, response) => {
// Retries exhausted, raise error
if (err && retries === 0) return callback(err);
// Adjust number of retries and call step again
if (err) return negotiate(client, retries - 1, payload, callback);
// Return the payload
callback(undefined, response || '');
});
}
function finalize(client, user, payload, callback) {
// GSS Client Unwrap
client.unwrap(payload, (err, response) => {
if (err) return callback(err);
// Wrap the response
client.wrap(response || '', { user }, (err, wrapped) => {
if (err) return callback(err);
// Return the payload
callback(undefined, wrapped);
});
});
}
function performGssapiCanonicalizeHostName(host, mechanismProperties, callback) {
const canonicalizeHostName =
typeof mechanismProperties.gssapiCanonicalizeHostName === 'boolean'
? mechanismProperties.gssapiCanonicalizeHostName
: false;
if (!canonicalizeHostName) return callback(undefined, host);
// Attempt to resolve the host name
dns.resolveCname(host, (err, r) => {
if (err) return callback(err);
// Get the first resolve host id
if (Array.isArray(r) && r.length > 0) {
return callback(undefined, r[0]);
}
callback(undefined, host);
});
}

107
node_modules/mongodb/lib/core/auth/mongo_credentials.js generated vendored Normal file
View File

@@ -0,0 +1,107 @@
'use strict';
// Resolves the default auth mechanism according to
// https://github.com/mongodb/specifications/blob/master/source/auth/auth.rst
function getDefaultAuthMechanism(ismaster) {
if (ismaster) {
// If ismaster contains saslSupportedMechs, use scram-sha-256
// if it is available, else scram-sha-1
if (Array.isArray(ismaster.saslSupportedMechs)) {
return ismaster.saslSupportedMechs.indexOf('SCRAM-SHA-256') >= 0
? 'scram-sha-256'
: 'scram-sha-1';
}
// Fallback to legacy selection method. If wire version >= 3, use scram-sha-1
if (ismaster.maxWireVersion >= 3) {
return 'scram-sha-1';
}
}
// Default for wireprotocol < 3
return 'mongocr';
}
/**
* A representation of the credentials used by MongoDB
* @class
* @property {string} mechanism The method used to authenticate
* @property {string} [username] The username used for authentication
* @property {string} [password] The password used for authentication
* @property {string} [source] The database that the user should authenticate against
* @property {object} [mechanismProperties] Special properties used by some types of auth mechanisms
*/
class MongoCredentials {
/**
* Creates a new MongoCredentials object
* @param {object} [options]
* @param {string} [options.username] The username used for authentication
* @param {string} [options.password] The password used for authentication
* @param {string} [options.source] The database that the user should authenticate against
* @param {string} [options.mechanism] The method used to authenticate
* @param {object} [options.mechanismProperties] Special properties used by some types of auth mechanisms
*/
constructor(options) {
options = options || {};
this.username = options.username;
this.password = options.password;
this.source = options.source || options.db;
this.mechanism = options.mechanism || 'default';
this.mechanismProperties = options.mechanismProperties || {};
if (this.mechanism.match(/MONGODB-AWS/i)) {
if (this.username == null && process.env.AWS_ACCESS_KEY_ID) {
this.username = process.env.AWS_ACCESS_KEY_ID;
}
if (this.password == null && process.env.AWS_SECRET_ACCESS_KEY) {
this.password = process.env.AWS_SECRET_ACCESS_KEY;
}
if (this.mechanismProperties.AWS_SESSION_TOKEN == null && process.env.AWS_SESSION_TOKEN) {
this.mechanismProperties.AWS_SESSION_TOKEN = process.env.AWS_SESSION_TOKEN;
}
}
Object.freeze(this.mechanismProperties);
Object.freeze(this);
}
/**
* Determines if two MongoCredentials objects are equivalent
* @param {MongoCredentials} other another MongoCredentials object
* @returns {boolean} true if the two objects are equal.
*/
equals(other) {
return (
this.mechanism === other.mechanism &&
this.username === other.username &&
this.password === other.password &&
this.source === other.source
);
}
/**
* If the authentication mechanism is set to "default", resolves the authMechanism
* based on the server version and server supported sasl mechanisms.
*
* @param {Object} [ismaster] An ismaster response from the server
* @returns {MongoCredentials}
*/
resolveAuthMechanism(ismaster) {
// If the mechanism is not "default", then it does not need to be resolved
if (this.mechanism.match(/DEFAULT/i)) {
return new MongoCredentials({
username: this.username,
password: this.password,
source: this.source,
mechanism: getDefaultAuthMechanism(ismaster),
mechanismProperties: this.mechanismProperties
});
}
return this;
}
}
module.exports = { MongoCredentials };

45
node_modules/mongodb/lib/core/auth/mongocr.js generated vendored Normal file
View File

@@ -0,0 +1,45 @@
'use strict';
const crypto = require('crypto');
const AuthProvider = require('./auth_provider').AuthProvider;
class MongoCR extends AuthProvider {
auth(authContext, callback) {
const connection = authContext.connection;
const credentials = authContext.credentials;
const username = credentials.username;
const password = credentials.password;
const source = credentials.source;
connection.command(`${source}.$cmd`, { getnonce: 1 }, (err, result) => {
let nonce = null;
let key = null;
// Get nonce
if (err == null) {
const r = result.result;
nonce = r.nonce;
// Use node md5 generator
let md5 = crypto.createHash('md5');
// Generate keys used for authentication
md5.update(username + ':mongo:' + password, 'utf8');
const hash_password = md5.digest('hex');
// Final key
md5 = crypto.createHash('md5');
md5.update(nonce + username + hash_password, 'utf8');
key = md5.digest('hex');
}
const authenticateCommand = {
authenticate: 1,
user: username,
nonce,
key
};
connection.command(`${source}.$cmd`, authenticateCommand, callback);
});
}
}
module.exports = MongoCR;

256
node_modules/mongodb/lib/core/auth/mongodb_aws.js generated vendored Normal file
View File

@@ -0,0 +1,256 @@
'use strict';
const AuthProvider = require('./auth_provider').AuthProvider;
const MongoCredentials = require('./mongo_credentials').MongoCredentials;
const MongoError = require('../error').MongoError;
const crypto = require('crypto');
const http = require('http');
const maxWireVersion = require('../utils').maxWireVersion;
const url = require('url');
let aws4;
try {
aws4 = require('aws4');
} catch (e) {
// don't do anything;
}
const ASCII_N = 110;
const AWS_RELATIVE_URI = 'http://169.254.170.2';
const AWS_EC2_URI = 'http://169.254.169.254';
const AWS_EC2_PATH = '/latest/meta-data/iam/security-credentials';
class MongoDBAWS extends AuthProvider {
auth(authContext, callback) {
const connection = authContext.connection;
const credentials = authContext.credentials;
if (maxWireVersion(connection) < 9) {
callback(new MongoError('MONGODB-AWS authentication requires MongoDB version 4.4 or later'));
return;
}
if (aws4 == null) {
callback(
new MongoError(
'MONGODB-AWS authentication requires the `aws4` module, please install it as a dependency of your project'
)
);
return;
}
if (credentials.username == null) {
makeTempCredentials(credentials, (err, tempCredentials) => {
if (err) return callback(err);
authContext.credentials = tempCredentials;
this.auth(authContext, callback);
});
return;
}
const username = credentials.username;
const password = credentials.password;
const db = credentials.source;
const token = credentials.mechanismProperties.AWS_SESSION_TOKEN;
const bson = this.bson;
crypto.randomBytes(32, (err, nonce) => {
if (err) {
callback(err);
return;
}
const saslStart = {
saslStart: 1,
mechanism: 'MONGODB-AWS',
payload: bson.serialize({ r: nonce, p: ASCII_N })
};
connection.command(`${db}.$cmd`, saslStart, (err, result) => {
if (err) return callback(err);
const res = result.result;
const serverResponse = bson.deserialize(res.payload.buffer);
const host = serverResponse.h;
const serverNonce = serverResponse.s.buffer;
if (serverNonce.length !== 64) {
callback(
new MongoError(`Invalid server nonce length ${serverNonce.length}, expected 64`)
);
return;
}
if (serverNonce.compare(nonce, 0, nonce.length, 0, nonce.length) !== 0) {
callback(new MongoError('Server nonce does not begin with client nonce'));
return;
}
if (host.length < 1 || host.length > 255 || host.indexOf('..') !== -1) {
callback(new MongoError(`Server returned an invalid host: "${host}"`));
return;
}
const body = 'Action=GetCallerIdentity&Version=2011-06-15';
const options = aws4.sign(
{
method: 'POST',
host,
region: deriveRegion(serverResponse.h),
service: 'sts',
headers: {
'Content-Type': 'application/x-www-form-urlencoded',
'Content-Length': body.length,
'X-MongoDB-Server-Nonce': serverNonce.toString('base64'),
'X-MongoDB-GS2-CB-Flag': 'n'
},
path: '/',
body
},
{
accessKeyId: username,
secretAccessKey: password,
token
}
);
const authorization = options.headers.Authorization;
const date = options.headers['X-Amz-Date'];
const payload = { a: authorization, d: date };
if (token) {
payload.t = token;
}
const saslContinue = {
saslContinue: 1,
conversationId: 1,
payload: bson.serialize(payload)
};
connection.command(`${db}.$cmd`, saslContinue, err => {
if (err) return callback(err);
callback();
});
});
});
}
}
function makeTempCredentials(credentials, callback) {
function done(creds) {
if (creds.AccessKeyId == null || creds.SecretAccessKey == null || creds.Token == null) {
callback(new MongoError('Could not obtain temporary MONGODB-AWS credentials'));
return;
}
callback(
undefined,
new MongoCredentials({
username: creds.AccessKeyId,
password: creds.SecretAccessKey,
source: credentials.source,
mechanism: 'MONGODB-AWS',
mechanismProperties: {
AWS_SESSION_TOKEN: creds.Token
}
})
);
}
// If the environment variable AWS_CONTAINER_CREDENTIALS_RELATIVE_URI
// is set then drivers MUST assume that it was set by an AWS ECS agent
if (process.env.AWS_CONTAINER_CREDENTIALS_RELATIVE_URI) {
request(
`${AWS_RELATIVE_URI}${process.env.AWS_CONTAINER_CREDENTIALS_RELATIVE_URI}`,
(err, res) => {
if (err) return callback(err);
done(res);
}
);
return;
}
// Otherwise assume we are on an EC2 instance
// get a token
request(
`${AWS_EC2_URI}/latest/api/token`,
{ method: 'PUT', json: false, headers: { 'X-aws-ec2-metadata-token-ttl-seconds': 30 } },
(err, token) => {
if (err) return callback(err);
// get role name
request(
`${AWS_EC2_URI}/${AWS_EC2_PATH}`,
{ json: false, headers: { 'X-aws-ec2-metadata-token': token } },
(err, roleName) => {
if (err) return callback(err);
// get temp credentials
request(
`${AWS_EC2_URI}/${AWS_EC2_PATH}/${roleName}`,
{ headers: { 'X-aws-ec2-metadata-token': token } },
(err, creds) => {
if (err) return callback(err);
done(creds);
}
);
}
);
}
);
}
function deriveRegion(host) {
const parts = host.split('.');
if (parts.length === 1 || parts[1] === 'amazonaws') {
return 'us-east-1';
}
return parts[1];
}
function request(uri, options, callback) {
if (typeof options === 'function') {
callback = options;
options = {};
}
options = Object.assign(
{
method: 'GET',
timeout: 10000,
json: true
},
url.parse(uri),
options
);
const req = http.request(options, res => {
res.setEncoding('utf8');
let data = '';
res.on('data', d => (data += d));
res.on('end', () => {
if (options.json === false) {
callback(undefined, data);
return;
}
try {
const parsed = JSON.parse(data);
callback(undefined, parsed);
} catch (err) {
callback(new MongoError(`Invalid JSON response: "${data}"`));
}
});
});
req.on('error', err => callback(err));
req.end();
}
module.exports = MongoDBAWS;

28
node_modules/mongodb/lib/core/auth/plain.js generated vendored Normal file
View File

@@ -0,0 +1,28 @@
'use strict';
const retrieveBSON = require('../connection/utils').retrieveBSON;
const AuthProvider = require('./auth_provider').AuthProvider;
// TODO: can we get the Binary type from this.bson instead?
const BSON = retrieveBSON();
const Binary = BSON.Binary;
class Plain extends AuthProvider {
auth(authContext, callback) {
const connection = authContext.connection;
const credentials = authContext.credentials;
const username = credentials.username;
const password = credentials.password;
const payload = new Binary(`\x00${username}\x00${password}`);
const command = {
saslStart: 1,
mechanism: 'PLAIN',
payload: payload,
autoAuthorize: 1
};
connection.command('$external.$cmd', command, callback);
}
}
module.exports = Plain;

346
node_modules/mongodb/lib/core/auth/scram.js generated vendored Normal file
View File

@@ -0,0 +1,346 @@
'use strict';
const crypto = require('crypto');
const Buffer = require('safe-buffer').Buffer;
const retrieveBSON = require('../connection/utils').retrieveBSON;
const MongoError = require('../error').MongoError;
const AuthProvider = require('./auth_provider').AuthProvider;
const BSON = retrieveBSON();
const Binary = BSON.Binary;
let saslprep;
try {
saslprep = require('saslprep');
} catch (e) {
// don't do anything;
}
class ScramSHA extends AuthProvider {
constructor(bson, cryptoMethod) {
super(bson);
this.cryptoMethod = cryptoMethod || 'sha1';
}
prepare(handshakeDoc, authContext, callback) {
const cryptoMethod = this.cryptoMethod;
if (cryptoMethod === 'sha256' && saslprep == null) {
console.warn('Warning: no saslprep library specified. Passwords will not be sanitized');
}
crypto.randomBytes(24, (err, nonce) => {
if (err) {
return callback(err);
}
// store the nonce for later use
Object.assign(authContext, { nonce });
const credentials = authContext.credentials;
const request = Object.assign({}, handshakeDoc, {
speculativeAuthenticate: Object.assign(makeFirstMessage(cryptoMethod, credentials, nonce), {
db: credentials.source
})
});
callback(undefined, request);
});
}
auth(authContext, callback) {
const response = authContext.response;
if (response && response.speculativeAuthenticate) {
continueScramConversation(
this.cryptoMethod,
response.speculativeAuthenticate,
authContext,
callback
);
return;
}
executeScram(this.cryptoMethod, authContext, callback);
}
}
function cleanUsername(username) {
return username.replace('=', '=3D').replace(',', '=2C');
}
function clientFirstMessageBare(username, nonce) {
// NOTE: This is done b/c Javascript uses UTF-16, but the server is hashing in UTF-8.
// Since the username is not sasl-prep-d, we need to do this here.
return Buffer.concat([
Buffer.from('n=', 'utf8'),
Buffer.from(username, 'utf8'),
Buffer.from(',r=', 'utf8'),
Buffer.from(nonce.toString('base64'), 'utf8')
]);
}
function makeFirstMessage(cryptoMethod, credentials, nonce) {
const username = cleanUsername(credentials.username);
const mechanism = cryptoMethod === 'sha1' ? 'SCRAM-SHA-1' : 'SCRAM-SHA-256';
// NOTE: This is done b/c Javascript uses UTF-16, but the server is hashing in UTF-8.
// Since the username is not sasl-prep-d, we need to do this here.
return {
saslStart: 1,
mechanism,
payload: new Binary(
Buffer.concat([Buffer.from('n,,', 'utf8'), clientFirstMessageBare(username, nonce)])
),
autoAuthorize: 1,
options: { skipEmptyExchange: true }
};
}
function executeScram(cryptoMethod, authContext, callback) {
const connection = authContext.connection;
const credentials = authContext.credentials;
const nonce = authContext.nonce;
const db = credentials.source;
const saslStartCmd = makeFirstMessage(cryptoMethod, credentials, nonce);
connection.command(`${db}.$cmd`, saslStartCmd, (_err, result) => {
const err = resolveError(_err, result);
if (err) {
return callback(err);
}
continueScramConversation(cryptoMethod, result.result, authContext, callback);
});
}
function continueScramConversation(cryptoMethod, response, authContext, callback) {
const connection = authContext.connection;
const credentials = authContext.credentials;
const nonce = authContext.nonce;
const db = credentials.source;
const username = cleanUsername(credentials.username);
const password = credentials.password;
let processedPassword;
if (cryptoMethod === 'sha256') {
processedPassword = saslprep ? saslprep(password) : password;
} else {
try {
processedPassword = passwordDigest(username, password);
} catch (e) {
return callback(e);
}
}
const payload = Buffer.isBuffer(response.payload)
? new Binary(response.payload)
: response.payload;
const dict = parsePayload(payload.value());
const iterations = parseInt(dict.i, 10);
if (iterations && iterations < 4096) {
callback(new MongoError(`Server returned an invalid iteration count ${iterations}`), false);
return;
}
const salt = dict.s;
const rnonce = dict.r;
if (rnonce.startsWith('nonce')) {
callback(new MongoError(`Server returned an invalid nonce: ${rnonce}`), false);
return;
}
// Set up start of proof
const withoutProof = `c=biws,r=${rnonce}`;
const saltedPassword = HI(
processedPassword,
Buffer.from(salt, 'base64'),
iterations,
cryptoMethod
);
const clientKey = HMAC(cryptoMethod, saltedPassword, 'Client Key');
const serverKey = HMAC(cryptoMethod, saltedPassword, 'Server Key');
const storedKey = H(cryptoMethod, clientKey);
const authMessage = [
clientFirstMessageBare(username, nonce),
payload.value().toString('base64'),
withoutProof
].join(',');
const clientSignature = HMAC(cryptoMethod, storedKey, authMessage);
const clientProof = `p=${xor(clientKey, clientSignature)}`;
const clientFinal = [withoutProof, clientProof].join(',');
const serverSignature = HMAC(cryptoMethod, serverKey, authMessage);
const saslContinueCmd = {
saslContinue: 1,
conversationId: response.conversationId,
payload: new Binary(Buffer.from(clientFinal))
};
connection.command(`${db}.$cmd`, saslContinueCmd, (_err, result) => {
const err = resolveError(_err, result);
if (err) {
return callback(err);
}
const r = result.result;
const parsedResponse = parsePayload(r.payload.value());
if (!compareDigest(Buffer.from(parsedResponse.v, 'base64'), serverSignature)) {
callback(new MongoError('Server returned an invalid signature'));
return;
}
if (!r || r.done !== false) {
return callback(err, r);
}
const retrySaslContinueCmd = {
saslContinue: 1,
conversationId: r.conversationId,
payload: Buffer.alloc(0)
};
connection.command(`${db}.$cmd`, retrySaslContinueCmd, callback);
});
}
function parsePayload(payload) {
const dict = {};
const parts = payload.split(',');
for (let i = 0; i < parts.length; i++) {
const valueParts = parts[i].split('=');
dict[valueParts[0]] = valueParts[1];
}
return dict;
}
function passwordDigest(username, password) {
if (typeof username !== 'string') {
throw new MongoError('username must be a string');
}
if (typeof password !== 'string') {
throw new MongoError('password must be a string');
}
if (password.length === 0) {
throw new MongoError('password cannot be empty');
}
const md5 = crypto.createHash('md5');
md5.update(`${username}:mongo:${password}`, 'utf8');
return md5.digest('hex');
}
// XOR two buffers
function xor(a, b) {
if (!Buffer.isBuffer(a)) {
a = Buffer.from(a);
}
if (!Buffer.isBuffer(b)) {
b = Buffer.from(b);
}
const length = Math.max(a.length, b.length);
const res = [];
for (let i = 0; i < length; i += 1) {
res.push(a[i] ^ b[i]);
}
return Buffer.from(res).toString('base64');
}
function H(method, text) {
return crypto
.createHash(method)
.update(text)
.digest();
}
function HMAC(method, key, text) {
return crypto
.createHmac(method, key)
.update(text)
.digest();
}
let _hiCache = {};
let _hiCacheCount = 0;
function _hiCachePurge() {
_hiCache = {};
_hiCacheCount = 0;
}
const hiLengthMap = {
sha256: 32,
sha1: 20
};
function HI(data, salt, iterations, cryptoMethod) {
// omit the work if already generated
const key = [data, salt.toString('base64'), iterations].join('_');
if (_hiCache[key] !== undefined) {
return _hiCache[key];
}
// generate the salt
const saltedData = crypto.pbkdf2Sync(
data,
salt,
iterations,
hiLengthMap[cryptoMethod],
cryptoMethod
);
// cache a copy to speed up the next lookup, but prevent unbounded cache growth
if (_hiCacheCount >= 200) {
_hiCachePurge();
}
_hiCache[key] = saltedData;
_hiCacheCount += 1;
return saltedData;
}
function compareDigest(lhs, rhs) {
if (lhs.length !== rhs.length) {
return false;
}
if (typeof crypto.timingSafeEqual === 'function') {
return crypto.timingSafeEqual(lhs, rhs);
}
let result = 0;
for (let i = 0; i < lhs.length; i++) {
result |= lhs[i] ^ rhs[i];
}
return result === 0;
}
function resolveError(err, result) {
if (err) return err;
const r = result.result;
if (r.$err || r.errmsg) return new MongoError(r);
}
class ScramSHA1 extends ScramSHA {
constructor(bson) {
super(bson, 'sha1');
}
}
class ScramSHA256 extends ScramSHA {
constructor(bson) {
super(bson, 'sha256');
}
}
module.exports = { ScramSHA1, ScramSHA256 };

35
node_modules/mongodb/lib/core/auth/x509.js generated vendored Normal file
View File

@@ -0,0 +1,35 @@
'use strict';
const AuthProvider = require('./auth_provider').AuthProvider;
class X509 extends AuthProvider {
prepare(handshakeDoc, authContext, callback) {
const credentials = authContext.credentials;
Object.assign(handshakeDoc, {
speculativeAuthenticate: x509AuthenticateCommand(credentials)
});
callback(undefined, handshakeDoc);
}
auth(authContext, callback) {
const connection = authContext.connection;
const credentials = authContext.credentials;
const response = authContext.response;
if (response.speculativeAuthenticate) {
return callback();
}
connection.command('$external.$cmd', x509AuthenticateCommand(credentials), callback);
}
}
function x509AuthenticateCommand(credentials) {
const command = { authenticate: 1, mechanism: 'MONGODB-X509' };
if (credentials.username) {
Object.apply(command, { user: credentials.username });
}
return command;
}
module.exports = X509;

251
node_modules/mongodb/lib/core/connection/apm.js generated vendored Normal file
View File

@@ -0,0 +1,251 @@
'use strict';
const Msg = require('../connection/msg').Msg;
const KillCursor = require('../connection/commands').KillCursor;
const GetMore = require('../connection/commands').GetMore;
const calculateDurationInMs = require('../../utils').calculateDurationInMs;
/** Commands that we want to redact because of the sensitive nature of their contents */
const SENSITIVE_COMMANDS = new Set([
'authenticate',
'saslStart',
'saslContinue',
'getnonce',
'createUser',
'updateUser',
'copydbgetnonce',
'copydbsaslstart',
'copydb'
]);
// helper methods
const extractCommandName = commandDoc => Object.keys(commandDoc)[0];
const namespace = command => command.ns;
const databaseName = command => command.ns.split('.')[0];
const collectionName = command => command.ns.split('.')[1];
const generateConnectionId = pool =>
pool.options ? `${pool.options.host}:${pool.options.port}` : pool.address;
const maybeRedact = (commandName, result) => (SENSITIVE_COMMANDS.has(commandName) ? {} : result);
const isLegacyPool = pool => pool.s && pool.queue;
const LEGACY_FIND_QUERY_MAP = {
$query: 'filter',
$orderby: 'sort',
$hint: 'hint',
$comment: 'comment',
$maxScan: 'maxScan',
$max: 'max',
$min: 'min',
$returnKey: 'returnKey',
$showDiskLoc: 'showRecordId',
$maxTimeMS: 'maxTimeMS',
$snapshot: 'snapshot'
};
const LEGACY_FIND_OPTIONS_MAP = {
numberToSkip: 'skip',
numberToReturn: 'batchSize',
returnFieldsSelector: 'projection'
};
const OP_QUERY_KEYS = [
'tailable',
'oplogReplay',
'noCursorTimeout',
'awaitData',
'partial',
'exhaust'
];
/**
* Extract the actual command from the query, possibly upconverting if it's a legacy
* format
*
* @param {Object} command the command
*/
const extractCommand = command => {
if (command instanceof GetMore) {
return {
getMore: command.cursorId,
collection: collectionName(command),
batchSize: command.numberToReturn
};
}
if (command instanceof KillCursor) {
return {
killCursors: collectionName(command),
cursors: command.cursorIds
};
}
if (command instanceof Msg) {
return command.command;
}
if (command.query && command.query.$query) {
let result;
if (command.ns === 'admin.$cmd') {
// upconvert legacy command
result = Object.assign({}, command.query.$query);
} else {
// upconvert legacy find command
result = { find: collectionName(command) };
Object.keys(LEGACY_FIND_QUERY_MAP).forEach(key => {
if (typeof command.query[key] !== 'undefined')
result[LEGACY_FIND_QUERY_MAP[key]] = command.query[key];
});
}
Object.keys(LEGACY_FIND_OPTIONS_MAP).forEach(key => {
if (typeof command[key] !== 'undefined') result[LEGACY_FIND_OPTIONS_MAP[key]] = command[key];
});
OP_QUERY_KEYS.forEach(key => {
if (command[key]) result[key] = command[key];
});
if (typeof command.pre32Limit !== 'undefined') {
result.limit = command.pre32Limit;
}
if (command.query.$explain) {
return { explain: result };
}
return result;
}
return command.query ? command.query : command;
};
const extractReply = (command, reply) => {
if (command instanceof GetMore) {
return {
ok: 1,
cursor: {
id: reply.message.cursorId,
ns: namespace(command),
nextBatch: reply.message.documents
}
};
}
if (command instanceof KillCursor) {
return {
ok: 1,
cursorsUnknown: command.cursorIds
};
}
// is this a legacy find command?
if (command.query && typeof command.query.$query !== 'undefined') {
return {
ok: 1,
cursor: {
id: reply.message.cursorId,
ns: namespace(command),
firstBatch: reply.message.documents
}
};
}
return reply && reply.result ? reply.result : reply;
};
const extractConnectionDetails = pool => {
if (isLegacyPool(pool)) {
return {
connectionId: generateConnectionId(pool)
};
}
// APM in the modern pool is done at the `Connection` level, so we rename it here for
// readability.
const connection = pool;
return {
address: connection.address,
connectionId: connection.id
};
};
/** An event indicating the start of a given command */
class CommandStartedEvent {
/**
* Create a started event
*
* @param {Pool} pool the pool that originated the command
* @param {Object} command the command
*/
constructor(pool, command) {
const cmd = extractCommand(command);
const commandName = extractCommandName(cmd);
const connectionDetails = extractConnectionDetails(pool);
// NOTE: remove in major revision, this is not spec behavior
if (SENSITIVE_COMMANDS.has(commandName)) {
this.commandObj = {};
this.commandObj[commandName] = true;
}
Object.assign(this, connectionDetails, {
requestId: command.requestId,
databaseName: databaseName(command),
commandName,
command: cmd
});
}
}
/** An event indicating the success of a given command */
class CommandSucceededEvent {
/**
* Create a succeeded event
*
* @param {Pool} pool the pool that originated the command
* @param {Object} command the command
* @param {Object} reply the reply for this command from the server
* @param {Array} started a high resolution tuple timestamp of when the command was first sent, to calculate duration
*/
constructor(pool, command, reply, started) {
const cmd = extractCommand(command);
const commandName = extractCommandName(cmd);
const connectionDetails = extractConnectionDetails(pool);
Object.assign(this, connectionDetails, {
requestId: command.requestId,
commandName,
duration: calculateDurationInMs(started),
reply: maybeRedact(commandName, extractReply(command, reply))
});
}
}
/** An event indicating the failure of a given command */
class CommandFailedEvent {
/**
* Create a failure event
*
* @param {Pool} pool the pool that originated the command
* @param {Object} command the command
* @param {MongoError|Object} error the generated error or a server error response
* @param {Array} started a high resolution tuple timestamp of when the command was first sent, to calculate duration
*/
constructor(pool, command, error, started) {
const cmd = extractCommand(command);
const commandName = extractCommandName(cmd);
const connectionDetails = extractConnectionDetails(pool);
Object.assign(this, connectionDetails, {
requestId: command.requestId,
commandName,
duration: calculateDurationInMs(started),
failure: maybeRedact(commandName, error)
});
}
}
module.exports = {
CommandStartedEvent,
CommandSucceededEvent,
CommandFailedEvent
};

View File

@@ -0,0 +1,36 @@
'use strict';
/**
* Creates a new CommandResult instance
* @class
* @param {object} result CommandResult object
* @param {Connection} connection A connection instance associated with this result
* @return {CommandResult} A cursor instance
*/
var CommandResult = function(result, connection, message) {
this.result = result;
this.connection = connection;
this.message = message;
};
/**
* Convert CommandResult to JSON
* @method
* @return {object}
*/
CommandResult.prototype.toJSON = function() {
let result = Object.assign({}, this, this.result);
delete result.message;
return result;
};
/**
* Convert CommandResult to String representation
* @method
* @return {string}
*/
CommandResult.prototype.toString = function() {
return JSON.stringify(this.toJSON());
};
module.exports = CommandResult;

507
node_modules/mongodb/lib/core/connection/commands.js generated vendored Normal file
View File

@@ -0,0 +1,507 @@
'use strict';
var retrieveBSON = require('./utils').retrieveBSON;
var BSON = retrieveBSON();
var Long = BSON.Long;
const Buffer = require('safe-buffer').Buffer;
// Incrementing request id
var _requestId = 0;
// Wire command operation ids
var opcodes = require('../wireprotocol/shared').opcodes;
// Query flags
var OPTS_TAILABLE_CURSOR = 2;
var OPTS_SLAVE = 4;
var OPTS_OPLOG_REPLAY = 8;
var OPTS_NO_CURSOR_TIMEOUT = 16;
var OPTS_AWAIT_DATA = 32;
var OPTS_EXHAUST = 64;
var OPTS_PARTIAL = 128;
// Response flags
var CURSOR_NOT_FOUND = 1;
var QUERY_FAILURE = 2;
var SHARD_CONFIG_STALE = 4;
var AWAIT_CAPABLE = 8;
/**************************************************************
* QUERY
**************************************************************/
var Query = function(bson, ns, query, options) {
var self = this;
// Basic options needed to be passed in
if (ns == null) throw new Error('ns must be specified for query');
if (query == null) throw new Error('query must be specified for query');
// Validate that we are not passing 0x00 in the collection name
if (ns.indexOf('\x00') !== -1) {
throw new Error('namespace cannot contain a null character');
}
// Basic options
this.bson = bson;
this.ns = ns;
this.query = query;
// Additional options
this.numberToSkip = options.numberToSkip || 0;
this.numberToReturn = options.numberToReturn || 0;
this.returnFieldSelector = options.returnFieldSelector || null;
this.requestId = Query.getRequestId();
// special case for pre-3.2 find commands, delete ASAP
this.pre32Limit = options.pre32Limit;
// Serialization option
this.serializeFunctions =
typeof options.serializeFunctions === 'boolean' ? options.serializeFunctions : false;
this.ignoreUndefined =
typeof options.ignoreUndefined === 'boolean' ? options.ignoreUndefined : false;
this.maxBsonSize = options.maxBsonSize || 1024 * 1024 * 16;
this.checkKeys = typeof options.checkKeys === 'boolean' ? options.checkKeys : true;
this.batchSize = self.numberToReturn;
// Flags
this.tailable = false;
this.slaveOk = typeof options.slaveOk === 'boolean' ? options.slaveOk : false;
this.oplogReplay = false;
this.noCursorTimeout = false;
this.awaitData = false;
this.exhaust = false;
this.partial = false;
};
//
// Assign a new request Id
Query.prototype.incRequestId = function() {
this.requestId = _requestId++;
};
//
// Assign a new request Id
Query.nextRequestId = function() {
return _requestId + 1;
};
//
// Uses a single allocated buffer for the process, avoiding multiple memory allocations
Query.prototype.toBin = function() {
var self = this;
var buffers = [];
var projection = null;
// Set up the flags
var flags = 0;
if (this.tailable) {
flags |= OPTS_TAILABLE_CURSOR;
}
if (this.slaveOk) {
flags |= OPTS_SLAVE;
}
if (this.oplogReplay) {
flags |= OPTS_OPLOG_REPLAY;
}
if (this.noCursorTimeout) {
flags |= OPTS_NO_CURSOR_TIMEOUT;
}
if (this.awaitData) {
flags |= OPTS_AWAIT_DATA;
}
if (this.exhaust) {
flags |= OPTS_EXHAUST;
}
if (this.partial) {
flags |= OPTS_PARTIAL;
}
// If batchSize is different to self.numberToReturn
if (self.batchSize !== self.numberToReturn) self.numberToReturn = self.batchSize;
// Allocate write protocol header buffer
var header = Buffer.alloc(
4 * 4 + // Header
4 + // Flags
Buffer.byteLength(self.ns) +
1 + // namespace
4 + // numberToSkip
4 // numberToReturn
);
// Add header to buffers
buffers.push(header);
// Serialize the query
var query = self.bson.serialize(this.query, {
checkKeys: this.checkKeys,
serializeFunctions: this.serializeFunctions,
ignoreUndefined: this.ignoreUndefined
});
// Add query document
buffers.push(query);
if (self.returnFieldSelector && Object.keys(self.returnFieldSelector).length > 0) {
// Serialize the projection document
projection = self.bson.serialize(this.returnFieldSelector, {
checkKeys: this.checkKeys,
serializeFunctions: this.serializeFunctions,
ignoreUndefined: this.ignoreUndefined
});
// Add projection document
buffers.push(projection);
}
// Total message size
var totalLength = header.length + query.length + (projection ? projection.length : 0);
// Set up the index
var index = 4;
// Write total document length
header[3] = (totalLength >> 24) & 0xff;
header[2] = (totalLength >> 16) & 0xff;
header[1] = (totalLength >> 8) & 0xff;
header[0] = totalLength & 0xff;
// Write header information requestId
header[index + 3] = (this.requestId >> 24) & 0xff;
header[index + 2] = (this.requestId >> 16) & 0xff;
header[index + 1] = (this.requestId >> 8) & 0xff;
header[index] = this.requestId & 0xff;
index = index + 4;
// Write header information responseTo
header[index + 3] = (0 >> 24) & 0xff;
header[index + 2] = (0 >> 16) & 0xff;
header[index + 1] = (0 >> 8) & 0xff;
header[index] = 0 & 0xff;
index = index + 4;
// Write header information OP_QUERY
header[index + 3] = (opcodes.OP_QUERY >> 24) & 0xff;
header[index + 2] = (opcodes.OP_QUERY >> 16) & 0xff;
header[index + 1] = (opcodes.OP_QUERY >> 8) & 0xff;
header[index] = opcodes.OP_QUERY & 0xff;
index = index + 4;
// Write header information flags
header[index + 3] = (flags >> 24) & 0xff;
header[index + 2] = (flags >> 16) & 0xff;
header[index + 1] = (flags >> 8) & 0xff;
header[index] = flags & 0xff;
index = index + 4;
// Write collection name
index = index + header.write(this.ns, index, 'utf8') + 1;
header[index - 1] = 0;
// Write header information flags numberToSkip
header[index + 3] = (this.numberToSkip >> 24) & 0xff;
header[index + 2] = (this.numberToSkip >> 16) & 0xff;
header[index + 1] = (this.numberToSkip >> 8) & 0xff;
header[index] = this.numberToSkip & 0xff;
index = index + 4;
// Write header information flags numberToReturn
header[index + 3] = (this.numberToReturn >> 24) & 0xff;
header[index + 2] = (this.numberToReturn >> 16) & 0xff;
header[index + 1] = (this.numberToReturn >> 8) & 0xff;
header[index] = this.numberToReturn & 0xff;
index = index + 4;
// Return the buffers
return buffers;
};
Query.getRequestId = function() {
return ++_requestId;
};
/**************************************************************
* GETMORE
**************************************************************/
var GetMore = function(bson, ns, cursorId, opts) {
opts = opts || {};
this.numberToReturn = opts.numberToReturn || 0;
this.requestId = _requestId++;
this.bson = bson;
this.ns = ns;
this.cursorId = cursorId;
};
//
// Uses a single allocated buffer for the process, avoiding multiple memory allocations
GetMore.prototype.toBin = function() {
var length = 4 + Buffer.byteLength(this.ns) + 1 + 4 + 8 + 4 * 4;
// Create command buffer
var index = 0;
// Allocate buffer
var _buffer = Buffer.alloc(length);
// Write header information
// index = write32bit(index, _buffer, length);
_buffer[index + 3] = (length >> 24) & 0xff;
_buffer[index + 2] = (length >> 16) & 0xff;
_buffer[index + 1] = (length >> 8) & 0xff;
_buffer[index] = length & 0xff;
index = index + 4;
// index = write32bit(index, _buffer, requestId);
_buffer[index + 3] = (this.requestId >> 24) & 0xff;
_buffer[index + 2] = (this.requestId >> 16) & 0xff;
_buffer[index + 1] = (this.requestId >> 8) & 0xff;
_buffer[index] = this.requestId & 0xff;
index = index + 4;
// index = write32bit(index, _buffer, 0);
_buffer[index + 3] = (0 >> 24) & 0xff;
_buffer[index + 2] = (0 >> 16) & 0xff;
_buffer[index + 1] = (0 >> 8) & 0xff;
_buffer[index] = 0 & 0xff;
index = index + 4;
// index = write32bit(index, _buffer, OP_GETMORE);
_buffer[index + 3] = (opcodes.OP_GETMORE >> 24) & 0xff;
_buffer[index + 2] = (opcodes.OP_GETMORE >> 16) & 0xff;
_buffer[index + 1] = (opcodes.OP_GETMORE >> 8) & 0xff;
_buffer[index] = opcodes.OP_GETMORE & 0xff;
index = index + 4;
// index = write32bit(index, _buffer, 0);
_buffer[index + 3] = (0 >> 24) & 0xff;
_buffer[index + 2] = (0 >> 16) & 0xff;
_buffer[index + 1] = (0 >> 8) & 0xff;
_buffer[index] = 0 & 0xff;
index = index + 4;
// Write collection name
index = index + _buffer.write(this.ns, index, 'utf8') + 1;
_buffer[index - 1] = 0;
// Write batch size
// index = write32bit(index, _buffer, numberToReturn);
_buffer[index + 3] = (this.numberToReturn >> 24) & 0xff;
_buffer[index + 2] = (this.numberToReturn >> 16) & 0xff;
_buffer[index + 1] = (this.numberToReturn >> 8) & 0xff;
_buffer[index] = this.numberToReturn & 0xff;
index = index + 4;
// Write cursor id
// index = write32bit(index, _buffer, cursorId.getLowBits());
_buffer[index + 3] = (this.cursorId.getLowBits() >> 24) & 0xff;
_buffer[index + 2] = (this.cursorId.getLowBits() >> 16) & 0xff;
_buffer[index + 1] = (this.cursorId.getLowBits() >> 8) & 0xff;
_buffer[index] = this.cursorId.getLowBits() & 0xff;
index = index + 4;
// index = write32bit(index, _buffer, cursorId.getHighBits());
_buffer[index + 3] = (this.cursorId.getHighBits() >> 24) & 0xff;
_buffer[index + 2] = (this.cursorId.getHighBits() >> 16) & 0xff;
_buffer[index + 1] = (this.cursorId.getHighBits() >> 8) & 0xff;
_buffer[index] = this.cursorId.getHighBits() & 0xff;
index = index + 4;
// Return buffer
return _buffer;
};
/**************************************************************
* KILLCURSOR
**************************************************************/
var KillCursor = function(bson, ns, cursorIds) {
this.ns = ns;
this.requestId = _requestId++;
this.cursorIds = cursorIds;
};
//
// Uses a single allocated buffer for the process, avoiding multiple memory allocations
KillCursor.prototype.toBin = function() {
var length = 4 + 4 + 4 * 4 + this.cursorIds.length * 8;
// Create command buffer
var index = 0;
var _buffer = Buffer.alloc(length);
// Write header information
// index = write32bit(index, _buffer, length);
_buffer[index + 3] = (length >> 24) & 0xff;
_buffer[index + 2] = (length >> 16) & 0xff;
_buffer[index + 1] = (length >> 8) & 0xff;
_buffer[index] = length & 0xff;
index = index + 4;
// index = write32bit(index, _buffer, requestId);
_buffer[index + 3] = (this.requestId >> 24) & 0xff;
_buffer[index + 2] = (this.requestId >> 16) & 0xff;
_buffer[index + 1] = (this.requestId >> 8) & 0xff;
_buffer[index] = this.requestId & 0xff;
index = index + 4;
// index = write32bit(index, _buffer, 0);
_buffer[index + 3] = (0 >> 24) & 0xff;
_buffer[index + 2] = (0 >> 16) & 0xff;
_buffer[index + 1] = (0 >> 8) & 0xff;
_buffer[index] = 0 & 0xff;
index = index + 4;
// index = write32bit(index, _buffer, OP_KILL_CURSORS);
_buffer[index + 3] = (opcodes.OP_KILL_CURSORS >> 24) & 0xff;
_buffer[index + 2] = (opcodes.OP_KILL_CURSORS >> 16) & 0xff;
_buffer[index + 1] = (opcodes.OP_KILL_CURSORS >> 8) & 0xff;
_buffer[index] = opcodes.OP_KILL_CURSORS & 0xff;
index = index + 4;
// index = write32bit(index, _buffer, 0);
_buffer[index + 3] = (0 >> 24) & 0xff;
_buffer[index + 2] = (0 >> 16) & 0xff;
_buffer[index + 1] = (0 >> 8) & 0xff;
_buffer[index] = 0 & 0xff;
index = index + 4;
// Write batch size
// index = write32bit(index, _buffer, this.cursorIds.length);
_buffer[index + 3] = (this.cursorIds.length >> 24) & 0xff;
_buffer[index + 2] = (this.cursorIds.length >> 16) & 0xff;
_buffer[index + 1] = (this.cursorIds.length >> 8) & 0xff;
_buffer[index] = this.cursorIds.length & 0xff;
index = index + 4;
// Write all the cursor ids into the array
for (var i = 0; i < this.cursorIds.length; i++) {
// Write cursor id
// index = write32bit(index, _buffer, cursorIds[i].getLowBits());
_buffer[index + 3] = (this.cursorIds[i].getLowBits() >> 24) & 0xff;
_buffer[index + 2] = (this.cursorIds[i].getLowBits() >> 16) & 0xff;
_buffer[index + 1] = (this.cursorIds[i].getLowBits() >> 8) & 0xff;
_buffer[index] = this.cursorIds[i].getLowBits() & 0xff;
index = index + 4;
// index = write32bit(index, _buffer, cursorIds[i].getHighBits());
_buffer[index + 3] = (this.cursorIds[i].getHighBits() >> 24) & 0xff;
_buffer[index + 2] = (this.cursorIds[i].getHighBits() >> 16) & 0xff;
_buffer[index + 1] = (this.cursorIds[i].getHighBits() >> 8) & 0xff;
_buffer[index] = this.cursorIds[i].getHighBits() & 0xff;
index = index + 4;
}
// Return buffer
return _buffer;
};
var Response = function(bson, message, msgHeader, msgBody, opts) {
opts = opts || { promoteLongs: true, promoteValues: true, promoteBuffers: false };
this.parsed = false;
this.raw = message;
this.data = msgBody;
this.bson = bson;
this.opts = opts;
// Read the message header
this.length = msgHeader.length;
this.requestId = msgHeader.requestId;
this.responseTo = msgHeader.responseTo;
this.opCode = msgHeader.opCode;
this.fromCompressed = msgHeader.fromCompressed;
// Read the message body
this.responseFlags = msgBody.readInt32LE(0);
this.cursorId = new Long(msgBody.readInt32LE(4), msgBody.readInt32LE(8));
this.startingFrom = msgBody.readInt32LE(12);
this.numberReturned = msgBody.readInt32LE(16);
// Preallocate document array
this.documents = new Array(this.numberReturned);
// Flag values
this.cursorNotFound = (this.responseFlags & CURSOR_NOT_FOUND) !== 0;
this.queryFailure = (this.responseFlags & QUERY_FAILURE) !== 0;
this.shardConfigStale = (this.responseFlags & SHARD_CONFIG_STALE) !== 0;
this.awaitCapable = (this.responseFlags & AWAIT_CAPABLE) !== 0;
this.promoteLongs = typeof opts.promoteLongs === 'boolean' ? opts.promoteLongs : true;
this.promoteValues = typeof opts.promoteValues === 'boolean' ? opts.promoteValues : true;
this.promoteBuffers = typeof opts.promoteBuffers === 'boolean' ? opts.promoteBuffers : false;
};
Response.prototype.isParsed = function() {
return this.parsed;
};
Response.prototype.parse = function(options) {
// Don't parse again if not needed
if (this.parsed) return;
options = options || {};
// Allow the return of raw documents instead of parsing
var raw = options.raw || false;
var documentsReturnedIn = options.documentsReturnedIn || null;
var promoteLongs =
typeof options.promoteLongs === 'boolean' ? options.promoteLongs : this.opts.promoteLongs;
var promoteValues =
typeof options.promoteValues === 'boolean' ? options.promoteValues : this.opts.promoteValues;
var promoteBuffers =
typeof options.promoteBuffers === 'boolean' ? options.promoteBuffers : this.opts.promoteBuffers;
var bsonSize, _options;
// Set up the options
_options = {
promoteLongs: promoteLongs,
promoteValues: promoteValues,
promoteBuffers: promoteBuffers
};
// Position within OP_REPLY at which documents start
// (See https://docs.mongodb.com/manual/reference/mongodb-wire-protocol/#wire-op-reply)
this.index = 20;
//
// Parse Body
//
for (var i = 0; i < this.numberReturned; i++) {
bsonSize =
this.data[this.index] |
(this.data[this.index + 1] << 8) |
(this.data[this.index + 2] << 16) |
(this.data[this.index + 3] << 24);
// If we have raw results specified slice the return document
if (raw) {
this.documents[i] = this.data.slice(this.index, this.index + bsonSize);
} else {
this.documents[i] = this.bson.deserialize(
this.data.slice(this.index, this.index + bsonSize),
_options
);
}
// Adjust the index
this.index = this.index + bsonSize;
}
if (this.documents.length === 1 && documentsReturnedIn != null && raw) {
const fieldsAsRaw = {};
fieldsAsRaw[documentsReturnedIn] = true;
_options.fieldsAsRaw = fieldsAsRaw;
const doc = this.bson.deserialize(this.documents[0], _options);
this.documents = [doc];
}
// Set parsed
this.parsed = true;
};
module.exports = {
Query: Query,
GetMore: GetMore,
Response: Response,
KillCursor: KillCursor
};

352
node_modules/mongodb/lib/core/connection/connect.js generated vendored Normal file
View File

@@ -0,0 +1,352 @@
'use strict';
const net = require('net');
const tls = require('tls');
const Connection = require('./connection');
const MongoError = require('../error').MongoError;
const MongoNetworkError = require('../error').MongoNetworkError;
const MongoNetworkTimeoutError = require('../error').MongoNetworkTimeoutError;
const defaultAuthProviders = require('../auth/defaultAuthProviders').defaultAuthProviders;
const AuthContext = require('../auth/auth_provider').AuthContext;
const WIRE_CONSTANTS = require('../wireprotocol/constants');
const makeClientMetadata = require('../utils').makeClientMetadata;
const MAX_SUPPORTED_WIRE_VERSION = WIRE_CONSTANTS.MAX_SUPPORTED_WIRE_VERSION;
const MAX_SUPPORTED_SERVER_VERSION = WIRE_CONSTANTS.MAX_SUPPORTED_SERVER_VERSION;
const MIN_SUPPORTED_WIRE_VERSION = WIRE_CONSTANTS.MIN_SUPPORTED_WIRE_VERSION;
const MIN_SUPPORTED_SERVER_VERSION = WIRE_CONSTANTS.MIN_SUPPORTED_SERVER_VERSION;
let AUTH_PROVIDERS;
function connect(options, cancellationToken, callback) {
if (typeof cancellationToken === 'function') {
callback = cancellationToken;
cancellationToken = undefined;
}
const ConnectionType = options && options.connectionType ? options.connectionType : Connection;
if (AUTH_PROVIDERS == null) {
AUTH_PROVIDERS = defaultAuthProviders(options.bson);
}
const family = options.family !== void 0 ? options.family : 0;
makeConnection(family, options, cancellationToken, (err, socket) => {
if (err) {
callback(err, socket); // in the error case, `socket` is the originating error event name
return;
}
performInitialHandshake(new ConnectionType(socket, options), options, callback);
});
}
function isModernConnectionType(conn) {
return !(conn instanceof Connection);
}
function checkSupportedServer(ismaster, options) {
const serverVersionHighEnough =
ismaster &&
typeof ismaster.maxWireVersion === 'number' &&
ismaster.maxWireVersion >= MIN_SUPPORTED_WIRE_VERSION;
const serverVersionLowEnough =
ismaster &&
typeof ismaster.minWireVersion === 'number' &&
ismaster.minWireVersion <= MAX_SUPPORTED_WIRE_VERSION;
if (serverVersionHighEnough) {
if (serverVersionLowEnough) {
return null;
}
const message = `Server at ${options.host}:${options.port} reports minimum wire version ${ismaster.minWireVersion}, but this version of the Node.js Driver requires at most ${MAX_SUPPORTED_WIRE_VERSION} (MongoDB ${MAX_SUPPORTED_SERVER_VERSION})`;
return new MongoError(message);
}
const message = `Server at ${options.host}:${
options.port
} reports maximum wire version ${ismaster.maxWireVersion ||
0}, but this version of the Node.js Driver requires at least ${MIN_SUPPORTED_WIRE_VERSION} (MongoDB ${MIN_SUPPORTED_SERVER_VERSION})`;
return new MongoError(message);
}
function performInitialHandshake(conn, options, _callback) {
const callback = function(err, ret) {
if (err && conn) {
conn.destroy();
}
_callback(err, ret);
};
const credentials = options.credentials;
if (credentials) {
if (!credentials.mechanism.match(/DEFAULT/i) && !AUTH_PROVIDERS[credentials.mechanism]) {
callback(new MongoError(`authMechanism '${credentials.mechanism}' not supported`));
return;
}
}
const authContext = new AuthContext(conn, credentials, options);
prepareHandshakeDocument(authContext, (err, handshakeDoc) => {
if (err) {
return callback(err);
}
const handshakeOptions = Object.assign({}, options);
if (options.connectTimeoutMS || options.connectionTimeout) {
// The handshake technically is a monitoring check, so its socket timeout should be connectTimeoutMS
handshakeOptions.socketTimeout = options.connectTimeoutMS || options.connectionTimeout;
}
const start = new Date().getTime();
conn.command('admin.$cmd', handshakeDoc, handshakeOptions, (err, result) => {
if (err) {
callback(err);
return;
}
const response = result.result;
if (response.ok === 0) {
callback(new MongoError(response));
return;
}
const supportedServerErr = checkSupportedServer(response, options);
if (supportedServerErr) {
callback(supportedServerErr);
return;
}
if (!isModernConnectionType(conn)) {
// resolve compression
if (response.compression) {
const agreedCompressors = handshakeDoc.compression.filter(
compressor => response.compression.indexOf(compressor) !== -1
);
if (agreedCompressors.length) {
conn.agreedCompressor = agreedCompressors[0];
}
if (options.compression && options.compression.zlibCompressionLevel) {
conn.zlibCompressionLevel = options.compression.zlibCompressionLevel;
}
}
}
// NOTE: This is metadata attached to the connection while porting away from
// handshake being done in the `Server` class. Likely, it should be
// relocated, or at very least restructured.
conn.ismaster = response;
conn.lastIsMasterMS = new Date().getTime() - start;
if (!response.arbiterOnly && credentials) {
// store the response on auth context
Object.assign(authContext, { response });
const resolvedCredentials = credentials.resolveAuthMechanism(response);
const authProvider = AUTH_PROVIDERS[resolvedCredentials.mechanism];
authProvider.auth(authContext, err => {
if (err) return callback(err);
callback(undefined, conn);
});
return;
}
callback(undefined, conn);
});
});
}
function prepareHandshakeDocument(authContext, callback) {
const options = authContext.options;
const compressors =
options.compression && options.compression.compressors ? options.compression.compressors : [];
const handshakeDoc = {
ismaster: true,
client: options.metadata || makeClientMetadata(options),
compression: compressors
};
const credentials = authContext.credentials;
if (credentials) {
if (credentials.mechanism.match(/DEFAULT/i) && credentials.username) {
Object.assign(handshakeDoc, {
saslSupportedMechs: `${credentials.source}.${credentials.username}`
});
AUTH_PROVIDERS['scram-sha-256'].prepare(handshakeDoc, authContext, callback);
return;
}
const authProvider = AUTH_PROVIDERS[credentials.mechanism];
authProvider.prepare(handshakeDoc, authContext, callback);
return;
}
callback(undefined, handshakeDoc);
}
const LEGAL_SSL_SOCKET_OPTIONS = [
'pfx',
'key',
'passphrase',
'cert',
'ca',
'ciphers',
'NPNProtocols',
'ALPNProtocols',
'servername',
'ecdhCurve',
'secureProtocol',
'secureContext',
'session',
'minDHSize',
'crl',
'rejectUnauthorized'
];
function parseConnectOptions(family, options) {
const host = typeof options.host === 'string' ? options.host : 'localhost';
if (host.indexOf('/') !== -1) {
return { path: host };
}
const result = {
family,
host,
port: typeof options.port === 'number' ? options.port : 27017,
rejectUnauthorized: false
};
return result;
}
function parseSslOptions(family, options) {
const result = parseConnectOptions(family, options);
// Merge in valid SSL options
for (const name in options) {
if (options[name] != null && LEGAL_SSL_SOCKET_OPTIONS.indexOf(name) !== -1) {
result[name] = options[name];
}
}
// Override checkServerIdentity behavior
if (options.checkServerIdentity === false) {
// Skip the identiy check by retuning undefined as per node documents
// https://nodejs.org/api/tls.html#tls_tls_connect_options_callback
result.checkServerIdentity = function() {
return undefined;
};
} else if (typeof options.checkServerIdentity === 'function') {
result.checkServerIdentity = options.checkServerIdentity;
}
// Set default sni servername to be the same as host
if (result.servername == null) {
result.servername = result.host;
}
return result;
}
const SOCKET_ERROR_EVENTS = new Set(['error', 'close', 'timeout', 'parseError']);
function makeConnection(family, options, cancellationToken, _callback) {
const useSsl = typeof options.ssl === 'boolean' ? options.ssl : false;
const keepAlive = typeof options.keepAlive === 'boolean' ? options.keepAlive : true;
let keepAliveInitialDelay =
typeof options.keepAliveInitialDelay === 'number' ? options.keepAliveInitialDelay : 120000;
const noDelay = typeof options.noDelay === 'boolean' ? options.noDelay : true;
const connectionTimeout =
typeof options.connectionTimeout === 'number'
? options.connectionTimeout
: typeof options.connectTimeoutMS === 'number'
? options.connectTimeoutMS
: 30000;
const socketTimeout = typeof options.socketTimeout === 'number' ? options.socketTimeout : 360000;
const rejectUnauthorized =
typeof options.rejectUnauthorized === 'boolean' ? options.rejectUnauthorized : true;
if (keepAliveInitialDelay > socketTimeout) {
keepAliveInitialDelay = Math.round(socketTimeout / 2);
}
let socket;
const callback = function(err, ret) {
if (err && socket) {
socket.destroy();
}
_callback(err, ret);
};
try {
if (useSsl) {
socket = tls.connect(parseSslOptions(family, options));
if (typeof socket.disableRenegotiation === 'function') {
socket.disableRenegotiation();
}
} else {
socket = net.createConnection(parseConnectOptions(family, options));
}
} catch (err) {
return callback(err);
}
socket.setKeepAlive(keepAlive, keepAliveInitialDelay);
socket.setTimeout(connectionTimeout);
socket.setNoDelay(noDelay);
const connectEvent = useSsl ? 'secureConnect' : 'connect';
let cancellationHandler;
function errorHandler(eventName) {
return err => {
SOCKET_ERROR_EVENTS.forEach(event => socket.removeAllListeners(event));
if (cancellationHandler) {
cancellationToken.removeListener('cancel', cancellationHandler);
}
socket.removeListener(connectEvent, connectHandler);
callback(connectionFailureError(eventName, err));
};
}
function connectHandler() {
SOCKET_ERROR_EVENTS.forEach(event => socket.removeAllListeners(event));
if (cancellationHandler) {
cancellationToken.removeListener('cancel', cancellationHandler);
}
if (socket.authorizationError && rejectUnauthorized) {
return callback(socket.authorizationError);
}
socket.setTimeout(socketTimeout);
callback(null, socket);
}
SOCKET_ERROR_EVENTS.forEach(event => socket.once(event, errorHandler(event)));
if (cancellationToken) {
cancellationHandler = errorHandler('cancel');
cancellationToken.once('cancel', cancellationHandler);
}
socket.once(connectEvent, connectHandler);
}
function connectionFailureError(type, err) {
switch (type) {
case 'error':
return new MongoNetworkError(err);
case 'timeout':
return new MongoNetworkTimeoutError(`connection timed out`);
case 'close':
return new MongoNetworkError(`connection closed`);
case 'cancel':
return new MongoNetworkError(`connection establishment was cancelled`);
default:
return new MongoNetworkError(`unknown network error`);
}
}
module.exports = connect;

712
node_modules/mongodb/lib/core/connection/connection.js generated vendored Normal file
View File

@@ -0,0 +1,712 @@
'use strict';
const EventEmitter = require('events').EventEmitter;
const crypto = require('crypto');
const debugOptions = require('./utils').debugOptions;
const parseHeader = require('../wireprotocol/shared').parseHeader;
const decompress = require('../wireprotocol/compression').decompress;
const Response = require('./commands').Response;
const BinMsg = require('./msg').BinMsg;
const MongoNetworkError = require('../error').MongoNetworkError;
const MongoNetworkTimeoutError = require('../error').MongoNetworkTimeoutError;
const MongoError = require('../error').MongoError;
const Logger = require('./logger');
const OP_COMPRESSED = require('../wireprotocol/shared').opcodes.OP_COMPRESSED;
const OP_MSG = require('../wireprotocol/shared').opcodes.OP_MSG;
const MESSAGE_HEADER_SIZE = require('../wireprotocol/shared').MESSAGE_HEADER_SIZE;
const Buffer = require('safe-buffer').Buffer;
const Query = require('./commands').Query;
const CommandResult = require('./command_result');
let _id = 0;
const DEFAULT_MAX_BSON_MESSAGE_SIZE = 1024 * 1024 * 16 * 4;
const DEBUG_FIELDS = [
'host',
'port',
'size',
'keepAlive',
'keepAliveInitialDelay',
'noDelay',
'connectionTimeout',
'socketTimeout',
'ssl',
'ca',
'crl',
'cert',
'rejectUnauthorized',
'promoteLongs',
'promoteValues',
'promoteBuffers',
'checkServerIdentity'
];
let connectionAccountingSpy = undefined;
let connectionAccounting = false;
let connections = {};
/**
* A class representing a single connection to a MongoDB server
*
* @fires Connection#connect
* @fires Connection#close
* @fires Connection#error
* @fires Connection#timeout
* @fires Connection#parseError
* @fires Connection#message
*/
class Connection extends EventEmitter {
/**
* Creates a new Connection instance
*
* **NOTE**: Internal class, do not instantiate directly
*
* @param {Socket} socket The socket this connection wraps
* @param {Object} options Various settings
* @param {object} options.bson An implementation of bson serialize and deserialize
* @param {string} [options.host='localhost'] The host the socket is connected to
* @param {number} [options.port=27017] The port used for the socket connection
* @param {boolean} [options.keepAlive=true] TCP Connection keep alive enabled
* @param {number} [options.keepAliveInitialDelay=120000] Initial delay before TCP keep alive enabled
* @param {number} [options.connectionTimeout=30000] TCP Connection timeout setting
* @param {number} [options.socketTimeout=360000] TCP Socket timeout setting
* @param {boolean} [options.promoteLongs] Convert Long values from the db into Numbers if they fit into 53 bits
* @param {boolean} [options.promoteValues] Promotes BSON values to native types where possible, set to false to only receive wrapper types.
* @param {boolean} [options.promoteBuffers] Promotes Binary BSON values to native Node Buffers.
* @param {number} [options.maxBsonMessageSize=0x4000000] Largest possible size of a BSON message (for legacy purposes)
*/
constructor(socket, options) {
super();
options = options || {};
if (!options.bson) {
throw new TypeError('must pass in valid bson parser');
}
this.id = _id++;
this.options = options;
this.logger = Logger('Connection', options);
this.bson = options.bson;
this.tag = options.tag;
this.maxBsonMessageSize = options.maxBsonMessageSize || DEFAULT_MAX_BSON_MESSAGE_SIZE;
this.port = options.port || 27017;
this.host = options.host || 'localhost';
this.socketTimeout = typeof options.socketTimeout === 'number' ? options.socketTimeout : 360000;
// These values are inspected directly in tests, but maybe not necessary to keep around
this.keepAlive = typeof options.keepAlive === 'boolean' ? options.keepAlive : true;
this.keepAliveInitialDelay =
typeof options.keepAliveInitialDelay === 'number' ? options.keepAliveInitialDelay : 120000;
this.connectionTimeout =
typeof options.connectionTimeout === 'number' ? options.connectionTimeout : 30000;
if (this.keepAliveInitialDelay > this.socketTimeout) {
this.keepAliveInitialDelay = Math.round(this.socketTimeout / 2);
}
// Debug information
if (this.logger.isDebug()) {
this.logger.debug(
`creating connection ${this.id} with options [${JSON.stringify(
debugOptions(DEBUG_FIELDS, options)
)}]`
);
}
// Response options
this.responseOptions = {
promoteLongs: typeof options.promoteLongs === 'boolean' ? options.promoteLongs : true,
promoteValues: typeof options.promoteValues === 'boolean' ? options.promoteValues : true,
promoteBuffers: typeof options.promoteBuffers === 'boolean' ? options.promoteBuffers : false
};
// Flushing
this.flushing = false;
this.queue = [];
// Internal state
this.writeStream = null;
this.destroyed = false;
this.timedOut = false;
// Create hash method
const hash = crypto.createHash('sha1');
hash.update(this.address);
this.hashedName = hash.digest('hex');
// All operations in flight on the connection
this.workItems = [];
// setup socket
this.socket = socket;
this.socket.once('error', errorHandler(this));
this.socket.once('timeout', timeoutHandler(this));
this.socket.once('close', closeHandler(this));
this.socket.on('data', dataHandler(this));
if (connectionAccounting) {
addConnection(this.id, this);
}
}
setSocketTimeout(value) {
if (this.socket) {
this.socket.setTimeout(value);
}
}
resetSocketTimeout() {
if (this.socket) {
this.socket.setTimeout(this.socketTimeout);
}
}
static enableConnectionAccounting(spy) {
if (spy) {
connectionAccountingSpy = spy;
}
connectionAccounting = true;
connections = {};
}
static disableConnectionAccounting() {
connectionAccounting = false;
connectionAccountingSpy = undefined;
}
static connections() {
return connections;
}
get address() {
return `${this.host}:${this.port}`;
}
/**
* Unref this connection
* @method
* @return {boolean}
*/
unref() {
if (this.socket == null) {
this.once('connect', () => this.socket.unref());
return;
}
this.socket.unref();
}
/**
* Flush all work Items on this connection
*
* @param {*} err The error to propagate to the flushed work items
*/
flush(err) {
while (this.workItems.length > 0) {
const workItem = this.workItems.shift();
if (workItem.cb) {
workItem.cb(err);
}
}
}
/**
* Destroy connection
* @method
*/
destroy(options, callback) {
if (typeof options === 'function') {
callback = options;
options = {};
}
options = Object.assign({ force: false }, options);
if (connectionAccounting) {
deleteConnection(this.id);
}
if (this.socket == null) {
this.destroyed = true;
return;
}
if (options.force || this.timedOut) {
this.socket.destroy();
this.destroyed = true;
if (typeof callback === 'function') callback(null, null);
return;
}
this.socket.end(err => {
this.destroyed = true;
if (typeof callback === 'function') callback(err, null);
});
}
/**
* Write to connection
* @method
* @param {Command} command Command to write out need to implement toBin and toBinUnified
*/
write(buffer) {
// Debug Log
if (this.logger.isDebug()) {
if (!Array.isArray(buffer)) {
this.logger.debug(`writing buffer [${buffer.toString('hex')}] to ${this.address}`);
} else {
for (let i = 0; i < buffer.length; i++)
this.logger.debug(`writing buffer [${buffer[i].toString('hex')}] to ${this.address}`);
}
}
// Double check that the connection is not destroyed
if (this.socket.destroyed === false) {
// Write out the command
if (!Array.isArray(buffer)) {
this.socket.write(buffer, 'binary');
return true;
}
// Iterate over all buffers and write them in order to the socket
for (let i = 0; i < buffer.length; i++) {
this.socket.write(buffer[i], 'binary');
}
return true;
}
// Connection is destroyed return write failed
return false;
}
/**
* Return id of connection as a string
* @method
* @return {string}
*/
toString() {
return '' + this.id;
}
/**
* Return json object of connection
* @method
* @return {object}
*/
toJSON() {
return { id: this.id, host: this.host, port: this.port };
}
/**
* Is the connection connected
* @method
* @return {boolean}
*/
isConnected() {
if (this.destroyed) return false;
return !this.socket.destroyed && this.socket.writable;
}
/**
* @ignore
*/
command(ns, command, options, callback) {
if (typeof options === 'function') (callback = options), (options = {});
const conn = this;
const socketTimeout =
typeof options.socketTimeout === 'number' ? options.socketTimeout : 360000;
const bson = conn.options.bson;
const query = new Query(bson, ns, command, {
numberToSkip: 0,
numberToReturn: 1
});
const noop = () => {};
function _callback(err, result) {
callback(err, result);
callback = noop;
}
function errorHandler(err) {
conn.resetSocketTimeout();
CONNECTION_ERROR_EVENTS.forEach(eventName => conn.removeListener(eventName, errorHandler));
conn.removeListener('message', messageHandler);
if (err == null) {
err = new MongoError(`runCommand failed for connection to '${conn.address}'`);
}
// ignore all future errors
conn.on('error', noop);
_callback(err);
}
function messageHandler(msg) {
if (msg.responseTo !== query.requestId) {
return;
}
conn.resetSocketTimeout();
CONNECTION_ERROR_EVENTS.forEach(eventName => conn.removeListener(eventName, errorHandler));
conn.removeListener('message', messageHandler);
msg.parse({ promoteValues: true });
const response = msg.documents[0];
if (response.ok === 0 || response.$err || response.errmsg || response.code) {
_callback(new MongoError(response));
return;
}
_callback(undefined, new CommandResult(response, this, msg));
}
conn.setSocketTimeout(socketTimeout);
CONNECTION_ERROR_EVENTS.forEach(eventName => conn.once(eventName, errorHandler));
conn.on('message', messageHandler);
conn.write(query.toBin());
}
}
const CONNECTION_ERROR_EVENTS = ['error', 'close', 'timeout', 'parseError'];
function deleteConnection(id) {
// console.log("=== deleted connection " + id + " :: " + (connections[id] ? connections[id].port : ''))
delete connections[id];
if (connectionAccountingSpy) {
connectionAccountingSpy.deleteConnection(id);
}
}
function addConnection(id, connection) {
// console.log("=== added connection " + id + " :: " + connection.port)
connections[id] = connection;
if (connectionAccountingSpy) {
connectionAccountingSpy.addConnection(id, connection);
}
}
//
// Connection handlers
function errorHandler(conn) {
return function(err) {
if (connectionAccounting) deleteConnection(conn.id);
// Debug information
if (conn.logger.isDebug()) {
conn.logger.debug(
`connection ${conn.id} for [${conn.address}] errored out with [${JSON.stringify(err)}]`
);
}
conn.emit('error', new MongoNetworkError(err), conn);
};
}
function timeoutHandler(conn) {
return function() {
if (connectionAccounting) deleteConnection(conn.id);
if (conn.logger.isDebug()) {
conn.logger.debug(`connection ${conn.id} for [${conn.address}] timed out`);
}
conn.timedOut = true;
conn.emit(
'timeout',
new MongoNetworkTimeoutError(`connection ${conn.id} to ${conn.address} timed out`, {
beforeHandshake: conn.ismaster == null
}),
conn
);
};
}
function closeHandler(conn) {
return function(hadError) {
if (connectionAccounting) deleteConnection(conn.id);
if (conn.logger.isDebug()) {
conn.logger.debug(`connection ${conn.id} with for [${conn.address}] closed`);
}
if (!hadError) {
conn.emit(
'close',
new MongoNetworkError(`connection ${conn.id} to ${conn.address} closed`),
conn
);
}
};
}
// Handle a message once it is received
function processMessage(conn, message) {
const msgHeader = parseHeader(message);
if (msgHeader.opCode !== OP_COMPRESSED) {
const ResponseConstructor = msgHeader.opCode === OP_MSG ? BinMsg : Response;
conn.emit(
'message',
new ResponseConstructor(
conn.bson,
message,
msgHeader,
message.slice(MESSAGE_HEADER_SIZE),
conn.responseOptions
),
conn
);
return;
}
msgHeader.fromCompressed = true;
let index = MESSAGE_HEADER_SIZE;
msgHeader.opCode = message.readInt32LE(index);
index += 4;
msgHeader.length = message.readInt32LE(index);
index += 4;
const compressorID = message[index];
index++;
decompress(compressorID, message.slice(index), (err, decompressedMsgBody) => {
if (err) {
conn.emit('error', err);
return;
}
if (decompressedMsgBody.length !== msgHeader.length) {
conn.emit(
'error',
new MongoError(
'Decompressing a compressed message from the server failed. The message is corrupt.'
)
);
return;
}
const ResponseConstructor = msgHeader.opCode === OP_MSG ? BinMsg : Response;
conn.emit(
'message',
new ResponseConstructor(
conn.bson,
message,
msgHeader,
decompressedMsgBody,
conn.responseOptions
),
conn
);
});
}
function dataHandler(conn) {
return function(data) {
// Parse until we are done with the data
while (data.length > 0) {
// If we still have bytes to read on the current message
if (conn.bytesRead > 0 && conn.sizeOfMessage > 0) {
// Calculate the amount of remaining bytes
const remainingBytesToRead = conn.sizeOfMessage - conn.bytesRead;
// Check if the current chunk contains the rest of the message
if (remainingBytesToRead > data.length) {
// Copy the new data into the exiting buffer (should have been allocated when we know the message size)
data.copy(conn.buffer, conn.bytesRead);
// Adjust the number of bytes read so it point to the correct index in the buffer
conn.bytesRead = conn.bytesRead + data.length;
// Reset state of buffer
data = Buffer.alloc(0);
} else {
// Copy the missing part of the data into our current buffer
data.copy(conn.buffer, conn.bytesRead, 0, remainingBytesToRead);
// Slice the overflow into a new buffer that we will then re-parse
data = data.slice(remainingBytesToRead);
// Emit current complete message
const emitBuffer = conn.buffer;
// Reset state of buffer
conn.buffer = null;
conn.sizeOfMessage = 0;
conn.bytesRead = 0;
conn.stubBuffer = null;
processMessage(conn, emitBuffer);
}
} else {
// Stub buffer is kept in case we don't get enough bytes to determine the
// size of the message (< 4 bytes)
if (conn.stubBuffer != null && conn.stubBuffer.length > 0) {
// If we have enough bytes to determine the message size let's do it
if (conn.stubBuffer.length + data.length > 4) {
// Prepad the data
const newData = Buffer.alloc(conn.stubBuffer.length + data.length);
conn.stubBuffer.copy(newData, 0);
data.copy(newData, conn.stubBuffer.length);
// Reassign for parsing
data = newData;
// Reset state of buffer
conn.buffer = null;
conn.sizeOfMessage = 0;
conn.bytesRead = 0;
conn.stubBuffer = null;
} else {
// Add the the bytes to the stub buffer
const newStubBuffer = Buffer.alloc(conn.stubBuffer.length + data.length);
// Copy existing stub buffer
conn.stubBuffer.copy(newStubBuffer, 0);
// Copy missing part of the data
data.copy(newStubBuffer, conn.stubBuffer.length);
// Exit parsing loop
data = Buffer.alloc(0);
}
} else {
if (data.length > 4) {
// Retrieve the message size
const sizeOfMessage = data[0] | (data[1] << 8) | (data[2] << 16) | (data[3] << 24);
// If we have a negative sizeOfMessage emit error and return
if (sizeOfMessage < 0 || sizeOfMessage > conn.maxBsonMessageSize) {
const errorObject = {
err: 'socketHandler',
trace: '',
bin: conn.buffer,
parseState: {
sizeOfMessage: sizeOfMessage,
bytesRead: conn.bytesRead,
stubBuffer: conn.stubBuffer
}
};
// We got a parse Error fire it off then keep going
conn.emit('parseError', errorObject, conn);
return;
}
// Ensure that the size of message is larger than 0 and less than the max allowed
if (
sizeOfMessage > 4 &&
sizeOfMessage < conn.maxBsonMessageSize &&
sizeOfMessage > data.length
) {
conn.buffer = Buffer.alloc(sizeOfMessage);
// Copy all the data into the buffer
data.copy(conn.buffer, 0);
// Update bytes read
conn.bytesRead = data.length;
// Update sizeOfMessage
conn.sizeOfMessage = sizeOfMessage;
// Ensure stub buffer is null
conn.stubBuffer = null;
// Exit parsing loop
data = Buffer.alloc(0);
} else if (
sizeOfMessage > 4 &&
sizeOfMessage < conn.maxBsonMessageSize &&
sizeOfMessage === data.length
) {
const emitBuffer = data;
// Reset state of buffer
conn.buffer = null;
conn.sizeOfMessage = 0;
conn.bytesRead = 0;
conn.stubBuffer = null;
// Exit parsing loop
data = Buffer.alloc(0);
// Emit the message
processMessage(conn, emitBuffer);
} else if (sizeOfMessage <= 4 || sizeOfMessage > conn.maxBsonMessageSize) {
const errorObject = {
err: 'socketHandler',
trace: null,
bin: data,
parseState: {
sizeOfMessage: sizeOfMessage,
bytesRead: 0,
buffer: null,
stubBuffer: null
}
};
// We got a parse Error fire it off then keep going
conn.emit('parseError', errorObject, conn);
// Clear out the state of the parser
conn.buffer = null;
conn.sizeOfMessage = 0;
conn.bytesRead = 0;
conn.stubBuffer = null;
// Exit parsing loop
data = Buffer.alloc(0);
} else {
const emitBuffer = data.slice(0, sizeOfMessage);
// Reset state of buffer
conn.buffer = null;
conn.sizeOfMessage = 0;
conn.bytesRead = 0;
conn.stubBuffer = null;
// Copy rest of message
data = data.slice(sizeOfMessage);
// Emit the message
processMessage(conn, emitBuffer);
}
} else {
// Create a buffer that contains the space for the non-complete message
conn.stubBuffer = Buffer.alloc(data.length);
// Copy the data to the stub buffer
data.copy(conn.stubBuffer, 0);
// Exit parsing loop
data = Buffer.alloc(0);
}
}
}
}
};
}
/**
* A server connect event, used to verify that the connection is up and running
*
* @event Connection#connect
* @type {Connection}
*/
/**
* The server connection closed, all pool connections closed
*
* @event Connection#close
* @type {Connection}
*/
/**
* The server connection caused an error, all pool connections closed
*
* @event Connection#error
* @type {Connection}
*/
/**
* The server connection timed out, all pool connections closed
*
* @event Connection#timeout
* @type {Connection}
*/
/**
* The driver experienced an invalid message, all pool connections closed
*
* @event Connection#parseError
* @type {Connection}
*/
/**
* An event emitted each time the connection receives a parsed message from the wire
*
* @event Connection#message
* @type {Connection}
*/
module.exports = Connection;

251
node_modules/mongodb/lib/core/connection/logger.js generated vendored Normal file
View File

@@ -0,0 +1,251 @@
'use strict';
var f = require('util').format,
MongoError = require('../error').MongoError;
// Filters for classes
var classFilters = {};
var filteredClasses = {};
var level = null;
// Save the process id
var pid = process.pid;
// current logger
var currentLogger = null;
/**
* @callback Logger~loggerCallback
* @param {string} msg message being logged
* @param {object} state an object containing more metadata about the logging message
*/
/**
* Creates a new Logger instance
* @class
* @param {string} className The Class name associated with the logging instance
* @param {object} [options=null] Optional settings.
* @param {Logger~loggerCallback} [options.logger=null] Custom logger function;
* @param {string} [options.loggerLevel=error] Override default global log level.
*/
var Logger = function(className, options) {
if (!(this instanceof Logger)) return new Logger(className, options);
options = options || {};
// Current reference
this.className = className;
// Current logger
if (options.logger) {
currentLogger = options.logger;
} else if (currentLogger == null) {
currentLogger = console.log;
}
// Set level of logging, default is error
if (options.loggerLevel) {
level = options.loggerLevel || 'error';
}
// Add all class names
if (filteredClasses[this.className] == null) classFilters[this.className] = true;
};
/**
* Log a message at the debug level
* @method
* @param {string} message The message to log
* @param {object} object additional meta data to log
* @return {null}
*/
Logger.prototype.debug = function(message, object) {
if (
this.isDebug() &&
((Object.keys(filteredClasses).length > 0 && filteredClasses[this.className]) ||
(Object.keys(filteredClasses).length === 0 && classFilters[this.className]))
) {
var dateTime = new Date().getTime();
var msg = f('[%s-%s:%s] %s %s', 'DEBUG', this.className, pid, dateTime, message);
var state = {
type: 'debug',
message: message,
className: this.className,
pid: pid,
date: dateTime
};
if (object) state.meta = object;
currentLogger(msg, state);
}
};
/**
* Log a message at the warn level
* @method
* @param {string} message The message to log
* @param {object} object additional meta data to log
* @return {null}
*/
(Logger.prototype.warn = function(message, object) {
if (
this.isWarn() &&
((Object.keys(filteredClasses).length > 0 && filteredClasses[this.className]) ||
(Object.keys(filteredClasses).length === 0 && classFilters[this.className]))
) {
var dateTime = new Date().getTime();
var msg = f('[%s-%s:%s] %s %s', 'WARN', this.className, pid, dateTime, message);
var state = {
type: 'warn',
message: message,
className: this.className,
pid: pid,
date: dateTime
};
if (object) state.meta = object;
currentLogger(msg, state);
}
}),
/**
* Log a message at the info level
* @method
* @param {string} message The message to log
* @param {object} object additional meta data to log
* @return {null}
*/
(Logger.prototype.info = function(message, object) {
if (
this.isInfo() &&
((Object.keys(filteredClasses).length > 0 && filteredClasses[this.className]) ||
(Object.keys(filteredClasses).length === 0 && classFilters[this.className]))
) {
var dateTime = new Date().getTime();
var msg = f('[%s-%s:%s] %s %s', 'INFO', this.className, pid, dateTime, message);
var state = {
type: 'info',
message: message,
className: this.className,
pid: pid,
date: dateTime
};
if (object) state.meta = object;
currentLogger(msg, state);
}
}),
/**
* Log a message at the error level
* @method
* @param {string} message The message to log
* @param {object} object additional meta data to log
* @return {null}
*/
(Logger.prototype.error = function(message, object) {
if (
this.isError() &&
((Object.keys(filteredClasses).length > 0 && filteredClasses[this.className]) ||
(Object.keys(filteredClasses).length === 0 && classFilters[this.className]))
) {
var dateTime = new Date().getTime();
var msg = f('[%s-%s:%s] %s %s', 'ERROR', this.className, pid, dateTime, message);
var state = {
type: 'error',
message: message,
className: this.className,
pid: pid,
date: dateTime
};
if (object) state.meta = object;
currentLogger(msg, state);
}
}),
/**
* Is the logger set at info level
* @method
* @return {boolean}
*/
(Logger.prototype.isInfo = function() {
return level === 'info' || level === 'debug';
}),
/**
* Is the logger set at error level
* @method
* @return {boolean}
*/
(Logger.prototype.isError = function() {
return level === 'error' || level === 'info' || level === 'debug';
}),
/**
* Is the logger set at error level
* @method
* @return {boolean}
*/
(Logger.prototype.isWarn = function() {
return level === 'error' || level === 'warn' || level === 'info' || level === 'debug';
}),
/**
* Is the logger set at debug level
* @method
* @return {boolean}
*/
(Logger.prototype.isDebug = function() {
return level === 'debug';
});
/**
* Resets the logger to default settings, error and no filtered classes
* @method
* @return {null}
*/
Logger.reset = function() {
level = 'error';
filteredClasses = {};
};
/**
* Get the current logger function
* @method
* @return {Logger~loggerCallback}
*/
Logger.currentLogger = function() {
return currentLogger;
};
/**
* Set the current logger function
* @method
* @param {Logger~loggerCallback} logger Logger function.
* @return {null}
*/
Logger.setCurrentLogger = function(logger) {
if (typeof logger !== 'function') throw new MongoError('current logger must be a function');
currentLogger = logger;
};
/**
* Set what classes to log.
* @method
* @param {string} type The type of filter (currently only class)
* @param {string[]} values The filters to apply
* @return {null}
*/
Logger.filter = function(type, values) {
if (type === 'class' && Array.isArray(values)) {
filteredClasses = {};
values.forEach(function(x) {
filteredClasses[x] = true;
});
}
};
/**
* Set the current log level
* @method
* @param {string} level Set current log level (debug, info, error)
* @return {null}
*/
Logger.setLevel = function(_level) {
if (_level !== 'info' && _level !== 'error' && _level !== 'debug' && _level !== 'warn') {
throw new Error(f('%s is an illegal logging level', _level));
}
level = _level;
};
module.exports = Logger;

222
node_modules/mongodb/lib/core/connection/msg.js generated vendored Normal file
View File

@@ -0,0 +1,222 @@
'use strict';
// Implementation of OP_MSG spec:
// https://github.com/mongodb/specifications/blob/master/source/message/OP_MSG.rst
//
// struct Section {
// uint8 payloadType;
// union payload {
// document document; // payloadType == 0
// struct sequence { // payloadType == 1
// int32 size;
// cstring identifier;
// document* documents;
// };
// };
// };
// struct OP_MSG {
// struct MsgHeader {
// int32 messageLength;
// int32 requestID;
// int32 responseTo;
// int32 opCode = 2013;
// };
// uint32 flagBits;
// Section+ sections;
// [uint32 checksum;]
// };
const Buffer = require('safe-buffer').Buffer;
const opcodes = require('../wireprotocol/shared').opcodes;
const databaseNamespace = require('../wireprotocol/shared').databaseNamespace;
const ReadPreference = require('../topologies/read_preference');
// Incrementing request id
let _requestId = 0;
// Msg Flags
const OPTS_CHECKSUM_PRESENT = 1;
const OPTS_MORE_TO_COME = 2;
const OPTS_EXHAUST_ALLOWED = 1 << 16;
class Msg {
constructor(bson, ns, command, options) {
// Basic options needed to be passed in
if (command == null) throw new Error('query must be specified for query');
// Basic options
this.bson = bson;
this.ns = ns;
this.command = command;
this.command.$db = databaseNamespace(ns);
if (options.readPreference && options.readPreference.mode !== ReadPreference.PRIMARY) {
this.command.$readPreference = options.readPreference.toJSON();
}
// Ensure empty options
this.options = options || {};
// Additional options
this.requestId = options.requestId ? options.requestId : Msg.getRequestId();
// Serialization option
this.serializeFunctions =
typeof options.serializeFunctions === 'boolean' ? options.serializeFunctions : false;
this.ignoreUndefined =
typeof options.ignoreUndefined === 'boolean' ? options.ignoreUndefined : false;
this.checkKeys = typeof options.checkKeys === 'boolean' ? options.checkKeys : false;
this.maxBsonSize = options.maxBsonSize || 1024 * 1024 * 16;
// flags
this.checksumPresent = false;
this.moreToCome = options.moreToCome || false;
this.exhaustAllowed =
typeof options.exhaustAllowed === 'boolean' ? options.exhaustAllowed : false;
}
toBin() {
const buffers = [];
let flags = 0;
if (this.checksumPresent) {
flags |= OPTS_CHECKSUM_PRESENT;
}
if (this.moreToCome) {
flags |= OPTS_MORE_TO_COME;
}
if (this.exhaustAllowed) {
flags |= OPTS_EXHAUST_ALLOWED;
}
const header = Buffer.alloc(
4 * 4 + // Header
4 // Flags
);
buffers.push(header);
let totalLength = header.length;
const command = this.command;
totalLength += this.makeDocumentSegment(buffers, command);
header.writeInt32LE(totalLength, 0); // messageLength
header.writeInt32LE(this.requestId, 4); // requestID
header.writeInt32LE(0, 8); // responseTo
header.writeInt32LE(opcodes.OP_MSG, 12); // opCode
header.writeUInt32LE(flags, 16); // flags
return buffers;
}
makeDocumentSegment(buffers, document) {
const payloadTypeBuffer = Buffer.alloc(1);
payloadTypeBuffer[0] = 0;
const documentBuffer = this.serializeBson(document);
buffers.push(payloadTypeBuffer);
buffers.push(documentBuffer);
return payloadTypeBuffer.length + documentBuffer.length;
}
serializeBson(document) {
return this.bson.serialize(document, {
checkKeys: this.checkKeys,
serializeFunctions: this.serializeFunctions,
ignoreUndefined: this.ignoreUndefined
});
}
}
Msg.getRequestId = function() {
_requestId = (_requestId + 1) & 0x7fffffff;
return _requestId;
};
class BinMsg {
constructor(bson, message, msgHeader, msgBody, opts) {
opts = opts || { promoteLongs: true, promoteValues: true, promoteBuffers: false };
this.parsed = false;
this.raw = message;
this.data = msgBody;
this.bson = bson;
this.opts = opts;
// Read the message header
this.length = msgHeader.length;
this.requestId = msgHeader.requestId;
this.responseTo = msgHeader.responseTo;
this.opCode = msgHeader.opCode;
this.fromCompressed = msgHeader.fromCompressed;
// Read response flags
this.responseFlags = msgBody.readInt32LE(0);
this.checksumPresent = (this.responseFlags & OPTS_CHECKSUM_PRESENT) !== 0;
this.moreToCome = (this.responseFlags & OPTS_MORE_TO_COME) !== 0;
this.exhaustAllowed = (this.responseFlags & OPTS_EXHAUST_ALLOWED) !== 0;
this.promoteLongs = typeof opts.promoteLongs === 'boolean' ? opts.promoteLongs : true;
this.promoteValues = typeof opts.promoteValues === 'boolean' ? opts.promoteValues : true;
this.promoteBuffers = typeof opts.promoteBuffers === 'boolean' ? opts.promoteBuffers : false;
this.documents = [];
}
isParsed() {
return this.parsed;
}
parse(options) {
// Don't parse again if not needed
if (this.parsed) return;
options = options || {};
this.index = 4;
// Allow the return of raw documents instead of parsing
const raw = options.raw || false;
const documentsReturnedIn = options.documentsReturnedIn || null;
const promoteLongs =
typeof options.promoteLongs === 'boolean' ? options.promoteLongs : this.opts.promoteLongs;
const promoteValues =
typeof options.promoteValues === 'boolean' ? options.promoteValues : this.opts.promoteValues;
const promoteBuffers =
typeof options.promoteBuffers === 'boolean'
? options.promoteBuffers
: this.opts.promoteBuffers;
// Set up the options
const _options = {
promoteLongs: promoteLongs,
promoteValues: promoteValues,
promoteBuffers: promoteBuffers
};
while (this.index < this.data.length) {
const payloadType = this.data.readUInt8(this.index++);
if (payloadType === 1) {
console.error('TYPE 1');
} else if (payloadType === 0) {
const bsonSize = this.data.readUInt32LE(this.index);
const bin = this.data.slice(this.index, this.index + bsonSize);
this.documents.push(raw ? bin : this.bson.deserialize(bin, _options));
this.index += bsonSize;
}
}
if (this.documents.length === 1 && documentsReturnedIn != null && raw) {
const fieldsAsRaw = {};
fieldsAsRaw[documentsReturnedIn] = true;
_options.fieldsAsRaw = fieldsAsRaw;
const doc = this.bson.deserialize(this.documents[0], _options);
this.documents = [doc];
}
this.parsed = true;
}
}
module.exports = { Msg, BinMsg };

1281
node_modules/mongodb/lib/core/connection/pool.js generated vendored Normal file

File diff suppressed because it is too large Load Diff

57
node_modules/mongodb/lib/core/connection/utils.js generated vendored Normal file
View File

@@ -0,0 +1,57 @@
'use strict';
const require_optional = require('require_optional');
function debugOptions(debugFields, options) {
var finaloptions = {};
debugFields.forEach(function(n) {
finaloptions[n] = options[n];
});
return finaloptions;
}
function retrieveBSON() {
var BSON = require('bson');
BSON.native = false;
try {
var optionalBSON = require_optional('bson-ext');
if (optionalBSON) {
optionalBSON.native = true;
return optionalBSON;
}
} catch (err) {} // eslint-disable-line
return BSON;
}
// Throw an error if an attempt to use Snappy is made when Snappy is not installed
function noSnappyWarning() {
throw new Error(
'Attempted to use Snappy compression, but Snappy is not installed. Install or disable Snappy compression and try again.'
);
}
// Facilitate loading Snappy optionally
function retrieveSnappy() {
var snappy = null;
try {
snappy = require_optional('snappy');
} catch (error) {} // eslint-disable-line
if (!snappy) {
snappy = {
compress: noSnappyWarning,
uncompress: noSnappyWarning,
compressSync: noSnappyWarning,
uncompressSync: noSnappyWarning
};
}
return snappy;
}
module.exports = {
debugOptions,
retrieveBSON,
retrieveSnappy
};

871
node_modules/mongodb/lib/core/cursor.js generated vendored Normal file
View File

@@ -0,0 +1,871 @@
'use strict';
const Logger = require('./connection/logger');
const retrieveBSON = require('./connection/utils').retrieveBSON;
const MongoError = require('./error').MongoError;
const MongoNetworkError = require('./error').MongoNetworkError;
const collationNotSupported = require('./utils').collationNotSupported;
const ReadPreference = require('./topologies/read_preference');
const isUnifiedTopology = require('./utils').isUnifiedTopology;
const executeOperation = require('../operations/execute_operation');
const Readable = require('stream').Readable;
const SUPPORTS = require('../utils').SUPPORTS;
const MongoDBNamespace = require('../utils').MongoDBNamespace;
const OperationBase = require('../operations/operation').OperationBase;
const BSON = retrieveBSON();
const Long = BSON.Long;
// Possible states for a cursor
const CursorState = {
INIT: 0,
OPEN: 1,
CLOSED: 2,
GET_MORE: 3
};
//
// Handle callback (including any exceptions thrown)
function handleCallback(callback, err, result) {
try {
callback(err, result);
} catch (err) {
process.nextTick(function() {
throw err;
});
}
}
/**
* This is a cursor results callback
*
* @callback resultCallback
* @param {error} error An error object. Set to null if no error present
* @param {object} document
*/
/**
* @fileOverview The **Cursor** class is an internal class that embodies a cursor on MongoDB
* allowing for iteration over the results returned from the underlying query.
*
* **CURSORS Cannot directly be instantiated**
*/
/**
* The core cursor class. All cursors in the driver build off of this one.
*
* @property {number} cursorBatchSize The current cursorBatchSize for the cursor
* @property {number} cursorLimit The current cursorLimit for the cursor
* @property {number} cursorSkip The current cursorSkip for the cursor
*/
class CoreCursor extends Readable {
/**
* Create a new core `Cursor` instance.
* **NOTE** Not to be instantiated directly
*
* @param {object} topology The server topology instance.
* @param {string} ns The MongoDB fully qualified namespace (ex: db1.collection1)
* @param {{object}|Long} cmd The selector (can be a command or a cursorId)
* @param {object} [options=null] Optional settings.
* @param {object} [options.batchSize=1000] The number of documents to return per batch. See {@link https://docs.mongodb.com/manual/reference/command/find/| find command documentation} and {@link https://docs.mongodb.com/manual/reference/command/aggregate|aggregation documentation}.
* @param {array} [options.documents=[]] Initial documents list for cursor
* @param {object} [options.transforms=null] Transform methods for the cursor results
* @param {function} [options.transforms.query] Transform the value returned from the initial query
* @param {function} [options.transforms.doc] Transform each document returned from Cursor.prototype._next
*/
constructor(topology, ns, cmd, options) {
super({ objectMode: true });
options = options || {};
if (ns instanceof OperationBase) {
this.operation = ns;
ns = this.operation.ns.toString();
options = this.operation.options;
cmd = this.operation.cmd ? this.operation.cmd : {};
}
// Cursor pool
this.pool = null;
// Cursor server
this.server = null;
// Do we have a not connected handler
this.disconnectHandler = options.disconnectHandler;
// Set local values
this.bson = topology.s.bson;
this.ns = ns;
this.namespace = MongoDBNamespace.fromString(ns);
this.cmd = cmd;
this.options = options;
this.topology = topology;
// All internal state
this.cursorState = {
cursorId: null,
cmd,
documents: options.documents || [],
cursorIndex: 0,
dead: false,
killed: false,
init: false,
notified: false,
limit: options.limit || cmd.limit || 0,
skip: options.skip || cmd.skip || 0,
batchSize: options.batchSize || cmd.batchSize || 1000,
currentLimit: 0,
// Result field name if not a cursor (contains the array of results)
transforms: options.transforms,
raw: options.raw || (cmd && cmd.raw)
};
if (typeof options.session === 'object') {
this.cursorState.session = options.session;
}
// Add promoteLong to cursor state
const topologyOptions = topology.s.options;
if (typeof topologyOptions.promoteLongs === 'boolean') {
this.cursorState.promoteLongs = topologyOptions.promoteLongs;
} else if (typeof options.promoteLongs === 'boolean') {
this.cursorState.promoteLongs = options.promoteLongs;
}
// Add promoteValues to cursor state
if (typeof topologyOptions.promoteValues === 'boolean') {
this.cursorState.promoteValues = topologyOptions.promoteValues;
} else if (typeof options.promoteValues === 'boolean') {
this.cursorState.promoteValues = options.promoteValues;
}
// Add promoteBuffers to cursor state
if (typeof topologyOptions.promoteBuffers === 'boolean') {
this.cursorState.promoteBuffers = topologyOptions.promoteBuffers;
} else if (typeof options.promoteBuffers === 'boolean') {
this.cursorState.promoteBuffers = options.promoteBuffers;
}
if (topologyOptions.reconnect) {
this.cursorState.reconnect = topologyOptions.reconnect;
}
// Logger
this.logger = Logger('Cursor', topologyOptions);
//
// Did we pass in a cursor id
if (typeof cmd === 'number') {
this.cursorState.cursorId = Long.fromNumber(cmd);
this.cursorState.lastCursorId = this.cursorState.cursorId;
} else if (cmd instanceof Long) {
this.cursorState.cursorId = cmd;
this.cursorState.lastCursorId = cmd;
}
// TODO: remove as part of NODE-2104
if (this.operation) {
this.operation.cursorState = this.cursorState;
}
}
setCursorBatchSize(value) {
this.cursorState.batchSize = value;
}
cursorBatchSize() {
return this.cursorState.batchSize;
}
setCursorLimit(value) {
this.cursorState.limit = value;
}
cursorLimit() {
return this.cursorState.limit;
}
setCursorSkip(value) {
this.cursorState.skip = value;
}
cursorSkip() {
return this.cursorState.skip;
}
/**
* Retrieve the next document from the cursor
* @method
* @param {resultCallback} callback A callback function
*/
_next(callback) {
nextFunction(this, callback);
}
/**
* Clone the cursor
* @method
* @return {Cursor}
*/
clone() {
return this.topology.cursor(this.ns, this.cmd, this.options);
}
/**
* Checks if the cursor is dead
* @method
* @return {boolean} A boolean signifying if the cursor is dead or not
*/
isDead() {
return this.cursorState.dead === true;
}
/**
* Checks if the cursor was killed by the application
* @method
* @return {boolean} A boolean signifying if the cursor was killed by the application
*/
isKilled() {
return this.cursorState.killed === true;
}
/**
* Checks if the cursor notified it's caller about it's death
* @method
* @return {boolean} A boolean signifying if the cursor notified the callback
*/
isNotified() {
return this.cursorState.notified === true;
}
/**
* Returns current buffered documents length
* @method
* @return {number} The number of items in the buffered documents
*/
bufferedCount() {
return this.cursorState.documents.length - this.cursorState.cursorIndex;
}
/**
* Returns current buffered documents
* @method
* @return {Array} An array of buffered documents
*/
readBufferedDocuments(number) {
const unreadDocumentsLength = this.cursorState.documents.length - this.cursorState.cursorIndex;
const length = number < unreadDocumentsLength ? number : unreadDocumentsLength;
let elements = this.cursorState.documents.slice(
this.cursorState.cursorIndex,
this.cursorState.cursorIndex + length
);
// Transform the doc with passed in transformation method if provided
if (this.cursorState.transforms && typeof this.cursorState.transforms.doc === 'function') {
// Transform all the elements
for (let i = 0; i < elements.length; i++) {
elements[i] = this.cursorState.transforms.doc(elements[i]);
}
}
// Ensure we do not return any more documents than the limit imposed
// Just return the number of elements up to the limit
if (
this.cursorState.limit > 0 &&
this.cursorState.currentLimit + elements.length > this.cursorState.limit
) {
elements = elements.slice(0, this.cursorState.limit - this.cursorState.currentLimit);
this.kill();
}
// Adjust current limit
this.cursorState.currentLimit = this.cursorState.currentLimit + elements.length;
this.cursorState.cursorIndex = this.cursorState.cursorIndex + elements.length;
// Return elements
return elements;
}
/**
* Resets local state for this cursor instance, and issues a `killCursors` command to the server
*
* @param {resultCallback} callback A callback function
*/
kill(callback) {
// Set cursor to dead
this.cursorState.dead = true;
this.cursorState.killed = true;
// Remove documents
this.cursorState.documents = [];
// If no cursor id just return
if (
this.cursorState.cursorId == null ||
this.cursorState.cursorId.isZero() ||
this.cursorState.init === false
) {
if (callback) callback(null, null);
return;
}
this.server.killCursors(this.ns, this.cursorState, callback);
}
/**
* Resets the cursor
*/
rewind() {
if (this.cursorState.init) {
if (!this.cursorState.dead) {
this.kill();
}
this.cursorState.currentLimit = 0;
this.cursorState.init = false;
this.cursorState.dead = false;
this.cursorState.killed = false;
this.cursorState.notified = false;
this.cursorState.documents = [];
this.cursorState.cursorId = null;
this.cursorState.cursorIndex = 0;
}
}
// Internal methods
_read() {
if ((this.s && this.s.state === CursorState.CLOSED) || this.isDead()) {
return this.push(null);
}
// Get the next item
this._next((err, result) => {
if (err) {
if (this.listeners('error') && this.listeners('error').length > 0) {
this.emit('error', err);
}
if (!this.isDead()) this.close();
// Emit end event
this.emit('end');
return this.emit('finish');
}
// If we provided a transformation method
if (
this.cursorState.streamOptions &&
typeof this.cursorState.streamOptions.transform === 'function' &&
result != null
) {
return this.push(this.cursorState.streamOptions.transform(result));
}
// Return the result
this.push(result);
if (result === null && this.isDead()) {
this.once('end', () => {
this.close();
this.emit('finish');
});
}
});
}
_endSession(options, callback) {
if (typeof options === 'function') {
callback = options;
options = {};
}
options = options || {};
const session = this.cursorState.session;
if (session && (options.force || session.owner === this)) {
this.cursorState.session = undefined;
if (this.operation) {
this.operation.clearSession();
}
session.endSession(callback);
return true;
}
if (callback) {
callback();
}
return false;
}
_getMore(callback) {
if (this.logger.isDebug()) {
this.logger.debug(`schedule getMore call for query [${JSON.stringify(this.query)}]`);
}
// Set the current batchSize
let batchSize = this.cursorState.batchSize;
if (
this.cursorState.limit > 0 &&
this.cursorState.currentLimit + batchSize > this.cursorState.limit
) {
batchSize = this.cursorState.limit - this.cursorState.currentLimit;
}
const cursorState = this.cursorState;
this.server.getMore(this.ns, cursorState, batchSize, this.options, (err, result, conn) => {
// NOTE: `getMore` modifies `cursorState`, would be very ideal not to do so in the future
if (err || (cursorState.cursorId && cursorState.cursorId.isZero())) {
this._endSession();
}
callback(err, result, conn);
});
}
_initializeCursor(callback) {
const cursor = this;
// NOTE: this goes away once cursors use `executeOperation`
if (isUnifiedTopology(cursor.topology) && cursor.topology.shouldCheckForSessionSupport()) {
cursor.topology.selectServer(ReadPreference.primaryPreferred, err => {
if (err) {
callback(err);
return;
}
this._initializeCursor(callback);
});
return;
}
function done(err, result) {
const cursorState = cursor.cursorState;
if (err || (cursorState.cursorId && cursorState.cursorId.isZero())) {
cursor._endSession();
}
if (
cursorState.documents.length === 0 &&
cursorState.cursorId &&
cursorState.cursorId.isZero() &&
!cursor.cmd.tailable &&
!cursor.cmd.awaitData
) {
return setCursorNotified(cursor, callback);
}
callback(err, result);
}
const queryCallback = (err, r) => {
if (err) {
return done(err);
}
const result = r.message;
if (Array.isArray(result.documents) && result.documents.length === 1) {
const document = result.documents[0];
if (result.queryFailure) {
return done(new MongoError(document), null);
}
// Check if we have a command cursor
if (!cursor.cmd.find || (cursor.cmd.find && cursor.cmd.virtual === false)) {
// We have an error document, return the error
if (document.$err || document.errmsg) {
return done(new MongoError(document), null);
}
// We have a cursor document
if (document.cursor != null && typeof document.cursor !== 'string') {
const id = document.cursor.id;
// If we have a namespace change set the new namespace for getmores
if (document.cursor.ns) {
cursor.ns = document.cursor.ns;
}
// Promote id to long if needed
cursor.cursorState.cursorId = typeof id === 'number' ? Long.fromNumber(id) : id;
cursor.cursorState.lastCursorId = cursor.cursorState.cursorId;
cursor.cursorState.operationTime = document.operationTime;
// If we have a firstBatch set it
if (Array.isArray(document.cursor.firstBatch)) {
cursor.cursorState.documents = document.cursor.firstBatch; //.reverse();
}
// Return after processing command cursor
return done(null, result);
}
}
}
// Otherwise fall back to regular find path
const cursorId = result.cursorId || 0;
cursor.cursorState.cursorId = cursorId instanceof Long ? cursorId : Long.fromNumber(cursorId);
cursor.cursorState.documents = result.documents;
cursor.cursorState.lastCursorId = result.cursorId;
// Transform the results with passed in transformation method if provided
if (
cursor.cursorState.transforms &&
typeof cursor.cursorState.transforms.query === 'function'
) {
cursor.cursorState.documents = cursor.cursorState.transforms.query(result);
}
done(null, result);
};
if (cursor.operation) {
if (cursor.logger.isDebug()) {
cursor.logger.debug(
`issue initial query [${JSON.stringify(cursor.cmd)}] with flags [${JSON.stringify(
cursor.query
)}]`
);
}
executeOperation(cursor.topology, cursor.operation, (err, result) => {
if (err) {
done(err);
return;
}
cursor.server = cursor.operation.server;
cursor.cursorState.init = true;
// NOTE: this is a special internal method for cloning a cursor, consider removing
if (cursor.cursorState.cursorId != null) {
return done();
}
queryCallback(err, result);
});
return;
}
// Very explicitly choose what is passed to selectServer
const serverSelectOptions = {};
if (cursor.cursorState.session) {
serverSelectOptions.session = cursor.cursorState.session;
}
if (cursor.operation) {
serverSelectOptions.readPreference = cursor.operation.readPreference;
} else if (cursor.options.readPreference) {
serverSelectOptions.readPreference = cursor.options.readPreference;
}
return cursor.topology.selectServer(serverSelectOptions, (err, server) => {
if (err) {
const disconnectHandler = cursor.disconnectHandler;
if (disconnectHandler != null) {
return disconnectHandler.addObjectAndMethod(
'cursor',
cursor,
'next',
[callback],
callback
);
}
return callback(err);
}
cursor.server = server;
cursor.cursorState.init = true;
if (collationNotSupported(cursor.server, cursor.cmd)) {
return callback(new MongoError(`server ${cursor.server.name} does not support collation`));
}
// NOTE: this is a special internal method for cloning a cursor, consider removing
if (cursor.cursorState.cursorId != null) {
return done();
}
if (cursor.logger.isDebug()) {
cursor.logger.debug(
`issue initial query [${JSON.stringify(cursor.cmd)}] with flags [${JSON.stringify(
cursor.query
)}]`
);
}
if (cursor.cmd.find != null) {
server.query(cursor.ns, cursor.cmd, cursor.cursorState, cursor.options, queryCallback);
return;
}
const commandOptions = Object.assign({ session: cursor.cursorState.session }, cursor.options);
server.command(cursor.ns, cursor.cmd, commandOptions, queryCallback);
});
}
}
if (SUPPORTS.ASYNC_ITERATOR) {
CoreCursor.prototype[Symbol.asyncIterator] = require('../async/async_iterator').asyncIterator;
}
/**
* Validate if the pool is dead and return error
*/
function isConnectionDead(self, callback) {
if (self.pool && self.pool.isDestroyed()) {
self.cursorState.killed = true;
const err = new MongoNetworkError(
`connection to host ${self.pool.host}:${self.pool.port} was destroyed`
);
_setCursorNotifiedImpl(self, () => callback(err));
return true;
}
return false;
}
/**
* Validate if the cursor is dead but was not explicitly killed by user
*/
function isCursorDeadButNotkilled(self, callback) {
// Cursor is dead but not marked killed, return null
if (self.cursorState.dead && !self.cursorState.killed) {
self.cursorState.killed = true;
setCursorNotified(self, callback);
return true;
}
return false;
}
/**
* Validate if the cursor is dead and was killed by user
*/
function isCursorDeadAndKilled(self, callback) {
if (self.cursorState.dead && self.cursorState.killed) {
handleCallback(callback, new MongoError('cursor is dead'));
return true;
}
return false;
}
/**
* Validate if the cursor was killed by the user
*/
function isCursorKilled(self, callback) {
if (self.cursorState.killed) {
setCursorNotified(self, callback);
return true;
}
return false;
}
/**
* Mark cursor as being dead and notified
*/
function setCursorDeadAndNotified(self, callback) {
self.cursorState.dead = true;
setCursorNotified(self, callback);
}
/**
* Mark cursor as being notified
*/
function setCursorNotified(self, callback) {
_setCursorNotifiedImpl(self, () => handleCallback(callback, null, null));
}
function _setCursorNotifiedImpl(self, callback) {
self.cursorState.notified = true;
self.cursorState.documents = [];
self.cursorState.cursorIndex = 0;
if (self.cursorState.session) {
self._endSession(callback);
return;
}
return callback();
}
function nextFunction(self, callback) {
// We have notified about it
if (self.cursorState.notified) {
return callback(new Error('cursor is exhausted'));
}
// Cursor is killed return null
if (isCursorKilled(self, callback)) return;
// Cursor is dead but not marked killed, return null
if (isCursorDeadButNotkilled(self, callback)) return;
// We have a dead and killed cursor, attempting to call next should error
if (isCursorDeadAndKilled(self, callback)) return;
// We have just started the cursor
if (!self.cursorState.init) {
// Topology is not connected, save the call in the provided store to be
// Executed at some point when the handler deems it's reconnected
if (!self.topology.isConnected(self.options)) {
// Only need this for single server, because repl sets and mongos
// will always continue trying to reconnect
if (self.topology._type === 'server' && !self.topology.s.options.reconnect) {
// Reconnect is disabled, so we'll never reconnect
return callback(new MongoError('no connection available'));
}
if (self.disconnectHandler != null) {
if (self.topology.isDestroyed()) {
// Topology was destroyed, so don't try to wait for it to reconnect
return callback(new MongoError('Topology was destroyed'));
}
self.disconnectHandler.addObjectAndMethod('cursor', self, 'next', [callback], callback);
return;
}
}
self._initializeCursor((err, result) => {
if (err || result === null) {
callback(err, result);
return;
}
nextFunction(self, callback);
});
return;
}
if (self.cursorState.limit > 0 && self.cursorState.currentLimit >= self.cursorState.limit) {
// Ensure we kill the cursor on the server
self.kill(() =>
// Set cursor in dead and notified state
setCursorDeadAndNotified(self, callback)
);
} else if (
self.cursorState.cursorIndex === self.cursorState.documents.length &&
!Long.ZERO.equals(self.cursorState.cursorId)
) {
// Ensure an empty cursor state
self.cursorState.documents = [];
self.cursorState.cursorIndex = 0;
// Check if topology is destroyed
if (self.topology.isDestroyed())
return callback(
new MongoNetworkError('connection destroyed, not possible to instantiate cursor')
);
// Check if connection is dead and return if not possible to
// execute a getMore on this connection
if (isConnectionDead(self, callback)) return;
// Execute the next get more
self._getMore(function(err, doc, connection) {
if (err) {
return handleCallback(callback, err);
}
// Save the returned connection to ensure all getMore's fire over the same connection
self.connection = connection;
// Tailable cursor getMore result, notify owner about it
// No attempt is made here to retry, this is left to the user of the
// core module to handle to keep core simple
if (
self.cursorState.documents.length === 0 &&
self.cmd.tailable &&
Long.ZERO.equals(self.cursorState.cursorId)
) {
// No more documents in the tailed cursor
return handleCallback(
callback,
new MongoError({
message: 'No more documents in tailed cursor',
tailable: self.cmd.tailable,
awaitData: self.cmd.awaitData
})
);
} else if (
self.cursorState.documents.length === 0 &&
self.cmd.tailable &&
!Long.ZERO.equals(self.cursorState.cursorId)
) {
return nextFunction(self, callback);
}
if (self.cursorState.limit > 0 && self.cursorState.currentLimit >= self.cursorState.limit) {
return setCursorDeadAndNotified(self, callback);
}
nextFunction(self, callback);
});
} else if (
self.cursorState.documents.length === self.cursorState.cursorIndex &&
self.cmd.tailable &&
Long.ZERO.equals(self.cursorState.cursorId)
) {
return handleCallback(
callback,
new MongoError({
message: 'No more documents in tailed cursor',
tailable: self.cmd.tailable,
awaitData: self.cmd.awaitData
})
);
} else if (
self.cursorState.documents.length === self.cursorState.cursorIndex &&
Long.ZERO.equals(self.cursorState.cursorId)
) {
setCursorDeadAndNotified(self, callback);
} else {
if (self.cursorState.limit > 0 && self.cursorState.currentLimit >= self.cursorState.limit) {
// Ensure we kill the cursor on the server
self.kill(() =>
// Set cursor in dead and notified state
setCursorDeadAndNotified(self, callback)
);
return;
}
// Increment the current cursor limit
self.cursorState.currentLimit += 1;
// Get the document
let doc = self.cursorState.documents[self.cursorState.cursorIndex++];
// Doc overflow
if (!doc || doc.$err) {
// Ensure we kill the cursor on the server
self.kill(() =>
// Set cursor in dead and notified state
setCursorDeadAndNotified(self, function() {
handleCallback(callback, new MongoError(doc ? doc.$err : undefined));
})
);
return;
}
// Transform the doc with passed in transformation method if provided
if (self.cursorState.transforms && typeof self.cursorState.transforms.doc === 'function') {
doc = self.cursorState.transforms.doc(doc);
}
// Return the document
handleCallback(callback, null, doc);
}
}
module.exports = {
CursorState,
CoreCursor
};

351
node_modules/mongodb/lib/core/error.js generated vendored Normal file
View File

@@ -0,0 +1,351 @@
'use strict';
const kErrorLabels = Symbol('errorLabels');
/**
* Creates a new MongoError
*
* @augments Error
* @param {Error|string|object} message The error message
* @property {string} message The error message
* @property {string} stack The error call stack
*/
class MongoError extends Error {
constructor(message) {
if (message instanceof Error) {
super(message.message);
this.stack = message.stack;
} else {
if (typeof message === 'string') {
super(message);
} else {
super(message.message || message.errmsg || message.$err || 'n/a');
if (message.errorLabels) {
this[kErrorLabels] = new Set(message.errorLabels);
}
for (var name in message) {
if (name === 'errorLabels' || name === 'errmsg') {
continue;
}
this[name] = message[name];
}
}
Error.captureStackTrace(this, this.constructor);
}
this.name = 'MongoError';
}
/**
* Legacy name for server error responses
*/
get errmsg() {
return this.message;
}
/**
* Creates a new MongoError object
*
* @param {Error|string|object} options The options used to create the error.
* @return {MongoError} A MongoError instance
* @deprecated Use `new MongoError()` instead.
*/
static create(options) {
return new MongoError(options);
}
/**
* Checks the error to see if it has an error label
* @param {string} label The error label to check for
* @returns {boolean} returns true if the error has the provided error label
*/
hasErrorLabel(label) {
if (this[kErrorLabels] == null) {
return false;
}
return this[kErrorLabels].has(label);
}
addErrorLabel(label) {
if (this[kErrorLabels] == null) {
this[kErrorLabels] = new Set();
}
this[kErrorLabels].add(label);
}
get errorLabels() {
return this[kErrorLabels] ? Array.from(this[kErrorLabels]) : [];
}
}
const kBeforeHandshake = Symbol('beforeHandshake');
function isNetworkErrorBeforeHandshake(err) {
return err[kBeforeHandshake] === true;
}
/**
* An error indicating an issue with the network, including TCP
* errors and timeouts.
*
* @param {Error|string|object} message The error message
* @property {string} message The error message
* @property {string} stack The error call stack
* @extends MongoError
*/
class MongoNetworkError extends MongoError {
constructor(message, options) {
super(message);
this.name = 'MongoNetworkError';
if (options && options.beforeHandshake === true) {
this[kBeforeHandshake] = true;
}
}
}
/**
* An error indicating a network timeout occurred
*
* @param {Error|string|object} message The error message
* @property {string} message The error message
* @property {object} [options.beforeHandshake] Indicates the timeout happened before a connection handshake completed
* @extends MongoError
*/
class MongoNetworkTimeoutError extends MongoNetworkError {
constructor(message, options) {
super(message, options);
this.name = 'MongoNetworkTimeoutError';
}
}
/**
* An error used when attempting to parse a value (like a connection string)
*
* @param {Error|string|object} message The error message
* @property {string} message The error message
* @extends MongoError
*/
class MongoParseError extends MongoError {
constructor(message) {
super(message);
this.name = 'MongoParseError';
}
}
/**
* An error signifying a client-side timeout event
*
* @param {Error|string|object} message The error message
* @param {string|object} [reason] The reason the timeout occured
* @property {string} message The error message
* @property {string} [reason] An optional reason context for the timeout, generally an error saved during flow of monitoring and selecting servers
* @extends MongoError
*/
class MongoTimeoutError extends MongoError {
constructor(message, reason) {
if (reason && reason.error) {
super(reason.error.message || reason.error);
} else {
super(message);
}
this.name = 'MongoTimeoutError';
if (reason) {
this.reason = reason;
}
}
}
/**
* An error signifying a client-side server selection error
*
* @param {Error|string|object} message The error message
* @param {string|object} [reason] The reason the timeout occured
* @property {string} message The error message
* @property {string} [reason] An optional reason context for the timeout, generally an error saved during flow of monitoring and selecting servers
* @extends MongoError
*/
class MongoServerSelectionError extends MongoTimeoutError {
constructor(message, reason) {
super(message, reason);
this.name = 'MongoServerSelectionError';
}
}
function makeWriteConcernResultObject(input) {
const output = Object.assign({}, input);
if (output.ok === 0) {
output.ok = 1;
delete output.errmsg;
delete output.code;
delete output.codeName;
}
return output;
}
/**
* An error thrown when the server reports a writeConcernError
*
* @param {Error|string|object} message The error message
* @param {object} result The result document (provided if ok: 1)
* @property {string} message The error message
* @property {object} [result] The result document (provided if ok: 1)
* @extends MongoError
*/
class MongoWriteConcernError extends MongoError {
constructor(message, result) {
super(message);
this.name = 'MongoWriteConcernError';
if (result && Array.isArray(result.errorLabels)) {
this[kErrorLabels] = new Set(result.errorLabels);
}
if (result != null) {
this.result = makeWriteConcernResultObject(result);
}
}
}
// see: https://github.com/mongodb/specifications/blob/master/source/retryable-writes/retryable-writes.rst#terms
const RETRYABLE_ERROR_CODES = new Set([
6, // HostUnreachable
7, // HostNotFound
89, // NetworkTimeout
91, // ShutdownInProgress
189, // PrimarySteppedDown
9001, // SocketException
10107, // NotMaster
11600, // InterruptedAtShutdown
11602, // InterruptedDueToReplStateChange
13435, // NotMasterNoSlaveOk
13436 // NotMasterOrSecondary
]);
const RETRYABLE_WRITE_ERROR_CODES = new Set([
11600, // InterruptedAtShutdown
11602, // InterruptedDueToReplStateChange
10107, // NotMaster
13435, // NotMasterNoSlaveOk
13436, // NotMasterOrSecondary
189, // PrimarySteppedDown
91, // ShutdownInProgress
7, // HostNotFound
6, // HostUnreachable
89, // NetworkTimeout
9001, // SocketException
262 // ExceededTimeLimit
]);
function isRetryableWriteError(error) {
if (error instanceof MongoWriteConcernError) {
return (
RETRYABLE_WRITE_ERROR_CODES.has(error.code) ||
RETRYABLE_WRITE_ERROR_CODES.has(error.result.code)
);
}
return RETRYABLE_WRITE_ERROR_CODES.has(error.code);
}
/**
* Determines whether an error is something the driver should attempt to retry
*
* @ignore
* @param {MongoError|Error} error
*/
function isRetryableError(error) {
return (
RETRYABLE_ERROR_CODES.has(error.code) ||
error instanceof MongoNetworkError ||
error.message.match(/not master/) ||
error.message.match(/node is recovering/)
);
}
const SDAM_RECOVERING_CODES = new Set([
91, // ShutdownInProgress
189, // PrimarySteppedDown
11600, // InterruptedAtShutdown
11602, // InterruptedDueToReplStateChange
13436 // NotMasterOrSecondary
]);
const SDAM_NOTMASTER_CODES = new Set([
10107, // NotMaster
13435 // NotMasterNoSlaveOk
]);
const SDAM_NODE_SHUTTING_DOWN_ERROR_CODES = new Set([
11600, // InterruptedAtShutdown
91 // ShutdownInProgress
]);
function isRecoveringError(err) {
if (err.code && SDAM_RECOVERING_CODES.has(err.code)) {
return true;
}
return err.message.match(/not master or secondary/) || err.message.match(/node is recovering/);
}
function isNotMasterError(err) {
if (err.code && SDAM_NOTMASTER_CODES.has(err.code)) {
return true;
}
if (isRecoveringError(err)) {
return false;
}
return err.message.match(/not master/);
}
function isNodeShuttingDownError(err) {
return err.code && SDAM_NODE_SHUTTING_DOWN_ERROR_CODES.has(err.code);
}
/**
* Determines whether SDAM can recover from a given error. If it cannot
* then the pool will be cleared, and server state will completely reset
* locally.
*
* @ignore
* @see https://github.com/mongodb/specifications/blob/master/source/server-discovery-and-monitoring/server-discovery-and-monitoring.rst#not-master-and-node-is-recovering
* @param {MongoError|Error} error
*/
function isSDAMUnrecoverableError(error) {
// NOTE: null check is here for a strictly pre-CMAP world, a timeout or
// close event are considered unrecoverable
if (error instanceof MongoParseError || error == null) {
return true;
}
if (isRecoveringError(error) || isNotMasterError(error)) {
return true;
}
return false;
}
module.exports = {
MongoError,
MongoNetworkError,
MongoNetworkTimeoutError,
MongoParseError,
MongoTimeoutError,
MongoServerSelectionError,
MongoWriteConcernError,
isRetryableError,
isSDAMUnrecoverableError,
isNodeShuttingDownError,
isRetryableWriteError,
isNetworkErrorBeforeHandshake
};

50
node_modules/mongodb/lib/core/index.js generated vendored Normal file
View File

@@ -0,0 +1,50 @@
'use strict';
let BSON = require('bson');
const require_optional = require('require_optional');
const EJSON = require('./utils').retrieveEJSON();
try {
// Attempt to grab the native BSON parser
const BSONNative = require_optional('bson-ext');
// If we got the native parser, use it instead of the
// Javascript one
if (BSONNative) {
BSON = BSONNative;
}
} catch (err) {} // eslint-disable-line
module.exports = {
// Errors
MongoError: require('./error').MongoError,
MongoNetworkError: require('./error').MongoNetworkError,
MongoParseError: require('./error').MongoParseError,
MongoTimeoutError: require('./error').MongoTimeoutError,
MongoServerSelectionError: require('./error').MongoServerSelectionError,
MongoWriteConcernError: require('./error').MongoWriteConcernError,
// Core
Connection: require('./connection/connection'),
Server: require('./topologies/server'),
ReplSet: require('./topologies/replset'),
Mongos: require('./topologies/mongos'),
Logger: require('./connection/logger'),
Cursor: require('./cursor').CoreCursor,
ReadPreference: require('./topologies/read_preference'),
Sessions: require('./sessions'),
BSON: BSON,
EJSON: EJSON,
Topology: require('./sdam/topology').Topology,
// Raw operations
Query: require('./connection/commands').Query,
// Auth mechanisms
MongoCredentials: require('./auth/mongo_credentials').MongoCredentials,
defaultAuthProviders: require('./auth/defaultAuthProviders').defaultAuthProviders,
MongoCR: require('./auth/mongocr'),
X509: require('./auth/x509'),
Plain: require('./auth/plain'),
GSSAPI: require('./auth/gssapi'),
ScramSHA1: require('./auth/scram').ScramSHA1,
ScramSHA256: require('./auth/scram').ScramSHA256,
// Utilities
parseConnectionString: require('./uri_parser')
};

67
node_modules/mongodb/lib/core/sdam/common.js generated vendored Normal file
View File

@@ -0,0 +1,67 @@
'use strict';
// shared state names
const STATE_CLOSING = 'closing';
const STATE_CLOSED = 'closed';
const STATE_CONNECTING = 'connecting';
const STATE_CONNECTED = 'connected';
// An enumeration of topology types we know about
const TopologyType = {
Single: 'Single',
ReplicaSetNoPrimary: 'ReplicaSetNoPrimary',
ReplicaSetWithPrimary: 'ReplicaSetWithPrimary',
Sharded: 'Sharded',
Unknown: 'Unknown'
};
// An enumeration of server types we know about
const ServerType = {
Standalone: 'Standalone',
Mongos: 'Mongos',
PossiblePrimary: 'PossiblePrimary',
RSPrimary: 'RSPrimary',
RSSecondary: 'RSSecondary',
RSArbiter: 'RSArbiter',
RSOther: 'RSOther',
RSGhost: 'RSGhost',
Unknown: 'Unknown'
};
// helper to get a server's type that works for both legacy and unified topologies
function serverType(server) {
let description = server.s.description || server.s.serverDescription;
if (description.topologyType === TopologyType.Single) return description.servers[0].type;
return description.type;
}
const TOPOLOGY_DEFAULTS = {
useUnifiedTopology: true,
localThresholdMS: 15,
serverSelectionTimeoutMS: 30000,
heartbeatFrequencyMS: 10000,
minHeartbeatFrequencyMS: 500
};
function drainTimerQueue(queue) {
queue.forEach(clearTimeout);
queue.clear();
}
function clearAndRemoveTimerFrom(timer, timers) {
clearTimeout(timer);
return timers.delete(timer);
}
module.exports = {
STATE_CLOSING,
STATE_CLOSED,
STATE_CONNECTING,
STATE_CONNECTED,
TOPOLOGY_DEFAULTS,
TopologyType,
ServerType,
serverType,
drainTimerQueue,
clearAndRemoveTimerFrom
};

124
node_modules/mongodb/lib/core/sdam/events.js generated vendored Normal file
View File

@@ -0,0 +1,124 @@
'use strict';
/**
* Published when server description changes, but does NOT include changes to the RTT.
*
* @property {Object} topologyId A unique identifier for the topology
* @property {ServerAddress} address The address (host/port pair) of the server
* @property {ServerDescription} previousDescription The previous server description
* @property {ServerDescription} newDescription The new server description
*/
class ServerDescriptionChangedEvent {
constructor(topologyId, address, previousDescription, newDescription) {
Object.assign(this, { topologyId, address, previousDescription, newDescription });
}
}
/**
* Published when server is initialized.
*
* @property {Object} topologyId A unique identifier for the topology
* @property {ServerAddress} address The address (host/port pair) of the server
*/
class ServerOpeningEvent {
constructor(topologyId, address) {
Object.assign(this, { topologyId, address });
}
}
/**
* Published when server is closed.
*
* @property {ServerAddress} address The address (host/port pair) of the server
* @property {Object} topologyId A unique identifier for the topology
*/
class ServerClosedEvent {
constructor(topologyId, address) {
Object.assign(this, { topologyId, address });
}
}
/**
* Published when topology description changes.
*
* @property {Object} topologyId
* @property {TopologyDescription} previousDescription The old topology description
* @property {TopologyDescription} newDescription The new topology description
*/
class TopologyDescriptionChangedEvent {
constructor(topologyId, previousDescription, newDescription) {
Object.assign(this, { topologyId, previousDescription, newDescription });
}
}
/**
* Published when topology is initialized.
*
* @param {Object} topologyId A unique identifier for the topology
*/
class TopologyOpeningEvent {
constructor(topologyId) {
Object.assign(this, { topologyId });
}
}
/**
* Published when topology is closed.
*
* @param {Object} topologyId A unique identifier for the topology
*/
class TopologyClosedEvent {
constructor(topologyId) {
Object.assign(this, { topologyId });
}
}
/**
* Fired when the server monitors ismaster command is started - immediately before
* the ismaster command is serialized into raw BSON and written to the socket.
*
* @property {Object} connectionId The connection id for the command
*/
class ServerHeartbeatStartedEvent {
constructor(connectionId) {
Object.assign(this, { connectionId });
}
}
/**
* Fired when the server monitors ismaster succeeds.
*
* @param {Number} duration The execution time of the event in ms
* @param {Object} reply The command reply
* @param {Object} connectionId The connection id for the command
*/
class ServerHeartbeatSucceededEvent {
constructor(duration, reply, connectionId) {
Object.assign(this, { connectionId, duration, reply });
}
}
/**
* Fired when the server monitors ismaster fails, either with an “ok: 0” or a socket exception.
*
* @param {Number} duration The execution time of the event in ms
* @param {MongoError|Object} failure The command failure
* @param {Object} connectionId The connection id for the command
*/
class ServerHeartbeatFailedEvent {
constructor(duration, failure, connectionId) {
Object.assign(this, { connectionId, duration, failure });
}
}
module.exports = {
ServerDescriptionChangedEvent,
ServerOpeningEvent,
ServerClosedEvent,
TopologyDescriptionChangedEvent,
TopologyOpeningEvent,
TopologyClosedEvent,
ServerHeartbeatStartedEvent,
ServerHeartbeatSucceededEvent,
ServerHeartbeatFailedEvent
};

405
node_modules/mongodb/lib/core/sdam/monitor.js generated vendored Normal file
View File

@@ -0,0 +1,405 @@
'use strict';
const ServerType = require('./common').ServerType;
const EventEmitter = require('events');
const connect = require('../connection/connect');
const Connection = require('../../cmap/connection').Connection;
const common = require('./common');
const makeStateMachine = require('../utils').makeStateMachine;
const MongoNetworkError = require('../error').MongoNetworkError;
const BSON = require('../connection/utils').retrieveBSON();
const makeInterruptableAsyncInterval = require('../../utils').makeInterruptableAsyncInterval;
const calculateDurationInMs = require('../../utils').calculateDurationInMs;
const now = require('../../utils').now;
const sdamEvents = require('./events');
const ServerHeartbeatStartedEvent = sdamEvents.ServerHeartbeatStartedEvent;
const ServerHeartbeatSucceededEvent = sdamEvents.ServerHeartbeatSucceededEvent;
const ServerHeartbeatFailedEvent = sdamEvents.ServerHeartbeatFailedEvent;
const kServer = Symbol('server');
const kMonitorId = Symbol('monitorId');
const kConnection = Symbol('connection');
const kCancellationToken = Symbol('cancellationToken');
const kRTTPinger = Symbol('rttPinger');
const kRoundTripTime = Symbol('roundTripTime');
const STATE_CLOSED = common.STATE_CLOSED;
const STATE_CLOSING = common.STATE_CLOSING;
const STATE_IDLE = 'idle';
const STATE_MONITORING = 'monitoring';
const stateTransition = makeStateMachine({
[STATE_CLOSING]: [STATE_CLOSING, STATE_IDLE, STATE_CLOSED],
[STATE_CLOSED]: [STATE_CLOSED, STATE_MONITORING],
[STATE_IDLE]: [STATE_IDLE, STATE_MONITORING, STATE_CLOSING],
[STATE_MONITORING]: [STATE_MONITORING, STATE_IDLE, STATE_CLOSING]
});
const INVALID_REQUEST_CHECK_STATES = new Set([STATE_CLOSING, STATE_CLOSED, STATE_MONITORING]);
function isInCloseState(monitor) {
return monitor.s.state === STATE_CLOSED || monitor.s.state === STATE_CLOSING;
}
class Monitor extends EventEmitter {
constructor(server, options) {
super(options);
this[kServer] = server;
this[kConnection] = undefined;
this[kCancellationToken] = new EventEmitter();
this[kCancellationToken].setMaxListeners(Infinity);
this[kMonitorId] = null;
this.s = {
state: STATE_CLOSED
};
this.address = server.description.address;
this.options = Object.freeze({
connectTimeoutMS:
typeof options.connectionTimeout === 'number'
? options.connectionTimeout
: typeof options.connectTimeoutMS === 'number'
? options.connectTimeoutMS
: 10000,
heartbeatFrequencyMS:
typeof options.heartbeatFrequencyMS === 'number' ? options.heartbeatFrequencyMS : 10000,
minHeartbeatFrequencyMS:
typeof options.minHeartbeatFrequencyMS === 'number' ? options.minHeartbeatFrequencyMS : 500
});
// TODO: refactor this to pull it directly from the pool, requires new ConnectionPool integration
const connectOptions = Object.assign(
{
id: '<monitor>',
host: server.description.host,
port: server.description.port,
bson: server.s.bson,
connectionType: Connection
},
server.s.options,
this.options,
// force BSON serialization options
{
raw: false,
promoteLongs: true,
promoteValues: true,
promoteBuffers: true
}
);
// ensure no authentication is used for monitoring
delete connectOptions.credentials;
this.connectOptions = Object.freeze(connectOptions);
}
connect() {
if (this.s.state !== STATE_CLOSED) {
return;
}
// start
const heartbeatFrequencyMS = this.options.heartbeatFrequencyMS;
const minHeartbeatFrequencyMS = this.options.minHeartbeatFrequencyMS;
this[kMonitorId] = makeInterruptableAsyncInterval(monitorServer(this), {
interval: heartbeatFrequencyMS,
minInterval: minHeartbeatFrequencyMS,
immediate: true
});
}
requestCheck() {
if (INVALID_REQUEST_CHECK_STATES.has(this.s.state)) {
return;
}
this[kMonitorId].wake();
}
reset() {
if (isInCloseState(this)) {
return;
}
stateTransition(this, STATE_CLOSING);
resetMonitorState(this);
// restart monitor
stateTransition(this, STATE_IDLE);
// restart monitoring
const heartbeatFrequencyMS = this.options.heartbeatFrequencyMS;
const minHeartbeatFrequencyMS = this.options.minHeartbeatFrequencyMS;
this[kMonitorId] = makeInterruptableAsyncInterval(monitorServer(this), {
interval: heartbeatFrequencyMS,
minInterval: minHeartbeatFrequencyMS
});
}
close() {
if (isInCloseState(this)) {
return;
}
stateTransition(this, STATE_CLOSING);
resetMonitorState(this);
// close monitor
this.emit('close');
stateTransition(this, STATE_CLOSED);
}
}
function resetMonitorState(monitor) {
stateTransition(monitor, STATE_CLOSING);
if (monitor[kMonitorId]) {
monitor[kMonitorId].stop();
monitor[kMonitorId] = null;
}
if (monitor[kRTTPinger]) {
monitor[kRTTPinger].close();
monitor[kRTTPinger] = undefined;
}
monitor[kCancellationToken].emit('cancel');
if (monitor[kMonitorId]) {
clearTimeout(monitor[kMonitorId]);
monitor[kMonitorId] = undefined;
}
if (monitor[kConnection]) {
monitor[kConnection].destroy({ force: true });
}
}
function checkServer(monitor, callback) {
let start = now();
monitor.emit('serverHeartbeatStarted', new ServerHeartbeatStartedEvent(monitor.address));
function failureHandler(err) {
if (monitor[kConnection]) {
monitor[kConnection].destroy({ force: true });
monitor[kConnection] = undefined;
}
monitor.emit(
'serverHeartbeatFailed',
new ServerHeartbeatFailedEvent(calculateDurationInMs(start), err, monitor.address)
);
monitor.emit('resetServer', err);
monitor.emit('resetConnectionPool');
callback(err);
}
if (monitor[kConnection] != null && !monitor[kConnection].closed) {
const connectTimeoutMS = monitor.options.connectTimeoutMS;
const maxAwaitTimeMS = monitor.options.heartbeatFrequencyMS;
const topologyVersion = monitor[kServer].description.topologyVersion;
const isAwaitable = topologyVersion != null;
const cmd = isAwaitable
? { ismaster: true, maxAwaitTimeMS, topologyVersion: makeTopologyVersion(topologyVersion) }
: { ismaster: true };
const options = isAwaitable
? { socketTimeout: connectTimeoutMS + maxAwaitTimeMS, exhaustAllowed: true }
: { socketTimeout: connectTimeoutMS };
if (isAwaitable && monitor[kRTTPinger] == null) {
monitor[kRTTPinger] = new RTTPinger(monitor[kCancellationToken], monitor.connectOptions);
}
monitor[kConnection].command('admin.$cmd', cmd, options, (err, result) => {
if (err) {
failureHandler(err);
return;
}
const isMaster = result.result;
const duration = isAwaitable
? monitor[kRTTPinger].roundTripTime
: calculateDurationInMs(start);
monitor.emit(
'serverHeartbeatSucceeded',
new ServerHeartbeatSucceededEvent(duration, isMaster, monitor.address)
);
// if we are using the streaming protocol then we immediately issue another `started`
// event, otherwise the "check" is complete and return to the main monitor loop
if (isAwaitable && isMaster.topologyVersion) {
monitor.emit('serverHeartbeatStarted', new ServerHeartbeatStartedEvent(monitor.address));
start = now();
} else {
if (monitor[kRTTPinger]) {
monitor[kRTTPinger].close();
monitor[kRTTPinger] = undefined;
}
callback(undefined, isMaster);
}
});
return;
}
// connecting does an implicit `ismaster`
connect(monitor.connectOptions, monitor[kCancellationToken], (err, conn) => {
if (conn && isInCloseState(monitor)) {
conn.destroy({ force: true });
return;
}
if (err) {
monitor[kConnection] = undefined;
// we already reset the connection pool on network errors in all cases
if (!(err instanceof MongoNetworkError)) {
monitor.emit('resetConnectionPool');
}
failureHandler(err);
return;
}
monitor[kConnection] = conn;
monitor.emit(
'serverHeartbeatSucceeded',
new ServerHeartbeatSucceededEvent(
calculateDurationInMs(start),
conn.ismaster,
monitor.address
)
);
callback(undefined, conn.ismaster);
});
}
function monitorServer(monitor) {
return callback => {
stateTransition(monitor, STATE_MONITORING);
function done() {
if (!isInCloseState(monitor)) {
stateTransition(monitor, STATE_IDLE);
}
callback();
}
// TODO: the next line is a legacy event, remove in v4
process.nextTick(() => monitor.emit('monitoring', monitor[kServer]));
checkServer(monitor, (err, isMaster) => {
if (err) {
// otherwise an error occured on initial discovery, also bail
if (monitor[kServer].description.type === ServerType.Unknown) {
monitor.emit('resetServer', err);
return done();
}
}
// if the check indicates streaming is supported, immediately reschedule monitoring
if (isMaster && isMaster.topologyVersion) {
setTimeout(() => {
if (!isInCloseState(monitor)) {
monitor[kMonitorId].wake();
}
});
}
done();
});
};
}
function makeTopologyVersion(tv) {
return {
processId: tv.processId,
counter: BSON.Long.fromNumber(tv.counter)
};
}
class RTTPinger {
constructor(cancellationToken, options) {
this[kConnection] = null;
this[kCancellationToken] = cancellationToken;
this[kRoundTripTime] = 0;
this.closed = false;
const heartbeatFrequencyMS = options.heartbeatFrequencyMS;
this[kMonitorId] = setTimeout(() => measureRoundTripTime(this, options), heartbeatFrequencyMS);
}
get roundTripTime() {
return this[kRoundTripTime];
}
close() {
this.closed = true;
clearTimeout(this[kMonitorId]);
this[kMonitorId] = undefined;
if (this[kConnection]) {
this[kConnection].destroy({ force: true });
}
}
}
function measureRoundTripTime(rttPinger, options) {
const start = now();
const cancellationToken = rttPinger[kCancellationToken];
const heartbeatFrequencyMS = options.heartbeatFrequencyMS;
if (rttPinger.closed) {
return;
}
function measureAndReschedule(conn) {
if (rttPinger.closed) {
conn.destroy({ force: true });
return;
}
if (rttPinger[kConnection] == null) {
rttPinger[kConnection] = conn;
}
rttPinger[kRoundTripTime] = calculateDurationInMs(start);
rttPinger[kMonitorId] = setTimeout(
() => measureRoundTripTime(rttPinger, options),
heartbeatFrequencyMS
);
}
if (rttPinger[kConnection] == null) {
connect(options, cancellationToken, (err, conn) => {
if (err) {
rttPinger[kConnection] = undefined;
rttPinger[kRoundTripTime] = 0;
return;
}
measureAndReschedule(conn);
});
return;
}
rttPinger[kConnection].command('admin.$cmd', { ismaster: 1 }, err => {
if (err) {
rttPinger[kConnection] = undefined;
rttPinger[kRoundTripTime] = 0;
return;
}
measureAndReschedule();
});
}
module.exports = {
Monitor
};

564
node_modules/mongodb/lib/core/sdam/server.js generated vendored Normal file
View File

@@ -0,0 +1,564 @@
'use strict';
const EventEmitter = require('events');
const ConnectionPool = require('../../cmap/connection_pool').ConnectionPool;
const CMAP_EVENT_NAMES = require('../../cmap/events').CMAP_EVENT_NAMES;
const MongoError = require('../error').MongoError;
const relayEvents = require('../utils').relayEvents;
const BSON = require('../connection/utils').retrieveBSON();
const Logger = require('../connection/logger');
const ServerDescription = require('./server_description').ServerDescription;
const compareTopologyVersion = require('./server_description').compareTopologyVersion;
const ReadPreference = require('../topologies/read_preference');
const Monitor = require('./monitor').Monitor;
const MongoNetworkError = require('../error').MongoNetworkError;
const MongoNetworkTimeoutError = require('../error').MongoNetworkTimeoutError;
const collationNotSupported = require('../utils').collationNotSupported;
const debugOptions = require('../connection/utils').debugOptions;
const isSDAMUnrecoverableError = require('../error').isSDAMUnrecoverableError;
const isRetryableWriteError = require('../error').isRetryableWriteError;
const isNodeShuttingDownError = require('../error').isNodeShuttingDownError;
const isNetworkErrorBeforeHandshake = require('../error').isNetworkErrorBeforeHandshake;
const maxWireVersion = require('../utils').maxWireVersion;
const makeStateMachine = require('../utils').makeStateMachine;
const common = require('./common');
const ServerType = common.ServerType;
const isTransactionCommand = require('../transactions').isTransactionCommand;
// Used for filtering out fields for logging
const DEBUG_FIELDS = [
'reconnect',
'reconnectTries',
'reconnectInterval',
'emitError',
'cursorFactory',
'host',
'port',
'size',
'keepAlive',
'keepAliveInitialDelay',
'noDelay',
'connectionTimeout',
'checkServerIdentity',
'socketTimeout',
'ssl',
'ca',
'crl',
'cert',
'key',
'rejectUnauthorized',
'promoteLongs',
'promoteValues',
'promoteBuffers',
'servername'
];
const STATE_CLOSING = common.STATE_CLOSING;
const STATE_CLOSED = common.STATE_CLOSED;
const STATE_CONNECTING = common.STATE_CONNECTING;
const STATE_CONNECTED = common.STATE_CONNECTED;
const stateTransition = makeStateMachine({
[STATE_CLOSED]: [STATE_CLOSED, STATE_CONNECTING],
[STATE_CONNECTING]: [STATE_CONNECTING, STATE_CLOSING, STATE_CONNECTED, STATE_CLOSED],
[STATE_CONNECTED]: [STATE_CONNECTED, STATE_CLOSING, STATE_CLOSED],
[STATE_CLOSING]: [STATE_CLOSING, STATE_CLOSED]
});
const kMonitor = Symbol('monitor');
/**
*
* @fires Server#serverHeartbeatStarted
* @fires Server#serverHeartbeatSucceeded
* @fires Server#serverHeartbeatFailed
*/
class Server extends EventEmitter {
/**
* Create a server
*
* @param {ServerDescription} description
* @param {Object} options
*/
constructor(description, options, topology) {
super();
this.s = {
// the server description
description,
// a saved copy of the incoming options
options,
// the server logger
logger: Logger('Server', options),
// the bson parser
bson:
options.bson ||
new BSON([
BSON.Binary,
BSON.Code,
BSON.DBRef,
BSON.Decimal128,
BSON.Double,
BSON.Int32,
BSON.Long,
BSON.Map,
BSON.MaxKey,
BSON.MinKey,
BSON.ObjectId,
BSON.BSONRegExp,
BSON.Symbol,
BSON.Timestamp
]),
// the server state
state: STATE_CLOSED,
credentials: options.credentials,
topology
};
// create the connection pool
// NOTE: this used to happen in `connect`, we supported overriding pool options there
const poolOptions = Object.assign(
{ host: this.description.host, port: this.description.port, bson: this.s.bson },
options
);
this.s.pool = new ConnectionPool(poolOptions);
relayEvents(
this.s.pool,
this,
['commandStarted', 'commandSucceeded', 'commandFailed'].concat(CMAP_EVENT_NAMES)
);
this.s.pool.on('clusterTimeReceived', clusterTime => {
this.clusterTime = clusterTime;
});
// create the monitor
this[kMonitor] = new Monitor(this, this.s.options);
relayEvents(this[kMonitor], this, [
'serverHeartbeatStarted',
'serverHeartbeatSucceeded',
'serverHeartbeatFailed',
// legacy events
'monitoring'
]);
this[kMonitor].on('resetConnectionPool', () => {
this.s.pool.clear();
});
this[kMonitor].on('resetServer', error => markServerUnknown(this, error));
this[kMonitor].on('serverHeartbeatSucceeded', event => {
this.emit(
'descriptionReceived',
new ServerDescription(this.description.address, event.reply, {
roundTripTime: calculateRoundTripTime(this.description.roundTripTime, event.duration)
})
);
if (this.s.state === STATE_CONNECTING) {
stateTransition(this, STATE_CONNECTED);
this.emit('connect', this);
}
});
}
get description() {
return this.s.description;
}
get name() {
return this.s.description.address;
}
get autoEncrypter() {
if (this.s.options && this.s.options.autoEncrypter) {
return this.s.options.autoEncrypter;
}
return null;
}
/**
* Initiate server connect
*/
connect() {
if (this.s.state !== STATE_CLOSED) {
return;
}
stateTransition(this, STATE_CONNECTING);
this[kMonitor].connect();
}
/**
* Destroy the server connection
*
* @param {object} [options] Optional settings
* @param {Boolean} [options.force=false] Force destroy the pool
*/
destroy(options, callback) {
if (typeof options === 'function') (callback = options), (options = {});
options = Object.assign({}, { force: false }, options);
if (this.s.state === STATE_CLOSED) {
if (typeof callback === 'function') {
callback();
}
return;
}
stateTransition(this, STATE_CLOSING);
this[kMonitor].close();
this.s.pool.close(options, err => {
stateTransition(this, STATE_CLOSED);
this.emit('closed');
if (typeof callback === 'function') {
callback(err);
}
});
}
/**
* Immediately schedule monitoring of this server. If there already an attempt being made
* this will be a no-op.
*/
requestCheck() {
this[kMonitor].requestCheck();
}
/**
* Execute a command
*
* @param {string} ns The MongoDB fully qualified namespace (ex: db1.collection1)
* @param {object} cmd The command hash
* @param {object} [options] Optional settings
* @param {ReadPreference} [options.readPreference] Specify read preference if command supports it
* @param {Boolean} [options.serializeFunctions=false] Specify if functions on an object should be serialized.
* @param {Boolean} [options.checkKeys=false] Specify if the bson parser should validate keys.
* @param {Boolean} [options.ignoreUndefined=false] Specify if the BSON serializer should ignore undefined fields.
* @param {Boolean} [options.fullResult=false] Return the full envelope instead of just the result document.
* @param {ClientSession} [options.session] Session to use for the operation
* @param {opResultCallback} callback A callback function
*/
command(ns, cmd, options, callback) {
if (typeof options === 'function') {
(callback = options), (options = {}), (options = options || {});
}
if (this.s.state === STATE_CLOSING || this.s.state === STATE_CLOSED) {
callback(new MongoError('server is closed'));
return;
}
const error = basicReadValidations(this, options);
if (error) {
return callback(error);
}
// Clone the options
options = Object.assign({}, options, { wireProtocolCommand: false });
// Debug log
if (this.s.logger.isDebug()) {
this.s.logger.debug(
`executing command [${JSON.stringify({
ns,
cmd,
options: debugOptions(DEBUG_FIELDS, options)
})}] against ${this.name}`
);
}
// error if collation not supported
if (collationNotSupported(this, cmd)) {
callback(new MongoError(`server ${this.name} does not support collation`));
return;
}
this.s.pool.withConnection((err, conn, cb) => {
if (err) {
markServerUnknown(this, err);
return cb(err);
}
conn.command(ns, cmd, options, makeOperationHandler(this, conn, cmd, options, cb));
}, callback);
}
/**
* Execute a query against the server
*
* @param {string} ns The MongoDB fully qualified namespace (ex: db1.collection1)
* @param {object} cmd The command document for the query
* @param {object} options Optional settings
* @param {function} callback
*/
query(ns, cmd, cursorState, options, callback) {
if (this.s.state === STATE_CLOSING || this.s.state === STATE_CLOSED) {
callback(new MongoError('server is closed'));
return;
}
this.s.pool.withConnection((err, conn, cb) => {
if (err) {
markServerUnknown(this, err);
return cb(err);
}
conn.query(ns, cmd, cursorState, options, makeOperationHandler(this, conn, cmd, options, cb));
}, callback);
}
/**
* Execute a `getMore` against the server
*
* @param {string} ns The MongoDB fully qualified namespace (ex: db1.collection1)
* @param {object} cursorState State data associated with the cursor calling this method
* @param {object} options Optional settings
* @param {function} callback
*/
getMore(ns, cursorState, batchSize, options, callback) {
if (this.s.state === STATE_CLOSING || this.s.state === STATE_CLOSED) {
callback(new MongoError('server is closed'));
return;
}
this.s.pool.withConnection((err, conn, cb) => {
if (err) {
markServerUnknown(this, err);
return cb(err);
}
conn.getMore(
ns,
cursorState,
batchSize,
options,
makeOperationHandler(this, conn, null, options, cb)
);
}, callback);
}
/**
* Execute a `killCursors` command against the server
*
* @param {string} ns The MongoDB fully qualified namespace (ex: db1.collection1)
* @param {object} cursorState State data associated with the cursor calling this method
* @param {function} callback
*/
killCursors(ns, cursorState, callback) {
if (this.s.state === STATE_CLOSING || this.s.state === STATE_CLOSED) {
if (typeof callback === 'function') {
callback(new MongoError('server is closed'));
}
return;
}
this.s.pool.withConnection((err, conn, cb) => {
if (err) {
markServerUnknown(this, err);
return cb(err);
}
conn.killCursors(ns, cursorState, makeOperationHandler(this, conn, null, undefined, cb));
}, callback);
}
/**
* Insert one or more documents
* @method
* @param {string} ns The MongoDB fully qualified namespace (ex: db1.collection1)
* @param {array} ops An array of documents to insert
* @param {boolean} [options.ordered=true] Execute in order or out of order
* @param {object} [options.writeConcern={}] Write concern for the operation
* @param {Boolean} [options.serializeFunctions=false] Specify if functions on an object should be serialized.
* @param {Boolean} [options.ignoreUndefined=false] Specify if the BSON serializer should ignore undefined fields.
* @param {ClientSession} [options.session] Session to use for the operation
* @param {opResultCallback} callback A callback function
*/
insert(ns, ops, options, callback) {
executeWriteOperation({ server: this, op: 'insert', ns, ops }, options, callback);
}
/**
* Perform one or more update operations
* @method
* @param {string} ns The MongoDB fully qualified namespace (ex: db1.collection1)
* @param {array} ops An array of updates
* @param {boolean} [options.ordered=true] Execute in order or out of order
* @param {object} [options.writeConcern={}] Write concern for the operation
* @param {Boolean} [options.serializeFunctions=false] Specify if functions on an object should be serialized.
* @param {Boolean} [options.ignoreUndefined=false] Specify if the BSON serializer should ignore undefined fields.
* @param {ClientSession} [options.session] Session to use for the operation
* @param {opResultCallback} callback A callback function
*/
update(ns, ops, options, callback) {
executeWriteOperation({ server: this, op: 'update', ns, ops }, options, callback);
}
/**
* Perform one or more remove operations
* @method
* @param {string} ns The MongoDB fully qualified namespace (ex: db1.collection1)
* @param {array} ops An array of removes
* @param {boolean} [options.ordered=true] Execute in order or out of order
* @param {object} [options.writeConcern={}] Write concern for the operation
* @param {Boolean} [options.serializeFunctions=false] Specify if functions on an object should be serialized.
* @param {Boolean} [options.ignoreUndefined=false] Specify if the BSON serializer should ignore undefined fields.
* @param {ClientSession} [options.session] Session to use for the operation
* @param {opResultCallback} callback A callback function
*/
remove(ns, ops, options, callback) {
executeWriteOperation({ server: this, op: 'remove', ns, ops }, options, callback);
}
}
Object.defineProperty(Server.prototype, 'clusterTime', {
get: function() {
return this.s.topology.clusterTime;
},
set: function(clusterTime) {
this.s.topology.clusterTime = clusterTime;
}
});
function supportsRetryableWrites(server) {
return (
server.description.maxWireVersion >= 6 &&
server.description.logicalSessionTimeoutMinutes &&
server.description.type !== ServerType.Standalone
);
}
function calculateRoundTripTime(oldRtt, duration) {
if (oldRtt === -1) {
return duration;
}
const alpha = 0.2;
return alpha * duration + (1 - alpha) * oldRtt;
}
function basicReadValidations(server, options) {
if (options.readPreference && !(options.readPreference instanceof ReadPreference)) {
return new MongoError('readPreference must be an instance of ReadPreference');
}
}
function executeWriteOperation(args, options, callback) {
if (typeof options === 'function') (callback = options), (options = {});
options = options || {};
// TODO: once we drop Node 4, use destructuring either here or in arguments.
const server = args.server;
const op = args.op;
const ns = args.ns;
const ops = Array.isArray(args.ops) ? args.ops : [args.ops];
if (server.s.state === STATE_CLOSING || server.s.state === STATE_CLOSED) {
callback(new MongoError('server is closed'));
return;
}
if (collationNotSupported(server, options)) {
callback(new MongoError(`server ${server.name} does not support collation`));
return;
}
const unacknowledgedWrite = options.writeConcern && options.writeConcern.w === 0;
if (unacknowledgedWrite || maxWireVersion(server) < 5) {
if ((op === 'update' || op === 'remove') && ops.find(o => o.hint)) {
callback(new MongoError(`servers < 3.4 do not support hint on ${op}`));
return;
}
}
server.s.pool.withConnection((err, conn, cb) => {
if (err) {
markServerUnknown(server, err);
return cb(err);
}
conn[op](ns, ops, options, makeOperationHandler(server, conn, ops, options, cb));
}, callback);
}
function markServerUnknown(server, error) {
if (error instanceof MongoNetworkError && !(error instanceof MongoNetworkTimeoutError)) {
server[kMonitor].reset();
}
server.emit(
'descriptionReceived',
new ServerDescription(server.description.address, null, {
error,
topologyVersion:
error && error.topologyVersion ? error.topologyVersion : server.description.topologyVersion
})
);
}
function connectionIsStale(pool, connection) {
return connection.generation !== pool.generation;
}
function shouldHandleStateChangeError(server, err) {
const etv = err.topologyVersion;
const stv = server.description.topologyVersion;
return compareTopologyVersion(stv, etv) < 0;
}
function inActiveTransaction(session, cmd) {
return session && session.inTransaction() && !isTransactionCommand(cmd);
}
function makeOperationHandler(server, connection, cmd, options, callback) {
const session = options && options.session;
return function handleOperationResult(err, result) {
if (err && !connectionIsStale(server.s.pool, connection)) {
if (err instanceof MongoNetworkError) {
if (session && !session.hasEnded) {
session.serverSession.isDirty = true;
}
if (supportsRetryableWrites(server) && !inActiveTransaction(session, cmd)) {
err.addErrorLabel('RetryableWriteError');
}
if (!(err instanceof MongoNetworkTimeoutError) || isNetworkErrorBeforeHandshake(err)) {
markServerUnknown(server, err);
server.s.pool.clear();
}
} else {
// if pre-4.4 server, then add error label if its a retryable write error
if (
maxWireVersion(server) < 9 &&
isRetryableWriteError(err) &&
!inActiveTransaction(session, cmd)
) {
err.addErrorLabel('RetryableWriteError');
}
if (isSDAMUnrecoverableError(err)) {
if (shouldHandleStateChangeError(server, err)) {
if (maxWireVersion(server) <= 7 || isNodeShuttingDownError(err)) {
server.s.pool.clear();
}
markServerUnknown(server, err);
process.nextTick(() => server.requestCheck());
}
}
}
}
callback(err, result);
};
}
module.exports = {
Server
};

View File

@@ -0,0 +1,227 @@
'use strict';
const arrayStrictEqual = require('../utils').arrayStrictEqual;
const tagsStrictEqual = require('../utils').tagsStrictEqual;
const errorStrictEqual = require('../utils').errorStrictEqual;
const ServerType = require('./common').ServerType;
const now = require('../../utils').now;
const WRITABLE_SERVER_TYPES = new Set([
ServerType.RSPrimary,
ServerType.Standalone,
ServerType.Mongos
]);
const DATA_BEARING_SERVER_TYPES = new Set([
ServerType.RSPrimary,
ServerType.RSSecondary,
ServerType.Mongos,
ServerType.Standalone
]);
const ISMASTER_FIELDS = [
'minWireVersion',
'maxWireVersion',
'maxBsonObjectSize',
'maxMessageSizeBytes',
'maxWriteBatchSize',
'compression',
'me',
'hosts',
'passives',
'arbiters',
'tags',
'setName',
'setVersion',
'electionId',
'primary',
'logicalSessionTimeoutMinutes',
'saslSupportedMechs',
'__nodejs_mock_server__',
'$clusterTime'
];
/**
* The client's view of a single server, based on the most recent ismaster outcome.
*
* Internal type, not meant to be directly instantiated
*/
class ServerDescription {
/**
* Create a ServerDescription
* @param {String} address The address of the server
* @param {Object} [ismaster] An optional ismaster response for this server
* @param {Object} [options] Optional settings
* @param {Number} [options.roundTripTime] The round trip time to ping this server (in ms)
* @param {Error} [options.error] An Error used for better reporting debugging
* @param {any} [options.topologyVersion] The topologyVersion
*/
constructor(address, ismaster, options) {
options = options || {};
ismaster = Object.assign(
{
minWireVersion: 0,
maxWireVersion: 0,
hosts: [],
passives: [],
arbiters: [],
tags: []
},
ismaster
);
this.address = address;
this.error = options.error;
this.roundTripTime = options.roundTripTime || -1;
this.lastUpdateTime = now();
this.lastWriteDate = ismaster.lastWrite ? ismaster.lastWrite.lastWriteDate : null;
this.opTime = ismaster.lastWrite ? ismaster.lastWrite.opTime : null;
this.type = parseServerType(ismaster);
this.topologyVersion = options.topologyVersion || ismaster.topologyVersion;
// direct mappings
ISMASTER_FIELDS.forEach(field => {
if (typeof ismaster[field] !== 'undefined') this[field] = ismaster[field];
});
// normalize case for hosts
if (this.me) this.me = this.me.toLowerCase();
this.hosts = this.hosts.map(host => host.toLowerCase());
this.passives = this.passives.map(host => host.toLowerCase());
this.arbiters = this.arbiters.map(host => host.toLowerCase());
}
get allHosts() {
return this.hosts.concat(this.arbiters).concat(this.passives);
}
/**
* @return {Boolean} Is this server available for reads
*/
get isReadable() {
return this.type === ServerType.RSSecondary || this.isWritable;
}
/**
* @return {Boolean} Is this server data bearing
*/
get isDataBearing() {
return DATA_BEARING_SERVER_TYPES.has(this.type);
}
/**
* @return {Boolean} Is this server available for writes
*/
get isWritable() {
return WRITABLE_SERVER_TYPES.has(this.type);
}
get host() {
const chopLength = `:${this.port}`.length;
return this.address.slice(0, -chopLength);
}
get port() {
const port = this.address.split(':').pop();
return port ? Number.parseInt(port, 10) : port;
}
/**
* Determines if another `ServerDescription` is equal to this one per the rules defined
* in the {@link https://github.com/mongodb/specifications/blob/master/source/server-discovery-and-monitoring/server-discovery-and-monitoring.rst#serverdescription|SDAM spec}
*
* @param {ServerDescription} other
* @return {Boolean}
*/
equals(other) {
const topologyVersionsEqual =
this.topologyVersion === other.topologyVersion ||
compareTopologyVersion(this.topologyVersion, other.topologyVersion) === 0;
return (
other != null &&
errorStrictEqual(this.error, other.error) &&
this.type === other.type &&
this.minWireVersion === other.minWireVersion &&
this.me === other.me &&
arrayStrictEqual(this.hosts, other.hosts) &&
tagsStrictEqual(this.tags, other.tags) &&
this.setName === other.setName &&
this.setVersion === other.setVersion &&
(this.electionId
? other.electionId && this.electionId.equals(other.electionId)
: this.electionId === other.electionId) &&
this.primary === other.primary &&
this.logicalSessionTimeoutMinutes === other.logicalSessionTimeoutMinutes &&
topologyVersionsEqual
);
}
}
/**
* Parses an `ismaster` message and determines the server type
*
* @param {Object} ismaster The `ismaster` message to parse
* @return {ServerType}
*/
function parseServerType(ismaster) {
if (!ismaster || !ismaster.ok) {
return ServerType.Unknown;
}
if (ismaster.isreplicaset) {
return ServerType.RSGhost;
}
if (ismaster.msg && ismaster.msg === 'isdbgrid') {
return ServerType.Mongos;
}
if (ismaster.setName) {
if (ismaster.hidden) {
return ServerType.RSOther;
} else if (ismaster.ismaster) {
return ServerType.RSPrimary;
} else if (ismaster.secondary) {
return ServerType.RSSecondary;
} else if (ismaster.arbiterOnly) {
return ServerType.RSArbiter;
} else {
return ServerType.RSOther;
}
}
return ServerType.Standalone;
}
/**
* Compares two topology versions.
*
* @param {object} lhs
* @param {object} rhs
* @returns A negative number if `lhs` is older than `rhs`; positive if `lhs` is newer than `rhs`; 0 if they are equivalent.
*/
function compareTopologyVersion(lhs, rhs) {
if (lhs == null || rhs == null) {
return -1;
}
if (lhs.processId.equals(rhs.processId)) {
// TODO: handle counters as Longs
if (lhs.counter === rhs.counter) {
return 0;
} else if (lhs.counter < rhs.counter) {
return -1;
}
return 1;
}
return -1;
}
module.exports = {
ServerDescription,
parseServerType,
compareTopologyVersion
};

238
node_modules/mongodb/lib/core/sdam/server_selection.js generated vendored Normal file
View File

@@ -0,0 +1,238 @@
'use strict';
const ServerType = require('./common').ServerType;
const TopologyType = require('./common').TopologyType;
const ReadPreference = require('../topologies/read_preference');
const MongoError = require('../error').MongoError;
// max staleness constants
const IDLE_WRITE_PERIOD = 10000;
const SMALLEST_MAX_STALENESS_SECONDS = 90;
/**
* Returns a server selector that selects for writable servers
*/
function writableServerSelector() {
return function(topologyDescription, servers) {
return latencyWindowReducer(
topologyDescription,
servers.filter(s => s.isWritable)
);
};
}
/**
* Reduces the passed in array of servers by the rules of the "Max Staleness" specification
* found here: https://github.com/mongodb/specifications/blob/master/source/max-staleness/max-staleness.rst
*
* @param {ReadPreference} readPreference The read preference providing max staleness guidance
* @param {topologyDescription} topologyDescription The topology description
* @param {ServerDescription[]} servers The list of server descriptions to be reduced
* @return {ServerDescription[]} The list of servers that satisfy the requirements of max staleness
*/
function maxStalenessReducer(readPreference, topologyDescription, servers) {
if (readPreference.maxStalenessSeconds == null || readPreference.maxStalenessSeconds < 0) {
return servers;
}
const maxStaleness = readPreference.maxStalenessSeconds;
const maxStalenessVariance =
(topologyDescription.heartbeatFrequencyMS + IDLE_WRITE_PERIOD) / 1000;
if (maxStaleness < maxStalenessVariance) {
throw new MongoError(`maxStalenessSeconds must be at least ${maxStalenessVariance} seconds`);
}
if (maxStaleness < SMALLEST_MAX_STALENESS_SECONDS) {
throw new MongoError(
`maxStalenessSeconds must be at least ${SMALLEST_MAX_STALENESS_SECONDS} seconds`
);
}
if (topologyDescription.type === TopologyType.ReplicaSetWithPrimary) {
const primary = Array.from(topologyDescription.servers.values()).filter(primaryFilter)[0];
return servers.reduce((result, server) => {
const stalenessMS =
server.lastUpdateTime -
server.lastWriteDate -
(primary.lastUpdateTime - primary.lastWriteDate) +
topologyDescription.heartbeatFrequencyMS;
const staleness = stalenessMS / 1000;
if (staleness <= readPreference.maxStalenessSeconds) result.push(server);
return result;
}, []);
}
if (topologyDescription.type === TopologyType.ReplicaSetNoPrimary) {
if (servers.length === 0) {
return servers;
}
const sMax = servers.reduce((max, s) => (s.lastWriteDate > max.lastWriteDate ? s : max));
return servers.reduce((result, server) => {
const stalenessMS =
sMax.lastWriteDate - server.lastWriteDate + topologyDescription.heartbeatFrequencyMS;
const staleness = stalenessMS / 1000;
if (staleness <= readPreference.maxStalenessSeconds) result.push(server);
return result;
}, []);
}
return servers;
}
/**
* Determines whether a server's tags match a given set of tags
*
* @param {String[]} tagSet The requested tag set to match
* @param {String[]} serverTags The server's tags
*/
function tagSetMatch(tagSet, serverTags) {
const keys = Object.keys(tagSet);
const serverTagKeys = Object.keys(serverTags);
for (let i = 0; i < keys.length; ++i) {
const key = keys[i];
if (serverTagKeys.indexOf(key) === -1 || serverTags[key] !== tagSet[key]) {
return false;
}
}
return true;
}
/**
* Reduces a set of server descriptions based on tags requested by the read preference
*
* @param {ReadPreference} readPreference The read preference providing the requested tags
* @param {ServerDescription[]} servers The list of server descriptions to reduce
* @return {ServerDescription[]} The list of servers matching the requested tags
*/
function tagSetReducer(readPreference, servers) {
if (
readPreference.tags == null ||
(Array.isArray(readPreference.tags) && readPreference.tags.length === 0)
) {
return servers;
}
for (let i = 0; i < readPreference.tags.length; ++i) {
const tagSet = readPreference.tags[i];
const serversMatchingTagset = servers.reduce((matched, server) => {
if (tagSetMatch(tagSet, server.tags)) matched.push(server);
return matched;
}, []);
if (serversMatchingTagset.length) {
return serversMatchingTagset;
}
}
return [];
}
/**
* Reduces a list of servers to ensure they fall within an acceptable latency window. This is
* further specified in the "Server Selection" specification, found here:
* https://github.com/mongodb/specifications/blob/master/source/server-selection/server-selection.rst
*
* @param {topologyDescription} topologyDescription The topology description
* @param {ServerDescription[]} servers The list of servers to reduce
* @returns {ServerDescription[]} The servers which fall within an acceptable latency window
*/
function latencyWindowReducer(topologyDescription, servers) {
const low = servers.reduce(
(min, server) => (min === -1 ? server.roundTripTime : Math.min(server.roundTripTime, min)),
-1
);
const high = low + topologyDescription.localThresholdMS;
return servers.reduce((result, server) => {
if (server.roundTripTime <= high && server.roundTripTime >= low) result.push(server);
return result;
}, []);
}
// filters
function primaryFilter(server) {
return server.type === ServerType.RSPrimary;
}
function secondaryFilter(server) {
return server.type === ServerType.RSSecondary;
}
function nearestFilter(server) {
return server.type === ServerType.RSSecondary || server.type === ServerType.RSPrimary;
}
function knownFilter(server) {
return server.type !== ServerType.Unknown;
}
/**
* Returns a function which selects servers based on a provided read preference
*
* @param {ReadPreference} readPreference The read preference to select with
*/
function readPreferenceServerSelector(readPreference) {
if (!readPreference.isValid()) {
throw new TypeError('Invalid read preference specified');
}
return function(topologyDescription, servers) {
const commonWireVersion = topologyDescription.commonWireVersion;
if (
commonWireVersion &&
readPreference.minWireVersion &&
readPreference.minWireVersion > commonWireVersion
) {
throw new MongoError(
`Minimum wire version '${readPreference.minWireVersion}' required, but found '${commonWireVersion}'`
);
}
if (topologyDescription.type === TopologyType.Unknown) {
return [];
}
if (
topologyDescription.type === TopologyType.Single ||
topologyDescription.type === TopologyType.Sharded
) {
return latencyWindowReducer(topologyDescription, servers.filter(knownFilter));
}
const mode = readPreference.mode;
if (mode === ReadPreference.PRIMARY) {
return servers.filter(primaryFilter);
}
if (mode === ReadPreference.PRIMARY_PREFERRED) {
const result = servers.filter(primaryFilter);
if (result.length) {
return result;
}
}
const filter = mode === ReadPreference.NEAREST ? nearestFilter : secondaryFilter;
const selectedServers = latencyWindowReducer(
topologyDescription,
tagSetReducer(
readPreference,
maxStalenessReducer(readPreference, topologyDescription, servers.filter(filter))
)
);
if (mode === ReadPreference.SECONDARY_PREFERRED && selectedServers.length === 0) {
return servers.filter(primaryFilter);
}
return selectedServers;
};
}
module.exports = {
writableServerSelector,
readPreferenceServerSelector
};

135
node_modules/mongodb/lib/core/sdam/srv_polling.js generated vendored Normal file
View File

@@ -0,0 +1,135 @@
'use strict';
const Logger = require('../connection/logger');
const EventEmitter = require('events').EventEmitter;
const dns = require('dns');
/**
* Determines whether a provided address matches the provided parent domain in order
* to avoid certain attack vectors.
*
* @param {String} srvAddress The address to check against a domain
* @param {String} parentDomain The domain to check the provided address against
* @return {Boolean} Whether the provided address matches the parent domain
*/
function matchesParentDomain(srvAddress, parentDomain) {
const regex = /^.*?\./;
const srv = `.${srvAddress.replace(regex, '')}`;
const parent = `.${parentDomain.replace(regex, '')}`;
return srv.endsWith(parent);
}
class SrvPollingEvent {
constructor(srvRecords) {
this.srvRecords = srvRecords;
}
addresses() {
return new Set(this.srvRecords.map(record => `${record.name}:${record.port}`));
}
}
class SrvPoller extends EventEmitter {
/**
* @param {object} options
* @param {string} options.srvHost
* @param {number} [options.heartbeatFrequencyMS]
* @param {function} [options.logger]
* @param {string} [options.loggerLevel]
*/
constructor(options) {
super();
if (!options || !options.srvHost) {
throw new TypeError('options for SrvPoller must exist and include srvHost');
}
this.srvHost = options.srvHost;
this.rescanSrvIntervalMS = 60000;
this.heartbeatFrequencyMS = options.heartbeatFrequencyMS || 10000;
this.logger = Logger('srvPoller', options);
this.haMode = false;
this.generation = 0;
this._timeout = null;
}
get srvAddress() {
return `_mongodb._tcp.${this.srvHost}`;
}
get intervalMS() {
return this.haMode ? this.heartbeatFrequencyMS : this.rescanSrvIntervalMS;
}
start() {
if (!this._timeout) {
this.schedule();
}
}
stop() {
if (this._timeout) {
clearTimeout(this._timeout);
this.generation += 1;
this._timeout = null;
}
}
schedule() {
clearTimeout(this._timeout);
this._timeout = setTimeout(() => this._poll(), this.intervalMS);
}
success(srvRecords) {
this.haMode = false;
this.schedule();
this.emit('srvRecordDiscovery', new SrvPollingEvent(srvRecords));
}
failure(message, obj) {
this.logger.warn(message, obj);
this.haMode = true;
this.schedule();
}
parentDomainMismatch(srvRecord) {
this.logger.warn(
`parent domain mismatch on SRV record (${srvRecord.name}:${srvRecord.port})`,
srvRecord
);
}
_poll() {
const generation = this.generation;
dns.resolveSrv(this.srvAddress, (err, srvRecords) => {
if (generation !== this.generation) {
return;
}
if (err) {
this.failure('DNS error', err);
return;
}
const finalAddresses = [];
srvRecords.forEach(record => {
if (matchesParentDomain(record.name, this.srvHost)) {
finalAddresses.push(record);
} else {
this.parentDomainMismatch(record);
}
});
if (!finalAddresses.length) {
this.failure('No valid addresses found at host');
return;
}
this.success(finalAddresses);
});
}
}
module.exports.SrvPollingEvent = SrvPollingEvent;
module.exports.SrvPoller = SrvPoller;

1142
node_modules/mongodb/lib/core/sdam/topology.js generated vendored Normal file

File diff suppressed because it is too large Load Diff

View File

@@ -0,0 +1,441 @@
'use strict';
const ServerType = require('./common').ServerType;
const ServerDescription = require('./server_description').ServerDescription;
const WIRE_CONSTANTS = require('../wireprotocol/constants');
const TopologyType = require('./common').TopologyType;
// contstants related to compatability checks
const MIN_SUPPORTED_SERVER_VERSION = WIRE_CONSTANTS.MIN_SUPPORTED_SERVER_VERSION;
const MAX_SUPPORTED_SERVER_VERSION = WIRE_CONSTANTS.MAX_SUPPORTED_SERVER_VERSION;
const MIN_SUPPORTED_WIRE_VERSION = WIRE_CONSTANTS.MIN_SUPPORTED_WIRE_VERSION;
const MAX_SUPPORTED_WIRE_VERSION = WIRE_CONSTANTS.MAX_SUPPORTED_WIRE_VERSION;
// Representation of a deployment of servers
class TopologyDescription {
/**
* Create a TopologyDescription
*
* @param {string} topologyType
* @param {Map<string, ServerDescription>} serverDescriptions the a map of address to ServerDescription
* @param {string} setName
* @param {number} maxSetVersion
* @param {ObjectId} maxElectionId
*/
constructor(
topologyType,
serverDescriptions,
setName,
maxSetVersion,
maxElectionId,
commonWireVersion,
options
) {
options = options || {};
// TODO: consider assigning all these values to a temporary value `s` which
// we use `Object.freeze` on, ensuring the internal state of this type
// is immutable.
this.type = topologyType || TopologyType.Unknown;
this.setName = setName || null;
this.maxSetVersion = maxSetVersion || null;
this.maxElectionId = maxElectionId || null;
this.servers = serverDescriptions || new Map();
this.stale = false;
this.compatible = true;
this.compatibilityError = null;
this.logicalSessionTimeoutMinutes = null;
this.heartbeatFrequencyMS = options.heartbeatFrequencyMS || 0;
this.localThresholdMS = options.localThresholdMS || 0;
this.commonWireVersion = commonWireVersion || null;
// save this locally, but don't display when printing the instance out
Object.defineProperty(this, 'options', { value: options, enumberable: false });
// determine server compatibility
for (const serverDescription of this.servers.values()) {
if (serverDescription.type === ServerType.Unknown) continue;
if (serverDescription.minWireVersion > MAX_SUPPORTED_WIRE_VERSION) {
this.compatible = false;
this.compatibilityError = `Server at ${serverDescription.address} requires wire version ${serverDescription.minWireVersion}, but this version of the driver only supports up to ${MAX_SUPPORTED_WIRE_VERSION} (MongoDB ${MAX_SUPPORTED_SERVER_VERSION})`;
}
if (serverDescription.maxWireVersion < MIN_SUPPORTED_WIRE_VERSION) {
this.compatible = false;
this.compatibilityError = `Server at ${serverDescription.address} reports wire version ${serverDescription.maxWireVersion}, but this version of the driver requires at least ${MIN_SUPPORTED_WIRE_VERSION} (MongoDB ${MIN_SUPPORTED_SERVER_VERSION}).`;
break;
}
}
// Whenever a client updates the TopologyDescription from an ismaster response, it MUST set
// TopologyDescription.logicalSessionTimeoutMinutes to the smallest logicalSessionTimeoutMinutes
// value among ServerDescriptions of all data-bearing server types. If any have a null
// logicalSessionTimeoutMinutes, then TopologyDescription.logicalSessionTimeoutMinutes MUST be
// set to null.
const readableServers = Array.from(this.servers.values()).filter(s => s.isReadable);
this.logicalSessionTimeoutMinutes = readableServers.reduce((result, server) => {
if (server.logicalSessionTimeoutMinutes == null) return null;
if (result == null) return server.logicalSessionTimeoutMinutes;
return Math.min(result, server.logicalSessionTimeoutMinutes);
}, null);
}
/**
* Returns a new TopologyDescription based on the SrvPollingEvent
* @param {SrvPollingEvent} ev The event
*/
updateFromSrvPollingEvent(ev) {
const newAddresses = ev.addresses();
const serverDescriptions = new Map(this.servers);
for (const server of this.servers) {
if (newAddresses.has(server[0])) {
newAddresses.delete(server[0]);
} else {
serverDescriptions.delete(server[0]);
}
}
if (serverDescriptions.size === this.servers.size && newAddresses.size === 0) {
return this;
}
for (const address of newAddresses) {
serverDescriptions.set(address, new ServerDescription(address));
}
return new TopologyDescription(
this.type,
serverDescriptions,
this.setName,
this.maxSetVersion,
this.maxElectionId,
this.commonWireVersion,
this.options,
null
);
}
/**
* Returns a copy of this description updated with a given ServerDescription
*
* @param {ServerDescription} serverDescription
*/
update(serverDescription) {
const address = serverDescription.address;
// NOTE: there are a number of prime targets for refactoring here
// once we support destructuring assignments
// potentially mutated values
let topologyType = this.type;
let setName = this.setName;
let maxSetVersion = this.maxSetVersion;
let maxElectionId = this.maxElectionId;
let commonWireVersion = this.commonWireVersion;
if (serverDescription.setName && setName && serverDescription.setName !== setName) {
serverDescription = new ServerDescription(address, null);
}
const serverType = serverDescription.type;
let serverDescriptions = new Map(this.servers);
// update common wire version
if (serverDescription.maxWireVersion !== 0) {
if (commonWireVersion == null) {
commonWireVersion = serverDescription.maxWireVersion;
} else {
commonWireVersion = Math.min(commonWireVersion, serverDescription.maxWireVersion);
}
}
// update the actual server description
serverDescriptions.set(address, serverDescription);
if (topologyType === TopologyType.Single) {
// once we are defined as single, that never changes
return new TopologyDescription(
TopologyType.Single,
serverDescriptions,
setName,
maxSetVersion,
maxElectionId,
commonWireVersion,
this.options
);
}
if (topologyType === TopologyType.Unknown) {
if (serverType === ServerType.Standalone && this.servers.size !== 1) {
serverDescriptions.delete(address);
} else {
topologyType = topologyTypeForServerType(serverType);
}
}
if (topologyType === TopologyType.Sharded) {
if ([ServerType.Mongos, ServerType.Unknown].indexOf(serverType) === -1) {
serverDescriptions.delete(address);
}
}
if (topologyType === TopologyType.ReplicaSetNoPrimary) {
if ([ServerType.Standalone, ServerType.Mongos].indexOf(serverType) >= 0) {
serverDescriptions.delete(address);
}
if (serverType === ServerType.RSPrimary) {
const result = updateRsFromPrimary(
serverDescriptions,
setName,
serverDescription,
maxSetVersion,
maxElectionId
);
(topologyType = result[0]),
(setName = result[1]),
(maxSetVersion = result[2]),
(maxElectionId = result[3]);
} else if (
[ServerType.RSSecondary, ServerType.RSArbiter, ServerType.RSOther].indexOf(serverType) >= 0
) {
const result = updateRsNoPrimaryFromMember(serverDescriptions, setName, serverDescription);
(topologyType = result[0]), (setName = result[1]);
}
}
if (topologyType === TopologyType.ReplicaSetWithPrimary) {
if ([ServerType.Standalone, ServerType.Mongos].indexOf(serverType) >= 0) {
serverDescriptions.delete(address);
topologyType = checkHasPrimary(serverDescriptions);
} else if (serverType === ServerType.RSPrimary) {
const result = updateRsFromPrimary(
serverDescriptions,
setName,
serverDescription,
maxSetVersion,
maxElectionId
);
(topologyType = result[0]),
(setName = result[1]),
(maxSetVersion = result[2]),
(maxElectionId = result[3]);
} else if (
[ServerType.RSSecondary, ServerType.RSArbiter, ServerType.RSOther].indexOf(serverType) >= 0
) {
topologyType = updateRsWithPrimaryFromMember(
serverDescriptions,
setName,
serverDescription
);
} else {
topologyType = checkHasPrimary(serverDescriptions);
}
}
return new TopologyDescription(
topologyType,
serverDescriptions,
setName,
maxSetVersion,
maxElectionId,
commonWireVersion,
this.options
);
}
get error() {
const descriptionsWithError = Array.from(this.servers.values()).filter(sd => sd.error);
if (descriptionsWithError.length > 0) {
return descriptionsWithError[0].error;
}
}
/**
* Determines if the topology description has any known servers
*/
get hasKnownServers() {
return Array.from(this.servers.values()).some(sd => sd.type !== ServerType.Unknown);
}
/**
* Determines if this topology description has a data-bearing server available.
*/
get hasDataBearingServers() {
return Array.from(this.servers.values()).some(sd => sd.isDataBearing);
}
/**
* Determines if the topology has a definition for the provided address
*
* @param {String} address
* @return {Boolean} Whether the topology knows about this server
*/
hasServer(address) {
return this.servers.has(address);
}
}
function topologyTypeForServerType(serverType) {
if (serverType === ServerType.Standalone) {
return TopologyType.Single;
}
if (serverType === ServerType.Mongos) {
return TopologyType.Sharded;
}
if (serverType === ServerType.RSPrimary) {
return TopologyType.ReplicaSetWithPrimary;
}
if (serverType === ServerType.RSGhost || serverType === ServerType.Unknown) {
return TopologyType.Unknown;
}
return TopologyType.ReplicaSetNoPrimary;
}
function compareObjectId(oid1, oid2) {
if (oid1 == null) {
return -1;
}
if (oid2 == null) {
return 1;
}
if (oid1.id instanceof Buffer && oid2.id instanceof Buffer) {
const oid1Buffer = oid1.id;
const oid2Buffer = oid2.id;
return oid1Buffer.compare(oid2Buffer);
}
const oid1String = oid1.toString();
const oid2String = oid2.toString();
return oid1String.localeCompare(oid2String);
}
function updateRsFromPrimary(
serverDescriptions,
setName,
serverDescription,
maxSetVersion,
maxElectionId
) {
setName = setName || serverDescription.setName;
if (setName !== serverDescription.setName) {
serverDescriptions.delete(serverDescription.address);
return [checkHasPrimary(serverDescriptions), setName, maxSetVersion, maxElectionId];
}
const electionId = serverDescription.electionId ? serverDescription.electionId : null;
if (serverDescription.setVersion && electionId) {
if (maxSetVersion && maxElectionId) {
if (
maxSetVersion > serverDescription.setVersion ||
compareObjectId(maxElectionId, electionId) > 0
) {
// this primary is stale, we must remove it
serverDescriptions.set(
serverDescription.address,
new ServerDescription(serverDescription.address)
);
return [checkHasPrimary(serverDescriptions), setName, maxSetVersion, maxElectionId];
}
}
maxElectionId = serverDescription.electionId;
}
if (
serverDescription.setVersion != null &&
(maxSetVersion == null || serverDescription.setVersion > maxSetVersion)
) {
maxSetVersion = serverDescription.setVersion;
}
// We've heard from the primary. Is it the same primary as before?
for (const address of serverDescriptions.keys()) {
const server = serverDescriptions.get(address);
if (server.type === ServerType.RSPrimary && server.address !== serverDescription.address) {
// Reset old primary's type to Unknown.
serverDescriptions.set(address, new ServerDescription(server.address));
// There can only be one primary
break;
}
}
// Discover new hosts from this primary's response.
serverDescription.allHosts.forEach(address => {
if (!serverDescriptions.has(address)) {
serverDescriptions.set(address, new ServerDescription(address));
}
});
// Remove hosts not in the response.
const currentAddresses = Array.from(serverDescriptions.keys());
const responseAddresses = serverDescription.allHosts;
currentAddresses
.filter(addr => responseAddresses.indexOf(addr) === -1)
.forEach(address => {
serverDescriptions.delete(address);
});
return [checkHasPrimary(serverDescriptions), setName, maxSetVersion, maxElectionId];
}
function updateRsWithPrimaryFromMember(serverDescriptions, setName, serverDescription) {
if (setName == null) {
throw new TypeError('setName is required');
}
if (
setName !== serverDescription.setName ||
(serverDescription.me && serverDescription.address !== serverDescription.me)
) {
serverDescriptions.delete(serverDescription.address);
}
return checkHasPrimary(serverDescriptions);
}
function updateRsNoPrimaryFromMember(serverDescriptions, setName, serverDescription) {
let topologyType = TopologyType.ReplicaSetNoPrimary;
setName = setName || serverDescription.setName;
if (setName !== serverDescription.setName) {
serverDescriptions.delete(serverDescription.address);
return [topologyType, setName];
}
serverDescription.allHosts.forEach(address => {
if (!serverDescriptions.has(address)) {
serverDescriptions.set(address, new ServerDescription(address));
}
});
if (serverDescription.me && serverDescription.address !== serverDescription.me) {
serverDescriptions.delete(serverDescription.address);
}
return [topologyType, setName];
}
function checkHasPrimary(serverDescriptions) {
for (const addr of serverDescriptions.keys()) {
if (serverDescriptions.get(addr).type === ServerType.RSPrimary) {
return TopologyType.ReplicaSetWithPrimary;
}
}
return TopologyType.ReplicaSetNoPrimary;
}
module.exports = {
TopologyDescription
};

780
node_modules/mongodb/lib/core/sessions.js generated vendored Normal file
View File

@@ -0,0 +1,780 @@
'use strict';
const retrieveBSON = require('./connection/utils').retrieveBSON;
const EventEmitter = require('events');
const BSON = retrieveBSON();
const Binary = BSON.Binary;
const uuidV4 = require('./utils').uuidV4;
const MongoError = require('./error').MongoError;
const isRetryableError = require('././error').isRetryableError;
const MongoNetworkError = require('./error').MongoNetworkError;
const MongoWriteConcernError = require('./error').MongoWriteConcernError;
const Transaction = require('./transactions').Transaction;
const TxnState = require('./transactions').TxnState;
const isPromiseLike = require('./utils').isPromiseLike;
const ReadPreference = require('./topologies/read_preference');
const maybePromise = require('../utils').maybePromise;
const isTransactionCommand = require('./transactions').isTransactionCommand;
const resolveClusterTime = require('./topologies/shared').resolveClusterTime;
const isSharded = require('./wireprotocol/shared').isSharded;
const maxWireVersion = require('./utils').maxWireVersion;
const now = require('./../utils').now;
const calculateDurationInMs = require('./../utils').calculateDurationInMs;
const minWireVersionForShardedTransactions = 8;
function assertAlive(session, callback) {
if (session.serverSession == null) {
const error = new MongoError('Cannot use a session that has ended');
if (typeof callback === 'function') {
callback(error, null);
return false;
}
throw error;
}
return true;
}
/**
* Options to pass when creating a Client Session
* @typedef {Object} SessionOptions
* @property {boolean} [causalConsistency=true] Whether causal consistency should be enabled on this session
* @property {TransactionOptions} [defaultTransactionOptions] The default TransactionOptions to use for transactions started on this session.
*/
/**
* A BSON document reflecting the lsid of a {@link ClientSession}
* @typedef {Object} SessionId
*/
const kServerSession = Symbol('serverSession');
/**
* A class representing a client session on the server
* WARNING: not meant to be instantiated directly.
* @class
* @hideconstructor
*/
class ClientSession extends EventEmitter {
/**
* Create a client session.
* WARNING: not meant to be instantiated directly
*
* @param {Topology} topology The current client's topology (Internal Class)
* @param {ServerSessionPool} sessionPool The server session pool (Internal Class)
* @param {SessionOptions} [options] Optional settings
* @param {Object} [clientOptions] Optional settings provided when creating a client in the porcelain driver
*/
constructor(topology, sessionPool, options, clientOptions) {
super();
if (topology == null) {
throw new Error('ClientSession requires a topology');
}
if (sessionPool == null || !(sessionPool instanceof ServerSessionPool)) {
throw new Error('ClientSession requires a ServerSessionPool');
}
options = options || {};
clientOptions = clientOptions || {};
this.topology = topology;
this.sessionPool = sessionPool;
this.hasEnded = false;
this.clientOptions = clientOptions;
this[kServerSession] = undefined;
this.supports = {
causalConsistency:
typeof options.causalConsistency !== 'undefined' ? options.causalConsistency : true
};
this.clusterTime = options.initialClusterTime;
this.operationTime = null;
this.explicit = !!options.explicit;
this.owner = options.owner;
this.defaultTransactionOptions = Object.assign({}, options.defaultTransactionOptions);
this.transaction = new Transaction();
}
/**
* The server id associated with this session
* @type {SessionId}
*/
get id() {
return this.serverSession.id;
}
get serverSession() {
if (this[kServerSession] == null) {
this[kServerSession] = this.sessionPool.acquire();
}
return this[kServerSession];
}
/**
* Ends this session on the server
*
* @param {Object} [options] Optional settings. Currently reserved for future use
* @param {Function} [callback] Optional callback for completion of this operation
*/
endSession(options, callback) {
if (typeof options === 'function') (callback = options), (options = {});
options = options || {};
const session = this;
return maybePromise(this, callback, done => {
if (session.hasEnded) {
return done();
}
function completeEndSession() {
// release the server session back to the pool
session.sessionPool.release(session.serverSession);
session[kServerSession] = undefined;
// mark the session as ended, and emit a signal
session.hasEnded = true;
session.emit('ended', session);
// spec indicates that we should ignore all errors for `endSessions`
done();
}
if (session.serverSession && session.inTransaction()) {
session.abortTransaction(err => {
if (err) return done(err);
completeEndSession();
});
return;
}
completeEndSession();
});
}
/**
* Advances the operationTime for a ClientSession.
*
* @param {Timestamp} operationTime the `BSON.Timestamp` of the operation type it is desired to advance to
*/
advanceOperationTime(operationTime) {
if (this.operationTime == null) {
this.operationTime = operationTime;
return;
}
if (operationTime.greaterThan(this.operationTime)) {
this.operationTime = operationTime;
}
}
/**
* Used to determine if this session equals another
* @param {ClientSession} session
* @return {boolean} true if the sessions are equal
*/
equals(session) {
if (!(session instanceof ClientSession)) {
return false;
}
return this.id.id.buffer.equals(session.id.id.buffer);
}
/**
* Increment the transaction number on the internal ServerSession
*/
incrementTransactionNumber() {
this.serverSession.txnNumber++;
}
/**
* @returns {boolean} whether this session is currently in a transaction or not
*/
inTransaction() {
return this.transaction.isActive;
}
/**
* Starts a new transaction with the given options.
*
* @param {TransactionOptions} options Options for the transaction
*/
startTransaction(options) {
assertAlive(this);
if (this.inTransaction()) {
throw new MongoError('Transaction already in progress');
}
const topologyMaxWireVersion = maxWireVersion(this.topology);
if (
isSharded(this.topology) &&
topologyMaxWireVersion != null &&
topologyMaxWireVersion < minWireVersionForShardedTransactions
) {
throw new MongoError('Transactions are not supported on sharded clusters in MongoDB < 4.2.');
}
// increment txnNumber
this.incrementTransactionNumber();
// create transaction state
this.transaction = new Transaction(
Object.assign({}, this.clientOptions, options || this.defaultTransactionOptions)
);
this.transaction.transition(TxnState.STARTING_TRANSACTION);
}
/**
* Commits the currently active transaction in this session.
*
* @param {Function} [callback] optional callback for completion of this operation
* @return {Promise} A promise is returned if no callback is provided
*/
commitTransaction(callback) {
return maybePromise(this, callback, done => endTransaction(this, 'commitTransaction', done));
}
/**
* Aborts the currently active transaction in this session.
*
* @param {Function} [callback] optional callback for completion of this operation
* @return {Promise} A promise is returned if no callback is provided
*/
abortTransaction(callback) {
return maybePromise(this, callback, done => endTransaction(this, 'abortTransaction', done));
}
/**
* This is here to ensure that ClientSession is never serialized to BSON.
* @ignore
*/
toBSON() {
throw new Error('ClientSession cannot be serialized to BSON.');
}
/**
* A user provided function to be run within a transaction
*
* @callback WithTransactionCallback
* @param {ClientSession} session The parent session of the transaction running the operation. This should be passed into each operation within the lambda.
* @returns {Promise} The resulting Promise of operations run within this transaction
*/
/**
* Runs a provided lambda within a transaction, retrying either the commit operation
* or entire transaction as needed (and when the error permits) to better ensure that
* the transaction can complete successfully.
*
* IMPORTANT: This method requires the user to return a Promise, all lambdas that do not
* return a Promise will result in undefined behavior.
*
* @param {WithTransactionCallback} fn
* @param {TransactionOptions} [options] Optional settings for the transaction
*/
withTransaction(fn, options) {
const startTime = now();
return attemptTransaction(this, startTime, fn, options);
}
}
const MAX_WITH_TRANSACTION_TIMEOUT = 120000;
const UNSATISFIABLE_WRITE_CONCERN_CODE = 100;
const UNKNOWN_REPL_WRITE_CONCERN_CODE = 79;
const MAX_TIME_MS_EXPIRED_CODE = 50;
const NON_DETERMINISTIC_WRITE_CONCERN_ERRORS = new Set([
'CannotSatisfyWriteConcern',
'UnknownReplWriteConcern',
'UnsatisfiableWriteConcern'
]);
function hasNotTimedOut(startTime, max) {
return calculateDurationInMs(startTime) < max;
}
function isUnknownTransactionCommitResult(err) {
return (
isMaxTimeMSExpiredError(err) ||
(!NON_DETERMINISTIC_WRITE_CONCERN_ERRORS.has(err.codeName) &&
err.code !== UNSATISFIABLE_WRITE_CONCERN_CODE &&
err.code !== UNKNOWN_REPL_WRITE_CONCERN_CODE)
);
}
function isMaxTimeMSExpiredError(err) {
if (err == null) return false;
return (
err.code === MAX_TIME_MS_EXPIRED_CODE ||
(err.writeConcernError && err.writeConcernError.code === MAX_TIME_MS_EXPIRED_CODE)
);
}
function attemptTransactionCommit(session, startTime, fn, options) {
return session.commitTransaction().catch(err => {
if (
err instanceof MongoError &&
hasNotTimedOut(startTime, MAX_WITH_TRANSACTION_TIMEOUT) &&
!isMaxTimeMSExpiredError(err)
) {
if (err.hasErrorLabel('UnknownTransactionCommitResult')) {
return attemptTransactionCommit(session, startTime, fn, options);
}
if (err.hasErrorLabel('TransientTransactionError')) {
return attemptTransaction(session, startTime, fn, options);
}
}
throw err;
});
}
const USER_EXPLICIT_TXN_END_STATES = new Set([
TxnState.NO_TRANSACTION,
TxnState.TRANSACTION_COMMITTED,
TxnState.TRANSACTION_ABORTED
]);
function userExplicitlyEndedTransaction(session) {
return USER_EXPLICIT_TXN_END_STATES.has(session.transaction.state);
}
function attemptTransaction(session, startTime, fn, options) {
session.startTransaction(options);
let promise;
try {
promise = fn(session);
} catch (err) {
promise = Promise.reject(err);
}
if (!isPromiseLike(promise)) {
session.abortTransaction();
throw new TypeError('Function provided to `withTransaction` must return a Promise');
}
return promise
.then(() => {
if (userExplicitlyEndedTransaction(session)) {
return;
}
return attemptTransactionCommit(session, startTime, fn, options);
})
.catch(err => {
function maybeRetryOrThrow(err) {
if (
err instanceof MongoError &&
err.hasErrorLabel('TransientTransactionError') &&
hasNotTimedOut(startTime, MAX_WITH_TRANSACTION_TIMEOUT)
) {
return attemptTransaction(session, startTime, fn, options);
}
if (isMaxTimeMSExpiredError(err)) {
err.addErrorLabel('UnknownTransactionCommitResult');
}
throw err;
}
if (session.transaction.isActive) {
return session.abortTransaction().then(() => maybeRetryOrThrow(err));
}
return maybeRetryOrThrow(err);
});
}
function endTransaction(session, commandName, callback) {
if (!assertAlive(session, callback)) {
// checking result in case callback was called
return;
}
// handle any initial problematic cases
let txnState = session.transaction.state;
if (txnState === TxnState.NO_TRANSACTION) {
callback(new MongoError('No transaction started'));
return;
}
if (commandName === 'commitTransaction') {
if (
txnState === TxnState.STARTING_TRANSACTION ||
txnState === TxnState.TRANSACTION_COMMITTED_EMPTY
) {
// the transaction was never started, we can safely exit here
session.transaction.transition(TxnState.TRANSACTION_COMMITTED_EMPTY);
callback(null, null);
return;
}
if (txnState === TxnState.TRANSACTION_ABORTED) {
callback(new MongoError('Cannot call commitTransaction after calling abortTransaction'));
return;
}
} else {
if (txnState === TxnState.STARTING_TRANSACTION) {
// the transaction was never started, we can safely exit here
session.transaction.transition(TxnState.TRANSACTION_ABORTED);
callback(null, null);
return;
}
if (txnState === TxnState.TRANSACTION_ABORTED) {
callback(new MongoError('Cannot call abortTransaction twice'));
return;
}
if (
txnState === TxnState.TRANSACTION_COMMITTED ||
txnState === TxnState.TRANSACTION_COMMITTED_EMPTY
) {
callback(new MongoError('Cannot call abortTransaction after calling commitTransaction'));
return;
}
}
// construct and send the command
const command = { [commandName]: 1 };
// apply a writeConcern if specified
let writeConcern;
if (session.transaction.options.writeConcern) {
writeConcern = Object.assign({}, session.transaction.options.writeConcern);
} else if (session.clientOptions && session.clientOptions.w) {
writeConcern = { w: session.clientOptions.w };
}
if (txnState === TxnState.TRANSACTION_COMMITTED) {
writeConcern = Object.assign({ wtimeout: 10000 }, writeConcern, { w: 'majority' });
}
if (writeConcern) {
Object.assign(command, { writeConcern });
}
if (commandName === 'commitTransaction' && session.transaction.options.maxTimeMS) {
Object.assign(command, { maxTimeMS: session.transaction.options.maxTimeMS });
}
function commandHandler(e, r) {
if (commandName === 'commitTransaction') {
session.transaction.transition(TxnState.TRANSACTION_COMMITTED);
if (
e &&
(e instanceof MongoNetworkError ||
e instanceof MongoWriteConcernError ||
isRetryableError(e) ||
isMaxTimeMSExpiredError(e))
) {
if (isUnknownTransactionCommitResult(e)) {
e.addErrorLabel('UnknownTransactionCommitResult');
// per txns spec, must unpin session in this case
session.transaction.unpinServer();
}
}
} else {
session.transaction.transition(TxnState.TRANSACTION_ABORTED);
}
callback(e, r);
}
// The spec indicates that we should ignore all errors on `abortTransaction`
function transactionError(err) {
return commandName === 'commitTransaction' ? err : null;
}
if (
// Assumption here that commandName is "commitTransaction" or "abortTransaction"
session.transaction.recoveryToken &&
supportsRecoveryToken(session)
) {
command.recoveryToken = session.transaction.recoveryToken;
}
// send the command
session.topology.command('admin.$cmd', command, { session }, (err, reply) => {
if (err && isRetryableError(err)) {
// SPEC-1185: apply majority write concern when retrying commitTransaction
if (command.commitTransaction) {
// per txns spec, must unpin session in this case
session.transaction.unpinServer();
command.writeConcern = Object.assign({ wtimeout: 10000 }, command.writeConcern, {
w: 'majority'
});
}
return session.topology.command('admin.$cmd', command, { session }, (_err, _reply) =>
commandHandler(transactionError(_err), _reply)
);
}
commandHandler(transactionError(err), reply);
});
}
function supportsRecoveryToken(session) {
const topology = session.topology;
return !!topology.s.options.useRecoveryToken;
}
/**
* Reflects the existence of a session on the server. Can be reused by the session pool.
* WARNING: not meant to be instantiated directly. For internal use only.
* @ignore
*/
class ServerSession {
constructor() {
this.id = { id: new Binary(uuidV4(), Binary.SUBTYPE_UUID) };
this.lastUse = now();
this.txnNumber = 0;
this.isDirty = false;
}
/**
* Determines if the server session has timed out.
* @ignore
* @param {Date} sessionTimeoutMinutes The server's "logicalSessionTimeoutMinutes"
* @return {boolean} true if the session has timed out.
*/
hasTimedOut(sessionTimeoutMinutes) {
// Take the difference of the lastUse timestamp and now, which will result in a value in
// milliseconds, and then convert milliseconds to minutes to compare to `sessionTimeoutMinutes`
const idleTimeMinutes = Math.round(
((calculateDurationInMs(this.lastUse) % 86400000) % 3600000) / 60000
);
return idleTimeMinutes > sessionTimeoutMinutes - 1;
}
}
/**
* Maintains a pool of Server Sessions.
* For internal use only
* @ignore
*/
class ServerSessionPool {
constructor(topology) {
if (topology == null) {
throw new Error('ServerSessionPool requires a topology');
}
this.topology = topology;
this.sessions = [];
}
/**
* Ends all sessions in the session pool.
* @ignore
*/
endAllPooledSessions(callback) {
if (this.sessions.length) {
this.topology.endSessions(
this.sessions.map(session => session.id),
() => {
this.sessions = [];
if (typeof callback === 'function') {
callback();
}
}
);
return;
}
if (typeof callback === 'function') {
callback();
}
}
/**
* Acquire a Server Session from the pool.
* Iterates through each session in the pool, removing any stale sessions
* along the way. The first non-stale session found is removed from the
* pool and returned. If no non-stale session is found, a new ServerSession
* is created.
* @ignore
* @returns {ServerSession}
*/
acquire() {
const sessionTimeoutMinutes = this.topology.logicalSessionTimeoutMinutes;
while (this.sessions.length) {
const session = this.sessions.shift();
if (!session.hasTimedOut(sessionTimeoutMinutes)) {
return session;
}
}
return new ServerSession();
}
/**
* Release a session to the session pool
* Adds the session back to the session pool if the session has not timed out yet.
* This method also removes any stale sessions from the pool.
* @ignore
* @param {ServerSession} session The session to release to the pool
*/
release(session) {
const sessionTimeoutMinutes = this.topology.logicalSessionTimeoutMinutes;
while (this.sessions.length) {
const pooledSession = this.sessions[this.sessions.length - 1];
if (pooledSession.hasTimedOut(sessionTimeoutMinutes)) {
this.sessions.pop();
} else {
break;
}
}
if (!session.hasTimedOut(sessionTimeoutMinutes)) {
if (session.isDirty) {
return;
}
// otherwise, readd this session to the session pool
this.sessions.unshift(session);
}
}
}
// TODO: this should be codified in command construction
// @see https://github.com/mongodb/specifications/blob/master/source/read-write-concern/read-write-concern.rst#read-concern
function commandSupportsReadConcern(command, options) {
if (
command.aggregate ||
command.count ||
command.distinct ||
command.find ||
command.parallelCollectionScan ||
command.geoNear ||
command.geoSearch
) {
return true;
}
if (
command.mapReduce &&
options &&
options.out &&
(options.out.inline === 1 || options.out === 'inline')
) {
return true;
}
return false;
}
/**
* Optionally decorate a command with sessions specific keys
*
* @ignore
* @param {ClientSession} session the session tracking transaction state
* @param {Object} command the command to decorate
* @param {Object} topology the topology for tracking the cluster time
* @param {Object} [options] Optional settings passed to calling operation
* @return {MongoError|null} An error, if some error condition was met
*/
function applySession(session, command, options) {
if (session.hasEnded) {
// TODO: merge this with `assertAlive`, did not want to throw a try/catch here
return new MongoError('Cannot use a session that has ended');
}
// SPEC-1019: silently ignore explicit session with unacknowledged write for backwards compatibility
if (options && options.writeConcern && options.writeConcern.w === 0) {
return;
}
const serverSession = session.serverSession;
serverSession.lastUse = now();
command.lsid = serverSession.id;
// first apply non-transaction-specific sessions data
const inTransaction = session.inTransaction() || isTransactionCommand(command);
const isRetryableWrite = options.willRetryWrite;
const shouldApplyReadConcern = commandSupportsReadConcern(command, options);
if (serverSession.txnNumber && (isRetryableWrite || inTransaction)) {
command.txnNumber = BSON.Long.fromNumber(serverSession.txnNumber);
}
// now attempt to apply transaction-specific sessions data
if (!inTransaction) {
if (session.transaction.state !== TxnState.NO_TRANSACTION) {
session.transaction.transition(TxnState.NO_TRANSACTION);
}
// TODO: the following should only be applied to read operation per spec.
// for causal consistency
if (session.supports.causalConsistency && session.operationTime && shouldApplyReadConcern) {
command.readConcern = command.readConcern || {};
Object.assign(command.readConcern, { afterClusterTime: session.operationTime });
}
return;
}
if (options.readPreference && !options.readPreference.equals(ReadPreference.primary)) {
return new MongoError(
`Read preference in a transaction must be primary, not: ${options.readPreference.mode}`
);
}
// `autocommit` must always be false to differentiate from retryable writes
command.autocommit = false;
if (session.transaction.state === TxnState.STARTING_TRANSACTION) {
session.transaction.transition(TxnState.TRANSACTION_IN_PROGRESS);
command.startTransaction = true;
const readConcern =
session.transaction.options.readConcern || session.clientOptions.readConcern;
if (readConcern) {
command.readConcern = readConcern;
}
if (session.supports.causalConsistency && session.operationTime) {
command.readConcern = command.readConcern || {};
Object.assign(command.readConcern, { afterClusterTime: session.operationTime });
}
}
}
function updateSessionFromResponse(session, document) {
if (document.$clusterTime) {
resolveClusterTime(session, document.$clusterTime);
}
if (document.operationTime && session && session.supports.causalConsistency) {
session.advanceOperationTime(document.operationTime);
}
if (document.recoveryToken && session && session.inTransaction()) {
session.transaction._recoveryToken = document.recoveryToken;
}
}
module.exports = {
ClientSession,
ServerSession,
ServerSessionPool,
TxnState,
applySession,
updateSessionFromResponse,
commandSupportsReadConcern
};

61
node_modules/mongodb/lib/core/tools/smoke_plugin.js generated vendored Normal file
View File

@@ -0,0 +1,61 @@
'use strict';
var fs = require('fs');
/* Note: because this plugin uses process.on('uncaughtException'), only one
* of these can exist at any given time. This plugin and anything else that
* uses process.on('uncaughtException') will conflict. */
exports.attachToRunner = function(runner, outputFile) {
var smokeOutput = { results: [] };
var runningTests = {};
var integraPlugin = {
beforeTest: function(test, callback) {
test.startTime = Date.now();
runningTests[test.name] = test;
callback();
},
afterTest: function(test, callback) {
smokeOutput.results.push({
status: test.status,
start: test.startTime,
end: Date.now(),
test_file: test.name,
exit_code: 0,
url: ''
});
delete runningTests[test.name];
callback();
},
beforeExit: function(obj, callback) {
fs.writeFile(outputFile, JSON.stringify(smokeOutput), function() {
callback();
});
}
};
// In case of exception, make sure we write file
process.on('uncaughtException', function(err) {
// Mark all currently running tests as failed
for (var testName in runningTests) {
smokeOutput.results.push({
status: 'fail',
start: runningTests[testName].startTime,
end: Date.now(),
test_file: testName,
exit_code: 0,
url: ''
});
}
// write file
fs.writeFileSync(outputFile, JSON.stringify(smokeOutput));
// Standard NodeJS uncaught exception handler
console.error(err.stack);
process.exit(1);
});
runner.plugin(integraPlugin);
return integraPlugin;
};

1396
node_modules/mongodb/lib/core/topologies/mongos.js generated vendored Normal file

File diff suppressed because it is too large Load Diff

View File

@@ -0,0 +1,266 @@
'use strict';
/**
* The **ReadPreference** class is a class that represents a MongoDB ReadPreference and is
* used to construct connections.
* @class
* @param {string} mode A string describing the read preference mode (primary|primaryPreferred|secondary|secondaryPreferred|nearest)
* @param {array} tags The tags object
* @param {object} [options] Additional read preference options
* @param {number} [options.maxStalenessSeconds] Max secondary read staleness in seconds, Minimum value is 90 seconds.
* @param {object} [options.hedge] Server mode in which the same query is dispatched in parallel to multiple replica set members.
* @param {boolean} [options.hedge.enabled] Explicitly enable or disable hedged reads.
* @see https://docs.mongodb.com/manual/core/read-preference/
* @return {ReadPreference}
*/
const ReadPreference = function(mode, tags, options) {
if (!ReadPreference.isValid(mode)) {
throw new TypeError(`Invalid read preference mode ${mode}`);
}
// TODO(major): tags MUST be an array of tagsets
if (tags && !Array.isArray(tags)) {
console.warn(
'ReadPreference tags must be an array, this will change in the next major version'
);
const tagsHasMaxStalenessSeconds = typeof tags.maxStalenessSeconds !== 'undefined';
const tagsHasHedge = typeof tags.hedge !== 'undefined';
const tagsHasOptions = tagsHasMaxStalenessSeconds || tagsHasHedge;
if (tagsHasOptions) {
// this is likely an options object
options = tags;
tags = undefined;
} else {
tags = [tags];
}
}
this.mode = mode;
this.tags = tags;
this.hedge = options && options.hedge;
options = options || {};
if (options.maxStalenessSeconds != null) {
if (options.maxStalenessSeconds <= 0) {
throw new TypeError('maxStalenessSeconds must be a positive integer');
}
this.maxStalenessSeconds = options.maxStalenessSeconds;
// NOTE: The minimum required wire version is 5 for this read preference. If the existing
// topology has a lower value then a MongoError will be thrown during server selection.
this.minWireVersion = 5;
}
if (this.mode === ReadPreference.PRIMARY) {
if (this.tags && Array.isArray(this.tags) && this.tags.length > 0) {
throw new TypeError('Primary read preference cannot be combined with tags');
}
if (this.maxStalenessSeconds) {
throw new TypeError('Primary read preference cannot be combined with maxStalenessSeconds');
}
if (this.hedge) {
throw new TypeError('Primary read preference cannot be combined with hedge');
}
}
};
// Support the deprecated `preference` property introduced in the porcelain layer
Object.defineProperty(ReadPreference.prototype, 'preference', {
enumerable: true,
get: function() {
return this.mode;
}
});
/*
* Read preference mode constants
*/
ReadPreference.PRIMARY = 'primary';
ReadPreference.PRIMARY_PREFERRED = 'primaryPreferred';
ReadPreference.SECONDARY = 'secondary';
ReadPreference.SECONDARY_PREFERRED = 'secondaryPreferred';
ReadPreference.NEAREST = 'nearest';
const VALID_MODES = [
ReadPreference.PRIMARY,
ReadPreference.PRIMARY_PREFERRED,
ReadPreference.SECONDARY,
ReadPreference.SECONDARY_PREFERRED,
ReadPreference.NEAREST,
null
];
/**
* Construct a ReadPreference given an options object.
*
* @param {object} options The options object from which to extract the read preference.
* @return {ReadPreference}
*/
ReadPreference.fromOptions = function(options) {
if (!options) return null;
const readPreference = options.readPreference;
if (!readPreference) return null;
const readPreferenceTags = options.readPreferenceTags;
const maxStalenessSeconds = options.maxStalenessSeconds;
if (typeof readPreference === 'string') {
return new ReadPreference(readPreference, readPreferenceTags);
} else if (!(readPreference instanceof ReadPreference) && typeof readPreference === 'object') {
const mode = readPreference.mode || readPreference.preference;
if (mode && typeof mode === 'string') {
return new ReadPreference(mode, readPreference.tags, {
maxStalenessSeconds: readPreference.maxStalenessSeconds || maxStalenessSeconds,
hedge: readPreference.hedge
});
}
}
return readPreference;
};
/**
* Resolves a read preference based on well-defined inheritance rules. This method will not only
* determine the read preference (if there is one), but will also ensure the returned value is a
* properly constructed instance of `ReadPreference`.
*
* @param {Collection|Db|MongoClient} parent The parent of the operation on which to determine the read
* preference, used for determining the inherited read preference.
* @param {object} options The options passed into the method, potentially containing a read preference
* @returns {(ReadPreference|null)} The resolved read preference
*/
ReadPreference.resolve = function(parent, options) {
options = options || {};
const session = options.session;
const inheritedReadPreference = parent && parent.readPreference;
let readPreference;
if (options.readPreference) {
readPreference = ReadPreference.fromOptions(options);
} else if (session && session.inTransaction() && session.transaction.options.readPreference) {
// The transactions read preference MUST override all other user configurable read preferences.
readPreference = session.transaction.options.readPreference;
} else if (inheritedReadPreference != null) {
readPreference = inheritedReadPreference;
} else {
readPreference = ReadPreference.primary;
}
return typeof readPreference === 'string' ? new ReadPreference(readPreference) : readPreference;
};
/**
* Replaces options.readPreference with a ReadPreference instance
*/
ReadPreference.translate = function(options) {
if (options.readPreference == null) return options;
const r = options.readPreference;
if (typeof r === 'string') {
options.readPreference = new ReadPreference(r);
} else if (r && !(r instanceof ReadPreference) && typeof r === 'object') {
const mode = r.mode || r.preference;
if (mode && typeof mode === 'string') {
options.readPreference = new ReadPreference(mode, r.tags, {
maxStalenessSeconds: r.maxStalenessSeconds
});
}
} else if (!(r instanceof ReadPreference)) {
throw new TypeError('Invalid read preference: ' + r);
}
return options;
};
/**
* Validate if a mode is legal
*
* @method
* @param {string} mode The string representing the read preference mode.
* @return {boolean} True if a mode is valid
*/
ReadPreference.isValid = function(mode) {
return VALID_MODES.indexOf(mode) !== -1;
};
/**
* Validate if a mode is legal
*
* @method
* @param {string} mode The string representing the read preference mode.
* @return {boolean} True if a mode is valid
*/
ReadPreference.prototype.isValid = function(mode) {
return ReadPreference.isValid(typeof mode === 'string' ? mode : this.mode);
};
const needSlaveOk = ['primaryPreferred', 'secondary', 'secondaryPreferred', 'nearest'];
/**
* Indicates that this readPreference needs the "slaveOk" bit when sent over the wire
* @method
* @return {boolean}
* @see https://docs.mongodb.com/manual/reference/mongodb-wire-protocol/#op-query
*/
ReadPreference.prototype.slaveOk = function() {
return needSlaveOk.indexOf(this.mode) !== -1;
};
/**
* Are the two read preference equal
* @method
* @param {ReadPreference} readPreference The read preference with which to check equality
* @return {boolean} True if the two ReadPreferences are equivalent
*/
ReadPreference.prototype.equals = function(readPreference) {
return readPreference.mode === this.mode;
};
/**
* Return JSON representation
* @method
* @return {Object} A JSON representation of the ReadPreference
*/
ReadPreference.prototype.toJSON = function() {
const readPreference = { mode: this.mode };
if (Array.isArray(this.tags)) readPreference.tags = this.tags;
if (this.maxStalenessSeconds) readPreference.maxStalenessSeconds = this.maxStalenessSeconds;
if (this.hedge) readPreference.hedge = this.hedge;
return readPreference;
};
/**
* Primary read preference
* @member
* @type {ReadPreference}
*/
ReadPreference.primary = new ReadPreference('primary');
/**
* Primary Preferred read preference
* @member
* @type {ReadPreference}
*/
ReadPreference.primaryPreferred = new ReadPreference('primaryPreferred');
/**
* Secondary read preference
* @member
* @type {ReadPreference}
*/
ReadPreference.secondary = new ReadPreference('secondary');
/**
* Secondary Preferred read preference
* @member
* @type {ReadPreference}
*/
ReadPreference.secondaryPreferred = new ReadPreference('secondaryPreferred');
/**
* Nearest read preference
* @member
* @type {ReadPreference}
*/
ReadPreference.nearest = new ReadPreference('nearest');
module.exports = ReadPreference;

1559
node_modules/mongodb/lib/core/topologies/replset.js generated vendored Normal file

File diff suppressed because it is too large Load Diff

1121
node_modules/mongodb/lib/core/topologies/replset_state.js generated vendored Normal file

File diff suppressed because it is too large Load Diff

990
node_modules/mongodb/lib/core/topologies/server.js generated vendored Normal file
View File

@@ -0,0 +1,990 @@
'use strict';
var inherits = require('util').inherits,
f = require('util').format,
EventEmitter = require('events').EventEmitter,
ReadPreference = require('./read_preference'),
Logger = require('../connection/logger'),
debugOptions = require('../connection/utils').debugOptions,
retrieveBSON = require('../connection/utils').retrieveBSON,
Pool = require('../connection/pool'),
MongoError = require('../error').MongoError,
MongoNetworkError = require('../error').MongoNetworkError,
wireProtocol = require('../wireprotocol'),
CoreCursor = require('../cursor').CoreCursor,
sdam = require('./shared'),
createCompressionInfo = require('./shared').createCompressionInfo,
resolveClusterTime = require('./shared').resolveClusterTime,
SessionMixins = require('./shared').SessionMixins,
relayEvents = require('../utils').relayEvents;
const collationNotSupported = require('../utils').collationNotSupported;
const makeClientMetadata = require('../utils').makeClientMetadata;
// Used for filtering out fields for loggin
var debugFields = [
'reconnect',
'reconnectTries',
'reconnectInterval',
'emitError',
'cursorFactory',
'host',
'port',
'size',
'keepAlive',
'keepAliveInitialDelay',
'noDelay',
'connectionTimeout',
'checkServerIdentity',
'socketTimeout',
'ssl',
'ca',
'crl',
'cert',
'key',
'rejectUnauthorized',
'promoteLongs',
'promoteValues',
'promoteBuffers',
'servername'
];
// Server instance id
var id = 0;
var serverAccounting = false;
var servers = {};
var BSON = retrieveBSON();
function topologyId(server) {
return server.s.parent == null ? server.id : server.s.parent.id;
}
/**
* Creates a new Server instance
* @class
* @param {boolean} [options.reconnect=true] Server will attempt to reconnect on loss of connection
* @param {number} [options.reconnectTries=30] Server attempt to reconnect #times
* @param {number} [options.reconnectInterval=1000] Server will wait # milliseconds between retries
* @param {number} [options.monitoring=true] Enable the server state monitoring (calling ismaster at monitoringInterval)
* @param {number} [options.monitoringInterval=5000] The interval of calling ismaster when monitoring is enabled.
* @param {Cursor} [options.cursorFactory=Cursor] The cursor factory class used for all query cursors
* @param {string} options.host The server host
* @param {number} options.port The server port
* @param {number} [options.size=5] Server connection pool size
* @param {boolean} [options.keepAlive=true] TCP Connection keep alive enabled
* @param {number} [options.keepAliveInitialDelay=120000] Initial delay before TCP keep alive enabled
* @param {boolean} [options.noDelay=true] TCP Connection no delay
* @param {number} [options.connectionTimeout=30000] TCP Connection timeout setting
* @param {number} [options.socketTimeout=360000] TCP Socket timeout setting
* @param {boolean} [options.ssl=false] Use SSL for connection
* @param {boolean|function} [options.checkServerIdentity=true] Ensure we check server identify during SSL, set to false to disable checking. Only works for Node 0.12.x or higher. You can pass in a boolean or your own checkServerIdentity override function.
* @param {Buffer} [options.ca] SSL Certificate store binary buffer
* @param {Buffer} [options.crl] SSL Certificate revocation store binary buffer
* @param {Buffer} [options.cert] SSL Certificate binary buffer
* @param {Buffer} [options.key] SSL Key file binary buffer
* @param {string} [options.passphrase] SSL Certificate pass phrase
* @param {boolean} [options.rejectUnauthorized=true] Reject unauthorized server certificates
* @param {string} [options.servername=null] String containing the server name requested via TLS SNI.
* @param {boolean} [options.promoteLongs=true] Convert Long values from the db into Numbers if they fit into 53 bits
* @param {boolean} [options.promoteValues=true] Promotes BSON values to native types where possible, set to false to only receive wrapper types.
* @param {boolean} [options.promoteBuffers=false] Promotes Binary BSON values to native Node Buffers.
* @param {string} [options.appname=null] Application name, passed in on ismaster call and logged in mongod server logs. Maximum size 128 bytes.
* @param {boolean} [options.domainsEnabled=false] Enable the wrapping of the callback in the current domain, disabled by default to avoid perf hit.
* @param {boolean} [options.monitorCommands=false] Enable command monitoring for this topology
* @return {Server} A cursor instance
* @fires Server#connect
* @fires Server#close
* @fires Server#error
* @fires Server#timeout
* @fires Server#parseError
* @fires Server#reconnect
* @fires Server#reconnectFailed
* @fires Server#serverHeartbeatStarted
* @fires Server#serverHeartbeatSucceeded
* @fires Server#serverHeartbeatFailed
* @fires Server#topologyOpening
* @fires Server#topologyClosed
* @fires Server#topologyDescriptionChanged
* @property {string} type the topology type.
* @property {string} parserType the parser type used (c++ or js).
*/
var Server = function(options) {
options = options || {};
// Add event listener
EventEmitter.call(this);
// Server instance id
this.id = id++;
// Internal state
this.s = {
// Options
options: Object.assign({ metadata: makeClientMetadata(options) }, options),
// Logger
logger: Logger('Server', options),
// Factory overrides
Cursor: options.cursorFactory || CoreCursor,
// BSON instance
bson:
options.bson ||
new BSON([
BSON.Binary,
BSON.Code,
BSON.DBRef,
BSON.Decimal128,
BSON.Double,
BSON.Int32,
BSON.Long,
BSON.Map,
BSON.MaxKey,
BSON.MinKey,
BSON.ObjectId,
BSON.BSONRegExp,
BSON.Symbol,
BSON.Timestamp
]),
// Pool
pool: null,
// Disconnect handler
disconnectHandler: options.disconnectHandler,
// Monitor thread (keeps the connection alive)
monitoring: typeof options.monitoring === 'boolean' ? options.monitoring : true,
// Is the server in a topology
inTopology: !!options.parent,
// Monitoring timeout
monitoringInterval:
typeof options.monitoringInterval === 'number' ? options.monitoringInterval : 5000,
compression: { compressors: createCompressionInfo(options) },
// Optional parent topology
parent: options.parent
};
// If this is a single deployment we need to track the clusterTime here
if (!this.s.parent) {
this.s.clusterTime = null;
}
// Curent ismaster
this.ismaster = null;
// Current ping time
this.lastIsMasterMS = -1;
// The monitoringProcessId
this.monitoringProcessId = null;
// Initial connection
this.initialConnect = true;
// Default type
this._type = 'server';
// Max Stalleness values
// last time we updated the ismaster state
this.lastUpdateTime = 0;
// Last write time
this.lastWriteDate = 0;
// Stalleness
this.staleness = 0;
};
inherits(Server, EventEmitter);
Object.assign(Server.prototype, SessionMixins);
Object.defineProperty(Server.prototype, 'type', {
enumerable: true,
get: function() {
return this._type;
}
});
Object.defineProperty(Server.prototype, 'parserType', {
enumerable: true,
get: function() {
return BSON.native ? 'c++' : 'js';
}
});
Object.defineProperty(Server.prototype, 'logicalSessionTimeoutMinutes', {
enumerable: true,
get: function() {
if (!this.ismaster) return null;
return this.ismaster.logicalSessionTimeoutMinutes || null;
}
});
Object.defineProperty(Server.prototype, 'clientMetadata', {
enumerable: true,
get: function() {
return this.s.options.metadata;
}
});
// In single server deployments we track the clusterTime directly on the topology, however
// in Mongos and ReplSet deployments we instead need to delegate the clusterTime up to the
// tracking objects so we can ensure we are gossiping the maximum time received from the
// server.
Object.defineProperty(Server.prototype, 'clusterTime', {
enumerable: true,
set: function(clusterTime) {
const settings = this.s.parent ? this.s.parent : this.s;
resolveClusterTime(settings, clusterTime);
},
get: function() {
const settings = this.s.parent ? this.s.parent : this.s;
return settings.clusterTime || null;
}
});
Server.enableServerAccounting = function() {
serverAccounting = true;
servers = {};
};
Server.disableServerAccounting = function() {
serverAccounting = false;
};
Server.servers = function() {
return servers;
};
Object.defineProperty(Server.prototype, 'name', {
enumerable: true,
get: function() {
return this.s.options.host + ':' + this.s.options.port;
}
});
function disconnectHandler(self, type, ns, cmd, options, callback) {
// Topology is not connected, save the call in the provided store to be
// Executed at some point when the handler deems it's reconnected
if (
!self.s.pool.isConnected() &&
self.s.options.reconnect &&
self.s.disconnectHandler != null &&
!options.monitoring
) {
self.s.disconnectHandler.add(type, ns, cmd, options, callback);
return true;
}
// If we have no connection error
if (!self.s.pool.isConnected()) {
callback(new MongoError(f('no connection available to server %s', self.name)));
return true;
}
}
function monitoringProcess(self) {
return function() {
// Pool was destroyed do not continue process
if (self.s.pool.isDestroyed()) return;
// Emit monitoring Process event
self.emit('monitoring', self);
// Perform ismaster call
// Get start time
var start = new Date().getTime();
// Execute the ismaster query
self.command(
'admin.$cmd',
{ ismaster: true },
{
socketTimeout:
typeof self.s.options.connectionTimeout !== 'number'
? 2000
: self.s.options.connectionTimeout,
monitoring: true
},
(err, result) => {
// Set initial lastIsMasterMS
self.lastIsMasterMS = new Date().getTime() - start;
if (self.s.pool.isDestroyed()) return;
// Update the ismaster view if we have a result
if (result) {
self.ismaster = result.result;
}
// Re-schedule the monitoring process
self.monitoringProcessId = setTimeout(monitoringProcess(self), self.s.monitoringInterval);
}
);
};
}
var eventHandler = function(self, event) {
return function(err, conn) {
// Log information of received information if in info mode
if (self.s.logger.isInfo()) {
var object = err instanceof MongoError ? JSON.stringify(err) : {};
self.s.logger.info(
f('server %s fired event %s out with message %s', self.name, event, object)
);
}
// Handle connect event
if (event === 'connect') {
self.initialConnect = false;
self.ismaster = conn.ismaster;
self.lastIsMasterMS = conn.lastIsMasterMS;
if (conn.agreedCompressor) {
self.s.pool.options.agreedCompressor = conn.agreedCompressor;
}
if (conn.zlibCompressionLevel) {
self.s.pool.options.zlibCompressionLevel = conn.zlibCompressionLevel;
}
if (conn.ismaster.$clusterTime) {
const $clusterTime = conn.ismaster.$clusterTime;
self.clusterTime = $clusterTime;
}
// It's a proxy change the type so
// the wireprotocol will send $readPreference
if (self.ismaster.msg === 'isdbgrid') {
self._type = 'mongos';
}
// Have we defined self monitoring
if (self.s.monitoring) {
self.monitoringProcessId = setTimeout(monitoringProcess(self), self.s.monitoringInterval);
}
// Emit server description changed if something listening
sdam.emitServerDescriptionChanged(self, {
address: self.name,
arbiters: [],
hosts: [],
passives: [],
type: sdam.getTopologyType(self)
});
if (!self.s.inTopology) {
// Emit topology description changed if something listening
sdam.emitTopologyDescriptionChanged(self, {
topologyType: 'Single',
servers: [
{
address: self.name,
arbiters: [],
hosts: [],
passives: [],
type: sdam.getTopologyType(self)
}
]
});
}
// Log the ismaster if available
if (self.s.logger.isInfo()) {
self.s.logger.info(
f('server %s connected with ismaster [%s]', self.name, JSON.stringify(self.ismaster))
);
}
// Emit connect
self.emit('connect', self);
} else if (
event === 'error' ||
event === 'parseError' ||
event === 'close' ||
event === 'timeout' ||
event === 'reconnect' ||
event === 'attemptReconnect' ||
'reconnectFailed'
) {
// Remove server instance from accounting
if (
serverAccounting &&
['close', 'timeout', 'error', 'parseError', 'reconnectFailed'].indexOf(event) !== -1
) {
// Emit toplogy opening event if not in topology
if (!self.s.inTopology) {
self.emit('topologyOpening', { topologyId: self.id });
}
delete servers[self.id];
}
if (event === 'close') {
// Closing emits a server description changed event going to unknown.
sdam.emitServerDescriptionChanged(self, {
address: self.name,
arbiters: [],
hosts: [],
passives: [],
type: 'Unknown'
});
}
// Reconnect failed return error
if (event === 'reconnectFailed') {
self.emit('reconnectFailed', err);
// Emit error if any listeners
if (self.listeners('error').length > 0) {
self.emit('error', err);
}
// Terminate
return;
}
// On first connect fail
if (
['disconnected', 'connecting'].indexOf(self.s.pool.state) !== -1 &&
self.initialConnect &&
['close', 'timeout', 'error', 'parseError'].indexOf(event) !== -1
) {
self.initialConnect = false;
return self.emit(
'error',
new MongoNetworkError(
f('failed to connect to server [%s] on first connect [%s]', self.name, err)
)
);
}
// Reconnect event, emit the server
if (event === 'reconnect') {
// Reconnecting emits a server description changed event going from unknown to the
// current server type.
sdam.emitServerDescriptionChanged(self, {
address: self.name,
arbiters: [],
hosts: [],
passives: [],
type: sdam.getTopologyType(self)
});
return self.emit(event, self);
}
// Emit the event
self.emit(event, err);
}
};
};
/**
* Initiate server connect
*/
Server.prototype.connect = function(options) {
var self = this;
options = options || {};
// Set the connections
if (serverAccounting) servers[this.id] = this;
// Do not allow connect to be called on anything that's not disconnected
if (self.s.pool && !self.s.pool.isDisconnected() && !self.s.pool.isDestroyed()) {
throw new MongoError(f('server instance in invalid state %s', self.s.pool.state));
}
// Create a pool
self.s.pool = new Pool(this, Object.assign(self.s.options, options, { bson: this.s.bson }));
// Set up listeners
self.s.pool.on('close', eventHandler(self, 'close'));
self.s.pool.on('error', eventHandler(self, 'error'));
self.s.pool.on('timeout', eventHandler(self, 'timeout'));
self.s.pool.on('parseError', eventHandler(self, 'parseError'));
self.s.pool.on('connect', eventHandler(self, 'connect'));
self.s.pool.on('reconnect', eventHandler(self, 'reconnect'));
self.s.pool.on('reconnectFailed', eventHandler(self, 'reconnectFailed'));
// Set up listeners for command monitoring
relayEvents(self.s.pool, self, ['commandStarted', 'commandSucceeded', 'commandFailed']);
// Emit toplogy opening event if not in topology
if (!self.s.inTopology) {
this.emit('topologyOpening', { topologyId: topologyId(self) });
}
// Emit opening server event
self.emit('serverOpening', { topologyId: topologyId(self), address: self.name });
self.s.pool.connect();
};
/**
* Authenticate the topology.
* @method
* @param {MongoCredentials} credentials The credentials for authentication we are using
* @param {authResultCallback} callback A callback function
*/
Server.prototype.auth = function(credentials, callback) {
if (typeof callback === 'function') callback(null, null);
};
/**
* Get the server description
* @method
* @return {object}
*/
Server.prototype.getDescription = function() {
var ismaster = this.ismaster || {};
var description = {
type: sdam.getTopologyType(this),
address: this.name
};
// Add fields if available
if (ismaster.hosts) description.hosts = ismaster.hosts;
if (ismaster.arbiters) description.arbiters = ismaster.arbiters;
if (ismaster.passives) description.passives = ismaster.passives;
if (ismaster.setName) description.setName = ismaster.setName;
return description;
};
/**
* Returns the last known ismaster document for this server
* @method
* @return {object}
*/
Server.prototype.lastIsMaster = function() {
return this.ismaster;
};
/**
* Unref all connections belong to this server
* @method
*/
Server.prototype.unref = function() {
this.s.pool.unref();
};
/**
* Figure out if the server is connected
* @method
* @return {boolean}
*/
Server.prototype.isConnected = function() {
if (!this.s.pool) return false;
return this.s.pool.isConnected();
};
/**
* Figure out if the server instance was destroyed by calling destroy
* @method
* @return {boolean}
*/
Server.prototype.isDestroyed = function() {
if (!this.s.pool) return false;
return this.s.pool.isDestroyed();
};
function basicWriteValidations(self) {
if (!self.s.pool) return new MongoError('server instance is not connected');
if (self.s.pool.isDestroyed()) return new MongoError('server instance pool was destroyed');
}
function basicReadValidations(self, options) {
basicWriteValidations(self, options);
if (options.readPreference && !(options.readPreference instanceof ReadPreference)) {
throw new Error('readPreference must be an instance of ReadPreference');
}
}
/**
* Execute a command
* @method
* @param {string} ns The MongoDB fully qualified namespace (ex: db1.collection1)
* @param {object} cmd The command hash
* @param {ReadPreference} [options.readPreference] Specify read preference if command supports it
* @param {Boolean} [options.serializeFunctions=false] Specify if functions on an object should be serialized.
* @param {Boolean} [options.checkKeys=false] Specify if the bson parser should validate keys.
* @param {Boolean} [options.ignoreUndefined=false] Specify if the BSON serializer should ignore undefined fields.
* @param {Boolean} [options.fullResult=false] Return the full envelope instead of just the result document.
* @param {ClientSession} [options.session=null] Session to use for the operation
* @param {opResultCallback} callback A callback function
*/
Server.prototype.command = function(ns, cmd, options, callback) {
var self = this;
if (typeof options === 'function') {
(callback = options), (options = {}), (options = options || {});
}
var result = basicReadValidations(self, options);
if (result) return callback(result);
// Clone the options
options = Object.assign({}, options, { wireProtocolCommand: false });
// Debug log
if (self.s.logger.isDebug())
self.s.logger.debug(
f(
'executing command [%s] against %s',
JSON.stringify({
ns: ns,
cmd: cmd,
options: debugOptions(debugFields, options)
}),
self.name
)
);
// If we are not connected or have a disconnectHandler specified
if (disconnectHandler(self, 'command', ns, cmd, options, callback)) return;
// error if collation not supported
if (collationNotSupported(this, cmd)) {
return callback(new MongoError(`server ${this.name} does not support collation`));
}
wireProtocol.command(self, ns, cmd, options, callback);
};
/**
* Execute a query against the server
*
* @param {string} ns The MongoDB fully qualified namespace (ex: db1.collection1)
* @param {object} cmd The command document for the query
* @param {object} options Optional settings
* @param {function} callback
*/
Server.prototype.query = function(ns, cmd, cursorState, options, callback) {
wireProtocol.query(this, ns, cmd, cursorState, options, callback);
};
/**
* Execute a `getMore` against the server
*
* @param {string} ns The MongoDB fully qualified namespace (ex: db1.collection1)
* @param {object} cursorState State data associated with the cursor calling this method
* @param {object} options Optional settings
* @param {function} callback
*/
Server.prototype.getMore = function(ns, cursorState, batchSize, options, callback) {
wireProtocol.getMore(this, ns, cursorState, batchSize, options, callback);
};
/**
* Execute a `killCursors` command against the server
*
* @param {string} ns The MongoDB fully qualified namespace (ex: db1.collection1)
* @param {object} cursorState State data associated with the cursor calling this method
* @param {function} callback
*/
Server.prototype.killCursors = function(ns, cursorState, callback) {
wireProtocol.killCursors(this, ns, cursorState, callback);
};
/**
* Insert one or more documents
* @method
* @param {string} ns The MongoDB fully qualified namespace (ex: db1.collection1)
* @param {array} ops An array of documents to insert
* @param {boolean} [options.ordered=true] Execute in order or out of order
* @param {object} [options.writeConcern={}] Write concern for the operation
* @param {Boolean} [options.serializeFunctions=false] Specify if functions on an object should be serialized.
* @param {Boolean} [options.ignoreUndefined=false] Specify if the BSON serializer should ignore undefined fields.
* @param {ClientSession} [options.session=null] Session to use for the operation
* @param {opResultCallback} callback A callback function
*/
Server.prototype.insert = function(ns, ops, options, callback) {
var self = this;
if (typeof options === 'function') {
(callback = options), (options = {}), (options = options || {});
}
var result = basicWriteValidations(self, options);
if (result) return callback(result);
// If we are not connected or have a disconnectHandler specified
if (disconnectHandler(self, 'insert', ns, ops, options, callback)) return;
// Setup the docs as an array
ops = Array.isArray(ops) ? ops : [ops];
// Execute write
return wireProtocol.insert(self, ns, ops, options, callback);
};
/**
* Perform one or more update operations
* @method
* @param {string} ns The MongoDB fully qualified namespace (ex: db1.collection1)
* @param {array} ops An array of updates
* @param {boolean} [options.ordered=true] Execute in order or out of order
* @param {object} [options.writeConcern={}] Write concern for the operation
* @param {Boolean} [options.serializeFunctions=false] Specify if functions on an object should be serialized.
* @param {Boolean} [options.ignoreUndefined=false] Specify if the BSON serializer should ignore undefined fields.
* @param {ClientSession} [options.session=null] Session to use for the operation
* @param {opResultCallback} callback A callback function
*/
Server.prototype.update = function(ns, ops, options, callback) {
var self = this;
if (typeof options === 'function') {
(callback = options), (options = {}), (options = options || {});
}
var result = basicWriteValidations(self, options);
if (result) return callback(result);
// If we are not connected or have a disconnectHandler specified
if (disconnectHandler(self, 'update', ns, ops, options, callback)) return;
// error if collation not supported
if (collationNotSupported(this, options)) {
return callback(new MongoError(`server ${this.name} does not support collation`));
}
// Setup the docs as an array
ops = Array.isArray(ops) ? ops : [ops];
// Execute write
return wireProtocol.update(self, ns, ops, options, callback);
};
/**
* Perform one or more remove operations
* @method
* @param {string} ns The MongoDB fully qualified namespace (ex: db1.collection1)
* @param {array} ops An array of removes
* @param {boolean} [options.ordered=true] Execute in order or out of order
* @param {object} [options.writeConcern={}] Write concern for the operation
* @param {Boolean} [options.serializeFunctions=false] Specify if functions on an object should be serialized.
* @param {Boolean} [options.ignoreUndefined=false] Specify if the BSON serializer should ignore undefined fields.
* @param {ClientSession} [options.session=null] Session to use for the operation
* @param {opResultCallback} callback A callback function
*/
Server.prototype.remove = function(ns, ops, options, callback) {
var self = this;
if (typeof options === 'function') {
(callback = options), (options = {}), (options = options || {});
}
var result = basicWriteValidations(self, options);
if (result) return callback(result);
// If we are not connected or have a disconnectHandler specified
if (disconnectHandler(self, 'remove', ns, ops, options, callback)) return;
// error if collation not supported
if (collationNotSupported(this, options)) {
return callback(new MongoError(`server ${this.name} does not support collation`));
}
// Setup the docs as an array
ops = Array.isArray(ops) ? ops : [ops];
// Execute write
return wireProtocol.remove(self, ns, ops, options, callback);
};
/**
* Get a new cursor
* @method
* @param {string} ns The MongoDB fully qualified namespace (ex: db1.collection1)
* @param {object|Long} cmd Can be either a command returning a cursor or a cursorId
* @param {object} [options] Options for the cursor
* @param {object} [options.batchSize=0] Batchsize for the operation
* @param {array} [options.documents=[]] Initial documents list for cursor
* @param {ReadPreference} [options.readPreference] Specify read preference if command supports it
* @param {Boolean} [options.serializeFunctions=false] Specify if functions on an object should be serialized.
* @param {Boolean} [options.ignoreUndefined=false] Specify if the BSON serializer should ignore undefined fields.
* @param {ClientSession} [options.session=null] Session to use for the operation
* @param {object} [options.topology] The internal topology of the created cursor
* @returns {Cursor}
*/
Server.prototype.cursor = function(ns, cmd, options) {
options = options || {};
const topology = options.topology || this;
// Set up final cursor type
var FinalCursor = options.cursorFactory || this.s.Cursor;
// Return the cursor
return new FinalCursor(topology, ns, cmd, options);
};
/**
* Compare two server instances
* @method
* @param {Server} server Server to compare equality against
* @return {boolean}
*/
Server.prototype.equals = function(server) {
if (typeof server === 'string') return this.name.toLowerCase() === server.toLowerCase();
if (server.name) return this.name.toLowerCase() === server.name.toLowerCase();
return false;
};
/**
* All raw connections
* @method
* @return {Connection[]}
*/
Server.prototype.connections = function() {
return this.s.pool.allConnections();
};
/**
* Selects a server
* @method
* @param {function} selector Unused
* @param {ReadPreference} [options.readPreference] Unused
* @param {ClientSession} [options.session] Unused
* @return {Server}
*/
Server.prototype.selectServer = function(selector, options, callback) {
if (typeof selector === 'function' && typeof callback === 'undefined')
(callback = selector), (selector = undefined), (options = {});
if (typeof options === 'function')
(callback = options), (options = selector), (selector = undefined);
callback(null, this);
};
var listeners = ['close', 'error', 'timeout', 'parseError', 'connect'];
/**
* Destroy the server connection
* @method
* @param {boolean} [options.emitClose=false] Emit close event on destroy
* @param {boolean} [options.emitDestroy=false] Emit destroy event on destroy
* @param {boolean} [options.force=false] Force destroy the pool
*/
Server.prototype.destroy = function(options, callback) {
if (this._destroyed) {
if (typeof callback === 'function') callback(null, null);
return;
}
if (typeof options === 'function') {
callback = options;
options = {};
}
options = options || {};
var self = this;
// Set the connections
if (serverAccounting) delete servers[this.id];
// Destroy the monitoring process if any
if (this.monitoringProcessId) {
clearTimeout(this.monitoringProcessId);
}
// No pool, return
if (!self.s.pool) {
this._destroyed = true;
if (typeof callback === 'function') callback(null, null);
return;
}
// Emit close event
if (options.emitClose) {
self.emit('close', self);
}
// Emit destroy event
if (options.emitDestroy) {
self.emit('destroy', self);
}
// Remove all listeners
listeners.forEach(function(event) {
self.s.pool.removeAllListeners(event);
});
// Emit opening server event
if (self.listeners('serverClosed').length > 0)
self.emit('serverClosed', { topologyId: topologyId(self), address: self.name });
// Emit toplogy opening event if not in topology
if (self.listeners('topologyClosed').length > 0 && !self.s.inTopology) {
self.emit('topologyClosed', { topologyId: topologyId(self) });
}
if (self.s.logger.isDebug()) {
self.s.logger.debug(f('destroy called on server %s', self.name));
}
// Destroy the pool
this.s.pool.destroy(options.force, callback);
this._destroyed = true;
};
/**
* A server connect event, used to verify that the connection is up and running
*
* @event Server#connect
* @type {Server}
*/
/**
* A server reconnect event, used to verify that the server topology has reconnected
*
* @event Server#reconnect
* @type {Server}
*/
/**
* A server opening SDAM monitoring event
*
* @event Server#serverOpening
* @type {object}
*/
/**
* A server closed SDAM monitoring event
*
* @event Server#serverClosed
* @type {object}
*/
/**
* A server description SDAM change monitoring event
*
* @event Server#serverDescriptionChanged
* @type {object}
*/
/**
* A topology open SDAM event
*
* @event Server#topologyOpening
* @type {object}
*/
/**
* A topology closed SDAM event
*
* @event Server#topologyClosed
* @type {object}
*/
/**
* A topology structure SDAM change event
*
* @event Server#topologyDescriptionChanged
* @type {object}
*/
/**
* Server reconnect failed
*
* @event Server#reconnectFailed
* @type {Error}
*/
/**
* Server connection pool closed
*
* @event Server#close
* @type {object}
*/
/**
* Server connection pool caused an error
*
* @event Server#error
* @type {Error}
*/
/**
* Server destroyed was called
*
* @event Server#destroy
* @type {Server}
*/
module.exports = Server;

456
node_modules/mongodb/lib/core/topologies/shared.js generated vendored Normal file
View File

@@ -0,0 +1,456 @@
'use strict';
const ReadPreference = require('./read_preference');
const TopologyType = require('../sdam/common').TopologyType;
const MongoError = require('../error').MongoError;
const isRetryableWriteError = require('../error').isRetryableWriteError;
const maxWireVersion = require('../utils').maxWireVersion;
const MongoNetworkError = require('../error').MongoNetworkError;
const MMAPv1_RETRY_WRITES_ERROR_CODE = 20;
/**
* Emit event if it exists
* @method
*/
function emitSDAMEvent(self, event, description) {
if (self.listeners(event).length > 0) {
self.emit(event, description);
}
}
function createCompressionInfo(options) {
if (!options.compression || !options.compression.compressors) {
return [];
}
// Check that all supplied compressors are valid
options.compression.compressors.forEach(function(compressor) {
if (compressor !== 'snappy' && compressor !== 'zlib') {
throw new Error('compressors must be at least one of snappy or zlib');
}
});
return options.compression.compressors;
}
function clone(object) {
return JSON.parse(JSON.stringify(object));
}
var getPreviousDescription = function(self) {
if (!self.s.serverDescription) {
self.s.serverDescription = {
address: self.name,
arbiters: [],
hosts: [],
passives: [],
type: 'Unknown'
};
}
return self.s.serverDescription;
};
var emitServerDescriptionChanged = function(self, description) {
if (self.listeners('serverDescriptionChanged').length > 0) {
// Emit the server description changed events
self.emit('serverDescriptionChanged', {
topologyId: self.s.topologyId !== -1 ? self.s.topologyId : self.id,
address: self.name,
previousDescription: getPreviousDescription(self),
newDescription: description
});
self.s.serverDescription = description;
}
};
var getPreviousTopologyDescription = function(self) {
if (!self.s.topologyDescription) {
self.s.topologyDescription = {
topologyType: 'Unknown',
servers: [
{
address: self.name,
arbiters: [],
hosts: [],
passives: [],
type: 'Unknown'
}
]
};
}
return self.s.topologyDescription;
};
var emitTopologyDescriptionChanged = function(self, description) {
if (self.listeners('topologyDescriptionChanged').length > 0) {
// Emit the server description changed events
self.emit('topologyDescriptionChanged', {
topologyId: self.s.topologyId !== -1 ? self.s.topologyId : self.id,
address: self.name,
previousDescription: getPreviousTopologyDescription(self),
newDescription: description
});
self.s.serverDescription = description;
}
};
var changedIsMaster = function(self, currentIsmaster, ismaster) {
var currentType = getTopologyType(self, currentIsmaster);
var newType = getTopologyType(self, ismaster);
if (newType !== currentType) return true;
return false;
};
var getTopologyType = function(self, ismaster) {
if (!ismaster) {
ismaster = self.ismaster;
}
if (!ismaster) return 'Unknown';
if (ismaster.ismaster && ismaster.msg === 'isdbgrid') return 'Mongos';
if (ismaster.ismaster && !ismaster.hosts) return 'Standalone';
if (ismaster.ismaster) return 'RSPrimary';
if (ismaster.secondary) return 'RSSecondary';
if (ismaster.arbiterOnly) return 'RSArbiter';
return 'Unknown';
};
var inquireServerState = function(self) {
return function(callback) {
if (self.s.state === 'destroyed') return;
// Record response time
var start = new Date().getTime();
// emitSDAMEvent
emitSDAMEvent(self, 'serverHeartbeatStarted', { connectionId: self.name });
// Attempt to execute ismaster command
self.command('admin.$cmd', { ismaster: true }, { monitoring: true }, function(err, r) {
if (!err) {
// Legacy event sender
self.emit('ismaster', r, self);
// Calculate latencyMS
var latencyMS = new Date().getTime() - start;
// Server heart beat event
emitSDAMEvent(self, 'serverHeartbeatSucceeded', {
durationMS: latencyMS,
reply: r.result,
connectionId: self.name
});
// Did the server change
if (changedIsMaster(self, self.s.ismaster, r.result)) {
// Emit server description changed if something listening
emitServerDescriptionChanged(self, {
address: self.name,
arbiters: [],
hosts: [],
passives: [],
type: !self.s.inTopology ? 'Standalone' : getTopologyType(self)
});
}
// Updat ismaster view
self.s.ismaster = r.result;
// Set server response time
self.s.isMasterLatencyMS = latencyMS;
} else {
emitSDAMEvent(self, 'serverHeartbeatFailed', {
durationMS: latencyMS,
failure: err,
connectionId: self.name
});
}
// Peforming an ismaster monitoring callback operation
if (typeof callback === 'function') {
return callback(err, r);
}
// Perform another sweep
self.s.inquireServerStateTimeout = setTimeout(inquireServerState(self), self.s.haInterval);
});
};
};
//
// Clone the options
var cloneOptions = function(options) {
var opts = {};
for (var name in options) {
opts[name] = options[name];
}
return opts;
};
function Interval(fn, time) {
var timer = false;
this.start = function() {
if (!this.isRunning()) {
timer = setInterval(fn, time);
}
return this;
};
this.stop = function() {
clearInterval(timer);
timer = false;
return this;
};
this.isRunning = function() {
return timer !== false;
};
}
function Timeout(fn, time) {
var timer = false;
var func = () => {
if (timer) {
clearTimeout(timer);
timer = false;
fn();
}
};
this.start = function() {
if (!this.isRunning()) {
timer = setTimeout(func, time);
}
return this;
};
this.stop = function() {
clearTimeout(timer);
timer = false;
return this;
};
this.isRunning = function() {
return timer !== false;
};
}
function diff(previous, current) {
// Difference document
var diff = {
servers: []
};
// Previous entry
if (!previous) {
previous = { servers: [] };
}
// Check if we have any previous servers missing in the current ones
for (var i = 0; i < previous.servers.length; i++) {
var found = false;
for (var j = 0; j < current.servers.length; j++) {
if (current.servers[j].address.toLowerCase() === previous.servers[i].address.toLowerCase()) {
found = true;
break;
}
}
if (!found) {
// Add to the diff
diff.servers.push({
address: previous.servers[i].address,
from: previous.servers[i].type,
to: 'Unknown'
});
}
}
// Check if there are any severs that don't exist
for (j = 0; j < current.servers.length; j++) {
found = false;
// Go over all the previous servers
for (i = 0; i < previous.servers.length; i++) {
if (previous.servers[i].address.toLowerCase() === current.servers[j].address.toLowerCase()) {
found = true;
break;
}
}
// Add the server to the diff
if (!found) {
diff.servers.push({
address: current.servers[j].address,
from: 'Unknown',
to: current.servers[j].type
});
}
}
// Got through all the servers
for (i = 0; i < previous.servers.length; i++) {
var prevServer = previous.servers[i];
// Go through all current servers
for (j = 0; j < current.servers.length; j++) {
var currServer = current.servers[j];
// Matching server
if (prevServer.address.toLowerCase() === currServer.address.toLowerCase()) {
// We had a change in state
if (prevServer.type !== currServer.type) {
diff.servers.push({
address: prevServer.address,
from: prevServer.type,
to: currServer.type
});
}
}
}
}
// Return difference
return diff;
}
/**
* Shared function to determine clusterTime for a given topology
*
* @param {*} topology
* @param {*} clusterTime
*/
function resolveClusterTime(topology, $clusterTime) {
if (topology.clusterTime == null) {
topology.clusterTime = $clusterTime;
} else {
if ($clusterTime.clusterTime.greaterThan(topology.clusterTime.clusterTime)) {
topology.clusterTime = $clusterTime;
}
}
}
// NOTE: this is a temporary move until the topologies can be more formally refactored
// to share code.
const SessionMixins = {
endSessions: function(sessions, callback) {
if (!Array.isArray(sessions)) {
sessions = [sessions];
}
// TODO:
// When connected to a sharded cluster the endSessions command
// can be sent to any mongos. When connected to a replica set the
// endSessions command MUST be sent to the primary if the primary
// is available, otherwise it MUST be sent to any available secondary.
// Is it enough to use: ReadPreference.primaryPreferred ?
this.command(
'admin.$cmd',
{ endSessions: sessions },
{ readPreference: ReadPreference.primaryPreferred },
() => {
// intentionally ignored, per spec
if (typeof callback === 'function') callback();
}
);
}
};
function topologyType(topology) {
if (topology.description) {
return topology.description.type;
}
if (topology.type === 'mongos') {
return TopologyType.Sharded;
} else if (topology.type === 'replset') {
return TopologyType.ReplicaSetWithPrimary;
}
return TopologyType.Single;
}
const RETRYABLE_WIRE_VERSION = 6;
/**
* Determines whether the provided topology supports retryable writes
*
* @param {Mongos|Replset} topology
*/
const isRetryableWritesSupported = function(topology) {
const maxWireVersion = topology.lastIsMaster().maxWireVersion;
if (maxWireVersion < RETRYABLE_WIRE_VERSION) {
return false;
}
if (!topology.logicalSessionTimeoutMinutes) {
return false;
}
if (topologyType(topology) === TopologyType.Single) {
return false;
}
return true;
};
const MMAPv1_RETRY_WRITES_ERROR_MESSAGE =
'This MongoDB deployment does not support retryable writes. Please add retryWrites=false to your connection string.';
function getMMAPError(err) {
if (err.code !== MMAPv1_RETRY_WRITES_ERROR_CODE || !err.errmsg.includes('Transaction numbers')) {
return err;
}
// According to the retryable writes spec, we must replace the error message in this case.
// We need to replace err.message so the thrown message is correct and we need to replace err.errmsg to meet the spec requirement.
const newErr = new MongoError({
message: MMAPv1_RETRY_WRITES_ERROR_MESSAGE,
errmsg: MMAPv1_RETRY_WRITES_ERROR_MESSAGE,
originalError: err
});
return newErr;
}
// NOTE: only used for legacy topology types
function legacyIsRetryableWriteError(err, topology) {
if (!(err instanceof MongoError)) {
return false;
}
// if pre-4.4 server, then add error label if its a retryable write error
if (
isRetryableWritesSupported(topology) &&
(err instanceof MongoNetworkError ||
(maxWireVersion(topology) < 9 && isRetryableWriteError(err)))
) {
err.addErrorLabel('RetryableWriteError');
}
return err.hasErrorLabel('RetryableWriteError');
}
module.exports = {
SessionMixins,
resolveClusterTime,
inquireServerState,
getTopologyType,
emitServerDescriptionChanged,
emitTopologyDescriptionChanged,
cloneOptions,
createCompressionInfo,
clone,
diff,
Interval,
Timeout,
isRetryableWritesSupported,
getMMAPError,
topologyType,
legacyIsRetryableWriteError
};

179
node_modules/mongodb/lib/core/transactions.js generated vendored Normal file
View File

@@ -0,0 +1,179 @@
'use strict';
const MongoError = require('./error').MongoError;
const ReadPreference = require('./topologies/read_preference');
const ReadConcern = require('../read_concern');
const WriteConcern = require('../write_concern');
let TxnState;
let stateMachine;
(() => {
const NO_TRANSACTION = 'NO_TRANSACTION';
const STARTING_TRANSACTION = 'STARTING_TRANSACTION';
const TRANSACTION_IN_PROGRESS = 'TRANSACTION_IN_PROGRESS';
const TRANSACTION_COMMITTED = 'TRANSACTION_COMMITTED';
const TRANSACTION_COMMITTED_EMPTY = 'TRANSACTION_COMMITTED_EMPTY';
const TRANSACTION_ABORTED = 'TRANSACTION_ABORTED';
TxnState = {
NO_TRANSACTION,
STARTING_TRANSACTION,
TRANSACTION_IN_PROGRESS,
TRANSACTION_COMMITTED,
TRANSACTION_COMMITTED_EMPTY,
TRANSACTION_ABORTED
};
stateMachine = {
[NO_TRANSACTION]: [NO_TRANSACTION, STARTING_TRANSACTION],
[STARTING_TRANSACTION]: [
TRANSACTION_IN_PROGRESS,
TRANSACTION_COMMITTED,
TRANSACTION_COMMITTED_EMPTY,
TRANSACTION_ABORTED
],
[TRANSACTION_IN_PROGRESS]: [
TRANSACTION_IN_PROGRESS,
TRANSACTION_COMMITTED,
TRANSACTION_ABORTED
],
[TRANSACTION_COMMITTED]: [
TRANSACTION_COMMITTED,
TRANSACTION_COMMITTED_EMPTY,
STARTING_TRANSACTION,
NO_TRANSACTION
],
[TRANSACTION_ABORTED]: [STARTING_TRANSACTION, NO_TRANSACTION],
[TRANSACTION_COMMITTED_EMPTY]: [TRANSACTION_COMMITTED_EMPTY, NO_TRANSACTION]
};
})();
/**
* The MongoDB ReadConcern, which allows for control of the consistency and isolation properties
* of the data read from replica sets and replica set shards.
* @typedef {Object} ReadConcern
* @property {'local'|'available'|'majority'|'linearizable'|'snapshot'} level The readConcern Level
* @see https://docs.mongodb.com/manual/reference/read-concern/
*/
/**
* A MongoDB WriteConcern, which describes the level of acknowledgement
* requested from MongoDB for write operations.
* @typedef {Object} WriteConcern
* @property {number|'majority'|string} [w=1] requests acknowledgement that the write operation has
* propagated to a specified number of mongod hosts
* @property {boolean} [j=false] requests acknowledgement from MongoDB that the write operation has
* been written to the journal
* @property {number} [wtimeout] a time limit, in milliseconds, for the write concern
* @see https://docs.mongodb.com/manual/reference/write-concern/
*/
/**
* Configuration options for a transaction.
* @typedef {Object} TransactionOptions
* @property {ReadConcern} [readConcern] A default read concern for commands in this transaction
* @property {WriteConcern} [writeConcern] A default writeConcern for commands in this transaction
* @property {ReadPreference} [readPreference] A default read preference for commands in this transaction
*/
/**
* A class maintaining state related to a server transaction. Internal Only
* @ignore
*/
class Transaction {
/**
* Create a transaction
*
* @ignore
* @param {TransactionOptions} [options] Optional settings
*/
constructor(options) {
options = options || {};
this.state = TxnState.NO_TRANSACTION;
this.options = {};
const writeConcern = WriteConcern.fromOptions(options);
if (writeConcern) {
if (writeConcern.w <= 0) {
throw new MongoError('Transactions do not support unacknowledged write concern');
}
this.options.writeConcern = writeConcern;
}
if (options.readConcern) {
this.options.readConcern = ReadConcern.fromOptions(options);
}
if (options.readPreference) {
this.options.readPreference = ReadPreference.fromOptions(options);
}
if (options.maxCommitTimeMS) {
this.options.maxTimeMS = options.maxCommitTimeMS;
}
// TODO: This isn't technically necessary
this._pinnedServer = undefined;
this._recoveryToken = undefined;
}
get server() {
return this._pinnedServer;
}
get recoveryToken() {
return this._recoveryToken;
}
get isPinned() {
return !!this.server;
}
/**
* @ignore
* @return Whether this session is presently in a transaction
*/
get isActive() {
return (
[TxnState.STARTING_TRANSACTION, TxnState.TRANSACTION_IN_PROGRESS].indexOf(this.state) !== -1
);
}
/**
* Transition the transaction in the state machine
* @ignore
* @param {TxnState} state The new state to transition to
*/
transition(nextState) {
const nextStates = stateMachine[this.state];
if (nextStates && nextStates.indexOf(nextState) !== -1) {
this.state = nextState;
if (this.state === TxnState.NO_TRANSACTION || this.state === TxnState.STARTING_TRANSACTION) {
this.unpinServer();
}
return;
}
throw new MongoError(
`Attempted illegal state transition from [${this.state}] to [${nextState}]`
);
}
pinServer(server) {
if (this.isActive) {
this._pinnedServer = server;
}
}
unpinServer() {
this._pinnedServer = undefined;
}
}
function isTransactionCommand(command) {
return !!(command.commitTransaction || command.abortTransaction);
}
module.exports = { TxnState, Transaction, isTransactionCommand };

723
node_modules/mongodb/lib/core/uri_parser.js generated vendored Normal file
View File

@@ -0,0 +1,723 @@
'use strict';
const URL = require('url');
const qs = require('querystring');
const dns = require('dns');
const MongoParseError = require('./error').MongoParseError;
const ReadPreference = require('./topologies/read_preference');
/**
* The following regular expression validates a connection string and breaks the
* provide string into the following capture groups: [protocol, username, password, hosts]
*/
const HOSTS_RX = /(mongodb(?:\+srv|)):\/\/(?: (?:[^:]*) (?: : ([^@]*) )? @ )?([^/?]*)(?:\/|)(.*)/;
/**
* Determines whether a provided address matches the provided parent domain in order
* to avoid certain attack vectors.
*
* @param {String} srvAddress The address to check against a domain
* @param {String} parentDomain The domain to check the provided address against
* @return {Boolean} Whether the provided address matches the parent domain
*/
function matchesParentDomain(srvAddress, parentDomain) {
const regex = /^.*?\./;
const srv = `.${srvAddress.replace(regex, '')}`;
const parent = `.${parentDomain.replace(regex, '')}`;
return srv.endsWith(parent);
}
/**
* Lookup a `mongodb+srv` connection string, combine the parts and reparse it as a normal
* connection string.
*
* @param {string} uri The connection string to parse
* @param {object} options Optional user provided connection string options
* @param {function} callback
*/
function parseSrvConnectionString(uri, options, callback) {
const result = URL.parse(uri, true);
if (options.directConnection || options.directconnection) {
return callback(new MongoParseError('directConnection not supported with SRV URI'));
}
if (result.hostname.split('.').length < 3) {
return callback(new MongoParseError('URI does not have hostname, domain name and tld'));
}
result.domainLength = result.hostname.split('.').length;
if (result.pathname && result.pathname.match(',')) {
return callback(new MongoParseError('Invalid URI, cannot contain multiple hostnames'));
}
if (result.port) {
return callback(new MongoParseError(`Ports not accepted with '${PROTOCOL_MONGODB_SRV}' URIs`));
}
// Resolve the SRV record and use the result as the list of hosts to connect to.
const lookupAddress = result.host;
dns.resolveSrv(`_mongodb._tcp.${lookupAddress}`, (err, addresses) => {
if (err) return callback(err);
if (addresses.length === 0) {
return callback(new MongoParseError('No addresses found at host'));
}
for (let i = 0; i < addresses.length; i++) {
if (!matchesParentDomain(addresses[i].name, result.hostname, result.domainLength)) {
return callback(
new MongoParseError('Server record does not share hostname with parent URI')
);
}
}
// Convert the original URL to a non-SRV URL.
result.protocol = 'mongodb';
result.host = addresses.map(address => `${address.name}:${address.port}`).join(',');
// Default to SSL true if it's not specified.
if (
!('ssl' in options) &&
(!result.search || !('ssl' in result.query) || result.query.ssl === null)
) {
result.query.ssl = true;
}
// Resolve TXT record and add options from there if they exist.
dns.resolveTxt(lookupAddress, (err, record) => {
if (err) {
if (err.code !== 'ENODATA') {
return callback(err);
}
record = null;
}
if (record) {
if (record.length > 1) {
return callback(new MongoParseError('Multiple text records not allowed'));
}
record = qs.parse(record[0].join(''));
if (Object.keys(record).some(key => key !== 'authSource' && key !== 'replicaSet')) {
return callback(
new MongoParseError('Text record must only set `authSource` or `replicaSet`')
);
}
result.query = Object.assign({}, record, result.query);
}
// Set completed options back into the URL object.
result.search = qs.stringify(result.query);
const finalString = URL.format(result);
parseConnectionString(finalString, options, (err, ret) => {
if (err) {
callback(err);
return;
}
callback(null, Object.assign({}, ret, { srvHost: lookupAddress }));
});
});
});
}
/**
* Parses a query string item according to the connection string spec
*
* @param {string} key The key for the parsed value
* @param {Array|String} value The value to parse
* @return {Array|Object|String} The parsed value
*/
function parseQueryStringItemValue(key, value) {
if (Array.isArray(value)) {
// deduplicate and simplify arrays
value = value.filter((v, idx) => value.indexOf(v) === idx);
if (value.length === 1) value = value[0];
} else if (value.indexOf(':') > 0) {
value = value.split(',').reduce((result, pair) => {
const parts = pair.split(':');
result[parts[0]] = parseQueryStringItemValue(key, parts[1]);
return result;
}, {});
} else if (value.indexOf(',') > 0) {
value = value.split(',').map(v => {
return parseQueryStringItemValue(key, v);
});
} else if (value.toLowerCase() === 'true' || value.toLowerCase() === 'false') {
value = value.toLowerCase() === 'true';
} else if (!Number.isNaN(value) && !STRING_OPTIONS.has(key)) {
const numericValue = parseFloat(value);
if (!Number.isNaN(numericValue)) {
value = parseFloat(value);
}
}
return value;
}
// Options that are known boolean types
const BOOLEAN_OPTIONS = new Set([
'slaveok',
'slave_ok',
'sslvalidate',
'fsync',
'safe',
'retrywrites',
'j'
]);
// Known string options, only used to bypass Number coercion in `parseQueryStringItemValue`
const STRING_OPTIONS = new Set(['authsource', 'replicaset']);
// Supported text representations of auth mechanisms
// NOTE: this list exists in native already, if it is merged here we should deduplicate
const AUTH_MECHANISMS = new Set([
'GSSAPI',
'MONGODB-AWS',
'MONGODB-X509',
'MONGODB-CR',
'DEFAULT',
'SCRAM-SHA-1',
'SCRAM-SHA-256',
'PLAIN'
]);
// Lookup table used to translate normalized (lower-cased) forms of connection string
// options to their expected camelCase version
const CASE_TRANSLATION = {
replicaset: 'replicaSet',
connecttimeoutms: 'connectTimeoutMS',
sockettimeoutms: 'socketTimeoutMS',
maxpoolsize: 'maxPoolSize',
minpoolsize: 'minPoolSize',
maxidletimems: 'maxIdleTimeMS',
waitqueuemultiple: 'waitQueueMultiple',
waitqueuetimeoutms: 'waitQueueTimeoutMS',
wtimeoutms: 'wtimeoutMS',
readconcern: 'readConcern',
readconcernlevel: 'readConcernLevel',
readpreference: 'readPreference',
maxstalenessseconds: 'maxStalenessSeconds',
readpreferencetags: 'readPreferenceTags',
authsource: 'authSource',
authmechanism: 'authMechanism',
authmechanismproperties: 'authMechanismProperties',
gssapiservicename: 'gssapiServiceName',
localthresholdms: 'localThresholdMS',
serverselectiontimeoutms: 'serverSelectionTimeoutMS',
serverselectiontryonce: 'serverSelectionTryOnce',
heartbeatfrequencyms: 'heartbeatFrequencyMS',
retrywrites: 'retryWrites',
uuidrepresentation: 'uuidRepresentation',
zlibcompressionlevel: 'zlibCompressionLevel',
tlsallowinvalidcertificates: 'tlsAllowInvalidCertificates',
tlsallowinvalidhostnames: 'tlsAllowInvalidHostnames',
tlsinsecure: 'tlsInsecure',
tlscafile: 'tlsCAFile',
tlscertificatekeyfile: 'tlsCertificateKeyFile',
tlscertificatekeyfilepassword: 'tlsCertificateKeyFilePassword',
wtimeout: 'wTimeoutMS',
j: 'journal',
directconnection: 'directConnection'
};
/**
* Sets the value for `key`, allowing for any required translation
*
* @param {object} obj The object to set the key on
* @param {string} key The key to set the value for
* @param {*} value The value to set
* @param {object} options The options used for option parsing
*/
function applyConnectionStringOption(obj, key, value, options) {
// simple key translation
if (key === 'journal') {
key = 'j';
} else if (key === 'wtimeoutms') {
key = 'wtimeout';
}
// more complicated translation
if (BOOLEAN_OPTIONS.has(key)) {
value = value === 'true' || value === true;
} else if (key === 'appname') {
value = decodeURIComponent(value);
} else if (key === 'readconcernlevel') {
obj['readConcernLevel'] = value;
key = 'readconcern';
value = { level: value };
}
// simple validation
if (key === 'compressors') {
value = Array.isArray(value) ? value : [value];
if (!value.every(c => c === 'snappy' || c === 'zlib')) {
throw new MongoParseError(
'Value for `compressors` must be at least one of: `snappy`, `zlib`'
);
}
}
if (key === 'authmechanism' && !AUTH_MECHANISMS.has(value)) {
throw new MongoParseError(
`Value for authMechanism must be one of: ${Array.from(AUTH_MECHANISMS).join(
', '
)}, found: ${value}`
);
}
if (key === 'readpreference' && !ReadPreference.isValid(value)) {
throw new MongoParseError(
'Value for `readPreference` must be one of: `primary`, `primaryPreferred`, `secondary`, `secondaryPreferred`, `nearest`'
);
}
if (key === 'zlibcompressionlevel' && (value < -1 || value > 9)) {
throw new MongoParseError('zlibCompressionLevel must be an integer between -1 and 9');
}
// special cases
if (key === 'compressors' || key === 'zlibcompressionlevel') {
obj.compression = obj.compression || {};
obj = obj.compression;
}
if (key === 'authmechanismproperties') {
if (typeof value.SERVICE_NAME === 'string') obj.gssapiServiceName = value.SERVICE_NAME;
if (typeof value.SERVICE_REALM === 'string') obj.gssapiServiceRealm = value.SERVICE_REALM;
if (typeof value.CANONICALIZE_HOST_NAME !== 'undefined') {
obj.gssapiCanonicalizeHostName = value.CANONICALIZE_HOST_NAME;
}
}
if (key === 'readpreferencetags') {
value = Array.isArray(value) ? splitArrayOfMultipleReadPreferenceTags(value) : [value];
}
// set the actual value
if (options.caseTranslate && CASE_TRANSLATION[key]) {
obj[CASE_TRANSLATION[key]] = value;
return;
}
obj[key] = value;
}
const USERNAME_REQUIRED_MECHANISMS = new Set([
'GSSAPI',
'MONGODB-CR',
'PLAIN',
'SCRAM-SHA-1',
'SCRAM-SHA-256'
]);
function splitArrayOfMultipleReadPreferenceTags(value) {
const parsedTags = [];
for (let i = 0; i < value.length; i++) {
parsedTags[i] = {};
value[i].split(',').forEach(individualTag => {
const splitTag = individualTag.split(':');
parsedTags[i][splitTag[0]] = splitTag[1];
});
}
return parsedTags;
}
/**
* Modifies the parsed connection string object taking into account expectations we
* have for authentication-related options.
*
* @param {object} parsed The parsed connection string result
* @return The parsed connection string result possibly modified for auth expectations
*/
function applyAuthExpectations(parsed) {
if (parsed.options == null) {
return;
}
const options = parsed.options;
const authSource = options.authsource || options.authSource;
if (authSource != null) {
parsed.auth = Object.assign({}, parsed.auth, { db: authSource });
}
const authMechanism = options.authmechanism || options.authMechanism;
if (authMechanism != null) {
if (
USERNAME_REQUIRED_MECHANISMS.has(authMechanism) &&
(!parsed.auth || parsed.auth.username == null)
) {
throw new MongoParseError(`Username required for mechanism \`${authMechanism}\``);
}
if (authMechanism === 'GSSAPI') {
if (authSource != null && authSource !== '$external') {
throw new MongoParseError(
`Invalid source \`${authSource}\` for mechanism \`${authMechanism}\` specified.`
);
}
parsed.auth = Object.assign({}, parsed.auth, { db: '$external' });
}
if (authMechanism === 'MONGODB-AWS') {
if (authSource != null && authSource !== '$external') {
throw new MongoParseError(
`Invalid source \`${authSource}\` for mechanism \`${authMechanism}\` specified.`
);
}
parsed.auth = Object.assign({}, parsed.auth, { db: '$external' });
}
if (authMechanism === 'MONGODB-X509') {
if (parsed.auth && parsed.auth.password != null) {
throw new MongoParseError(`Password not allowed for mechanism \`${authMechanism}\``);
}
if (authSource != null && authSource !== '$external') {
throw new MongoParseError(
`Invalid source \`${authSource}\` for mechanism \`${authMechanism}\` specified.`
);
}
parsed.auth = Object.assign({}, parsed.auth, { db: '$external' });
}
if (authMechanism === 'PLAIN') {
if (parsed.auth && parsed.auth.db == null) {
parsed.auth = Object.assign({}, parsed.auth, { db: '$external' });
}
}
}
// default to `admin` if nothing else was resolved
if (parsed.auth && parsed.auth.db == null) {
parsed.auth = Object.assign({}, parsed.auth, { db: 'admin' });
}
return parsed;
}
/**
* Parses a query string according the connection string spec.
*
* @param {String} query The query string to parse
* @param {object} [options] The options used for options parsing
* @return {Object|Error} The parsed query string as an object, or an error if one was encountered
*/
function parseQueryString(query, options) {
const result = {};
let parsedQueryString = qs.parse(query);
checkTLSOptions(parsedQueryString);
for (const key in parsedQueryString) {
const value = parsedQueryString[key];
if (value === '' || value == null) {
throw new MongoParseError('Incomplete key value pair for option');
}
const normalizedKey = key.toLowerCase();
const parsedValue = parseQueryStringItemValue(normalizedKey, value);
applyConnectionStringOption(result, normalizedKey, parsedValue, options);
}
// special cases for known deprecated options
if (result.wtimeout && result.wtimeoutms) {
delete result.wtimeout;
console.warn('Unsupported option `wtimeout` specified');
}
return Object.keys(result).length ? result : null;
}
/// Adds support for modern `tls` variants of out `ssl` options
function translateTLSOptions(queryString) {
if (queryString.tls) {
queryString.ssl = queryString.tls;
}
if (queryString.tlsInsecure) {
queryString.checkServerIdentity = false;
queryString.sslValidate = false;
} else {
Object.assign(queryString, {
checkServerIdentity: queryString.tlsAllowInvalidHostnames ? false : true,
sslValidate: queryString.tlsAllowInvalidCertificates ? false : true
});
}
if (queryString.tlsCAFile) {
queryString.ssl = true;
queryString.sslCA = queryString.tlsCAFile;
}
if (queryString.tlsCertificateKeyFile) {
queryString.ssl = true;
if (queryString.tlsCertificateFile) {
queryString.sslCert = queryString.tlsCertificateFile;
queryString.sslKey = queryString.tlsCertificateKeyFile;
} else {
queryString.sslKey = queryString.tlsCertificateKeyFile;
queryString.sslCert = queryString.tlsCertificateKeyFile;
}
}
if (queryString.tlsCertificateKeyFilePassword) {
queryString.ssl = true;
queryString.sslPass = queryString.tlsCertificateKeyFilePassword;
}
return queryString;
}
/**
* Checks a query string for invalid tls options according to the URI options spec.
*
* @param {string} queryString The query string to check
* @throws {MongoParseError}
*/
function checkTLSOptions(queryString) {
const queryStringKeys = Object.keys(queryString);
if (
queryStringKeys.indexOf('tlsInsecure') !== -1 &&
(queryStringKeys.indexOf('tlsAllowInvalidCertificates') !== -1 ||
queryStringKeys.indexOf('tlsAllowInvalidHostnames') !== -1)
) {
throw new MongoParseError(
'The `tlsInsecure` option cannot be used with `tlsAllowInvalidCertificates` or `tlsAllowInvalidHostnames`.'
);
}
const tlsValue = assertTlsOptionsAreEqual('tls', queryString, queryStringKeys);
const sslValue = assertTlsOptionsAreEqual('ssl', queryString, queryStringKeys);
if (tlsValue != null && sslValue != null) {
if (tlsValue !== sslValue) {
throw new MongoParseError('All values of `tls` and `ssl` must be the same.');
}
}
}
/**
* Checks a query string to ensure all tls/ssl options are the same.
*
* @param {string} key The key (tls or ssl) to check
* @param {string} queryString The query string to check
* @throws {MongoParseError}
* @return The value of the tls/ssl option
*/
function assertTlsOptionsAreEqual(optionName, queryString, queryStringKeys) {
const queryStringHasTLSOption = queryStringKeys.indexOf(optionName) !== -1;
let optionValue;
if (Array.isArray(queryString[optionName])) {
optionValue = queryString[optionName][0];
} else {
optionValue = queryString[optionName];
}
if (queryStringHasTLSOption) {
if (Array.isArray(queryString[optionName])) {
const firstValue = queryString[optionName][0];
queryString[optionName].forEach(tlsValue => {
if (tlsValue !== firstValue) {
throw new MongoParseError(`All values of ${optionName} must be the same.`);
}
});
}
}
return optionValue;
}
const PROTOCOL_MONGODB = 'mongodb';
const PROTOCOL_MONGODB_SRV = 'mongodb+srv';
const SUPPORTED_PROTOCOLS = [PROTOCOL_MONGODB, PROTOCOL_MONGODB_SRV];
/**
* Parses a MongoDB connection string
*
* @param {*} uri the MongoDB connection string to parse
* @param {object} [options] Optional settings.
* @param {boolean} [options.caseTranslate] Whether the parser should translate options back into camelCase after normalization
* @param {parseCallback} callback
*/
function parseConnectionString(uri, options, callback) {
if (typeof options === 'function') (callback = options), (options = {});
options = Object.assign({}, { caseTranslate: true }, options);
// Check for bad uris before we parse
try {
URL.parse(uri);
} catch (e) {
return callback(new MongoParseError('URI malformed, cannot be parsed'));
}
const cap = uri.match(HOSTS_RX);
if (!cap) {
return callback(new MongoParseError('Invalid connection string'));
}
const protocol = cap[1];
if (SUPPORTED_PROTOCOLS.indexOf(protocol) === -1) {
return callback(new MongoParseError('Invalid protocol provided'));
}
const dbAndQuery = cap[4].split('?');
const db = dbAndQuery.length > 0 ? dbAndQuery[0] : null;
const query = dbAndQuery.length > 1 ? dbAndQuery[1] : null;
let parsedOptions;
try {
parsedOptions = parseQueryString(query, options);
} catch (parseError) {
return callback(parseError);
}
parsedOptions = Object.assign({}, parsedOptions, options);
if (protocol === PROTOCOL_MONGODB_SRV) {
return parseSrvConnectionString(uri, parsedOptions, callback);
}
const auth = { username: null, password: null, db: db && db !== '' ? qs.unescape(db) : null };
if (parsedOptions.auth) {
// maintain support for legacy options passed into `MongoClient`
if (parsedOptions.auth.username) auth.username = parsedOptions.auth.username;
if (parsedOptions.auth.user) auth.username = parsedOptions.auth.user;
if (parsedOptions.auth.password) auth.password = parsedOptions.auth.password;
} else {
if (parsedOptions.username) auth.username = parsedOptions.username;
if (parsedOptions.user) auth.username = parsedOptions.user;
if (parsedOptions.password) auth.password = parsedOptions.password;
}
if (cap[4].split('?')[0].indexOf('@') !== -1) {
return callback(new MongoParseError('Unescaped slash in userinfo section'));
}
const authorityParts = cap[3].split('@');
if (authorityParts.length > 2) {
return callback(new MongoParseError('Unescaped at-sign in authority section'));
}
if (authorityParts[0] == null || authorityParts[0] === '') {
return callback(new MongoParseError('No username provided in authority section'));
}
if (authorityParts.length > 1) {
const authParts = authorityParts.shift().split(':');
if (authParts.length > 2) {
return callback(new MongoParseError('Unescaped colon in authority section'));
}
if (authParts[0] === '') {
return callback(new MongoParseError('Invalid empty username provided'));
}
if (!auth.username) auth.username = qs.unescape(authParts[0]);
if (!auth.password) auth.password = authParts[1] ? qs.unescape(authParts[1]) : null;
}
let hostParsingError = null;
const hosts = authorityParts
.shift()
.split(',')
.map(host => {
let parsedHost = URL.parse(`mongodb://${host}`);
if (parsedHost.path === '/:') {
hostParsingError = new MongoParseError('Double colon in host identifier');
return null;
}
// heuristically determine if we're working with a domain socket
if (host.match(/\.sock/)) {
parsedHost.hostname = qs.unescape(host);
parsedHost.port = null;
}
if (Number.isNaN(parsedHost.port)) {
hostParsingError = new MongoParseError('Invalid port (non-numeric string)');
return;
}
const result = {
host: parsedHost.hostname,
port: parsedHost.port ? parseInt(parsedHost.port) : 27017
};
if (result.port === 0) {
hostParsingError = new MongoParseError('Invalid port (zero) with hostname');
return;
}
if (result.port > 65535) {
hostParsingError = new MongoParseError('Invalid port (larger than 65535) with hostname');
return;
}
if (result.port < 0) {
hostParsingError = new MongoParseError('Invalid port (negative number)');
return;
}
return result;
})
.filter(host => !!host);
if (hostParsingError) {
return callback(hostParsingError);
}
if (hosts.length === 0 || hosts[0].host === '' || hosts[0].host === null) {
return callback(new MongoParseError('No hostname or hostnames provided in connection string'));
}
const directConnection = !!parsedOptions.directConnection;
if (directConnection && hosts.length !== 1) {
// If the option is set to true, the driver MUST validate that there is exactly one host given
// in the host list in the URI, and fail client creation otherwise.
return callback(new MongoParseError('directConnection option requires exactly one host'));
}
// NOTE: this behavior will go away in v4.0, we will always auto discover there
if (
parsedOptions.directConnection == null &&
hosts.length === 1 &&
parsedOptions.replicaSet == null
) {
parsedOptions.directConnection = true;
}
const result = {
hosts: hosts,
auth: auth.db || auth.username ? auth : null,
options: Object.keys(parsedOptions).length ? parsedOptions : null
};
if (result.auth && result.auth.db) {
result.defaultDatabase = result.auth.db;
} else {
result.defaultDatabase = 'test';
}
// support modern `tls` variants to SSL options
result.options = translateTLSOptions(result.options);
try {
applyAuthExpectations(result);
} catch (authError) {
return callback(authError);
}
callback(null, result);
}
module.exports = parseConnectionString;

297
node_modules/mongodb/lib/core/utils.js generated vendored Normal file
View File

@@ -0,0 +1,297 @@
'use strict';
const os = require('os');
const crypto = require('crypto');
const requireOptional = require('require_optional');
/**
* Generate a UUIDv4
*/
const uuidV4 = () => {
const result = crypto.randomBytes(16);
result[6] = (result[6] & 0x0f) | 0x40;
result[8] = (result[8] & 0x3f) | 0x80;
return result;
};
/**
* Relays events for a given listener and emitter
*
* @param {EventEmitter} listener the EventEmitter to listen to the events from
* @param {EventEmitter} emitter the EventEmitter to relay the events to
*/
function relayEvents(listener, emitter, events) {
events.forEach(eventName => listener.on(eventName, event => emitter.emit(eventName, event)));
}
function retrieveKerberos() {
let kerberos;
try {
kerberos = requireOptional('kerberos');
} catch (err) {
if (err.code === 'MODULE_NOT_FOUND') {
throw new Error('The `kerberos` module was not found. Please install it and try again.');
}
throw err;
}
return kerberos;
}
// Throw an error if an attempt to use EJSON is made when it is not installed
const noEJSONError = function() {
throw new Error('The `mongodb-extjson` module was not found. Please install it and try again.');
};
// Facilitate loading EJSON optionally
function retrieveEJSON() {
let EJSON = null;
try {
EJSON = requireOptional('mongodb-extjson');
} catch (error) {} // eslint-disable-line
if (!EJSON) {
EJSON = {
parse: noEJSONError,
deserialize: noEJSONError,
serialize: noEJSONError,
stringify: noEJSONError,
setBSONModule: noEJSONError,
BSON: noEJSONError
};
}
return EJSON;
}
/**
* A helper function for determining `maxWireVersion` between legacy and new topology
* instances
*
* @private
* @param {(Topology|Server)} topologyOrServer
*/
function maxWireVersion(topologyOrServer) {
if (topologyOrServer) {
if (topologyOrServer.ismaster) {
return topologyOrServer.ismaster.maxWireVersion;
}
if (typeof topologyOrServer.lastIsMaster === 'function') {
const lastIsMaster = topologyOrServer.lastIsMaster();
if (lastIsMaster) {
return lastIsMaster.maxWireVersion;
}
}
if (topologyOrServer.description) {
return topologyOrServer.description.maxWireVersion;
}
}
return 0;
}
/*
* Checks that collation is supported by server.
*
* @param {Server} [server] to check against
* @param {object} [cmd] object where collation may be specified
* @param {function} [callback] callback function
* @return true if server does not support collation
*/
function collationNotSupported(server, cmd) {
return cmd && cmd.collation && maxWireVersion(server) < 5;
}
/**
* Checks if a given value is a Promise
*
* @param {*} maybePromise
* @return true if the provided value is a Promise
*/
function isPromiseLike(maybePromise) {
return maybePromise && typeof maybePromise.then === 'function';
}
/**
* Applies the function `eachFn` to each item in `arr`, in parallel.
*
* @param {array} arr an array of items to asynchronusly iterate over
* @param {function} eachFn A function to call on each item of the array. The callback signature is `(item, callback)`, where the callback indicates iteration is complete.
* @param {function} callback The callback called after every item has been iterated
*/
function eachAsync(arr, eachFn, callback) {
arr = arr || [];
let idx = 0;
let awaiting = 0;
for (idx = 0; idx < arr.length; ++idx) {
awaiting++;
eachFn(arr[idx], eachCallback);
}
if (awaiting === 0) {
callback();
return;
}
function eachCallback(err) {
awaiting--;
if (err) {
callback(err);
return;
}
if (idx === arr.length && awaiting <= 0) {
callback();
}
}
}
function eachAsyncSeries(arr, eachFn, callback) {
arr = arr || [];
let idx = 0;
let awaiting = arr.length;
if (awaiting === 0) {
callback();
return;
}
function eachCallback(err) {
idx++;
awaiting--;
if (err) {
callback(err);
return;
}
if (idx === arr.length && awaiting <= 0) {
callback();
return;
}
eachFn(arr[idx], eachCallback);
}
eachFn(arr[idx], eachCallback);
}
function isUnifiedTopology(topology) {
return topology.description != null;
}
function arrayStrictEqual(arr, arr2) {
if (!Array.isArray(arr) || !Array.isArray(arr2)) {
return false;
}
return arr.length === arr2.length && arr.every((elt, idx) => elt === arr2[idx]);
}
function tagsStrictEqual(tags, tags2) {
const tagsKeys = Object.keys(tags);
const tags2Keys = Object.keys(tags2);
return tagsKeys.length === tags2Keys.length && tagsKeys.every(key => tags2[key] === tags[key]);
}
function errorStrictEqual(lhs, rhs) {
if (lhs === rhs) {
return true;
}
if ((lhs == null && rhs != null) || (lhs != null && rhs == null)) {
return false;
}
if (lhs.constructor.name !== rhs.constructor.name) {
return false;
}
if (lhs.message !== rhs.message) {
return false;
}
return true;
}
function makeStateMachine(stateTable) {
return function stateTransition(target, newState) {
const legalStates = stateTable[target.s.state];
if (legalStates && legalStates.indexOf(newState) < 0) {
throw new TypeError(
`illegal state transition from [${target.s.state}] => [${newState}], allowed: [${legalStates}]`
);
}
target.emit('stateChanged', target.s.state, newState);
target.s.state = newState;
};
}
function makeClientMetadata(options) {
options = options || {};
const metadata = {
driver: {
name: 'nodejs',
version: require('../../package.json').version
},
os: {
type: os.type(),
name: process.platform,
architecture: process.arch,
version: os.release()
},
platform: `'Node.js ${process.version}, ${os.endianness} (${
options.useUnifiedTopology ? 'unified' : 'legacy'
})`
};
// support optionally provided wrapping driver info
if (options.driverInfo) {
if (options.driverInfo.name) {
metadata.driver.name = `${metadata.driver.name}|${options.driverInfo.name}`;
}
if (options.driverInfo.version) {
metadata.version = `${metadata.driver.version}|${options.driverInfo.version}`;
}
if (options.driverInfo.platform) {
metadata.platform = `${metadata.platform}|${options.driverInfo.platform}`;
}
}
if (options.appname) {
// MongoDB requires the appname not exceed a byte length of 128
const buffer = Buffer.from(options.appname);
metadata.application = {
name: buffer.length > 128 ? buffer.slice(0, 128).toString('utf8') : options.appname
};
}
return metadata;
}
const noop = () => {};
module.exports = {
uuidV4,
relayEvents,
collationNotSupported,
retrieveEJSON,
retrieveKerberos,
maxWireVersion,
isPromiseLike,
eachAsync,
eachAsyncSeries,
isUnifiedTopology,
arrayStrictEqual,
tagsStrictEqual,
errorStrictEqual,
makeStateMachine,
makeClientMetadata,
noop
};

177
node_modules/mongodb/lib/core/wireprotocol/command.js generated vendored Normal file
View File

@@ -0,0 +1,177 @@
'use strict';
const Query = require('../connection/commands').Query;
const Msg = require('../connection/msg').Msg;
const MongoError = require('../error').MongoError;
const getReadPreference = require('./shared').getReadPreference;
const isSharded = require('./shared').isSharded;
const databaseNamespace = require('./shared').databaseNamespace;
const isTransactionCommand = require('../transactions').isTransactionCommand;
const applySession = require('../sessions').applySession;
const MongoNetworkError = require('../error').MongoNetworkError;
const maxWireVersion = require('../utils').maxWireVersion;
function isClientEncryptionEnabled(server) {
const wireVersion = maxWireVersion(server);
return wireVersion && server.autoEncrypter;
}
function command(server, ns, cmd, options, callback) {
if (typeof options === 'function') (callback = options), (options = {});
options = options || {};
if (cmd == null) {
return callback(new MongoError(`command ${JSON.stringify(cmd)} does not return a cursor`));
}
if (!isClientEncryptionEnabled(server)) {
_command(server, ns, cmd, options, callback);
return;
}
const wireVersion = maxWireVersion(server);
if (typeof wireVersion !== 'number' || wireVersion < 8) {
callback(new MongoError('Auto-encryption requires a minimum MongoDB version of 4.2'));
return;
}
_cryptCommand(server, ns, cmd, options, callback);
}
function _command(server, ns, cmd, options, callback) {
const bson = server.s.bson;
const pool = server.s.pool;
const readPreference = getReadPreference(cmd, options);
const shouldUseOpMsg = supportsOpMsg(server);
const session = options.session;
let clusterTime = server.clusterTime;
let finalCmd = Object.assign({}, cmd);
if (hasSessionSupport(server) && session) {
if (
session.clusterTime &&
session.clusterTime.clusterTime.greaterThan(clusterTime.clusterTime)
) {
clusterTime = session.clusterTime;
}
const err = applySession(session, finalCmd, options);
if (err) {
return callback(err);
}
}
// if we have a known cluster time, gossip it
if (clusterTime) {
finalCmd.$clusterTime = clusterTime;
}
if (isSharded(server) && !shouldUseOpMsg && readPreference && readPreference.mode !== 'primary') {
finalCmd = {
$query: finalCmd,
$readPreference: readPreference.toJSON()
};
}
const commandOptions = Object.assign(
{
command: true,
numberToSkip: 0,
numberToReturn: -1,
checkKeys: false
},
options
);
// This value is not overridable
commandOptions.slaveOk = readPreference.slaveOk();
const cmdNs = `${databaseNamespace(ns)}.$cmd`;
const message = shouldUseOpMsg
? new Msg(bson, cmdNs, finalCmd, commandOptions)
: new Query(bson, cmdNs, finalCmd, commandOptions);
const inTransaction = session && (session.inTransaction() || isTransactionCommand(finalCmd));
const commandResponseHandler = inTransaction
? function(err) {
// We need to add a TransientTransactionError errorLabel, as stated in the transaction spec.
if (
err &&
err instanceof MongoNetworkError &&
!err.hasErrorLabel('TransientTransactionError')
) {
err.addErrorLabel('TransientTransactionError');
}
if (
!cmd.commitTransaction &&
err &&
err instanceof MongoError &&
err.hasErrorLabel('TransientTransactionError')
) {
session.transaction.unpinServer();
}
return callback.apply(null, arguments);
}
: callback;
try {
pool.write(message, commandOptions, commandResponseHandler);
} catch (err) {
commandResponseHandler(err);
}
}
function hasSessionSupport(topology) {
if (topology == null) return false;
if (topology.description) {
return topology.description.maxWireVersion >= 6;
}
return topology.ismaster == null ? false : topology.ismaster.maxWireVersion >= 6;
}
function supportsOpMsg(topologyOrServer) {
const description = topologyOrServer.ismaster
? topologyOrServer.ismaster
: topologyOrServer.description;
if (description == null) {
return false;
}
return description.maxWireVersion >= 6 && description.__nodejs_mock_server__ == null;
}
function _cryptCommand(server, ns, cmd, options, callback) {
const autoEncrypter = server.autoEncrypter;
function commandResponseHandler(err, response) {
if (err || response == null) {
callback(err, response);
return;
}
autoEncrypter.decrypt(response.result, options, (err, decrypted) => {
if (err) {
callback(err, null);
return;
}
response.result = decrypted;
response.message.documents = [decrypted];
callback(null, response);
});
}
autoEncrypter.encrypt(ns, cmd, options, (err, encrypted) => {
if (err) {
callback(err, null);
return;
}
_command(server, ns, encrypted, options, commandResponseHandler);
});
}
module.exports = command;

View File

@@ -0,0 +1,73 @@
'use strict';
const Snappy = require('../connection/utils').retrieveSnappy();
const zlib = require('zlib');
const compressorIDs = {
snappy: 1,
zlib: 2
};
const uncompressibleCommands = new Set([
'ismaster',
'saslStart',
'saslContinue',
'getnonce',
'authenticate',
'createUser',
'updateUser',
'copydbSaslStart',
'copydbgetnonce',
'copydb'
]);
// Facilitate compressing a message using an agreed compressor
function compress(self, dataToBeCompressed, callback) {
switch (self.options.agreedCompressor) {
case 'snappy':
Snappy.compress(dataToBeCompressed, callback);
break;
case 'zlib':
// Determine zlibCompressionLevel
var zlibOptions = {};
if (self.options.zlibCompressionLevel) {
zlibOptions.level = self.options.zlibCompressionLevel;
}
zlib.deflate(dataToBeCompressed, zlibOptions, callback);
break;
default:
throw new Error(
'Attempt to compress message using unknown compressor "' +
self.options.agreedCompressor +
'".'
);
}
}
// Decompress a message using the given compressor
function decompress(compressorID, compressedData, callback) {
if (compressorID < 0 || compressorID > compressorIDs.length) {
throw new Error(
'Server sent message compressed using an unsupported compressor. (Received compressor ID ' +
compressorID +
')'
);
}
switch (compressorID) {
case compressorIDs.snappy:
Snappy.uncompress(compressedData, callback);
break;
case compressorIDs.zlib:
zlib.inflate(compressedData, callback);
break;
default:
callback(null, compressedData);
}
}
module.exports = {
compressorIDs,
uncompressibleCommands,
compress,
decompress
};

View File

@@ -0,0 +1,13 @@
'use strict';
const MIN_SUPPORTED_SERVER_VERSION = '2.6';
const MAX_SUPPORTED_SERVER_VERSION = '4.4';
const MIN_SUPPORTED_WIRE_VERSION = 2;
const MAX_SUPPORTED_WIRE_VERSION = 9;
module.exports = {
MIN_SUPPORTED_SERVER_VERSION,
MAX_SUPPORTED_SERVER_VERSION,
MIN_SUPPORTED_WIRE_VERSION,
MAX_SUPPORTED_WIRE_VERSION
};

95
node_modules/mongodb/lib/core/wireprotocol/get_more.js generated vendored Normal file
View File

@@ -0,0 +1,95 @@
'use strict';
const GetMore = require('../connection/commands').GetMore;
const retrieveBSON = require('../connection/utils').retrieveBSON;
const MongoError = require('../error').MongoError;
const MongoNetworkError = require('../error').MongoNetworkError;
const BSON = retrieveBSON();
const Long = BSON.Long;
const collectionNamespace = require('./shared').collectionNamespace;
const maxWireVersion = require('../utils').maxWireVersion;
const applyCommonQueryOptions = require('./shared').applyCommonQueryOptions;
const command = require('./command');
function getMore(server, ns, cursorState, batchSize, options, callback) {
options = options || {};
const wireVersion = maxWireVersion(server);
function queryCallback(err, result) {
if (err) return callback(err);
const response = result.message;
// If we have a timed out query or a cursor that was killed
if (response.cursorNotFound) {
return callback(new MongoNetworkError('cursor killed or timed out'), null);
}
if (wireVersion < 4) {
const cursorId =
typeof response.cursorId === 'number'
? Long.fromNumber(response.cursorId)
: response.cursorId;
cursorState.documents = response.documents;
cursorState.cursorId = cursorId;
callback(null, null, response.connection);
return;
}
// We have an error detected
if (response.documents[0].ok === 0) {
return callback(new MongoError(response.documents[0]));
}
// Ensure we have a Long valid cursor id
const cursorId =
typeof response.documents[0].cursor.id === 'number'
? Long.fromNumber(response.documents[0].cursor.id)
: response.documents[0].cursor.id;
cursorState.documents = response.documents[0].cursor.nextBatch;
cursorState.cursorId = cursorId;
callback(null, response.documents[0], response.connection);
}
if (wireVersion < 4) {
const bson = server.s.bson;
const getMoreOp = new GetMore(bson, ns, cursorState.cursorId, { numberToReturn: batchSize });
const queryOptions = applyCommonQueryOptions({}, cursorState);
server.s.pool.write(getMoreOp, queryOptions, queryCallback);
return;
}
const cursorId =
cursorState.cursorId instanceof Long
? cursorState.cursorId
: Long.fromNumber(cursorState.cursorId);
const getMoreCmd = {
getMore: cursorId,
collection: collectionNamespace(ns),
batchSize: Math.abs(batchSize)
};
if (cursorState.cmd.tailable && typeof cursorState.cmd.maxAwaitTimeMS === 'number') {
getMoreCmd.maxTimeMS = cursorState.cmd.maxAwaitTimeMS;
}
const commandOptions = Object.assign(
{
returnFieldSelector: null,
documentsReturnedIn: 'nextBatch'
},
options
);
if (cursorState.session) {
commandOptions.session = cursorState.session;
}
command(server, ns, getMoreCmd, commandOptions, queryCallback);
}
module.exports = getMore;

18
node_modules/mongodb/lib/core/wireprotocol/index.js generated vendored Normal file
View File

@@ -0,0 +1,18 @@
'use strict';
const writeCommand = require('./write_command');
module.exports = {
insert: function insert(server, ns, ops, options, callback) {
writeCommand(server, 'insert', 'documents', ns, ops, options, callback);
},
update: function update(server, ns, ops, options, callback) {
writeCommand(server, 'update', 'updates', ns, ops, options, callback);
},
remove: function remove(server, ns, ops, options, callback) {
writeCommand(server, 'delete', 'deletes', ns, ops, options, callback);
},
killCursors: require('./kill_cursors'),
getMore: require('./get_more'),
query: require('./query'),
command: require('./command')
};

View File

@@ -0,0 +1,70 @@
'use strict';
const KillCursor = require('../connection/commands').KillCursor;
const MongoError = require('../error').MongoError;
const MongoNetworkError = require('../error').MongoNetworkError;
const collectionNamespace = require('./shared').collectionNamespace;
const maxWireVersion = require('../utils').maxWireVersion;
const command = require('./command');
function killCursors(server, ns, cursorState, callback) {
callback = typeof callback === 'function' ? callback : () => {};
const cursorId = cursorState.cursorId;
if (maxWireVersion(server) < 4) {
const bson = server.s.bson;
const pool = server.s.pool;
const killCursor = new KillCursor(bson, ns, [cursorId]);
const options = {
immediateRelease: true,
noResponse: true
};
if (typeof cursorState.session === 'object') {
options.session = cursorState.session;
}
if (pool && pool.isConnected()) {
try {
pool.write(killCursor, options, callback);
} catch (err) {
if (typeof callback === 'function') {
callback(err, null);
} else {
console.warn(err);
}
}
}
return;
}
const killCursorCmd = {
killCursors: collectionNamespace(ns),
cursors: [cursorId]
};
const options = {};
if (typeof cursorState.session === 'object') options.session = cursorState.session;
command(server, ns, killCursorCmd, options, (err, result) => {
if (err) {
return callback(err);
}
const response = result.message;
if (response.cursorNotFound) {
return callback(new MongoNetworkError('cursor killed or timed out'), null);
}
if (!Array.isArray(response.documents) || response.documents.length === 0) {
return callback(
new MongoError(`invalid killCursors result returned for cursor id ${cursorId}`)
);
}
callback(null, response.documents[0]);
});
}
module.exports = killCursors;

235
node_modules/mongodb/lib/core/wireprotocol/query.js generated vendored Normal file
View File

@@ -0,0 +1,235 @@
'use strict';
const Query = require('../connection/commands').Query;
const MongoError = require('../error').MongoError;
const getReadPreference = require('./shared').getReadPreference;
const collectionNamespace = require('./shared').collectionNamespace;
const isSharded = require('./shared').isSharded;
const maxWireVersion = require('../utils').maxWireVersion;
const applyCommonQueryOptions = require('./shared').applyCommonQueryOptions;
const command = require('./command');
function query(server, ns, cmd, cursorState, options, callback) {
options = options || {};
if (cursorState.cursorId != null) {
return callback();
}
if (cmd == null) {
return callback(new MongoError(`command ${JSON.stringify(cmd)} does not return a cursor`));
}
if (maxWireVersion(server) < 4) {
const query = prepareLegacyFindQuery(server, ns, cmd, cursorState, options);
const queryOptions = applyCommonQueryOptions({}, cursorState);
if (typeof query.documentsReturnedIn === 'string') {
queryOptions.documentsReturnedIn = query.documentsReturnedIn;
}
server.s.pool.write(query, queryOptions, callback);
return;
}
const readPreference = getReadPreference(cmd, options);
const findCmd = prepareFindCommand(server, ns, cmd, cursorState, options);
// NOTE: This actually modifies the passed in cmd, and our code _depends_ on this
// side-effect. Change this ASAP
cmd.virtual = false;
const commandOptions = Object.assign(
{
documentsReturnedIn: 'firstBatch',
numberToReturn: 1,
slaveOk: readPreference.slaveOk()
},
options
);
if (cmd.readPreference) {
commandOptions.readPreference = readPreference;
}
if (cursorState.session) {
commandOptions.session = cursorState.session;
}
command(server, ns, findCmd, commandOptions, callback);
}
function prepareFindCommand(server, ns, cmd, cursorState) {
cursorState.batchSize = cmd.batchSize || cursorState.batchSize;
let findCmd = {
find: collectionNamespace(ns)
};
if (cmd.query) {
if (cmd.query['$query']) {
findCmd.filter = cmd.query['$query'];
} else {
findCmd.filter = cmd.query;
}
}
let sortValue = cmd.sort;
if (Array.isArray(sortValue)) {
const sortObject = {};
if (sortValue.length > 0 && !Array.isArray(sortValue[0])) {
let sortDirection = sortValue[1];
if (sortDirection === 'asc') {
sortDirection = 1;
} else if (sortDirection === 'desc') {
sortDirection = -1;
}
sortObject[sortValue[0]] = sortDirection;
} else {
for (let i = 0; i < sortValue.length; i++) {
let sortDirection = sortValue[i][1];
if (sortDirection === 'asc') {
sortDirection = 1;
} else if (sortDirection === 'desc') {
sortDirection = -1;
}
sortObject[sortValue[i][0]] = sortDirection;
}
}
sortValue = sortObject;
}
if (typeof cmd.allowDiskUse === 'boolean') {
findCmd.allowDiskUse = cmd.allowDiskUse;
}
if (cmd.sort) findCmd.sort = sortValue;
if (cmd.fields) findCmd.projection = cmd.fields;
if (cmd.hint) findCmd.hint = cmd.hint;
if (cmd.skip) findCmd.skip = cmd.skip;
if (cmd.limit) findCmd.limit = cmd.limit;
if (cmd.limit < 0) {
findCmd.limit = Math.abs(cmd.limit);
findCmd.singleBatch = true;
}
if (typeof cmd.batchSize === 'number') {
if (cmd.batchSize < 0) {
if (cmd.limit !== 0 && Math.abs(cmd.batchSize) < Math.abs(cmd.limit)) {
findCmd.limit = Math.abs(cmd.batchSize);
}
findCmd.singleBatch = true;
}
findCmd.batchSize = Math.abs(cmd.batchSize);
}
if (cmd.comment) findCmd.comment = cmd.comment;
if (cmd.maxScan) findCmd.maxScan = cmd.maxScan;
if (cmd.maxTimeMS) findCmd.maxTimeMS = cmd.maxTimeMS;
if (cmd.min) findCmd.min = cmd.min;
if (cmd.max) findCmd.max = cmd.max;
findCmd.returnKey = cmd.returnKey ? cmd.returnKey : false;
findCmd.showRecordId = cmd.showDiskLoc ? cmd.showDiskLoc : false;
if (cmd.snapshot) findCmd.snapshot = cmd.snapshot;
if (cmd.tailable) findCmd.tailable = cmd.tailable;
if (cmd.oplogReplay) findCmd.oplogReplay = cmd.oplogReplay;
if (cmd.noCursorTimeout) findCmd.noCursorTimeout = cmd.noCursorTimeout;
if (cmd.awaitData) findCmd.awaitData = cmd.awaitData;
if (cmd.awaitdata) findCmd.awaitData = cmd.awaitdata;
if (cmd.partial) findCmd.partial = cmd.partial;
if (cmd.collation) findCmd.collation = cmd.collation;
if (cmd.readConcern) findCmd.readConcern = cmd.readConcern;
// If we have explain, we need to rewrite the find command
// to wrap it in the explain command
if (cmd.explain) {
findCmd = {
explain: findCmd
};
}
return findCmd;
}
function prepareLegacyFindQuery(server, ns, cmd, cursorState, options) {
options = options || {};
const bson = server.s.bson;
const readPreference = getReadPreference(cmd, options);
cursorState.batchSize = cmd.batchSize || cursorState.batchSize;
let numberToReturn = 0;
if (
cursorState.limit < 0 ||
(cursorState.limit !== 0 && cursorState.limit < cursorState.batchSize) ||
(cursorState.limit > 0 && cursorState.batchSize === 0)
) {
numberToReturn = cursorState.limit;
} else {
numberToReturn = cursorState.batchSize;
}
const numberToSkip = cursorState.skip || 0;
const findCmd = {};
if (isSharded(server) && readPreference) {
findCmd['$readPreference'] = readPreference.toJSON();
}
if (cmd.sort) findCmd['$orderby'] = cmd.sort;
if (cmd.hint) findCmd['$hint'] = cmd.hint;
if (cmd.snapshot) findCmd['$snapshot'] = cmd.snapshot;
if (typeof cmd.returnKey !== 'undefined') findCmd['$returnKey'] = cmd.returnKey;
if (cmd.maxScan) findCmd['$maxScan'] = cmd.maxScan;
if (cmd.min) findCmd['$min'] = cmd.min;
if (cmd.max) findCmd['$max'] = cmd.max;
if (typeof cmd.showDiskLoc !== 'undefined') findCmd['$showDiskLoc'] = cmd.showDiskLoc;
if (cmd.comment) findCmd['$comment'] = cmd.comment;
if (cmd.maxTimeMS) findCmd['$maxTimeMS'] = cmd.maxTimeMS;
if (cmd.explain) {
// nToReturn must be 0 (match all) or negative (match N and close cursor)
// nToReturn > 0 will give explain results equivalent to limit(0)
numberToReturn = -Math.abs(cmd.limit || 0);
findCmd['$explain'] = true;
}
findCmd['$query'] = cmd.query;
if (cmd.readConcern && cmd.readConcern.level !== 'local') {
throw new MongoError(
`server find command does not support a readConcern level of ${cmd.readConcern.level}`
);
}
if (cmd.readConcern) {
cmd = Object.assign({}, cmd);
delete cmd['readConcern'];
}
const serializeFunctions =
typeof options.serializeFunctions === 'boolean' ? options.serializeFunctions : false;
const ignoreUndefined =
typeof options.ignoreUndefined === 'boolean' ? options.ignoreUndefined : false;
const query = new Query(bson, ns, findCmd, {
numberToSkip: numberToSkip,
numberToReturn: numberToReturn,
pre32Limit: typeof cmd.limit !== 'undefined' ? cmd.limit : undefined,
checkKeys: false,
returnFieldSelector: cmd.fields,
serializeFunctions: serializeFunctions,
ignoreUndefined: ignoreUndefined
});
if (typeof cmd.tailable === 'boolean') query.tailable = cmd.tailable;
if (typeof cmd.oplogReplay === 'boolean') query.oplogReplay = cmd.oplogReplay;
if (typeof cmd.noCursorTimeout === 'boolean') query.noCursorTimeout = cmd.noCursorTimeout;
if (typeof cmd.awaitData === 'boolean') query.awaitData = cmd.awaitData;
if (typeof cmd.partial === 'boolean') query.partial = cmd.partial;
query.slaveOk = readPreference.slaveOk();
return query;
}
module.exports = query;

115
node_modules/mongodb/lib/core/wireprotocol/shared.js generated vendored Normal file
View File

@@ -0,0 +1,115 @@
'use strict';
const ReadPreference = require('../topologies/read_preference');
const MongoError = require('../error').MongoError;
const ServerType = require('../sdam/common').ServerType;
const TopologyDescription = require('../sdam/topology_description').TopologyDescription;
const MESSAGE_HEADER_SIZE = 16;
const COMPRESSION_DETAILS_SIZE = 9; // originalOpcode + uncompressedSize, compressorID
// OPCODE Numbers
// Defined at https://docs.mongodb.com/manual/reference/mongodb-wire-protocol/#request-opcodes
var opcodes = {
OP_REPLY: 1,
OP_UPDATE: 2001,
OP_INSERT: 2002,
OP_QUERY: 2004,
OP_GETMORE: 2005,
OP_DELETE: 2006,
OP_KILL_CURSORS: 2007,
OP_COMPRESSED: 2012,
OP_MSG: 2013
};
var getReadPreference = function(cmd, options) {
// Default to command version of the readPreference
var readPreference = cmd.readPreference || new ReadPreference('primary');
// If we have an option readPreference override the command one
if (options.readPreference) {
readPreference = options.readPreference;
}
if (typeof readPreference === 'string') {
readPreference = new ReadPreference(readPreference);
}
if (!(readPreference instanceof ReadPreference)) {
throw new MongoError('read preference must be a ReadPreference instance');
}
return readPreference;
};
// Parses the header of a wire protocol message
var parseHeader = function(message) {
return {
length: message.readInt32LE(0),
requestId: message.readInt32LE(4),
responseTo: message.readInt32LE(8),
opCode: message.readInt32LE(12)
};
};
function applyCommonQueryOptions(queryOptions, options) {
Object.assign(queryOptions, {
raw: typeof options.raw === 'boolean' ? options.raw : false,
promoteLongs: typeof options.promoteLongs === 'boolean' ? options.promoteLongs : true,
promoteValues: typeof options.promoteValues === 'boolean' ? options.promoteValues : true,
promoteBuffers: typeof options.promoteBuffers === 'boolean' ? options.promoteBuffers : false,
monitoring: typeof options.monitoring === 'boolean' ? options.monitoring : false,
fullResult: typeof options.fullResult === 'boolean' ? options.fullResult : false
});
if (typeof options.socketTimeout === 'number') {
queryOptions.socketTimeout = options.socketTimeout;
}
if (options.session) {
queryOptions.session = options.session;
}
if (typeof options.documentsReturnedIn === 'string') {
queryOptions.documentsReturnedIn = options.documentsReturnedIn;
}
return queryOptions;
}
function isSharded(topologyOrServer) {
if (topologyOrServer.type === 'mongos') return true;
if (topologyOrServer.description && topologyOrServer.description.type === ServerType.Mongos) {
return true;
}
// NOTE: This is incredibly inefficient, and should be removed once command construction
// happens based on `Server` not `Topology`.
if (topologyOrServer.description && topologyOrServer.description instanceof TopologyDescription) {
const servers = Array.from(topologyOrServer.description.servers.values());
return servers.some(server => server.type === ServerType.Mongos);
}
return false;
}
function databaseNamespace(ns) {
return ns.split('.')[0];
}
function collectionNamespace(ns) {
return ns
.split('.')
.slice(1)
.join('.');
}
module.exports = {
getReadPreference,
MESSAGE_HEADER_SIZE,
COMPRESSION_DETAILS_SIZE,
opcodes,
parseHeader,
applyCommonQueryOptions,
isSharded,
databaseNamespace,
collectionNamespace
};

View File

@@ -0,0 +1,50 @@
'use strict';
const MongoError = require('../error').MongoError;
const collectionNamespace = require('./shared').collectionNamespace;
const command = require('./command');
function writeCommand(server, type, opsField, ns, ops, options, callback) {
if (ops.length === 0) throw new MongoError(`${type} must contain at least one document`);
if (typeof options === 'function') {
callback = options;
options = {};
}
options = options || {};
const ordered = typeof options.ordered === 'boolean' ? options.ordered : true;
const writeConcern = options.writeConcern;
const writeCommand = {};
writeCommand[type] = collectionNamespace(ns);
writeCommand[opsField] = ops;
writeCommand.ordered = ordered;
if (writeConcern && Object.keys(writeConcern).length > 0) {
writeCommand.writeConcern = writeConcern;
}
if (options.collation) {
for (let i = 0; i < writeCommand[opsField].length; i++) {
if (!writeCommand[opsField][i].collation) {
writeCommand[opsField][i].collation = options.collation;
}
}
}
if (options.bypassDocumentValidation === true) {
writeCommand.bypassDocumentValidation = options.bypassDocumentValidation;
}
const commandOptions = Object.assign(
{
checkKeys: type === 'insert',
numberToReturn: 1
},
options
);
command(server, ns, writeCommand, commandOptions, callback);
}
module.exports = writeCommand;

1135
node_modules/mongodb/lib/cursor.js generated vendored Normal file

File diff suppressed because it is too large Load Diff

1032
node_modules/mongodb/lib/db.js generated vendored Normal file

File diff suppressed because it is too large Load Diff

32
node_modules/mongodb/lib/dynamic_loaders.js generated vendored Normal file
View File

@@ -0,0 +1,32 @@
'use strict';
let collection;
let cursor;
let db;
function loadCollection() {
if (!collection) {
collection = require('./collection');
}
return collection;
}
function loadCursor() {
if (!cursor) {
cursor = require('./cursor');
}
return cursor;
}
function loadDb() {
if (!db) {
db = require('./db');
}
return db;
}
module.exports = {
loadCollection,
loadCursor,
loadDb
};

43
node_modules/mongodb/lib/error.js generated vendored Normal file
View File

@@ -0,0 +1,43 @@
'use strict';
const MongoNetworkError = require('./core').MongoNetworkError;
// From spec@https://github.com/mongodb/specifications/blob/f93d78191f3db2898a59013a7ed5650352ef6da8/source/change-streams/change-streams.rst#resumable-error
const GET_MORE_RESUMABLE_CODES = new Set([
6, // HostUnreachable
7, // HostNotFound
89, // NetworkTimeout
91, // ShutdownInProgress
189, // PrimarySteppedDown
262, // ExceededTimeLimit
9001, // SocketException
10107, // NotMaster
11600, // InterruptedAtShutdown
11602, // InterruptedDueToReplStateChange
13435, // NotMasterNoSlaveOk
13436, // NotMasterOrSecondary
63, // StaleShardVersion
150, // StaleEpoch
13388, // StaleConfig
234, // RetryChangeStream
133, // FailedToSatisfyReadPreference
43 // CursorNotFound
]);
function isResumableError(error, wireVersion) {
if (error instanceof MongoNetworkError) {
return true;
}
if (wireVersion >= 9) {
// DRIVERS-1308: For 4.4 drivers running against 4.4 servers, drivers will add a special case to treat the CursorNotFound error code as resumable
if (error.code === 43) {
return true;
}
return error.hasErrorLabel('ResumableChangeStreamError');
}
return GET_MORE_RESUMABLE_CODES.has(error.code);
}
module.exports = { GET_MORE_RESUMABLE_CODES, isResumableError };

433
node_modules/mongodb/lib/gridfs-stream/download.js generated vendored Normal file
View File

@@ -0,0 +1,433 @@
'use strict';
var stream = require('stream'),
util = require('util');
module.exports = GridFSBucketReadStream;
/**
* A readable stream that enables you to read buffers from GridFS.
*
* Do not instantiate this class directly. Use `openDownloadStream()` instead.
*
* @class
* @extends external:Readable
* @param {Collection} chunks Handle for chunks collection
* @param {Collection} files Handle for files collection
* @param {Object} readPreference The read preference to use
* @param {Object} filter The query to use to find the file document
* @param {Object} [options] Optional settings.
* @param {Number} [options.sort] Optional sort for the file find query
* @param {Number} [options.skip] Optional skip for the file find query
* @param {Number} [options.start] Optional 0-based offset in bytes to start streaming from
* @param {Number} [options.end] Optional 0-based offset in bytes to stop streaming before
* @fires GridFSBucketReadStream#error
* @fires GridFSBucketReadStream#file
*/
function GridFSBucketReadStream(chunks, files, readPreference, filter, options) {
this.s = {
bytesRead: 0,
chunks: chunks,
cursor: null,
expected: 0,
files: files,
filter: filter,
init: false,
expectedEnd: 0,
file: null,
options: options,
readPreference: readPreference
};
stream.Readable.call(this);
}
util.inherits(GridFSBucketReadStream, stream.Readable);
/**
* An error occurred
*
* @event GridFSBucketReadStream#error
* @type {Error}
*/
/**
* Fires when the stream loaded the file document corresponding to the
* provided id.
*
* @event GridFSBucketReadStream#file
* @type {object}
*/
/**
* Emitted when a chunk of data is available to be consumed.
*
* @event GridFSBucketReadStream#data
* @type {object}
*/
/**
* Fired when the stream is exhausted (no more data events).
*
* @event GridFSBucketReadStream#end
* @type {object}
*/
/**
* Fired when the stream is exhausted and the underlying cursor is killed
*
* @event GridFSBucketReadStream#close
* @type {object}
*/
/**
* Reads from the cursor and pushes to the stream.
* Private Impl, do not call directly
* @ignore
* @method
*/
GridFSBucketReadStream.prototype._read = function() {
var _this = this;
if (this.destroyed) {
return;
}
waitForFile(_this, function() {
doRead(_this);
});
};
/**
* Sets the 0-based offset in bytes to start streaming from. Throws
* an error if this stream has entered flowing mode
* (e.g. if you've already called `on('data')`)
* @method
* @param {Number} start Offset in bytes to start reading at
* @return {GridFSBucketReadStream} Reference to Self
*/
GridFSBucketReadStream.prototype.start = function(start) {
throwIfInitialized(this);
this.s.options.start = start;
return this;
};
/**
* Sets the 0-based offset in bytes to start streaming from. Throws
* an error if this stream has entered flowing mode
* (e.g. if you've already called `on('data')`)
* @method
* @param {Number} end Offset in bytes to stop reading at
* @return {GridFSBucketReadStream} Reference to self
*/
GridFSBucketReadStream.prototype.end = function(end) {
throwIfInitialized(this);
this.s.options.end = end;
return this;
};
/**
* Marks this stream as aborted (will never push another `data` event)
* and kills the underlying cursor. Will emit the 'end' event, and then
* the 'close' event once the cursor is successfully killed.
*
* @method
* @param {GridFSBucket~errorCallback} [callback] called when the cursor is successfully closed or an error occurred.
* @fires GridFSBucketWriteStream#close
* @fires GridFSBucketWriteStream#end
*/
GridFSBucketReadStream.prototype.abort = function(callback) {
var _this = this;
this.push(null);
this.destroyed = true;
if (this.s.cursor) {
this.s.cursor.close(function(error) {
_this.emit('close');
callback && callback(error);
});
} else {
if (!this.s.init) {
// If not initialized, fire close event because we will never
// get a cursor
_this.emit('close');
}
callback && callback();
}
};
/**
* @ignore
*/
function throwIfInitialized(self) {
if (self.s.init) {
throw new Error('You cannot change options after the stream has entered' + 'flowing mode!');
}
}
/**
* @ignore
*/
function doRead(_this) {
if (_this.destroyed) {
return;
}
_this.s.cursor.next(function(error, doc) {
if (_this.destroyed) {
return;
}
if (error) {
return __handleError(_this, error);
}
if (!doc) {
_this.push(null);
process.nextTick(() => {
_this.s.cursor.close(function(error) {
if (error) {
__handleError(_this, error);
return;
}
_this.emit('close');
});
});
return;
}
var bytesRemaining = _this.s.file.length - _this.s.bytesRead;
var expectedN = _this.s.expected++;
var expectedLength = Math.min(_this.s.file.chunkSize, bytesRemaining);
if (doc.n > expectedN) {
var errmsg = 'ChunkIsMissing: Got unexpected n: ' + doc.n + ', expected: ' + expectedN;
return __handleError(_this, new Error(errmsg));
}
if (doc.n < expectedN) {
errmsg = 'ExtraChunk: Got unexpected n: ' + doc.n + ', expected: ' + expectedN;
return __handleError(_this, new Error(errmsg));
}
var buf = Buffer.isBuffer(doc.data) ? doc.data : doc.data.buffer;
if (buf.length !== expectedLength) {
if (bytesRemaining <= 0) {
errmsg = 'ExtraChunk: Got unexpected n: ' + doc.n;
return __handleError(_this, new Error(errmsg));
}
errmsg =
'ChunkIsWrongSize: Got unexpected length: ' + buf.length + ', expected: ' + expectedLength;
return __handleError(_this, new Error(errmsg));
}
_this.s.bytesRead += buf.length;
if (buf.length === 0) {
return _this.push(null);
}
var sliceStart = null;
var sliceEnd = null;
if (_this.s.bytesToSkip != null) {
sliceStart = _this.s.bytesToSkip;
_this.s.bytesToSkip = 0;
}
const atEndOfStream = expectedN === _this.s.expectedEnd - 1;
const bytesLeftToRead = _this.s.options.end - _this.s.bytesToSkip;
if (atEndOfStream && _this.s.bytesToTrim != null) {
sliceEnd = _this.s.file.chunkSize - _this.s.bytesToTrim;
} else if (_this.s.options.end && bytesLeftToRead < doc.data.length()) {
sliceEnd = bytesLeftToRead;
}
if (sliceStart != null || sliceEnd != null) {
buf = buf.slice(sliceStart || 0, sliceEnd || buf.length);
}
_this.push(buf);
});
}
/**
* @ignore
*/
function init(self) {
var findOneOptions = {};
if (self.s.readPreference) {
findOneOptions.readPreference = self.s.readPreference;
}
if (self.s.options && self.s.options.sort) {
findOneOptions.sort = self.s.options.sort;
}
if (self.s.options && self.s.options.skip) {
findOneOptions.skip = self.s.options.skip;
}
self.s.files.findOne(self.s.filter, findOneOptions, function(error, doc) {
if (error) {
return __handleError(self, error);
}
if (!doc) {
var identifier = self.s.filter._id ? self.s.filter._id.toString() : self.s.filter.filename;
var errmsg = 'FileNotFound: file ' + identifier + ' was not found';
var err = new Error(errmsg);
err.code = 'ENOENT';
return __handleError(self, err);
}
// If document is empty, kill the stream immediately and don't
// execute any reads
if (doc.length <= 0) {
self.push(null);
return;
}
if (self.destroyed) {
// If user destroys the stream before we have a cursor, wait
// until the query is done to say we're 'closed' because we can't
// cancel a query.
self.emit('close');
return;
}
try {
self.s.bytesToSkip = handleStartOption(self, doc, self.s.options);
} catch (error) {
return __handleError(self, error);
}
var filter = { files_id: doc._id };
// Currently (MongoDB 3.4.4) skip function does not support the index,
// it needs to retrieve all the documents first and then skip them. (CS-25811)
// As work around we use $gte on the "n" field.
if (self.s.options && self.s.options.start != null) {
var skip = Math.floor(self.s.options.start / doc.chunkSize);
if (skip > 0) {
filter['n'] = { $gte: skip };
}
}
self.s.cursor = self.s.chunks.find(filter).sort({ n: 1 });
if (self.s.readPreference) {
self.s.cursor.setReadPreference(self.s.readPreference);
}
self.s.expectedEnd = Math.ceil(doc.length / doc.chunkSize);
self.s.file = doc;
try {
self.s.bytesToTrim = handleEndOption(self, doc, self.s.cursor, self.s.options);
} catch (error) {
return __handleError(self, error);
}
self.emit('file', doc);
});
}
/**
* @ignore
*/
function waitForFile(_this, callback) {
if (_this.s.file) {
return callback();
}
if (!_this.s.init) {
init(_this);
_this.s.init = true;
}
_this.once('file', function() {
callback();
});
}
/**
* @ignore
*/
function handleStartOption(stream, doc, options) {
if (options && options.start != null) {
if (options.start > doc.length) {
throw new Error(
'Stream start (' +
options.start +
') must not be ' +
'more than the length of the file (' +
doc.length +
')'
);
}
if (options.start < 0) {
throw new Error('Stream start (' + options.start + ') must not be ' + 'negative');
}
if (options.end != null && options.end < options.start) {
throw new Error(
'Stream start (' +
options.start +
') must not be ' +
'greater than stream end (' +
options.end +
')'
);
}
stream.s.bytesRead = Math.floor(options.start / doc.chunkSize) * doc.chunkSize;
stream.s.expected = Math.floor(options.start / doc.chunkSize);
return options.start - stream.s.bytesRead;
}
}
/**
* @ignore
*/
function handleEndOption(stream, doc, cursor, options) {
if (options && options.end != null) {
if (options.end > doc.length) {
throw new Error(
'Stream end (' +
options.end +
') must not be ' +
'more than the length of the file (' +
doc.length +
')'
);
}
if (options.start < 0) {
throw new Error('Stream end (' + options.end + ') must not be ' + 'negative');
}
var start = options.start != null ? Math.floor(options.start / doc.chunkSize) : 0;
cursor.limit(Math.ceil(options.end / doc.chunkSize) - start);
stream.s.expectedEnd = Math.ceil(options.end / doc.chunkSize);
return Math.ceil(options.end / doc.chunkSize) * doc.chunkSize - options.end;
}
}
/**
* @ignore
*/
function __handleError(_this, error) {
_this.emit('error', error);
}

359
node_modules/mongodb/lib/gridfs-stream/index.js generated vendored Normal file
View File

@@ -0,0 +1,359 @@
'use strict';
var Emitter = require('events').EventEmitter;
var GridFSBucketReadStream = require('./download');
var GridFSBucketWriteStream = require('./upload');
var shallowClone = require('../utils').shallowClone;
var toError = require('../utils').toError;
var util = require('util');
var executeLegacyOperation = require('../utils').executeLegacyOperation;
var DEFAULT_GRIDFS_BUCKET_OPTIONS = {
bucketName: 'fs',
chunkSizeBytes: 255 * 1024
};
module.exports = GridFSBucket;
/**
* Constructor for a streaming GridFS interface
* @class
* @extends external:EventEmitter
* @param {Db} db A db handle
* @param {object} [options] Optional settings.
* @param {string} [options.bucketName="fs"] The 'files' and 'chunks' collections will be prefixed with the bucket name followed by a dot.
* @param {number} [options.chunkSizeBytes=255 * 1024] Number of bytes stored in each chunk. Defaults to 255KB
* @param {object} [options.writeConcern] Optional write concern to be passed to write operations, for instance `{ w: 1 }`
* @param {object} [options.readPreference] Optional read preference to be passed to read operations
* @fires GridFSBucketWriteStream#index
*/
function GridFSBucket(db, options) {
Emitter.apply(this);
this.setMaxListeners(0);
if (options && typeof options === 'object') {
options = shallowClone(options);
var keys = Object.keys(DEFAULT_GRIDFS_BUCKET_OPTIONS);
for (var i = 0; i < keys.length; ++i) {
if (!options[keys[i]]) {
options[keys[i]] = DEFAULT_GRIDFS_BUCKET_OPTIONS[keys[i]];
}
}
} else {
options = DEFAULT_GRIDFS_BUCKET_OPTIONS;
}
this.s = {
db: db,
options: options,
_chunksCollection: db.collection(options.bucketName + '.chunks'),
_filesCollection: db.collection(options.bucketName + '.files'),
checkedIndexes: false,
calledOpenUploadStream: false,
promiseLibrary: db.s.promiseLibrary || Promise
};
}
util.inherits(GridFSBucket, Emitter);
/**
* When the first call to openUploadStream is made, the upload stream will
* check to see if it needs to create the proper indexes on the chunks and
* files collections. This event is fired either when 1) it determines that
* no index creation is necessary, 2) when it successfully creates the
* necessary indexes.
*
* @event GridFSBucket#index
* @type {Error}
*/
/**
* Returns a writable stream (GridFSBucketWriteStream) for writing
* buffers to GridFS. The stream's 'id' property contains the resulting
* file's id.
* @method
* @param {string} filename The value of the 'filename' key in the files doc
* @param {object} [options] Optional settings.
* @param {number} [options.chunkSizeBytes] Optional overwrite this bucket's chunkSizeBytes for this file
* @param {object} [options.metadata] Optional object to store in the file document's `metadata` field
* @param {string} [options.contentType] Optional string to store in the file document's `contentType` field
* @param {array} [options.aliases] Optional array of strings to store in the file document's `aliases` field
* @param {boolean} [options.disableMD5=false] If true, disables adding an md5 field to file data
* @return {GridFSBucketWriteStream}
*/
GridFSBucket.prototype.openUploadStream = function(filename, options) {
if (options) {
options = shallowClone(options);
} else {
options = {};
}
if (!options.chunkSizeBytes) {
options.chunkSizeBytes = this.s.options.chunkSizeBytes;
}
return new GridFSBucketWriteStream(this, filename, options);
};
/**
* Returns a writable stream (GridFSBucketWriteStream) for writing
* buffers to GridFS for a custom file id. The stream's 'id' property contains the resulting
* file's id.
* @method
* @param {string|number|object} id A custom id used to identify the file
* @param {string} filename The value of the 'filename' key in the files doc
* @param {object} [options] Optional settings.
* @param {number} [options.chunkSizeBytes] Optional overwrite this bucket's chunkSizeBytes for this file
* @param {object} [options.metadata] Optional object to store in the file document's `metadata` field
* @param {string} [options.contentType] Optional string to store in the file document's `contentType` field
* @param {array} [options.aliases] Optional array of strings to store in the file document's `aliases` field
* @param {boolean} [options.disableMD5=false] If true, disables adding an md5 field to file data
* @return {GridFSBucketWriteStream}
*/
GridFSBucket.prototype.openUploadStreamWithId = function(id, filename, options) {
if (options) {
options = shallowClone(options);
} else {
options = {};
}
if (!options.chunkSizeBytes) {
options.chunkSizeBytes = this.s.options.chunkSizeBytes;
}
options.id = id;
return new GridFSBucketWriteStream(this, filename, options);
};
/**
* Returns a readable stream (GridFSBucketReadStream) for streaming file
* data from GridFS.
* @method
* @param {ObjectId} id The id of the file doc
* @param {Object} [options] Optional settings.
* @param {Number} [options.start] Optional 0-based offset in bytes to start streaming from
* @param {Number} [options.end] Optional 0-based offset in bytes to stop streaming before
* @return {GridFSBucketReadStream}
*/
GridFSBucket.prototype.openDownloadStream = function(id, options) {
var filter = { _id: id };
options = {
start: options && options.start,
end: options && options.end
};
return new GridFSBucketReadStream(
this.s._chunksCollection,
this.s._filesCollection,
this.s.options.readPreference,
filter,
options
);
};
/**
* Deletes a file with the given id
* @method
* @param {ObjectId} id The id of the file doc
* @param {GridFSBucket~errorCallback} [callback]
*/
GridFSBucket.prototype.delete = function(id, callback) {
return executeLegacyOperation(this.s.db.s.topology, _delete, [this, id, callback], {
skipSessions: true
});
};
/**
* @ignore
*/
function _delete(_this, id, callback) {
_this.s._filesCollection.deleteOne({ _id: id }, function(error, res) {
if (error) {
return callback(error);
}
_this.s._chunksCollection.deleteMany({ files_id: id }, function(error) {
if (error) {
return callback(error);
}
// Delete orphaned chunks before returning FileNotFound
if (!res.result.n) {
var errmsg = 'FileNotFound: no file with id ' + id + ' found';
return callback(new Error(errmsg));
}
callback();
});
});
}
/**
* Convenience wrapper around find on the files collection
* @method
* @param {Object} filter
* @param {Object} [options] Optional settings for cursor
* @param {number} [options.batchSize=1000] The number of documents to return per batch. See {@link https://docs.mongodb.com/manual/reference/command/find|find command documentation}.
* @param {number} [options.limit] Optional limit for cursor
* @param {number} [options.maxTimeMS] Optional maxTimeMS for cursor
* @param {boolean} [options.noCursorTimeout] Optionally set cursor's `noCursorTimeout` flag
* @param {number} [options.skip] Optional skip for cursor
* @param {object} [options.sort] Optional sort for cursor
* @return {Cursor}
*/
GridFSBucket.prototype.find = function(filter, options) {
filter = filter || {};
options = options || {};
var cursor = this.s._filesCollection.find(filter);
if (options.batchSize != null) {
cursor.batchSize(options.batchSize);
}
if (options.limit != null) {
cursor.limit(options.limit);
}
if (options.maxTimeMS != null) {
cursor.maxTimeMS(options.maxTimeMS);
}
if (options.noCursorTimeout != null) {
cursor.addCursorFlag('noCursorTimeout', options.noCursorTimeout);
}
if (options.skip != null) {
cursor.skip(options.skip);
}
if (options.sort != null) {
cursor.sort(options.sort);
}
return cursor;
};
/**
* Returns a readable stream (GridFSBucketReadStream) for streaming the
* file with the given name from GridFS. If there are multiple files with
* the same name, this will stream the most recent file with the given name
* (as determined by the `uploadDate` field). You can set the `revision`
* option to change this behavior.
* @method
* @param {String} filename The name of the file to stream
* @param {Object} [options] Optional settings
* @param {number} [options.revision=-1] The revision number relative to the oldest file with the given filename. 0 gets you the oldest file, 1 gets you the 2nd oldest, -1 gets you the newest.
* @param {Number} [options.start] Optional 0-based offset in bytes to start streaming from
* @param {Number} [options.end] Optional 0-based offset in bytes to stop streaming before
* @return {GridFSBucketReadStream}
*/
GridFSBucket.prototype.openDownloadStreamByName = function(filename, options) {
var sort = { uploadDate: -1 };
var skip = null;
if (options && options.revision != null) {
if (options.revision >= 0) {
sort = { uploadDate: 1 };
skip = options.revision;
} else {
skip = -options.revision - 1;
}
}
var filter = { filename: filename };
options = {
sort: sort,
skip: skip,
start: options && options.start,
end: options && options.end
};
return new GridFSBucketReadStream(
this.s._chunksCollection,
this.s._filesCollection,
this.s.options.readPreference,
filter,
options
);
};
/**
* Renames the file with the given _id to the given string
* @method
* @param {ObjectId} id the id of the file to rename
* @param {String} filename new name for the file
* @param {GridFSBucket~errorCallback} [callback]
*/
GridFSBucket.prototype.rename = function(id, filename, callback) {
return executeLegacyOperation(this.s.db.s.topology, _rename, [this, id, filename, callback], {
skipSessions: true
});
};
/**
* @ignore
*/
function _rename(_this, id, filename, callback) {
var filter = { _id: id };
var update = { $set: { filename: filename } };
_this.s._filesCollection.updateOne(filter, update, function(error, res) {
if (error) {
return callback(error);
}
if (!res.result.n) {
return callback(toError('File with id ' + id + ' not found'));
}
callback();
});
}
/**
* Removes this bucket's files collection, followed by its chunks collection.
* @method
* @param {GridFSBucket~errorCallback} [callback]
*/
GridFSBucket.prototype.drop = function(callback) {
return executeLegacyOperation(this.s.db.s.topology, _drop, [this, callback], {
skipSessions: true
});
};
/**
* Return the db logger
* @method
* @return {Logger} return the db logger
* @ignore
*/
GridFSBucket.prototype.getLogger = function() {
return this.s.db.s.logger;
};
/**
* @ignore
*/
function _drop(_this, callback) {
_this.s._filesCollection.drop(function(error) {
if (error) {
return callback(error);
}
_this.s._chunksCollection.drop(function(error) {
if (error) {
return callback(error);
}
return callback();
});
});
}
/**
* Callback format for all GridFSBucket methods that can accept a callback.
* @callback GridFSBucket~errorCallback
* @param {MongoError|undefined} error If present, an error instance representing any errors that occurred
* @param {*} result If present, a returned result for the method
*/

538
node_modules/mongodb/lib/gridfs-stream/upload.js generated vendored Normal file
View File

@@ -0,0 +1,538 @@
'use strict';
var core = require('../core');
var crypto = require('crypto');
var stream = require('stream');
var util = require('util');
var Buffer = require('safe-buffer').Buffer;
var ERROR_NAMESPACE_NOT_FOUND = 26;
module.exports = GridFSBucketWriteStream;
/**
* A writable stream that enables you to write buffers to GridFS.
*
* Do not instantiate this class directly. Use `openUploadStream()` instead.
*
* @class
* @extends external:Writable
* @param {GridFSBucket} bucket Handle for this stream's corresponding bucket
* @param {string} filename The value of the 'filename' key in the files doc
* @param {object} [options] Optional settings.
* @param {string|number|object} [options.id] Custom file id for the GridFS file.
* @param {number} [options.chunkSizeBytes] The chunk size to use, in bytes
* @param {number} [options.w] The write concern
* @param {number} [options.wtimeout] The write concern timeout
* @param {number} [options.j] The journal write concern
* @param {boolean} [options.disableMD5=false] If true, disables adding an md5 field to file data
* @fires GridFSBucketWriteStream#error
* @fires GridFSBucketWriteStream#finish
*/
function GridFSBucketWriteStream(bucket, filename, options) {
options = options || {};
this.bucket = bucket;
this.chunks = bucket.s._chunksCollection;
this.filename = filename;
this.files = bucket.s._filesCollection;
this.options = options;
// Signals the write is all done
this.done = false;
this.id = options.id ? options.id : core.BSON.ObjectId();
this.chunkSizeBytes = this.options.chunkSizeBytes;
this.bufToStore = Buffer.alloc(this.chunkSizeBytes);
this.length = 0;
this.md5 = !options.disableMD5 && crypto.createHash('md5');
this.n = 0;
this.pos = 0;
this.state = {
streamEnd: false,
outstandingRequests: 0,
errored: false,
aborted: false,
promiseLibrary: this.bucket.s.promiseLibrary
};
if (!this.bucket.s.calledOpenUploadStream) {
this.bucket.s.calledOpenUploadStream = true;
var _this = this;
checkIndexes(this, function() {
_this.bucket.s.checkedIndexes = true;
_this.bucket.emit('index');
});
}
}
util.inherits(GridFSBucketWriteStream, stream.Writable);
/**
* An error occurred
*
* @event GridFSBucketWriteStream#error
* @type {Error}
*/
/**
* `end()` was called and the write stream successfully wrote the file
* metadata and all the chunks to MongoDB.
*
* @event GridFSBucketWriteStream#finish
* @type {object}
*/
/**
* Write a buffer to the stream.
*
* @method
* @param {Buffer} chunk Buffer to write
* @param {String} encoding Optional encoding for the buffer
* @param {GridFSBucket~errorCallback} callback Function to call when the chunk was added to the buffer, or if the entire chunk was persisted to MongoDB if this chunk caused a flush.
* @return {Boolean} False if this write required flushing a chunk to MongoDB. True otherwise.
*/
GridFSBucketWriteStream.prototype.write = function(chunk, encoding, callback) {
var _this = this;
return waitForIndexes(this, function() {
return doWrite(_this, chunk, encoding, callback);
});
};
/**
* Places this write stream into an aborted state (all future writes fail)
* and deletes all chunks that have already been written.
*
* @method
* @param {GridFSBucket~errorCallback} callback called when chunks are successfully removed or error occurred
* @return {Promise} if no callback specified
*/
GridFSBucketWriteStream.prototype.abort = function(callback) {
if (this.state.streamEnd) {
var error = new Error('Cannot abort a stream that has already completed');
if (typeof callback === 'function') {
return callback(error);
}
return this.state.promiseLibrary.reject(error);
}
if (this.state.aborted) {
error = new Error('Cannot call abort() on a stream twice');
if (typeof callback === 'function') {
return callback(error);
}
return this.state.promiseLibrary.reject(error);
}
this.state.aborted = true;
this.chunks.deleteMany({ files_id: this.id }, function(error) {
if (typeof callback === 'function') callback(error);
});
};
/**
* Tells the stream that no more data will be coming in. The stream will
* persist the remaining data to MongoDB, write the files document, and
* then emit a 'finish' event.
*
* @method
* @param {Buffer} chunk Buffer to write
* @param {String} encoding Optional encoding for the buffer
* @param {GridFSBucket~errorCallback} callback Function to call when all files and chunks have been persisted to MongoDB
*/
GridFSBucketWriteStream.prototype.end = function(chunk, encoding, callback) {
var _this = this;
if (typeof chunk === 'function') {
(callback = chunk), (chunk = null), (encoding = null);
} else if (typeof encoding === 'function') {
(callback = encoding), (encoding = null);
}
if (checkAborted(this, callback)) {
return;
}
this.state.streamEnd = true;
if (callback) {
this.once('finish', function(result) {
callback(null, result);
});
}
if (!chunk) {
waitForIndexes(this, function() {
writeRemnant(_this);
});
return;
}
this.write(chunk, encoding, function() {
writeRemnant(_this);
});
};
/**
* @ignore
*/
function __handleError(_this, error, callback) {
if (_this.state.errored) {
return;
}
_this.state.errored = true;
if (callback) {
return callback(error);
}
_this.emit('error', error);
}
/**
* @ignore
*/
function createChunkDoc(filesId, n, data) {
return {
_id: core.BSON.ObjectId(),
files_id: filesId,
n: n,
data: data
};
}
/**
* @ignore
*/
function checkChunksIndex(_this, callback) {
_this.chunks.listIndexes().toArray(function(error, indexes) {
if (error) {
// Collection doesn't exist so create index
if (error.code === ERROR_NAMESPACE_NOT_FOUND) {
var index = { files_id: 1, n: 1 };
_this.chunks.createIndex(index, { background: false, unique: true }, function(error) {
if (error) {
return callback(error);
}
callback();
});
return;
}
return callback(error);
}
var hasChunksIndex = false;
indexes.forEach(function(index) {
if (index.key) {
var keys = Object.keys(index.key);
if (keys.length === 2 && index.key.files_id === 1 && index.key.n === 1) {
hasChunksIndex = true;
}
}
});
if (hasChunksIndex) {
callback();
} else {
index = { files_id: 1, n: 1 };
var indexOptions = getWriteOptions(_this);
indexOptions.background = false;
indexOptions.unique = true;
_this.chunks.createIndex(index, indexOptions, function(error) {
if (error) {
return callback(error);
}
callback();
});
}
});
}
/**
* @ignore
*/
function checkDone(_this, callback) {
if (_this.done) return true;
if (_this.state.streamEnd && _this.state.outstandingRequests === 0 && !_this.state.errored) {
// Set done so we dont' trigger duplicate createFilesDoc
_this.done = true;
// Create a new files doc
var filesDoc = createFilesDoc(
_this.id,
_this.length,
_this.chunkSizeBytes,
_this.md5 && _this.md5.digest('hex'),
_this.filename,
_this.options.contentType,
_this.options.aliases,
_this.options.metadata
);
if (checkAborted(_this, callback)) {
return false;
}
_this.files.insertOne(filesDoc, getWriteOptions(_this), function(error) {
if (error) {
return __handleError(_this, error, callback);
}
_this.emit('finish', filesDoc);
});
return true;
}
return false;
}
/**
* @ignore
*/
function checkIndexes(_this, callback) {
_this.files.findOne({}, { _id: 1 }, function(error, doc) {
if (error) {
return callback(error);
}
if (doc) {
return callback();
}
_this.files.listIndexes().toArray(function(error, indexes) {
if (error) {
// Collection doesn't exist so create index
if (error.code === ERROR_NAMESPACE_NOT_FOUND) {
var index = { filename: 1, uploadDate: 1 };
_this.files.createIndex(index, { background: false }, function(error) {
if (error) {
return callback(error);
}
checkChunksIndex(_this, callback);
});
return;
}
return callback(error);
}
var hasFileIndex = false;
indexes.forEach(function(index) {
var keys = Object.keys(index.key);
if (keys.length === 2 && index.key.filename === 1 && index.key.uploadDate === 1) {
hasFileIndex = true;
}
});
if (hasFileIndex) {
checkChunksIndex(_this, callback);
} else {
index = { filename: 1, uploadDate: 1 };
var indexOptions = getWriteOptions(_this);
indexOptions.background = false;
_this.files.createIndex(index, indexOptions, function(error) {
if (error) {
return callback(error);
}
checkChunksIndex(_this, callback);
});
}
});
});
}
/**
* @ignore
*/
function createFilesDoc(_id, length, chunkSize, md5, filename, contentType, aliases, metadata) {
var ret = {
_id: _id,
length: length,
chunkSize: chunkSize,
uploadDate: new Date(),
filename: filename
};
if (md5) {
ret.md5 = md5;
}
if (contentType) {
ret.contentType = contentType;
}
if (aliases) {
ret.aliases = aliases;
}
if (metadata) {
ret.metadata = metadata;
}
return ret;
}
/**
* @ignore
*/
function doWrite(_this, chunk, encoding, callback) {
if (checkAborted(_this, callback)) {
return false;
}
var inputBuf = Buffer.isBuffer(chunk) ? chunk : Buffer.from(chunk, encoding);
_this.length += inputBuf.length;
// Input is small enough to fit in our buffer
if (_this.pos + inputBuf.length < _this.chunkSizeBytes) {
inputBuf.copy(_this.bufToStore, _this.pos);
_this.pos += inputBuf.length;
callback && callback();
// Note that we reverse the typical semantics of write's return value
// to be compatible with node's `.pipe()` function.
// True means client can keep writing.
return true;
}
// Otherwise, buffer is too big for current chunk, so we need to flush
// to MongoDB.
var inputBufRemaining = inputBuf.length;
var spaceRemaining = _this.chunkSizeBytes - _this.pos;
var numToCopy = Math.min(spaceRemaining, inputBuf.length);
var outstandingRequests = 0;
while (inputBufRemaining > 0) {
var inputBufPos = inputBuf.length - inputBufRemaining;
inputBuf.copy(_this.bufToStore, _this.pos, inputBufPos, inputBufPos + numToCopy);
_this.pos += numToCopy;
spaceRemaining -= numToCopy;
if (spaceRemaining === 0) {
if (_this.md5) {
_this.md5.update(_this.bufToStore);
}
var doc = createChunkDoc(_this.id, _this.n, Buffer.from(_this.bufToStore));
++_this.state.outstandingRequests;
++outstandingRequests;
if (checkAborted(_this, callback)) {
return false;
}
_this.chunks.insertOne(doc, getWriteOptions(_this), function(error) {
if (error) {
return __handleError(_this, error);
}
--_this.state.outstandingRequests;
--outstandingRequests;
if (!outstandingRequests) {
_this.emit('drain', doc);
callback && callback();
checkDone(_this);
}
});
spaceRemaining = _this.chunkSizeBytes;
_this.pos = 0;
++_this.n;
}
inputBufRemaining -= numToCopy;
numToCopy = Math.min(spaceRemaining, inputBufRemaining);
}
// Note that we reverse the typical semantics of write's return value
// to be compatible with node's `.pipe()` function.
// False means the client should wait for the 'drain' event.
return false;
}
/**
* @ignore
*/
function getWriteOptions(_this) {
var obj = {};
if (_this.options.writeConcern) {
obj.w = _this.options.writeConcern.w;
obj.wtimeout = _this.options.writeConcern.wtimeout;
obj.j = _this.options.writeConcern.j;
}
return obj;
}
/**
* @ignore
*/
function waitForIndexes(_this, callback) {
if (_this.bucket.s.checkedIndexes) {
return callback(false);
}
_this.bucket.once('index', function() {
callback(true);
});
return true;
}
/**
* @ignore
*/
function writeRemnant(_this, callback) {
// Buffer is empty, so don't bother to insert
if (_this.pos === 0) {
return checkDone(_this, callback);
}
++_this.state.outstandingRequests;
// Create a new buffer to make sure the buffer isn't bigger than it needs
// to be.
var remnant = Buffer.alloc(_this.pos);
_this.bufToStore.copy(remnant, 0, 0, _this.pos);
if (_this.md5) {
_this.md5.update(remnant);
}
var doc = createChunkDoc(_this.id, _this.n, remnant);
// If the stream was aborted, do not write remnant
if (checkAborted(_this, callback)) {
return false;
}
_this.chunks.insertOne(doc, getWriteOptions(_this), function(error) {
if (error) {
return __handleError(_this, error);
}
--_this.state.outstandingRequests;
checkDone(_this);
});
}
/**
* @ignore
*/
function checkAborted(_this, callback) {
if (_this.state.aborted) {
if (typeof callback === 'function') {
callback(new Error('this stream has been aborted'));
}
return true;
}
return false;
}

236
node_modules/mongodb/lib/gridfs/chunk.js generated vendored Normal file
View File

@@ -0,0 +1,236 @@
'use strict';
var Binary = require('../core').BSON.Binary,
ObjectID = require('../core').BSON.ObjectID;
var Buffer = require('safe-buffer').Buffer;
/**
* Class for representing a single chunk in GridFS.
*
* @class
*
* @param file {GridStore} The {@link GridStore} object holding this chunk.
* @param mongoObject {object} The mongo object representation of this chunk.
*
* @throws Error when the type of data field for {@link mongoObject} is not
* supported. Currently supported types for data field are instances of
* {@link String}, {@link Array}, {@link Binary} and {@link Binary}
* from the bson module
*
* @see Chunk#buildMongoObject
*/
var Chunk = function(file, mongoObject, writeConcern) {
if (!(this instanceof Chunk)) return new Chunk(file, mongoObject);
this.file = file;
var mongoObjectFinal = mongoObject == null ? {} : mongoObject;
this.writeConcern = writeConcern || { w: 1 };
this.objectId = mongoObjectFinal._id == null ? new ObjectID() : mongoObjectFinal._id;
this.chunkNumber = mongoObjectFinal.n == null ? 0 : mongoObjectFinal.n;
this.data = new Binary();
if (typeof mongoObjectFinal.data === 'string') {
var buffer = Buffer.alloc(mongoObjectFinal.data.length);
buffer.write(mongoObjectFinal.data, 0, mongoObjectFinal.data.length, 'binary');
this.data = new Binary(buffer);
} else if (Array.isArray(mongoObjectFinal.data)) {
buffer = Buffer.alloc(mongoObjectFinal.data.length);
var data = mongoObjectFinal.data.join('');
buffer.write(data, 0, data.length, 'binary');
this.data = new Binary(buffer);
} else if (mongoObjectFinal.data && mongoObjectFinal.data._bsontype === 'Binary') {
this.data = mongoObjectFinal.data;
} else if (!Buffer.isBuffer(mongoObjectFinal.data) && !(mongoObjectFinal.data == null)) {
throw Error('Illegal chunk format');
}
// Update position
this.internalPosition = 0;
};
/**
* Writes a data to this object and advance the read/write head.
*
* @param data {string} the data to write
* @param callback {function(*, GridStore)} This will be called after executing
* this method. The first parameter will contain null and the second one
* will contain a reference to this object.
*/
Chunk.prototype.write = function(data, callback) {
this.data.write(data, this.internalPosition, data.length, 'binary');
this.internalPosition = this.data.length();
if (callback != null) return callback(null, this);
return this;
};
/**
* Reads data and advances the read/write head.
*
* @param length {number} The length of data to read.
*
* @return {string} The data read if the given length will not exceed the end of
* the chunk. Returns an empty String otherwise.
*/
Chunk.prototype.read = function(length) {
// Default to full read if no index defined
length = length == null || length === 0 ? this.length() : length;
if (this.length() - this.internalPosition + 1 >= length) {
var data = this.data.read(this.internalPosition, length);
this.internalPosition = this.internalPosition + length;
return data;
} else {
return '';
}
};
Chunk.prototype.readSlice = function(length) {
if (this.length() - this.internalPosition >= length) {
var data = null;
if (this.data.buffer != null) {
//Pure BSON
data = this.data.buffer.slice(this.internalPosition, this.internalPosition + length);
} else {
//Native BSON
data = Buffer.alloc(length);
length = this.data.readInto(data, this.internalPosition);
}
this.internalPosition = this.internalPosition + length;
return data;
} else {
return null;
}
};
/**
* Checks if the read/write head is at the end.
*
* @return {boolean} Whether the read/write head has reached the end of this
* chunk.
*/
Chunk.prototype.eof = function() {
return this.internalPosition === this.length() ? true : false;
};
/**
* Reads one character from the data of this chunk and advances the read/write
* head.
*
* @return {string} a single character data read if the the read/write head is
* not at the end of the chunk. Returns an empty String otherwise.
*/
Chunk.prototype.getc = function() {
return this.read(1);
};
/**
* Clears the contents of the data in this chunk and resets the read/write head
* to the initial position.
*/
Chunk.prototype.rewind = function() {
this.internalPosition = 0;
this.data = new Binary();
};
/**
* Saves this chunk to the database. Also overwrites existing entries having the
* same id as this chunk.
*
* @param callback {function(*, GridStore)} This will be called after executing
* this method. The first parameter will contain null and the second one
* will contain a reference to this object.
*/
Chunk.prototype.save = function(options, callback) {
var self = this;
if (typeof options === 'function') {
callback = options;
options = {};
}
self.file.chunkCollection(function(err, collection) {
if (err) return callback(err);
// Merge the options
var writeOptions = { upsert: true };
for (var name in options) writeOptions[name] = options[name];
for (name in self.writeConcern) writeOptions[name] = self.writeConcern[name];
if (self.data.length() > 0) {
self.buildMongoObject(function(mongoObject) {
var options = { forceServerObjectId: true };
for (var name in self.writeConcern) {
options[name] = self.writeConcern[name];
}
collection.replaceOne({ _id: self.objectId }, mongoObject, writeOptions, function(err) {
callback(err, self);
});
});
} else {
callback(null, self);
}
// });
});
};
/**
* Creates a mongoDB object representation of this chunk.
*
* @param callback {function(Object)} This will be called after executing this
* method. The object will be passed to the first parameter and will have
* the structure:
*
* <pre><code>
* {
* '_id' : , // {number} id for this chunk
* 'files_id' : , // {number} foreign key to the file collection
* 'n' : , // {number} chunk number
* 'data' : , // {bson#Binary} the chunk data itself
* }
* </code></pre>
*
* @see <a href="http://www.mongodb.org/display/DOCS/GridFS+Specification#GridFSSpecification-{{chunks}}">MongoDB GridFS Chunk Object Structure</a>
*/
Chunk.prototype.buildMongoObject = function(callback) {
var mongoObject = {
files_id: this.file.fileId,
n: this.chunkNumber,
data: this.data
};
// If we are saving using a specific ObjectId
if (this.objectId != null) mongoObject._id = this.objectId;
callback(mongoObject);
};
/**
* @return {number} the length of the data
*/
Chunk.prototype.length = function() {
return this.data.length();
};
/**
* The position of the read/write head
* @name position
* @lends Chunk#
* @field
*/
Object.defineProperty(Chunk.prototype, 'position', {
enumerable: true,
get: function() {
return this.internalPosition;
},
set: function(value) {
this.internalPosition = value;
}
});
/**
* The default chunk size
* @constant
*/
Chunk.DEFAULT_CHUNK_SIZE = 1024 * 255;
module.exports = Chunk;

1920
node_modules/mongodb/lib/gridfs/grid_store.js generated vendored Normal file

File diff suppressed because it is too large Load Diff

542
node_modules/mongodb/lib/mongo_client.js generated vendored Normal file
View File

@@ -0,0 +1,542 @@
'use strict';
const ChangeStream = require('./change_stream');
const Db = require('./db');
const EventEmitter = require('events').EventEmitter;
const inherits = require('util').inherits;
const MongoError = require('./core').MongoError;
const deprecate = require('util').deprecate;
const WriteConcern = require('./write_concern');
const MongoDBNamespace = require('./utils').MongoDBNamespace;
const ReadPreference = require('./core/topologies/read_preference');
const maybePromise = require('./utils').maybePromise;
const NativeTopology = require('./topologies/native_topology');
const connect = require('./operations/connect').connect;
const validOptions = require('./operations/connect').validOptions;
/**
* @fileOverview The **MongoClient** class is a class that allows for making Connections to MongoDB.
*
* @example
* // Connect using a MongoClient instance
* const MongoClient = require('mongodb').MongoClient;
* const test = require('assert');
* // Connection url
* const url = 'mongodb://localhost:27017';
* // Database Name
* const dbName = 'test';
* // Connect using MongoClient
* const mongoClient = new MongoClient(url);
* mongoClient.connect(function(err, client) {
* const db = client.db(dbName);
* client.close();
* });
*
* @example
* // Connect using the MongoClient.connect static method
* const MongoClient = require('mongodb').MongoClient;
* const test = require('assert');
* // Connection url
* const url = 'mongodb://localhost:27017';
* // Database Name
* const dbName = 'test';
* // Connect using MongoClient
* MongoClient.connect(url, function(err, client) {
* const db = client.db(dbName);
* client.close();
* });
*/
/**
* A string specifying the level of a ReadConcern
* @typedef {'local'|'available'|'majority'|'linearizable'|'snapshot'} ReadConcernLevel
* @see https://docs.mongodb.com/manual/reference/read-concern/index.html#read-concern-levels
*/
/**
* Configuration options for drivers wrapping the node driver.
*
* @typedef {Object} DriverInfoOptions
* @property {string} [name] The name of the driver
* @property {string} [version] The version of the driver
* @property {string} [platform] Optional platform information
*/
/**
* Configuration options for drivers wrapping the node driver.
*
* @typedef {Object} DriverInfoOptions
* @property {string} [name] The name of the driver
* @property {string} [version] The version of the driver
* @property {string} [platform] Optional platform information
*/
/**
* Creates a new MongoClient instance
* @class
* @param {string} url The connection URI string
* @param {object} [options] Optional settings
* @param {number} [options.poolSize=5] The maximum size of the individual server pool
* @param {boolean} [options.ssl=false] Enable SSL connection. *deprecated* use `tls` variants
* @param {boolean} [options.sslValidate=false] Validate mongod server certificate against Certificate Authority
* @param {buffer} [options.sslCA=undefined] SSL Certificate store binary buffer *deprecated* use `tls` variants
* @param {buffer} [options.sslCert=undefined] SSL Certificate binary buffer *deprecated* use `tls` variants
* @param {buffer} [options.sslKey=undefined] SSL Key file binary buffer *deprecated* use `tls` variants
* @param {string} [options.sslPass=undefined] SSL Certificate pass phrase *deprecated* use `tls` variants
* @param {buffer} [options.sslCRL=undefined] SSL Certificate revocation list binary buffer *deprecated* use `tls` variants
* @param {boolean|function} [options.checkServerIdentity=true] Ensure we check server identify during SSL, set to false to disable checking. Only works for Node 0.12.x or higher. You can pass in a boolean or your own checkServerIdentity override function. *deprecated* use `tls` variants
* @param {boolean} [options.tls=false] Enable TLS connections
* @param {boolean} [options.tlsInsecure=false] Relax TLS constraints, disabling validation
* @param {string} [options.tlsCAFile] A path to file with either a single or bundle of certificate authorities to be considered trusted when making a TLS connection
* @param {string} [options.tlsCertificateKeyFile] A path to the client certificate file or the client private key file; in the case that they both are needed, the files should be concatenated
* @param {string} [options.tlsCertificateKeyFilePassword] The password to decrypt the client private key to be used for TLS connections
* @param {boolean} [options.tlsAllowInvalidCertificates] Specifies whether or not the driver should error when the servers TLS certificate is invalid
* @param {boolean} [options.tlsAllowInvalidHostnames] Specifies whether or not the driver should error when there is a mismatch between the servers hostname and the hostname specified by the TLS certificate
* @param {boolean} [options.autoReconnect=true] Enable autoReconnect for single server instances
* @param {boolean} [options.noDelay=true] TCP Connection no delay
* @param {boolean} [options.keepAlive=true] TCP Connection keep alive enabled
* @param {number} [options.keepAliveInitialDelay=120000] The number of milliseconds to wait before initiating keepAlive on the TCP socket
* @param {number} [options.connectTimeoutMS=10000] How long to wait for a connection to be established before timing out
* @param {number} [options.socketTimeoutMS=360000] How long a send or receive on a socket can take before timing out
* @param {number} [options.family] Version of IP stack. Can be 4, 6 or null (default).
* If null, will attempt to connect with IPv6, and will fall back to IPv4 on failure
* @param {number} [options.reconnectTries=30] Server attempt to reconnect #times
* @param {number} [options.reconnectInterval=1000] Server will wait # milliseconds between retries
* @param {boolean} [options.ha=true] Control if high availability monitoring runs for Replicaset or Mongos proxies
* @param {number} [options.haInterval=10000] The High availability period for replicaset inquiry
* @param {string} [options.replicaSet=undefined] The Replicaset set name
* @param {number} [options.secondaryAcceptableLatencyMS=15] Cutoff latency point in MS for Replicaset member selection
* @param {number} [options.acceptableLatencyMS=15] Cutoff latency point in MS for Mongos proxies selection
* @param {boolean} [options.connectWithNoPrimary=false] Sets if the driver should connect even if no primary is available
* @param {string} [options.authSource=undefined] Define the database to authenticate against
* @param {(number|string)} [options.w] The write concern
* @param {number} [options.wtimeout] The write concern timeout
* @param {boolean} [options.j=false] Specify a journal write concern
* @param {boolean} [options.forceServerObjectId=false] Force server to assign _id values instead of driver
* @param {boolean} [options.serializeFunctions=false] Serialize functions on any object
* @param {Boolean} [options.ignoreUndefined=false] Specify if the BSON serializer should ignore undefined fields
* @param {boolean} [options.raw=false] Return document results as raw BSON buffers
* @param {number} [options.bufferMaxEntries=-1] Sets a cap on how many operations the driver will buffer up before giving up on getting a working connection, default is -1 which is unlimited
* @param {(ReadPreference|string)} [options.readPreference] The preferred read preference (ReadPreference.PRIMARY, ReadPreference.PRIMARY_PREFERRED, ReadPreference.SECONDARY, ReadPreference.SECONDARY_PREFERRED, ReadPreference.NEAREST)
* @param {object} [options.pkFactory] A primary key factory object for generation of custom _id keys
* @param {object} [options.promiseLibrary] A Promise library class the application wishes to use such as Bluebird, must be ES6 compatible
* @param {object} [options.readConcern] Specify a read concern for the collection (only MongoDB 3.2 or higher supported)
* @param {ReadConcernLevel} [options.readConcern.level='local'] Specify a read concern level for the collection operations (only MongoDB 3.2 or higher supported)
* @param {number} [options.maxStalenessSeconds=undefined] The max staleness to secondary reads (values under 10 seconds cannot be guaranteed)
* @param {string} [options.loggerLevel=undefined] The logging level (error/warn/info/debug)
* @param {object} [options.logger=undefined] Custom logger object
* @param {boolean} [options.promoteValues=true] Promotes BSON values to native types where possible, set to false to only receive wrapper types
* @param {boolean} [options.promoteBuffers=false] Promotes Binary BSON values to native Node Buffers
* @param {boolean} [options.promoteLongs=true] Promotes long values to number if they fit inside the 53 bits resolution
* @param {boolean} [options.domainsEnabled=false] Enable the wrapping of the callback in the current domain, disabled by default to avoid perf hit
* @param {object} [options.validateOptions=false] Validate MongoClient passed in options for correctness
* @param {string} [options.appname=undefined] The name of the application that created this MongoClient instance. MongoDB 3.4 and newer will print this value in the server log upon establishing each connection. It is also recorded in the slow query log and profile collections
* @param {string} [options.auth.user=undefined] The username for auth
* @param {string} [options.auth.password=undefined] The password for auth
* @param {string} [options.authMechanism] An authentication mechanism to use for connection authentication, see the {@link https://docs.mongodb.com/manual/reference/connection-string/#urioption.authMechanism|authMechanism} reference for supported options.
* @param {object} [options.compression] Type of compression to use: snappy or zlib
* @param {boolean} [options.fsync=false] Specify a file sync write concern
* @param {array} [options.readPreferenceTags] Read preference tags
* @param {number} [options.numberOfRetries=5] The number of retries for a tailable cursor
* @param {boolean} [options.auto_reconnect=true] Enable auto reconnecting for single server instances
* @param {boolean} [options.monitorCommands=false] Enable command monitoring for this client
* @param {number} [options.minSize] If present, the connection pool will be initialized with minSize connections, and will never dip below minSize connections
* @param {boolean} [options.useNewUrlParser=true] Determines whether or not to use the new url parser. Enables the new, spec-compliant, url parser shipped in the core driver. This url parser fixes a number of problems with the original parser, and aims to outright replace that parser in the near future. Defaults to true, and must be explicitly set to false to use the legacy url parser.
* @param {boolean} [options.useUnifiedTopology] Enables the new unified topology layer
* @param {Number} [options.localThresholdMS=15] **Only applies to the unified topology** The size of the latency window for selecting among multiple suitable servers
* @param {Number} [options.serverSelectionTimeoutMS=30000] **Only applies to the unified topology** How long to block for server selection before throwing an error
* @param {Number} [options.heartbeatFrequencyMS=10000] **Only applies to the unified topology** The frequency with which topology updates are scheduled
* @param {number} [options.maxPoolSize=10] **Only applies to the unified topology** The maximum number of connections that may be associated with a pool at a given time. This includes in use and available connections.
* @param {number} [options.minPoolSize=0] **Only applies to the unified topology** The minimum number of connections that MUST exist at any moment in a single connection pool.
* @param {number} [options.maxIdleTimeMS] **Only applies to the unified topology** The maximum amount of time a connection should remain idle in the connection pool before being marked idle. The default is infinity.
* @param {number} [options.waitQueueTimeoutMS=0] **Only applies to the unified topology** The maximum amount of time operation execution should wait for a connection to become available. The default is 0 which means there is no limit.
* @param {AutoEncrypter~AutoEncryptionOptions} [options.autoEncryption] Optionally enable client side auto encryption
* @param {DriverInfoOptions} [options.driverInfo] Allows a wrapping driver to amend the client metadata generated by the driver to include information about the wrapping driver
* @param {boolean} [options.directConnection=false] Enable directConnection
* @param {MongoClient~connectCallback} [callback] The command result callback
* @return {MongoClient} a MongoClient instance
*/
function MongoClient(url, options) {
if (!(this instanceof MongoClient)) return new MongoClient(url, options);
// Set up event emitter
EventEmitter.call(this);
// The internal state
this.s = {
url: url,
options: options || {},
promiseLibrary: (options && options.promiseLibrary) || Promise,
dbCache: new Map(),
sessions: new Set(),
writeConcern: WriteConcern.fromOptions(options),
namespace: new MongoDBNamespace('admin')
};
}
/**
* @ignore
*/
inherits(MongoClient, EventEmitter);
Object.defineProperty(MongoClient.prototype, 'writeConcern', {
enumerable: true,
get: function() {
return this.s.writeConcern;
}
});
Object.defineProperty(MongoClient.prototype, 'readPreference', {
enumerable: true,
get: function() {
return ReadPreference.primary;
}
});
/**
* The callback format for results
* @callback MongoClient~connectCallback
* @param {MongoError} error An error instance representing the error during the execution.
* @param {MongoClient} client The connected client.
*/
/**
* Connect to MongoDB using a url as documented at
*
* docs.mongodb.org/manual/reference/connection-string/
*
* Note that for replicasets the replicaSet query parameter is required in the 2.0 driver
*
* @method
* @param {MongoClient~connectCallback} [callback] The command result callback
* @return {Promise<MongoClient>} returns Promise if no callback passed
*/
MongoClient.prototype.connect = function(callback) {
if (typeof callback === 'string') {
throw new TypeError('`connect` only accepts a callback');
}
const client = this;
return maybePromise(this, callback, cb => {
const err = validOptions(client.s.options);
if (err) return cb(err);
connect(client, client.s.url, client.s.options, err => {
if (err) return cb(err);
cb(null, client);
});
});
};
MongoClient.prototype.logout = deprecate(function(options, callback) {
if (typeof options === 'function') (callback = options), (options = {});
if (typeof callback === 'function') callback(null, true);
}, 'Multiple authentication is prohibited on a connected client, please only authenticate once per MongoClient');
/**
* Close the db and its underlying connections
* @method
* @param {boolean} [force=false] Force close, emitting no events
* @param {Db~noResultCallback} [callback] The result callback
* @return {Promise} returns Promise if no callback passed
*/
MongoClient.prototype.close = function(force, callback) {
if (typeof force === 'function') {
callback = force;
force = false;
}
const client = this;
return maybePromise(this, callback, cb => {
const completeClose = err => {
client.emit('close', client);
if (!(client.topology instanceof NativeTopology)) {
for (const item of client.s.dbCache) {
item[1].emit('close', client);
}
}
client.removeAllListeners('close');
cb(err);
};
if (client.topology == null) {
completeClose();
return;
}
client.topology.close(force, err => {
const autoEncrypter = client.topology.s.options.autoEncrypter;
if (!autoEncrypter) {
completeClose(err);
return;
}
autoEncrypter.teardown(force, err2 => completeClose(err || err2));
});
});
};
/**
* Create a new Db instance sharing the current socket connections. Be aware that the new db instances are
* related in a parent-child relationship to the original instance so that events are correctly emitted on child
* db instances. Child db instances are cached so performing db('db1') twice will return the same instance.
* You can control these behaviors with the options noListener and returnNonCachedInstance.
*
* @method
* @param {string} [dbName] The name of the database we want to use. If not provided, use database name from connection string.
* @param {object} [options] Optional settings.
* @param {boolean} [options.noListener=false] Do not make the db an event listener to the original connection.
* @param {boolean} [options.returnNonCachedInstance=false] Control if you want to return a cached instance or have a new one created
* @return {Db}
*/
MongoClient.prototype.db = function(dbName, options) {
options = options || {};
// Default to db from connection string if not provided
if (!dbName) {
dbName = this.s.options.dbName;
}
// Copy the options and add out internal override of the not shared flag
const finalOptions = Object.assign({}, this.s.options, options);
// Do we have the db in the cache already
if (this.s.dbCache.has(dbName) && finalOptions.returnNonCachedInstance !== true) {
return this.s.dbCache.get(dbName);
}
// Add promiseLibrary
finalOptions.promiseLibrary = this.s.promiseLibrary;
// If no topology throw an error message
if (!this.topology) {
throw new MongoError('MongoClient must be connected before calling MongoClient.prototype.db');
}
// Return the db object
const db = new Db(dbName, this.topology, finalOptions);
// Add the db to the cache
this.s.dbCache.set(dbName, db);
// Return the database
return db;
};
/**
* Check if MongoClient is connected
*
* @method
* @param {object} [options] Optional settings.
* @param {boolean} [options.noListener=false] Do not make the db an event listener to the original connection.
* @param {boolean} [options.returnNonCachedInstance=false] Control if you want to return a cached instance or have a new one created
* @return {boolean}
*/
MongoClient.prototype.isConnected = function(options) {
options = options || {};
if (!this.topology) return false;
return this.topology.isConnected(options);
};
/**
* Connect to MongoDB using a url as documented at
*
* docs.mongodb.org/manual/reference/connection-string/
*
* Note that for replicasets the replicaSet query parameter is required in the 2.0 driver
*
* @method
* @static
* @param {string} url The connection URI string
* @param {object} [options] Optional settings
* @param {number} [options.poolSize=5] The maximum size of the individual server pool
* @param {boolean} [options.ssl=false] Enable SSL connection. *deprecated* use `tls` variants
* @param {boolean} [options.sslValidate=false] Validate mongod server certificate against Certificate Authority
* @param {buffer} [options.sslCA=undefined] SSL Certificate store binary buffer *deprecated* use `tls` variants
* @param {buffer} [options.sslCert=undefined] SSL Certificate binary buffer *deprecated* use `tls` variants
* @param {buffer} [options.sslKey=undefined] SSL Key file binary buffer *deprecated* use `tls` variants
* @param {string} [options.sslPass=undefined] SSL Certificate pass phrase *deprecated* use `tls` variants
* @param {buffer} [options.sslCRL=undefined] SSL Certificate revocation list binary buffer *deprecated* use `tls` variants
* @param {boolean|function} [options.checkServerIdentity=true] Ensure we check server identify during SSL, set to false to disable checking. Only works for Node 0.12.x or higher. You can pass in a boolean or your own checkServerIdentity override function. *deprecated* use `tls` variants
* @param {boolean} [options.tls=false] Enable TLS connections
* @param {boolean} [options.tlsInsecure=false] Relax TLS constraints, disabling validation
* @param {string} [options.tlsCAFile] A path to file with either a single or bundle of certificate authorities to be considered trusted when making a TLS connection
* @param {string} [options.tlsCertificateKeyFile] A path to the client certificate file or the client private key file; in the case that they both are needed, the files should be concatenated
* @param {string} [options.tlsCertificateKeyFilePassword] The password to decrypt the client private key to be used for TLS connections
* @param {boolean} [options.tlsAllowInvalidCertificates] Specifies whether or not the driver should error when the servers TLS certificate is invalid
* @param {boolean} [options.tlsAllowInvalidHostnames] Specifies whether or not the driver should error when there is a mismatch between the servers hostname and the hostname specified by the TLS certificate
* @param {boolean} [options.autoReconnect=true] Enable autoReconnect for single server instances
* @param {boolean} [options.noDelay=true] TCP Connection no delay
* @param {boolean} [options.keepAlive=true] TCP Connection keep alive enabled
* @param {number} [options.keepAliveInitialDelay=120000] The number of milliseconds to wait before initiating keepAlive on the TCP socket
* @param {number} [options.connectTimeoutMS=10000] How long to wait for a connection to be established before timing out
* @param {number} [options.socketTimeoutMS=360000] How long a send or receive on a socket can take before timing out
* @param {number} [options.family] Version of IP stack. Can be 4, 6 or null (default).
* If null, will attempt to connect with IPv6, and will fall back to IPv4 on failure
* @param {number} [options.reconnectTries=30] Server attempt to reconnect #times
* @param {number} [options.reconnectInterval=1000] Server will wait # milliseconds between retries
* @param {boolean} [options.ha=true] Control if high availability monitoring runs for Replicaset or Mongos proxies
* @param {number} [options.haInterval=10000] The High availability period for replicaset inquiry
* @param {string} [options.replicaSet=undefined] The Replicaset set name
* @param {number} [options.secondaryAcceptableLatencyMS=15] Cutoff latency point in MS for Replicaset member selection
* @param {number} [options.acceptableLatencyMS=15] Cutoff latency point in MS for Mongos proxies selection
* @param {boolean} [options.connectWithNoPrimary=false] Sets if the driver should connect even if no primary is available
* @param {string} [options.authSource=undefined] Define the database to authenticate against
* @param {(number|string)} [options.w] The write concern
* @param {number} [options.wtimeout] The write concern timeout
* @param {boolean} [options.j=false] Specify a journal write concern
* @param {boolean} [options.forceServerObjectId=false] Force server to assign _id values instead of driver
* @param {boolean} [options.serializeFunctions=false] Serialize functions on any object
* @param {Boolean} [options.ignoreUndefined=false] Specify if the BSON serializer should ignore undefined fields
* @param {boolean} [options.raw=false] Return document results as raw BSON buffers
* @param {number} [options.bufferMaxEntries=-1] Sets a cap on how many operations the driver will buffer up before giving up on getting a working connection, default is -1 which is unlimited
* @param {(ReadPreference|string)} [options.readPreference] The preferred read preference (ReadPreference.PRIMARY, ReadPreference.PRIMARY_PREFERRED, ReadPreference.SECONDARY, ReadPreference.SECONDARY_PREFERRED, ReadPreference.NEAREST)
* @param {object} [options.pkFactory] A primary key factory object for generation of custom _id keys
* @param {object} [options.promiseLibrary] A Promise library class the application wishes to use such as Bluebird, must be ES6 compatible
* @param {object} [options.readConcern] Specify a read concern for the collection (only MongoDB 3.2 or higher supported)
* @param {ReadConcernLevel} [options.readConcern.level='local'] Specify a read concern level for the collection operations (only MongoDB 3.2 or higher supported)
* @param {number} [options.maxStalenessSeconds=undefined] The max staleness to secondary reads (values under 10 seconds cannot be guaranteed)
* @param {string} [options.loggerLevel=undefined] The logging level (error/warn/info/debug)
* @param {object} [options.logger=undefined] Custom logger object
* @param {boolean} [options.promoteValues=true] Promotes BSON values to native types where possible, set to false to only receive wrapper types
* @param {boolean} [options.promoteBuffers=false] Promotes Binary BSON values to native Node Buffers
* @param {boolean} [options.promoteLongs=true] Promotes long values to number if they fit inside the 53 bits resolution
* @param {boolean} [options.domainsEnabled=false] Enable the wrapping of the callback in the current domain, disabled by default to avoid perf hit
* @param {object} [options.validateOptions=false] Validate MongoClient passed in options for correctness
* @param {string} [options.appname=undefined] The name of the application that created this MongoClient instance. MongoDB 3.4 and newer will print this value in the server log upon establishing each connection. It is also recorded in the slow query log and profile collections
* @param {string} [options.auth.user=undefined] The username for auth
* @param {string} [options.auth.password=undefined] The password for auth
* @param {string} [options.authMechanism] An authentication mechanism to use for connection authentication, see the {@link https://docs.mongodb.com/manual/reference/connection-string/#urioption.authMechanism|authMechanism} reference for supported options.
* @param {object} [options.compression] Type of compression to use: snappy or zlib
* @param {boolean} [options.fsync=false] Specify a file sync write concern
* @param {array} [options.readPreferenceTags] Read preference tags
* @param {number} [options.numberOfRetries=5] The number of retries for a tailable cursor
* @param {boolean} [options.auto_reconnect=true] Enable auto reconnecting for single server instances
* @param {boolean} [options.monitorCommands=false] Enable command monitoring for this client
* @param {number} [options.minSize] If present, the connection pool will be initialized with minSize connections, and will never dip below minSize connections
* @param {boolean} [options.directConnection=false] Enable directConnection
* @param {boolean} [options.useNewUrlParser=true] Determines whether or not to use the new url parser. Enables the new, spec-compliant, url parser shipped in the core driver. This url parser fixes a number of problems with the original parser, and aims to outright replace that parser in the near future. Defaults to true, and must be explicitly set to false to use the legacy url parser.
* @param {boolean} [options.useUnifiedTopology] Enables the new unified topology layer
* @param {Number} [options.localThresholdMS=15] **Only applies to the unified topology** The size of the latency window for selecting among multiple suitable servers
* @param {Number} [options.serverSelectionTimeoutMS=30000] **Only applies to the unified topology** How long to block for server selection before throwing an error
* @param {Number} [options.heartbeatFrequencyMS=10000] **Only applies to the unified topology** The frequency with which topology updates are scheduled
* @param {number} [options.maxPoolSize=10] **Only applies to the unified topology** The maximum number of connections that may be associated with a pool at a given time. This includes in use and available connections.
* @param {number} [options.minPoolSize=0] **Only applies to the unified topology** The minimum number of connections that MUST exist at any moment in a single connection pool.
* @param {number} [options.maxIdleTimeMS] **Only applies to the unified topology** The maximum amount of time a connection should remain idle in the connection pool before being marked idle. The default is infinity.
* @param {number} [options.waitQueueTimeoutMS=0] **Only applies to the unified topology** The maximum amount of time operation execution should wait for a connection to become available. The default is 0 which means there is no limit.
* @param {AutoEncrypter~AutoEncryptionOptions} [options.autoEncryption] Optionally enable client side auto encryption
* @param {DriverInfoOptions} [options.driverInfo] Allows a wrapping driver to amend the client metadata generated by the driver to include information about the wrapping driver
* @param {MongoClient~connectCallback} [callback] The command result callback
* @return {Promise<MongoClient>} returns Promise if no callback passed
*/
MongoClient.connect = function(url, options, callback) {
const args = Array.prototype.slice.call(arguments, 1);
callback = typeof args[args.length - 1] === 'function' ? args.pop() : undefined;
options = args.length ? args.shift() : null;
options = options || {};
// Create client
const mongoClient = new MongoClient(url, options);
// Execute the connect method
return mongoClient.connect(callback);
};
/**
* Starts a new session on the server
*
* @param {SessionOptions} [options] optional settings for a driver session
* @return {ClientSession} the newly established session
*/
MongoClient.prototype.startSession = function(options) {
options = Object.assign({ explicit: true }, options);
if (!this.topology) {
throw new MongoError('Must connect to a server before calling this method');
}
if (!this.topology.hasSessionSupport()) {
throw new MongoError('Current topology does not support sessions');
}
return this.topology.startSession(options, this.s.options);
};
/**
* Runs a given operation with an implicitly created session. The lifetime of the session
* will be handled without the need for user interaction.
*
* NOTE: presently the operation MUST return a Promise (either explicit or implicity as an async function)
*
* @param {Object} [options] Optional settings to be appled to implicitly created session
* @param {Function} operation An operation to execute with an implicitly created session. The signature of this MUST be `(session) => {}`
* @return {Promise}
*/
MongoClient.prototype.withSession = function(options, operation) {
if (typeof options === 'function') (operation = options), (options = undefined);
const session = this.startSession(options);
let cleanupHandler = (err, result, opts) => {
// prevent multiple calls to cleanupHandler
cleanupHandler = () => {
throw new ReferenceError('cleanupHandler was called too many times');
};
opts = Object.assign({ throw: true }, opts);
session.endSession();
if (err) {
if (opts.throw) throw err;
return Promise.reject(err);
}
};
try {
const result = operation(session);
return Promise.resolve(result)
.then(result => cleanupHandler(null, result))
.catch(err => cleanupHandler(err, null, { throw: true }));
} catch (err) {
return cleanupHandler(err, null, { throw: false });
}
};
/**
* Create a new Change Stream, watching for new changes (insertions, updates, replacements, deletions, and invalidations) in this cluster. Will ignore all changes to system collections, as well as the local, admin,
* and config databases.
* @method
* @since 3.1.0
* @param {Array} [pipeline] An array of {@link https://docs.mongodb.com/manual/reference/operator/aggregation-pipeline/|aggregation pipeline stages} through which to pass change stream documents. This allows for filtering (using $match) and manipulating the change stream documents.
* @param {object} [options] Optional settings
* @param {string} [options.fullDocument='default'] Allowed values: default, updateLookup. When set to updateLookup, the change stream will include both a delta describing the changes to the document, as well as a copy of the entire document that was changed from some time after the change occurred.
* @param {object} [options.resumeAfter] Specifies the logical starting point for the new change stream. This should be the _id field from a previously returned change stream document.
* @param {number} [options.maxAwaitTimeMS] The maximum amount of time for the server to wait on new documents to satisfy a change stream query
* @param {number} [options.batchSize=1000] The number of documents to return per batch. See {@link https://docs.mongodb.com/manual/reference/command/aggregate|aggregation documentation}.
* @param {object} [options.collation] Specify collation settings for operation. See {@link https://docs.mongodb.com/manual/reference/command/aggregate|aggregation documentation}.
* @param {ReadPreference} [options.readPreference] The read preference. See {@link https://docs.mongodb.com/manual/reference/read-preference|read preference documentation}.
* @param {Timestamp} [options.startAtOperationTime] receive change events that occur after the specified timestamp
* @param {ClientSession} [options.session] optional session to use for this operation
* @return {ChangeStream} a ChangeStream instance.
*/
MongoClient.prototype.watch = function(pipeline, options) {
pipeline = pipeline || [];
options = options || {};
// Allow optionally not specifying a pipeline
if (!Array.isArray(pipeline)) {
options = pipeline;
pipeline = [];
}
return new ChangeStream(this, pipeline, options);
};
/**
* Return the mongo client logger
* @method
* @return {Logger} return the mongo client logger
* @ignore
*/
MongoClient.prototype.getLogger = function() {
return this.s.options.logger;
};
module.exports = MongoClient;

96
node_modules/mongodb/lib/operations/add_user.js generated vendored Normal file
View File

@@ -0,0 +1,96 @@
'use strict';
const Aspect = require('./operation').Aspect;
const CommandOperation = require('./command');
const defineAspects = require('./operation').defineAspects;
const crypto = require('crypto');
const handleCallback = require('../utils').handleCallback;
const toError = require('../utils').toError;
class AddUserOperation extends CommandOperation {
constructor(db, username, password, options) {
super(db, options);
this.username = username;
this.password = password;
}
_buildCommand() {
const db = this.db;
const username = this.username;
const password = this.password;
const options = this.options;
// Get additional values
let roles = Array.isArray(options.roles) ? options.roles : [];
// If not roles defined print deprecated message
// TODO: handle deprecation properly
if (roles.length === 0) {
console.log('Creating a user without roles is deprecated in MongoDB >= 2.6');
}
// Check the db name and add roles if needed
if (
(db.databaseName.toLowerCase() === 'admin' || options.dbName === 'admin') &&
!Array.isArray(options.roles)
) {
roles = ['root'];
} else if (!Array.isArray(options.roles)) {
roles = ['dbOwner'];
}
const digestPassword = db.s.topology.lastIsMaster().maxWireVersion >= 7;
let userPassword = password;
if (!digestPassword) {
// Use node md5 generator
const md5 = crypto.createHash('md5');
// Generate keys used for authentication
md5.update(username + ':mongo:' + password);
userPassword = md5.digest('hex');
}
// Build the command to execute
const command = {
createUser: username,
customData: options.customData || {},
roles: roles,
digestPassword
};
// No password
if (typeof password === 'string') {
command.pwd = userPassword;
}
return command;
}
execute(callback) {
const options = this.options;
// Error out if digestPassword set
if (options.digestPassword != null) {
return callback(
toError(
"The digestPassword option is not supported via add_user. Please use db.command('createUser', ...) instead for this option."
)
);
}
// Attempt to execute auth command
super.execute((err, r) => {
if (!err) {
return handleCallback(callback, err, r);
}
return handleCallback(callback, err, null);
});
}
}
defineAspects(AddUserOperation, Aspect.WRITE_OPERATION);
module.exports = AddUserOperation;

62
node_modules/mongodb/lib/operations/admin_ops.js generated vendored Normal file
View File

@@ -0,0 +1,62 @@
'use strict';
const executeCommand = require('./db_ops').executeCommand;
const executeDbAdminCommand = require('./db_ops').executeDbAdminCommand;
/**
* Get ReplicaSet status
*
* @param {Admin} a collection instance.
* @param {Object} [options] Optional settings. See Admin.prototype.replSetGetStatus for a list of options.
* @param {Admin~resultCallback} [callback] The command result callback.
*/
function replSetGetStatus(admin, options, callback) {
executeDbAdminCommand(admin.s.db, { replSetGetStatus: 1 }, options, callback);
}
/**
* Retrieve this db's server status.
*
* @param {Admin} a collection instance.
* @param {Object} [options] Optional settings. See Admin.prototype.serverStatus for a list of options.
* @param {Admin~resultCallback} [callback] The command result callback
*/
function serverStatus(admin, options, callback) {
executeDbAdminCommand(admin.s.db, { serverStatus: 1 }, options, callback);
}
/**
* Validate an existing collection
*
* @param {Admin} a collection instance.
* @param {string} collectionName The name of the collection to validate.
* @param {Object} [options] Optional settings. See Admin.prototype.validateCollection for a list of options.
* @param {Admin~resultCallback} [callback] The command result callback.
*/
function validateCollection(admin, collectionName, options, callback) {
const command = { validate: collectionName };
const keys = Object.keys(options);
// Decorate command with extra options
for (let i = 0; i < keys.length; i++) {
if (options.hasOwnProperty(keys[i]) && keys[i] !== 'session') {
command[keys[i]] = options[keys[i]];
}
}
executeCommand(admin.s.db, command, options, (err, doc) => {
if (err != null) return callback(err, null);
if (doc.ok === 0) return callback(new Error('Error with validate command'), null);
if (doc.result != null && doc.result.constructor !== String)
return callback(new Error('Error with validation data'), null);
if (doc.result != null && doc.result.match(/exception|corrupt/) != null)
return callback(new Error('Error: invalid collection ' + collectionName), null);
if (doc.valid != null && !doc.valid)
return callback(new Error('Error: invalid collection ' + collectionName), null);
return callback(null, doc);
});
}
module.exports = { replSetGetStatus, serverStatus, validateCollection };

106
node_modules/mongodb/lib/operations/aggregate.js generated vendored Normal file
View File

@@ -0,0 +1,106 @@
'use strict';
const CommandOperationV2 = require('./command_v2');
const MongoError = require('../core').MongoError;
const maxWireVersion = require('../core/utils').maxWireVersion;
const ReadPreference = require('../core').ReadPreference;
const Aspect = require('./operation').Aspect;
const defineAspects = require('./operation').defineAspects;
const DB_AGGREGATE_COLLECTION = 1;
const MIN_WIRE_VERSION_$OUT_READ_CONCERN_SUPPORT = 8;
class AggregateOperation extends CommandOperationV2 {
constructor(parent, pipeline, options) {
super(parent, options, { fullResponse: true });
this.target =
parent.s.namespace && parent.s.namespace.collection
? parent.s.namespace.collection
: DB_AGGREGATE_COLLECTION;
this.pipeline = pipeline;
// determine if we have a write stage, override read preference if so
this.hasWriteStage = false;
if (typeof options.out === 'string') {
this.pipeline = this.pipeline.concat({ $out: options.out });
this.hasWriteStage = true;
} else if (pipeline.length > 0) {
const finalStage = pipeline[pipeline.length - 1];
if (finalStage.$out || finalStage.$merge) {
this.hasWriteStage = true;
}
}
if (this.hasWriteStage) {
this.readPreference = ReadPreference.primary;
}
if (options.explain && (this.readConcern || this.writeConcern)) {
throw new MongoError(
'"explain" cannot be used on an aggregate call with readConcern/writeConcern'
);
}
if (options.cursor != null && typeof options.cursor !== 'object') {
throw new MongoError('cursor options must be an object');
}
}
get canRetryRead() {
return !this.hasWriteStage;
}
addToPipeline(stage) {
this.pipeline.push(stage);
}
execute(server, callback) {
const options = this.options;
const serverWireVersion = maxWireVersion(server);
const command = { aggregate: this.target, pipeline: this.pipeline };
if (this.hasWriteStage && serverWireVersion < MIN_WIRE_VERSION_$OUT_READ_CONCERN_SUPPORT) {
this.readConcern = null;
}
if (serverWireVersion >= 5) {
if (this.hasWriteStage && this.writeConcern) {
Object.assign(command, { writeConcern: this.writeConcern });
}
}
if (options.bypassDocumentValidation === true) {
command.bypassDocumentValidation = options.bypassDocumentValidation;
}
if (typeof options.allowDiskUse === 'boolean') {
command.allowDiskUse = options.allowDiskUse;
}
if (options.hint) {
command.hint = options.hint;
}
if (options.explain) {
options.full = false;
command.explain = options.explain;
}
command.cursor = options.cursor || {};
if (options.batchSize && !this.hasWriteStage) {
command.cursor.batchSize = options.batchSize;
}
super.executeCommand(server, command, callback);
}
}
defineAspects(AggregateOperation, [
Aspect.READ_OPERATION,
Aspect.RETRYABLE,
Aspect.EXECUTE_WITH_SELECTION
]);
module.exports = AggregateOperation;

104
node_modules/mongodb/lib/operations/bulk_write.js generated vendored Normal file
View File

@@ -0,0 +1,104 @@
'use strict';
const applyRetryableWrites = require('../utils').applyRetryableWrites;
const applyWriteConcern = require('../utils').applyWriteConcern;
const MongoError = require('../core').MongoError;
const OperationBase = require('./operation').OperationBase;
class BulkWriteOperation extends OperationBase {
constructor(collection, operations, options) {
super(options);
this.collection = collection;
this.operations = operations;
}
execute(callback) {
const coll = this.collection;
const operations = this.operations;
let options = this.options;
// Add ignoreUndfined
if (coll.s.options.ignoreUndefined) {
options = Object.assign({}, options);
options.ignoreUndefined = coll.s.options.ignoreUndefined;
}
// Create the bulk operation
const bulk =
options.ordered === true || options.ordered == null
? coll.initializeOrderedBulkOp(options)
: coll.initializeUnorderedBulkOp(options);
// Do we have a collation
let collation = false;
// for each op go through and add to the bulk
try {
for (let i = 0; i < operations.length; i++) {
// Get the operation type
const key = Object.keys(operations[i])[0];
// Check if we have a collation
if (operations[i][key].collation) {
collation = true;
}
// Pass to the raw bulk
bulk.raw(operations[i]);
}
} catch (err) {
return callback(err, null);
}
// Final options for retryable writes and write concern
let finalOptions = Object.assign({}, options);
finalOptions = applyRetryableWrites(finalOptions, coll.s.db);
finalOptions = applyWriteConcern(finalOptions, { db: coll.s.db, collection: coll }, options);
const writeCon = finalOptions.writeConcern ? finalOptions.writeConcern : {};
const capabilities = coll.s.topology.capabilities();
// Did the user pass in a collation, check if our write server supports it
if (collation && capabilities && !capabilities.commandsTakeCollation) {
return callback(new MongoError('server/primary/mongos does not support collation'));
}
// Execute the bulk
bulk.execute(writeCon, finalOptions, (err, r) => {
// We have connection level error
if (!r && err) {
return callback(err, null);
}
r.insertedCount = r.nInserted;
r.matchedCount = r.nMatched;
r.modifiedCount = r.nModified || 0;
r.deletedCount = r.nRemoved;
r.upsertedCount = r.getUpsertedIds().length;
r.upsertedIds = {};
r.insertedIds = {};
// Update the n
r.n = r.insertedCount;
// Inserted documents
const inserted = r.getInsertedIds();
// Map inserted ids
for (let i = 0; i < inserted.length; i++) {
r.insertedIds[inserted[i].index] = inserted[i]._id;
}
// Upserted documents
const upserted = r.getUpsertedIds();
// Map upserted ids
for (let i = 0; i < upserted.length; i++) {
r.upsertedIds[upserted[i].index] = upserted[i]._id;
}
// Return the results
callback(null, r);
});
}
}
module.exports = BulkWriteOperation;

353
node_modules/mongodb/lib/operations/collection_ops.js generated vendored Normal file
View File

@@ -0,0 +1,353 @@
'use strict';
const applyWriteConcern = require('../utils').applyWriteConcern;
const Code = require('../core').BSON.Code;
const createIndexDb = require('./db_ops').createIndex;
const decorateWithCollation = require('../utils').decorateWithCollation;
const decorateWithReadConcern = require('../utils').decorateWithReadConcern;
const ensureIndexDb = require('./db_ops').ensureIndex;
const evaluate = require('./db_ops').evaluate;
const executeCommand = require('./db_ops').executeCommand;
const handleCallback = require('../utils').handleCallback;
const indexInformationDb = require('./db_ops').indexInformation;
const Long = require('../core').BSON.Long;
const MongoError = require('../core').MongoError;
const ReadPreference = require('../core').ReadPreference;
const insertDocuments = require('./common_functions').insertDocuments;
const updateDocuments = require('./common_functions').updateDocuments;
/**
* Group function helper
* @ignore
*/
// var groupFunction = function () {
// var c = db[ns].find(condition);
// var map = new Map();
// var reduce_function = reduce;
//
// while (c.hasNext()) {
// var obj = c.next();
// var key = {};
//
// for (var i = 0, len = keys.length; i < len; ++i) {
// var k = keys[i];
// key[k] = obj[k];
// }
//
// var aggObj = map.get(key);
//
// if (aggObj == null) {
// var newObj = Object.extend({}, key);
// aggObj = Object.extend(newObj, initial);
// map.put(key, aggObj);
// }
//
// reduce_function(obj, aggObj);
// }
//
// return { "result": map.values() };
// }.toString();
const groupFunction =
'function () {\nvar c = db[ns].find(condition);\nvar map = new Map();\nvar reduce_function = reduce;\n\nwhile (c.hasNext()) {\nvar obj = c.next();\nvar key = {};\n\nfor (var i = 0, len = keys.length; i < len; ++i) {\nvar k = keys[i];\nkey[k] = obj[k];\n}\n\nvar aggObj = map.get(key);\n\nif (aggObj == null) {\nvar newObj = Object.extend({}, key);\naggObj = Object.extend(newObj, initial);\nmap.put(key, aggObj);\n}\n\nreduce_function(obj, aggObj);\n}\n\nreturn { "result": map.values() };\n}';
/**
* Create an index on the db and collection.
*
* @method
* @param {Collection} a Collection instance.
* @param {(string|object)} fieldOrSpec Defines the index.
* @param {object} [options] Optional settings. See Collection.prototype.createIndex for a list of options.
* @param {Collection~resultCallback} [callback] The command result callback
*/
function createIndex(coll, fieldOrSpec, options, callback) {
createIndexDb(coll.s.db, coll.collectionName, fieldOrSpec, options, callback);
}
/**
* Create multiple indexes in the collection. This method is only supported for
* MongoDB 2.6 or higher. Earlier version of MongoDB will throw a command not supported
* error. Index specifications are defined at http://docs.mongodb.org/manual/reference/command/createIndexes/.
*
* @method
* @param {Collection} a Collection instance.
* @param {array} indexSpecs An array of index specifications to be created
* @param {Object} [options] Optional settings. See Collection.prototype.createIndexes for a list of options.
* @param {Collection~resultCallback} [callback] The command result callback
*/
function createIndexes(coll, indexSpecs, options, callback) {
const capabilities = coll.s.topology.capabilities();
// Ensure we generate the correct name if the parameter is not set
for (let i = 0; i < indexSpecs.length; i++) {
if (indexSpecs[i].name == null) {
const keys = [];
// Did the user pass in a collation, check if our write server supports it
if (indexSpecs[i].collation && capabilities && !capabilities.commandsTakeCollation) {
return callback(new MongoError('server/primary/mongos does not support collation'));
}
for (let name in indexSpecs[i].key) {
keys.push(`${name}_${indexSpecs[i].key[name]}`);
}
// Set the name
indexSpecs[i].name = keys.join('_');
}
}
options = Object.assign({}, options, { readPreference: ReadPreference.PRIMARY });
// Execute the index
executeCommand(
coll.s.db,
{
createIndexes: coll.collectionName,
indexes: indexSpecs
},
options,
callback
);
}
/**
* Ensure that an index exists. If the index does not exist, this function creates it.
*
* @method
* @param {Collection} a Collection instance.
* @param {(string|object)} fieldOrSpec Defines the index.
* @param {object} [options] Optional settings. See Collection.prototype.ensureIndex for a list of options.
* @param {Collection~resultCallback} [callback] The command result callback
*/
function ensureIndex(coll, fieldOrSpec, options, callback) {
ensureIndexDb(coll.s.db, coll.collectionName, fieldOrSpec, options, callback);
}
/**
* Run a group command across a collection.
*
* @method
* @param {Collection} a Collection instance.
* @param {(object|array|function|code)} keys An object, array or function expressing the keys to group by.
* @param {object} condition An optional condition that must be true for a row to be considered.
* @param {object} initial Initial value of the aggregation counter object.
* @param {(function|Code)} reduce The reduce function aggregates (reduces) the objects iterated
* @param {(function|Code)} finalize An optional function to be run on each item in the result set just before the item is returned.
* @param {boolean} command Specify if you wish to run using the internal group command or using eval, default is true.
* @param {object} [options] Optional settings. See Collection.prototype.group for a list of options.
* @param {Collection~resultCallback} [callback] The command result callback
* @deprecated MongoDB 3.6 or higher will no longer support the group command. We recommend rewriting using the aggregation framework.
*/
function group(coll, keys, condition, initial, reduce, finalize, command, options, callback) {
// Execute using the command
if (command) {
const reduceFunction = reduce && reduce._bsontype === 'Code' ? reduce : new Code(reduce);
const selector = {
group: {
ns: coll.collectionName,
$reduce: reduceFunction,
cond: condition,
initial: initial,
out: 'inline'
}
};
// if finalize is defined
if (finalize != null) selector.group['finalize'] = finalize;
// Set up group selector
if ('function' === typeof keys || (keys && keys._bsontype === 'Code')) {
selector.group.$keyf = keys && keys._bsontype === 'Code' ? keys : new Code(keys);
} else {
const hash = {};
keys.forEach(key => {
hash[key] = 1;
});
selector.group.key = hash;
}
options = Object.assign({}, options);
// Ensure we have the right read preference inheritance
options.readPreference = ReadPreference.resolve(coll, options);
// Do we have a readConcern specified
decorateWithReadConcern(selector, coll, options);
// Have we specified collation
try {
decorateWithCollation(selector, coll, options);
} catch (err) {
return callback(err, null);
}
// Execute command
executeCommand(coll.s.db, selector, options, (err, result) => {
if (err) return handleCallback(callback, err, null);
handleCallback(callback, null, result.retval);
});
} else {
// Create execution scope
const scope = reduce != null && reduce._bsontype === 'Code' ? reduce.scope : {};
scope.ns = coll.collectionName;
scope.keys = keys;
scope.condition = condition;
scope.initial = initial;
// Pass in the function text to execute within mongodb.
const groupfn = groupFunction.replace(/ reduce;/, reduce.toString() + ';');
evaluate(coll.s.db, new Code(groupfn, scope), null, options, (err, results) => {
if (err) return handleCallback(callback, err, null);
handleCallback(callback, null, results.result || results);
});
}
}
/**
* Retrieve all the indexes on the collection.
*
* @method
* @param {Collection} a Collection instance.
* @param {Object} [options] Optional settings. See Collection.prototype.indexes for a list of options.
* @param {Collection~resultCallback} [callback] The command result callback
*/
function indexes(coll, options, callback) {
options = Object.assign({}, { full: true }, options);
indexInformationDb(coll.s.db, coll.collectionName, options, callback);
}
/**
* Check if one or more indexes exist on the collection. This fails on the first index that doesn't exist.
*
* @method
* @param {Collection} a Collection instance.
* @param {(string|array)} indexes One or more index names to check.
* @param {Object} [options] Optional settings. See Collection.prototype.indexExists for a list of options.
* @param {Collection~resultCallback} [callback] The command result callback
*/
function indexExists(coll, indexes, options, callback) {
indexInformation(coll, options, (err, indexInformation) => {
// If we have an error return
if (err != null) return handleCallback(callback, err, null);
// Let's check for the index names
if (!Array.isArray(indexes))
return handleCallback(callback, null, indexInformation[indexes] != null);
// Check in list of indexes
for (let i = 0; i < indexes.length; i++) {
if (indexInformation[indexes[i]] == null) {
return handleCallback(callback, null, false);
}
}
// All keys found return true
return handleCallback(callback, null, true);
});
}
/**
* Retrieve this collection's index info.
*
* @method
* @param {Collection} a Collection instance.
* @param {object} [options] Optional settings. See Collection.prototype.indexInformation for a list of options.
* @param {Collection~resultCallback} [callback] The command result callback
*/
function indexInformation(coll, options, callback) {
indexInformationDb(coll.s.db, coll.collectionName, options, callback);
}
/**
* Return N parallel cursors for a collection to allow parallel reading of the entire collection. There are
* no ordering guarantees for returned results.
*
* @method
* @param {Collection} a Collection instance.
* @param {object} [options] Optional settings. See Collection.prototype.parallelCollectionScan for a list of options.
* @param {Collection~parallelCollectionScanCallback} [callback] The command result callback
*/
function parallelCollectionScan(coll, options, callback) {
// Create command object
const commandObject = {
parallelCollectionScan: coll.collectionName,
numCursors: options.numCursors
};
// Do we have a readConcern specified
decorateWithReadConcern(commandObject, coll, options);
// Store the raw value
const raw = options.raw;
delete options['raw'];
// Execute the command
executeCommand(coll.s.db, commandObject, options, (err, result) => {
if (err) return handleCallback(callback, err, null);
if (result == null)
return handleCallback(
callback,
new Error('no result returned for parallelCollectionScan'),
null
);
options = Object.assign({ explicitlyIgnoreSession: true }, options);
const cursors = [];
// Add the raw back to the option
if (raw) options.raw = raw;
// Create command cursors for each item
for (let i = 0; i < result.cursors.length; i++) {
const rawId = result.cursors[i].cursor.id;
// Convert cursorId to Long if needed
const cursorId = typeof rawId === 'number' ? Long.fromNumber(rawId) : rawId;
// Add a command cursor
cursors.push(coll.s.topology.cursor(coll.namespace, cursorId, options));
}
handleCallback(callback, null, cursors);
});
}
/**
* Save a document.
*
* @method
* @param {Collection} a Collection instance.
* @param {object} doc Document to save
* @param {object} [options] Optional settings. See Collection.prototype.save for a list of options.
* @param {Collection~writeOpCallback} [callback] The command result callback
* @deprecated use insertOne, insertMany, updateOne or updateMany
*/
function save(coll, doc, options, callback) {
// Get the write concern options
const finalOptions = applyWriteConcern(
Object.assign({}, options),
{ db: coll.s.db, collection: coll },
options
);
// Establish if we need to perform an insert or update
if (doc._id != null) {
finalOptions.upsert = true;
return updateDocuments(coll, { _id: doc._id }, doc, finalOptions, callback);
}
// Insert the document
insertDocuments(coll, [doc], finalOptions, (err, result) => {
if (callback == null) return;
if (doc == null) return handleCallback(callback, null, null);
if (err) return handleCallback(callback, err, null);
handleCallback(callback, null, result);
});
}
module.exports = {
createIndex,
createIndexes,
ensureIndex,
group,
indexes,
indexExists,
indexInformation,
parallelCollectionScan,
save
};

55
node_modules/mongodb/lib/operations/collections.js generated vendored Normal file
View File

@@ -0,0 +1,55 @@
'use strict';
const OperationBase = require('./operation').OperationBase;
const handleCallback = require('../utils').handleCallback;
let collection;
function loadCollection() {
if (!collection) {
collection = require('../collection');
}
return collection;
}
class CollectionsOperation extends OperationBase {
constructor(db, options) {
super(options);
this.db = db;
}
execute(callback) {
const db = this.db;
let options = this.options;
let Collection = loadCollection();
options = Object.assign({}, options, { nameOnly: true });
// Let's get the collection names
db.listCollections({}, options).toArray((err, documents) => {
if (err != null) return handleCallback(callback, err, null);
// Filter collections removing any illegal ones
documents = documents.filter(doc => {
return doc.name.indexOf('$') === -1;
});
// Return the collection objects
handleCallback(
callback,
null,
documents.map(d => {
return new Collection(
db,
db.s.topology,
db.databaseName,
d.name,
db.s.pkFactory,
db.s.options
);
})
);
});
}
}
module.exports = CollectionsOperation;

119
node_modules/mongodb/lib/operations/command.js generated vendored Normal file
View File

@@ -0,0 +1,119 @@
'use strict';
const Aspect = require('./operation').Aspect;
const OperationBase = require('./operation').OperationBase;
const applyWriteConcern = require('../utils').applyWriteConcern;
const debugOptions = require('../utils').debugOptions;
const handleCallback = require('../utils').handleCallback;
const MongoError = require('../core').MongoError;
const ReadPreference = require('../core').ReadPreference;
const MongoDBNamespace = require('../utils').MongoDBNamespace;
const debugFields = [
'authSource',
'w',
'wtimeout',
'j',
'native_parser',
'forceServerObjectId',
'serializeFunctions',
'raw',
'promoteLongs',
'promoteValues',
'promoteBuffers',
'bufferMaxEntries',
'numberOfRetries',
'retryMiliSeconds',
'readPreference',
'pkFactory',
'parentDb',
'promiseLibrary',
'noListener'
];
class CommandOperation extends OperationBase {
constructor(db, options, collection, command) {
super(options);
if (!this.hasAspect(Aspect.WRITE_OPERATION)) {
if (collection != null) {
this.options.readPreference = ReadPreference.resolve(collection, options);
} else {
this.options.readPreference = ReadPreference.resolve(db, options);
}
} else {
if (collection != null) {
applyWriteConcern(this.options, { db, coll: collection }, this.options);
} else {
applyWriteConcern(this.options, { db }, this.options);
}
this.options.readPreference = ReadPreference.primary;
}
this.db = db;
if (command != null) {
this.command = command;
}
if (collection != null) {
this.collection = collection;
}
}
_buildCommand() {
if (this.command != null) {
return this.command;
}
}
execute(callback) {
const db = this.db;
const options = Object.assign({}, this.options);
// Did the user destroy the topology
if (db.serverConfig && db.serverConfig.isDestroyed()) {
return callback(new MongoError('topology was destroyed'));
}
let command;
try {
command = this._buildCommand();
} catch (e) {
return callback(e);
}
// Get the db name we are executing against
const dbName = options.dbName || options.authdb || db.databaseName;
// Convert the readPreference if its not a write
if (this.hasAspect(Aspect.WRITE_OPERATION)) {
if (options.writeConcern && (!options.session || !options.session.inTransaction())) {
command.writeConcern = options.writeConcern;
}
}
// Debug information
if (db.s.logger.isDebug()) {
db.s.logger.debug(
`executing command ${JSON.stringify(
command
)} against ${dbName}.$cmd with options [${JSON.stringify(
debugOptions(debugFields, options)
)}]`
);
}
const namespace =
this.namespace != null ? this.namespace : new MongoDBNamespace(dbName, '$cmd');
// Execute command
db.s.topology.command(namespace, command, options, (err, result) => {
if (err) return handleCallback(callback, err);
if (options.full) return handleCallback(callback, null, result);
handleCallback(callback, null, result.result);
});
}
}
module.exports = CommandOperation;

108
node_modules/mongodb/lib/operations/command_v2.js generated vendored Normal file
View File

@@ -0,0 +1,108 @@
'use strict';
const Aspect = require('./operation').Aspect;
const OperationBase = require('./operation').OperationBase;
const ReadPreference = require('../core').ReadPreference;
const ReadConcern = require('../read_concern');
const WriteConcern = require('../write_concern');
const maxWireVersion = require('../core/utils').maxWireVersion;
const commandSupportsReadConcern = require('../core/sessions').commandSupportsReadConcern;
const MongoError = require('../core/error').MongoError;
const SUPPORTS_WRITE_CONCERN_AND_COLLATION = 5;
class CommandOperationV2 extends OperationBase {
constructor(parent, options, operationOptions) {
super(options);
this.ns = parent.s.namespace.withCollection('$cmd');
const propertyProvider = this.hasAspect(Aspect.NO_INHERIT_OPTIONS) ? undefined : parent;
this.readPreference = ReadPreference.resolve(propertyProvider, this.options);
this.readConcern = resolveReadConcern(propertyProvider, this.options);
this.writeConcern = resolveWriteConcern(propertyProvider, this.options);
this.explain = false;
if (operationOptions && typeof operationOptions.fullResponse === 'boolean') {
this.fullResponse = true;
}
// TODO: A lot of our code depends on having the read preference in the options. This should
// go away, but also requires massive test rewrites.
this.options.readPreference = this.readPreference;
// TODO(NODE-2056): make logger another "inheritable" property
if (parent.s.logger) {
this.logger = parent.s.logger;
} else if (parent.s.db && parent.s.db.logger) {
this.logger = parent.s.db.logger;
}
}
executeCommand(server, cmd, callback) {
// TODO: consider making this a non-enumerable property
this.server = server;
const options = this.options;
const serverWireVersion = maxWireVersion(server);
const inTransaction = this.session && this.session.inTransaction();
if (this.readConcern && commandSupportsReadConcern(cmd) && !inTransaction) {
Object.assign(cmd, { readConcern: this.readConcern });
}
if (options.collation && serverWireVersion < SUPPORTS_WRITE_CONCERN_AND_COLLATION) {
callback(
new MongoError(
`Server ${server.name}, which reports wire version ${serverWireVersion}, does not support collation`
)
);
return;
}
if (serverWireVersion >= SUPPORTS_WRITE_CONCERN_AND_COLLATION) {
if (this.writeConcern && this.hasAspect(Aspect.WRITE_OPERATION)) {
Object.assign(cmd, { writeConcern: this.writeConcern });
}
if (options.collation && typeof options.collation === 'object') {
Object.assign(cmd, { collation: options.collation });
}
}
if (typeof options.maxTimeMS === 'number') {
cmd.maxTimeMS = options.maxTimeMS;
}
if (typeof options.comment === 'string') {
cmd.comment = options.comment;
}
if (this.logger && this.logger.isDebug()) {
this.logger.debug(`executing command ${JSON.stringify(cmd)} against ${this.ns}`);
}
server.command(this.ns.toString(), cmd, this.options, (err, result) => {
if (err) {
callback(err, null);
return;
}
if (this.fullResponse) {
callback(null, result);
return;
}
callback(null, result.result);
});
}
}
function resolveWriteConcern(parent, options) {
return WriteConcern.fromOptions(options) || (parent && parent.writeConcern);
}
function resolveReadConcern(parent, options) {
return ReadConcern.fromOptions(options) || (parent && parent.readConcern);
}
module.exports = CommandOperationV2;

412
node_modules/mongodb/lib/operations/common_functions.js generated vendored Normal file
View File

@@ -0,0 +1,412 @@
'use strict';
const applyRetryableWrites = require('../utils').applyRetryableWrites;
const applyWriteConcern = require('../utils').applyWriteConcern;
const decorateWithCollation = require('../utils').decorateWithCollation;
const decorateWithReadConcern = require('../utils').decorateWithReadConcern;
const executeCommand = require('./db_ops').executeCommand;
const formattedOrderClause = require('../utils').formattedOrderClause;
const handleCallback = require('../utils').handleCallback;
const MongoError = require('../core').MongoError;
const ReadPreference = require('../core').ReadPreference;
const toError = require('../utils').toError;
const CursorState = require('../core/cursor').CursorState;
/**
* Build the count command.
*
* @method
* @param {collectionOrCursor} an instance of a collection or cursor
* @param {object} query The query for the count.
* @param {object} [options] Optional settings. See Collection.prototype.count and Cursor.prototype.count for a list of options.
*/
function buildCountCommand(collectionOrCursor, query, options) {
const skip = options.skip;
const limit = options.limit;
let hint = options.hint;
const maxTimeMS = options.maxTimeMS;
query = query || {};
// Final query
const cmd = {
count: options.collectionName,
query: query
};
if (collectionOrCursor.s.numberOfRetries) {
// collectionOrCursor is a cursor
if (collectionOrCursor.options.hint) {
hint = collectionOrCursor.options.hint;
} else if (collectionOrCursor.cmd.hint) {
hint = collectionOrCursor.cmd.hint;
}
decorateWithCollation(cmd, collectionOrCursor, collectionOrCursor.cmd);
} else {
decorateWithCollation(cmd, collectionOrCursor, options);
}
// Add limit, skip and maxTimeMS if defined
if (typeof skip === 'number') cmd.skip = skip;
if (typeof limit === 'number') cmd.limit = limit;
if (typeof maxTimeMS === 'number') cmd.maxTimeMS = maxTimeMS;
if (hint) cmd.hint = hint;
// Do we have a readConcern specified
decorateWithReadConcern(cmd, collectionOrCursor);
return cmd;
}
function deleteCallback(err, r, callback) {
if (callback == null) return;
if (err && callback) return callback(err);
if (r == null) return callback(null, { result: { ok: 1 } });
r.deletedCount = r.result.n;
if (callback) callback(null, r);
}
/**
* Find and update a document.
*
* @method
* @param {Collection} a Collection instance.
* @param {object} query Query object to locate the object to modify.
* @param {array} sort If multiple docs match, choose the first one in the specified sort order as the object to manipulate.
* @param {object} doc The fields/vals to be updated.
* @param {object} [options] Optional settings. See Collection.prototype.findAndModify for a list of options.
* @param {Collection~findAndModifyCallback} [callback] The command result callback
* @deprecated use findOneAndUpdate, findOneAndReplace or findOneAndDelete instead
*/
function findAndModify(coll, query, sort, doc, options, callback) {
// Create findAndModify command object
const queryObject = {
findAndModify: coll.collectionName,
query: query
};
sort = formattedOrderClause(sort);
if (sort) {
queryObject.sort = sort;
}
queryObject.new = options.new ? true : false;
queryObject.remove = options.remove ? true : false;
queryObject.upsert = options.upsert ? true : false;
const projection = options.projection || options.fields;
if (projection) {
queryObject.fields = projection;
}
if (options.arrayFilters) {
queryObject.arrayFilters = options.arrayFilters;
delete options.arrayFilters;
}
if (doc && !options.remove) {
queryObject.update = doc;
}
if (options.maxTimeMS) queryObject.maxTimeMS = options.maxTimeMS;
// Either use override on the function, or go back to default on either the collection
// level or db
options.serializeFunctions = options.serializeFunctions || coll.s.serializeFunctions;
// No check on the documents
options.checkKeys = false;
// Final options for retryable writes and write concern
let finalOptions = Object.assign({}, options);
finalOptions = applyRetryableWrites(finalOptions, coll.s.db);
finalOptions = applyWriteConcern(finalOptions, { db: coll.s.db, collection: coll }, options);
// Decorate the findAndModify command with the write Concern
if (finalOptions.writeConcern) {
queryObject.writeConcern = finalOptions.writeConcern;
}
// Have we specified bypassDocumentValidation
if (finalOptions.bypassDocumentValidation === true) {
queryObject.bypassDocumentValidation = finalOptions.bypassDocumentValidation;
}
finalOptions.readPreference = ReadPreference.primary;
// Have we specified collation
try {
decorateWithCollation(queryObject, coll, finalOptions);
} catch (err) {
return callback(err, null);
}
// Execute the command
executeCommand(coll.s.db, queryObject, finalOptions, (err, result) => {
if (err) return handleCallback(callback, err, null);
return handleCallback(callback, null, result);
});
}
/**
* Retrieves this collections index info.
*
* @method
* @param {Db} db The Db instance on which to retrieve the index info.
* @param {string} name The name of the collection.
* @param {object} [options] Optional settings. See Db.prototype.indexInformation for a list of options.
* @param {Db~resultCallback} [callback] The command result callback
*/
function indexInformation(db, name, options, callback) {
// If we specified full information
const full = options['full'] == null ? false : options['full'];
// Did the user destroy the topology
if (db.serverConfig && db.serverConfig.isDestroyed())
return callback(new MongoError('topology was destroyed'));
// Process all the results from the index command and collection
function processResults(indexes) {
// Contains all the information
let info = {};
// Process all the indexes
for (let i = 0; i < indexes.length; i++) {
const index = indexes[i];
// Let's unpack the object
info[index.name] = [];
for (let name in index.key) {
info[index.name].push([name, index.key[name]]);
}
}
return info;
}
// Get the list of indexes of the specified collection
db.collection(name)
.listIndexes(options)
.toArray((err, indexes) => {
if (err) return callback(toError(err));
if (!Array.isArray(indexes)) return handleCallback(callback, null, []);
if (full) return handleCallback(callback, null, indexes);
handleCallback(callback, null, processResults(indexes));
});
}
function prepareDocs(coll, docs, options) {
const forceServerObjectId =
typeof options.forceServerObjectId === 'boolean'
? options.forceServerObjectId
: coll.s.db.options.forceServerObjectId;
// no need to modify the docs if server sets the ObjectId
if (forceServerObjectId === true) {
return docs;
}
return docs.map(doc => {
if (forceServerObjectId !== true && doc._id == null) {
doc._id = coll.s.pkFactory.createPk();
}
return doc;
});
}
// Get the next available document from the cursor, returns null if no more documents are available.
function nextObject(cursor, callback) {
if (cursor.s.state === CursorState.CLOSED || (cursor.isDead && cursor.isDead())) {
return handleCallback(
callback,
MongoError.create({ message: 'Cursor is closed', driver: true })
);
}
if (cursor.s.state === CursorState.INIT && cursor.cmd && cursor.cmd.sort) {
try {
cursor.cmd.sort = formattedOrderClause(cursor.cmd.sort);
} catch (err) {
return handleCallback(callback, err);
}
}
// Get the next object
cursor._next((err, doc) => {
cursor.s.state = CursorState.OPEN;
if (err) return handleCallback(callback, err);
handleCallback(callback, null, doc);
});
}
function insertDocuments(coll, docs, options, callback) {
if (typeof options === 'function') (callback = options), (options = {});
options = options || {};
// Ensure we are operating on an array op docs
docs = Array.isArray(docs) ? docs : [docs];
// Final options for retryable writes and write concern
let finalOptions = Object.assign({}, options);
finalOptions = applyRetryableWrites(finalOptions, coll.s.db);
finalOptions = applyWriteConcern(finalOptions, { db: coll.s.db, collection: coll }, options);
// If keep going set unordered
if (finalOptions.keepGoing === true) finalOptions.ordered = false;
finalOptions.serializeFunctions = options.serializeFunctions || coll.s.serializeFunctions;
docs = prepareDocs(coll, docs, options);
// File inserts
coll.s.topology.insert(coll.s.namespace, docs, finalOptions, (err, result) => {
if (callback == null) return;
if (err) return handleCallback(callback, err);
if (result == null) return handleCallback(callback, null, null);
if (result.result.code) return handleCallback(callback, toError(result.result));
if (result.result.writeErrors)
return handleCallback(callback, toError(result.result.writeErrors[0]));
// Add docs to the list
result.ops = docs;
// Return the results
handleCallback(callback, null, result);
});
}
function removeDocuments(coll, selector, options, callback) {
if (typeof options === 'function') {
(callback = options), (options = {});
} else if (typeof selector === 'function') {
callback = selector;
options = {};
selector = {};
}
// Create an empty options object if the provided one is null
options = options || {};
// Final options for retryable writes and write concern
let finalOptions = Object.assign({}, options);
finalOptions = applyRetryableWrites(finalOptions, coll.s.db);
finalOptions = applyWriteConcern(finalOptions, { db: coll.s.db, collection: coll }, options);
// If selector is null set empty
if (selector == null) selector = {};
// Build the op
const op = { q: selector, limit: 0 };
if (options.single) {
op.limit = 1;
} else if (finalOptions.retryWrites) {
finalOptions.retryWrites = false;
}
if (options.hint) {
op.hint = options.hint;
}
// Have we specified collation
try {
decorateWithCollation(finalOptions, coll, options);
} catch (err) {
return callback(err, null);
}
// Execute the remove
coll.s.topology.remove(coll.s.namespace, [op], finalOptions, (err, result) => {
if (callback == null) return;
if (err) return handleCallback(callback, err, null);
if (result == null) return handleCallback(callback, null, null);
if (result.result.code) return handleCallback(callback, toError(result.result));
if (result.result.writeErrors) {
return handleCallback(callback, toError(result.result.writeErrors[0]));
}
// Return the results
handleCallback(callback, null, result);
});
}
function updateDocuments(coll, selector, document, options, callback) {
if ('function' === typeof options) (callback = options), (options = null);
if (options == null) options = {};
if (!('function' === typeof callback)) callback = null;
// If we are not providing a selector or document throw
if (selector == null || typeof selector !== 'object')
return callback(toError('selector must be a valid JavaScript object'));
if (document == null || typeof document !== 'object')
return callback(toError('document must be a valid JavaScript object'));
// Final options for retryable writes and write concern
let finalOptions = Object.assign({}, options);
finalOptions = applyRetryableWrites(finalOptions, coll.s.db);
finalOptions = applyWriteConcern(finalOptions, { db: coll.s.db, collection: coll }, options);
// Do we return the actual result document
// Either use override on the function, or go back to default on either the collection
// level or db
finalOptions.serializeFunctions = options.serializeFunctions || coll.s.serializeFunctions;
// Execute the operation
const op = { q: selector, u: document };
op.upsert = options.upsert !== void 0 ? !!options.upsert : false;
op.multi = options.multi !== void 0 ? !!options.multi : false;
if (options.hint) {
op.hint = options.hint;
}
if (finalOptions.arrayFilters) {
op.arrayFilters = finalOptions.arrayFilters;
delete finalOptions.arrayFilters;
}
if (finalOptions.retryWrites && op.multi) {
finalOptions.retryWrites = false;
}
// Have we specified collation
try {
decorateWithCollation(finalOptions, coll, options);
} catch (err) {
return callback(err, null);
}
// Update options
coll.s.topology.update(coll.s.namespace, [op], finalOptions, (err, result) => {
if (callback == null) return;
if (err) return handleCallback(callback, err, null);
if (result == null) return handleCallback(callback, null, null);
if (result.result.code) return handleCallback(callback, toError(result.result));
if (result.result.writeErrors)
return handleCallback(callback, toError(result.result.writeErrors[0]));
// Return the results
handleCallback(callback, null, result);
});
}
function updateCallback(err, r, callback) {
if (callback == null) return;
if (err) return callback(err);
if (r == null) return callback(null, { result: { ok: 1 } });
r.modifiedCount = r.result.nModified != null ? r.result.nModified : r.result.n;
r.upsertedId =
Array.isArray(r.result.upserted) && r.result.upserted.length > 0
? r.result.upserted[0] // FIXME(major): should be `r.result.upserted[0]._id`
: null;
r.upsertedCount =
Array.isArray(r.result.upserted) && r.result.upserted.length ? r.result.upserted.length : 0;
r.matchedCount =
Array.isArray(r.result.upserted) && r.result.upserted.length > 0 ? 0 : r.result.n;
callback(null, r);
}
module.exports = {
buildCountCommand,
deleteCallback,
findAndModify,
indexInformation,
nextObject,
prepareDocs,
insertDocuments,
removeDocuments,
updateDocuments,
updateCallback
};

806
node_modules/mongodb/lib/operations/connect.js generated vendored Normal file
View File

@@ -0,0 +1,806 @@
'use strict';
const deprecate = require('util').deprecate;
const Logger = require('../core').Logger;
const MongoCredentials = require('../core').MongoCredentials;
const MongoError = require('../core').MongoError;
const Mongos = require('../topologies/mongos');
const NativeTopology = require('../topologies/native_topology');
const parse = require('../core').parseConnectionString;
const ReadConcern = require('../read_concern');
const ReadPreference = require('../core').ReadPreference;
const ReplSet = require('../topologies/replset');
const Server = require('../topologies/server');
const ServerSessionPool = require('../core').Sessions.ServerSessionPool;
const emitDeprecationWarning = require('../utils').emitDeprecationWarning;
const fs = require('fs');
const BSON = require('../core/connection/utils').retrieveBSON();
const CMAP_EVENT_NAMES = require('../cmap/events').CMAP_EVENT_NAMES;
let client;
function loadClient() {
if (!client) {
client = require('../mongo_client');
}
return client;
}
const legacyParse = deprecate(
require('../url_parser'),
'current URL string parser is deprecated, and will be removed in a future version. ' +
'To use the new parser, pass option { useNewUrlParser: true } to MongoClient.connect.'
);
const AUTH_MECHANISM_INTERNAL_MAP = {
DEFAULT: 'default',
PLAIN: 'plain',
GSSAPI: 'gssapi',
'MONGODB-CR': 'mongocr',
'MONGODB-X509': 'x509',
'MONGODB-AWS': 'mongodb-aws',
'SCRAM-SHA-1': 'scram-sha-1',
'SCRAM-SHA-256': 'scram-sha-256'
};
const monitoringEvents = [
'timeout',
'close',
'serverOpening',
'serverDescriptionChanged',
'serverHeartbeatStarted',
'serverHeartbeatSucceeded',
'serverHeartbeatFailed',
'serverClosed',
'topologyOpening',
'topologyClosed',
'topologyDescriptionChanged',
'commandStarted',
'commandSucceeded',
'commandFailed',
'joined',
'left',
'ping',
'ha',
'all',
'fullsetup',
'open'
];
const VALID_AUTH_MECHANISMS = new Set([
'DEFAULT',
'PLAIN',
'GSSAPI',
'MONGODB-CR',
'MONGODB-X509',
'MONGODB-AWS',
'SCRAM-SHA-1',
'SCRAM-SHA-256'
]);
const validOptionNames = [
'poolSize',
'ssl',
'sslValidate',
'sslCA',
'sslCert',
'sslKey',
'sslPass',
'sslCRL',
'autoReconnect',
'noDelay',
'keepAlive',
'keepAliveInitialDelay',
'connectTimeoutMS',
'family',
'socketTimeoutMS',
'reconnectTries',
'reconnectInterval',
'ha',
'haInterval',
'replicaSet',
'secondaryAcceptableLatencyMS',
'acceptableLatencyMS',
'connectWithNoPrimary',
'authSource',
'w',
'wtimeout',
'j',
'forceServerObjectId',
'serializeFunctions',
'ignoreUndefined',
'raw',
'bufferMaxEntries',
'readPreference',
'pkFactory',
'promiseLibrary',
'readConcern',
'maxStalenessSeconds',
'loggerLevel',
'logger',
'promoteValues',
'promoteBuffers',
'promoteLongs',
'domainsEnabled',
'checkServerIdentity',
'validateOptions',
'appname',
'auth',
'user',
'password',
'authMechanism',
'compression',
'fsync',
'readPreferenceTags',
'numberOfRetries',
'auto_reconnect',
'minSize',
'monitorCommands',
'retryWrites',
'retryReads',
'useNewUrlParser',
'useUnifiedTopology',
'serverSelectionTimeoutMS',
'useRecoveryToken',
'autoEncryption',
'driverInfo',
'tls',
'tlsInsecure',
'tlsinsecure',
'tlsAllowInvalidCertificates',
'tlsAllowInvalidHostnames',
'tlsCAFile',
'tlsCertificateFile',
'tlsCertificateKeyFile',
'tlsCertificateKeyFilePassword',
'minHeartbeatFrequencyMS',
'heartbeatFrequencyMS',
'directConnection',
'appName',
// CMAP options
'maxPoolSize',
'minPoolSize',
'maxIdleTimeMS',
'waitQueueTimeoutMS'
];
const ignoreOptionNames = ['native_parser'];
const legacyOptionNames = ['server', 'replset', 'replSet', 'mongos', 'db'];
// Validate options object
function validOptions(options) {
const _validOptions = validOptionNames.concat(legacyOptionNames);
for (const name in options) {
if (ignoreOptionNames.indexOf(name) !== -1) {
continue;
}
if (_validOptions.indexOf(name) === -1) {
if (options.validateOptions) {
return new MongoError(`option ${name} is not supported`);
} else {
console.warn(`the options [${name}] is not supported`);
}
}
if (legacyOptionNames.indexOf(name) !== -1) {
console.warn(
`the server/replset/mongos/db options are deprecated, ` +
`all their options are supported at the top level of the options object [${validOptionNames}]`
);
}
}
}
const LEGACY_OPTIONS_MAP = validOptionNames.reduce((obj, name) => {
obj[name.toLowerCase()] = name;
return obj;
}, {});
function addListeners(mongoClient, topology) {
topology.on('authenticated', createListener(mongoClient, 'authenticated'));
topology.on('error', createListener(mongoClient, 'error'));
topology.on('timeout', createListener(mongoClient, 'timeout'));
topology.on('close', createListener(mongoClient, 'close'));
topology.on('parseError', createListener(mongoClient, 'parseError'));
topology.once('open', createListener(mongoClient, 'open'));
topology.once('fullsetup', createListener(mongoClient, 'fullsetup'));
topology.once('all', createListener(mongoClient, 'all'));
topology.on('reconnect', createListener(mongoClient, 'reconnect'));
}
function assignTopology(client, topology) {
client.topology = topology;
if (!(topology instanceof NativeTopology)) {
topology.s.sessionPool = new ServerSessionPool(topology.s.coreTopology);
}
}
// Clear out all events
function clearAllEvents(topology) {
monitoringEvents.forEach(event => topology.removeAllListeners(event));
}
// Collect all events in order from SDAM
function collectEvents(mongoClient, topology) {
let MongoClient = loadClient();
const collectedEvents = [];
if (mongoClient instanceof MongoClient) {
monitoringEvents.forEach(event => {
topology.on(event, (object1, object2) => {
if (event === 'open') {
collectedEvents.push({ event: event, object1: mongoClient });
} else {
collectedEvents.push({ event: event, object1: object1, object2: object2 });
}
});
});
}
return collectedEvents;
}
function resolveTLSOptions(options) {
if (options.tls == null) {
return;
}
['sslCA', 'sslKey', 'sslCert'].forEach(optionName => {
if (options[optionName]) {
options[optionName] = fs.readFileSync(options[optionName]);
}
});
}
const emitDeprecationForNonUnifiedTopology = deprecate(() => {},
'current Server Discovery and Monitoring engine is deprecated, and will be removed in a future version. ' + 'To use the new Server Discover and Monitoring engine, pass option { useUnifiedTopology: true } to the MongoClient constructor.');
function connect(mongoClient, url, options, callback) {
options = Object.assign({}, options);
// If callback is null throw an exception
if (callback == null) {
throw new Error('no callback function provided');
}
let didRequestAuthentication = false;
const logger = Logger('MongoClient', options);
// Did we pass in a Server/ReplSet/Mongos
if (url instanceof Server || url instanceof ReplSet || url instanceof Mongos) {
return connectWithUrl(mongoClient, url, options, connectCallback);
}
const useNewUrlParser = options.useNewUrlParser !== false;
const parseFn = useNewUrlParser ? parse : legacyParse;
const transform = useNewUrlParser ? transformUrlOptions : legacyTransformUrlOptions;
parseFn(url, options, (err, _object) => {
// Do not attempt to connect if parsing error
if (err) return callback(err);
// Flatten
const object = transform(_object);
// Parse the string
const _finalOptions = createUnifiedOptions(object, options);
// Check if we have connection and socket timeout set
if (_finalOptions.socketTimeoutMS == null) _finalOptions.socketTimeoutMS = 360000;
if (_finalOptions.connectTimeoutMS == null) _finalOptions.connectTimeoutMS = 10000;
if (_finalOptions.retryWrites == null) _finalOptions.retryWrites = true;
if (_finalOptions.useRecoveryToken == null) _finalOptions.useRecoveryToken = true;
if (_finalOptions.readPreference == null) _finalOptions.readPreference = 'primary';
if (_finalOptions.db_options && _finalOptions.db_options.auth) {
delete _finalOptions.db_options.auth;
}
// `journal` should be translated to `j` for the driver
if (_finalOptions.journal != null) {
_finalOptions.j = _finalOptions.journal;
_finalOptions.journal = undefined;
}
// resolve tls options if needed
resolveTLSOptions(_finalOptions);
// Store the merged options object
mongoClient.s.options = _finalOptions;
// Failure modes
if (object.servers.length === 0) {
return callback(new Error('connection string must contain at least one seed host'));
}
if (_finalOptions.auth && !_finalOptions.credentials) {
try {
didRequestAuthentication = true;
_finalOptions.credentials = generateCredentials(
mongoClient,
_finalOptions.auth.user,
_finalOptions.auth.password,
_finalOptions
);
} catch (err) {
return callback(err);
}
}
if (_finalOptions.useUnifiedTopology) {
return createTopology(mongoClient, 'unified', _finalOptions, connectCallback);
}
emitDeprecationForNonUnifiedTopology();
// Do we have a replicaset then skip discovery and go straight to connectivity
if (_finalOptions.replicaSet || _finalOptions.rs_name) {
return createTopology(mongoClient, 'replicaset', _finalOptions, connectCallback);
} else if (object.servers.length > 1) {
return createTopology(mongoClient, 'mongos', _finalOptions, connectCallback);
} else {
return createServer(mongoClient, _finalOptions, connectCallback);
}
});
function connectCallback(err, topology) {
const warningMessage = `seed list contains no mongos proxies, replicaset connections requires the parameter replicaSet to be supplied in the URI or options object, mongodb://server:port/db?replicaSet=name`;
if (err && err.message === 'no mongos proxies found in seed list') {
if (logger.isWarn()) {
logger.warn(warningMessage);
}
// Return a more specific error message for MongoClient.connect
return callback(new MongoError(warningMessage));
}
if (didRequestAuthentication) {
mongoClient.emit('authenticated', null, true);
}
// Return the error and db instance
callback(err, topology);
}
}
function connectWithUrl(mongoClient, url, options, connectCallback) {
// Set the topology
assignTopology(mongoClient, url);
// Add listeners
addListeners(mongoClient, url);
// Propagate the events to the client
relayEvents(mongoClient, url);
let finalOptions = Object.assign({}, options);
// If we have a readPreference passed in by the db options, convert it from a string
if (typeof options.readPreference === 'string' || typeof options.read_preference === 'string') {
finalOptions.readPreference = new ReadPreference(
options.readPreference || options.read_preference
);
}
const isDoingAuth = finalOptions.user || finalOptions.password || finalOptions.authMechanism;
if (isDoingAuth && !finalOptions.credentials) {
try {
finalOptions.credentials = generateCredentials(
mongoClient,
finalOptions.user,
finalOptions.password,
finalOptions
);
} catch (err) {
return connectCallback(err, url);
}
}
return url.connect(finalOptions, connectCallback);
}
function createListener(mongoClient, event) {
const eventSet = new Set(['all', 'fullsetup', 'open', 'reconnect']);
return (v1, v2) => {
if (eventSet.has(event)) {
return mongoClient.emit(event, mongoClient);
}
mongoClient.emit(event, v1, v2);
};
}
function createServer(mongoClient, options, callback) {
// Pass in the promise library
options.promiseLibrary = mongoClient.s.promiseLibrary;
// Set default options
const servers = translateOptions(options);
const server = servers[0];
// Propagate the events to the client
const collectedEvents = collectEvents(mongoClient, server);
// Connect to topology
server.connect(options, (err, topology) => {
if (err) {
server.close(true);
return callback(err);
}
// Clear out all the collected event listeners
clearAllEvents(server);
// Relay all the events
relayEvents(mongoClient, server);
// Add listeners
addListeners(mongoClient, server);
// Check if we are really speaking to a mongos
const ismaster = topology.lastIsMaster();
// Set the topology
assignTopology(mongoClient, topology);
// Do we actually have a mongos
if (ismaster && ismaster.msg === 'isdbgrid') {
// Destroy the current connection
topology.close();
// Create mongos connection instead
return createTopology(mongoClient, 'mongos', options, callback);
}
// Fire all the events
replayEvents(mongoClient, collectedEvents);
// Otherwise callback
callback(err, topology);
});
}
const DEPRECATED_UNIFIED_EVENTS = new Set([
'reconnect',
'reconnectFailed',
'attemptReconnect',
'joined',
'left',
'ping',
'ha',
'all',
'fullsetup',
'open'
]);
function registerDeprecatedEventNotifiers(client) {
client.on('newListener', eventName => {
if (DEPRECATED_UNIFIED_EVENTS.has(eventName)) {
emitDeprecationWarning(
`The \`${eventName}\` event is no longer supported by the unified topology, please read more by visiting http://bit.ly/2D8WfT6`,
'DeprecationWarning'
);
}
});
}
function createTopology(mongoClient, topologyType, options, callback) {
// Pass in the promise library
options.promiseLibrary = mongoClient.s.promiseLibrary;
const translationOptions = {};
if (topologyType === 'unified') translationOptions.createServers = false;
// Set default options
const servers = translateOptions(options, translationOptions);
// determine CSFLE support
if (options.autoEncryption != null) {
let AutoEncrypter;
try {
require.resolve('mongodb-client-encryption');
} catch (err) {
callback(
new MongoError(
'Auto-encryption requested, but the module is not installed. Please add `mongodb-client-encryption` as a dependency of your project'
)
);
return;
}
try {
let mongodbClientEncryption = require('mongodb-client-encryption');
if (typeof mongodbClientEncryption.extension !== 'function') {
callback(
new MongoError(
'loaded version of `mongodb-client-encryption` does not have property `extension`. Please make sure you are loading the correct version of `mongodb-client-encryption`'
)
);
}
AutoEncrypter = mongodbClientEncryption.extension(require('../../index')).AutoEncrypter;
} catch (err) {
callback(err);
return;
}
const mongoCryptOptions = Object.assign(
{
bson:
options.bson ||
new BSON([
BSON.Binary,
BSON.Code,
BSON.DBRef,
BSON.Decimal128,
BSON.Double,
BSON.Int32,
BSON.Long,
BSON.Map,
BSON.MaxKey,
BSON.MinKey,
BSON.ObjectId,
BSON.BSONRegExp,
BSON.Symbol,
BSON.Timestamp
])
},
options.autoEncryption
);
options.autoEncrypter = new AutoEncrypter(mongoClient, mongoCryptOptions);
}
// Create the topology
let topology;
if (topologyType === 'mongos') {
topology = new Mongos(servers, options);
} else if (topologyType === 'replicaset') {
topology = new ReplSet(servers, options);
} else if (topologyType === 'unified') {
topology = new NativeTopology(options.servers, options);
registerDeprecatedEventNotifiers(mongoClient);
}
// Add listeners
addListeners(mongoClient, topology);
// Propagate the events to the client
relayEvents(mongoClient, topology);
// Open the connection
assignTopology(mongoClient, topology);
// initialize CSFLE if requested
if (options.autoEncrypter) {
options.autoEncrypter.init(err => {
if (err) {
callback(err);
return;
}
topology.connect(options, err => {
if (err) {
topology.close(true);
callback(err);
return;
}
callback(undefined, topology);
});
});
return;
}
// otherwise connect normally
topology.connect(options, err => {
if (err) {
topology.close(true);
return callback(err);
}
callback(undefined, topology);
return;
});
}
function createUnifiedOptions(finalOptions, options) {
const childOptions = [
'mongos',
'server',
'db',
'replset',
'db_options',
'server_options',
'rs_options',
'mongos_options'
];
const noMerge = ['readconcern', 'compression', 'autoencryption'];
for (const name in options) {
if (noMerge.indexOf(name.toLowerCase()) !== -1) {
finalOptions[name] = options[name];
} else if (childOptions.indexOf(name.toLowerCase()) !== -1) {
finalOptions = mergeOptions(finalOptions, options[name], false);
} else {
if (
options[name] &&
typeof options[name] === 'object' &&
!Buffer.isBuffer(options[name]) &&
!Array.isArray(options[name])
) {
finalOptions = mergeOptions(finalOptions, options[name], true);
} else {
finalOptions[name] = options[name];
}
}
}
return finalOptions;
}
function generateCredentials(client, username, password, options) {
options = Object.assign({}, options);
// the default db to authenticate against is 'self'
// if authententicate is called from a retry context, it may be another one, like admin
const source = options.authSource || options.authdb || options.dbName;
// authMechanism
const authMechanismRaw = options.authMechanism || 'DEFAULT';
const authMechanism = authMechanismRaw.toUpperCase();
const mechanismProperties = options.authMechanismProperties;
if (!VALID_AUTH_MECHANISMS.has(authMechanism)) {
throw MongoError.create({
message: `authentication mechanism ${authMechanismRaw} not supported', options.authMechanism`,
driver: true
});
}
return new MongoCredentials({
mechanism: AUTH_MECHANISM_INTERNAL_MAP[authMechanism],
mechanismProperties,
source,
username,
password
});
}
function legacyTransformUrlOptions(object) {
return mergeOptions(createUnifiedOptions({}, object), object, false);
}
function mergeOptions(target, source, flatten) {
for (const name in source) {
if (source[name] && typeof source[name] === 'object' && flatten) {
target = mergeOptions(target, source[name], flatten);
} else {
target[name] = source[name];
}
}
return target;
}
function relayEvents(mongoClient, topology) {
const serverOrCommandEvents = [
// APM
'commandStarted',
'commandSucceeded',
'commandFailed',
// SDAM
'serverOpening',
'serverClosed',
'serverDescriptionChanged',
'serverHeartbeatStarted',
'serverHeartbeatSucceeded',
'serverHeartbeatFailed',
'topologyOpening',
'topologyClosed',
'topologyDescriptionChanged',
// Legacy
'joined',
'left',
'ping',
'ha'
].concat(CMAP_EVENT_NAMES);
serverOrCommandEvents.forEach(event => {
topology.on(event, (object1, object2) => {
mongoClient.emit(event, object1, object2);
});
});
}
//
// Replay any events due to single server connection switching to Mongos
//
function replayEvents(mongoClient, events) {
for (let i = 0; i < events.length; i++) {
mongoClient.emit(events[i].event, events[i].object1, events[i].object2);
}
}
function transformUrlOptions(_object) {
let object = Object.assign({ servers: _object.hosts }, _object.options);
for (let name in object) {
const camelCaseName = LEGACY_OPTIONS_MAP[name];
if (camelCaseName) {
object[camelCaseName] = object[name];
}
}
const hasUsername = _object.auth && _object.auth.username;
const hasAuthMechanism = _object.options && _object.options.authMechanism;
if (hasUsername || hasAuthMechanism) {
object.auth = Object.assign({}, _object.auth);
if (object.auth.db) {
object.authSource = object.authSource || object.auth.db;
}
if (object.auth.username) {
object.auth.user = object.auth.username;
}
}
if (_object.defaultDatabase) {
object.dbName = _object.defaultDatabase;
}
if (object.maxPoolSize) {
object.poolSize = object.maxPoolSize;
}
if (object.readConcernLevel) {
object.readConcern = new ReadConcern(object.readConcernLevel);
}
if (object.wTimeoutMS) {
object.wtimeout = object.wTimeoutMS;
}
if (_object.srvHost) {
object.srvHost = _object.srvHost;
}
return object;
}
function translateOptions(options, translationOptions) {
translationOptions = Object.assign({}, { createServers: true }, translationOptions);
// If we have a readPreference passed in by the db options
if (typeof options.readPreference === 'string' || typeof options.read_preference === 'string') {
options.readPreference = new ReadPreference(options.readPreference || options.read_preference);
}
// Do we have readPreference tags, add them
if (options.readPreference && (options.readPreferenceTags || options.read_preference_tags)) {
options.readPreference.tags = options.readPreferenceTags || options.read_preference_tags;
}
// Do we have maxStalenessSeconds
if (options.maxStalenessSeconds) {
options.readPreference.maxStalenessSeconds = options.maxStalenessSeconds;
}
// Set the socket and connection timeouts
if (options.socketTimeoutMS == null) options.socketTimeoutMS = 360000;
if (options.connectTimeoutMS == null) options.connectTimeoutMS = 10000;
if (!translationOptions.createServers) {
return;
}
// Create server instances
return options.servers.map(serverObj => {
return serverObj.domain_socket
? new Server(serverObj.domain_socket, 27017, options)
: new Server(serverObj.host, serverObj.port, options);
});
}
module.exports = { validOptions, connect };

68
node_modules/mongodb/lib/operations/count.js generated vendored Normal file
View File

@@ -0,0 +1,68 @@
'use strict';
const buildCountCommand = require('./common_functions').buildCountCommand;
const OperationBase = require('./operation').OperationBase;
class CountOperation extends OperationBase {
constructor(cursor, applySkipLimit, options) {
super(options);
this.cursor = cursor;
this.applySkipLimit = applySkipLimit;
}
execute(callback) {
const cursor = this.cursor;
const applySkipLimit = this.applySkipLimit;
const options = this.options;
if (applySkipLimit) {
if (typeof cursor.cursorSkip() === 'number') options.skip = cursor.cursorSkip();
if (typeof cursor.cursorLimit() === 'number') options.limit = cursor.cursorLimit();
}
// Ensure we have the right read preference inheritance
if (options.readPreference) {
cursor.setReadPreference(options.readPreference);
}
if (
typeof options.maxTimeMS !== 'number' &&
cursor.cmd &&
typeof cursor.cmd.maxTimeMS === 'number'
) {
options.maxTimeMS = cursor.cmd.maxTimeMS;
}
let finalOptions = {};
finalOptions.skip = options.skip;
finalOptions.limit = options.limit;
finalOptions.hint = options.hint;
finalOptions.maxTimeMS = options.maxTimeMS;
// Command
finalOptions.collectionName = cursor.namespace.collection;
let command;
try {
command = buildCountCommand(cursor, cursor.cmd.query, finalOptions);
} catch (err) {
return callback(err);
}
// Set cursor server to the same as the topology
cursor.server = cursor.topology.s.coreTopology;
// Execute the command
cursor.topology.command(
cursor.namespace.withCollection('$cmd'),
command,
cursor.options,
(err, result) => {
callback(err, result ? result.result.n : null);
}
);
}
}
module.exports = CountOperation;

41
node_modules/mongodb/lib/operations/count_documents.js generated vendored Normal file
View File

@@ -0,0 +1,41 @@
'use strict';
const AggregateOperation = require('./aggregate');
class CountDocumentsOperation extends AggregateOperation {
constructor(collection, query, options) {
const pipeline = [{ $match: query }];
if (typeof options.skip === 'number') {
pipeline.push({ $skip: options.skip });
}
if (typeof options.limit === 'number') {
pipeline.push({ $limit: options.limit });
}
pipeline.push({ $group: { _id: 1, n: { $sum: 1 } } });
super(collection, pipeline, options);
}
execute(server, callback) {
super.execute(server, (err, result) => {
if (err) {
callback(err, null);
return;
}
// NOTE: We're avoiding creating a cursor here to reduce the callstack.
const response = result.result;
if (response.cursor == null || response.cursor.firstBatch == null) {
callback(null, 0);
return;
}
const docs = response.cursor.firstBatch;
callback(null, docs.length ? docs[0].n : 0);
});
}
}
module.exports = CountDocumentsOperation;

View File

@@ -0,0 +1,102 @@
'use strict';
const Aspect = require('./operation').Aspect;
const defineAspects = require('./operation').defineAspects;
const CommandOperation = require('./command');
const applyWriteConcern = require('../utils').applyWriteConcern;
const loadCollection = require('../dynamic_loaders').loadCollection;
const MongoError = require('../core').MongoError;
const ReadPreference = require('../core').ReadPreference;
const ILLEGAL_COMMAND_FIELDS = new Set([
'w',
'wtimeout',
'j',
'fsync',
'autoIndexId',
'strict',
'serializeFunctions',
'pkFactory',
'raw',
'readPreference',
'session',
'readConcern',
'writeConcern'
]);
class CreateCollectionOperation extends CommandOperation {
constructor(db, name, options) {
super(db, options);
this.name = name;
}
_buildCommand() {
const name = this.name;
const options = this.options;
const cmd = { create: name };
for (let n in options) {
if (
options[n] != null &&
typeof options[n] !== 'function' &&
!ILLEGAL_COMMAND_FIELDS.has(n)
) {
cmd[n] = options[n];
}
}
return cmd;
}
execute(callback) {
const db = this.db;
const name = this.name;
const options = this.options;
const Collection = loadCollection();
let listCollectionOptions = Object.assign({ nameOnly: true, strict: false }, options);
listCollectionOptions = applyWriteConcern(listCollectionOptions, { db }, listCollectionOptions);
function done(err) {
if (err) {
return callback(err);
}
try {
callback(
null,
new Collection(db, db.s.topology, db.databaseName, name, db.s.pkFactory, options)
);
} catch (err) {
callback(err);
}
}
const strictMode = listCollectionOptions.strict;
if (strictMode) {
db.listCollections({ name }, listCollectionOptions)
.setReadPreference(ReadPreference.PRIMARY)
.toArray((err, collections) => {
if (err) {
return callback(err);
}
if (collections.length > 0) {
return callback(
new MongoError(`Collection ${name} already exists. Currently in strict mode.`)
);
}
super.execute(done);
});
return;
}
// otherwise just execute the command
super.execute(done);
}
}
defineAspects(CreateCollectionOperation, Aspect.WRITE_OPERATION);
module.exports = CreateCollectionOperation;

137
node_modules/mongodb/lib/operations/create_indexes.js generated vendored Normal file
View File

@@ -0,0 +1,137 @@
'use strict';
const Aspect = require('./operation').Aspect;
const defineAspects = require('./operation').defineAspects;
const CommandOperationV2 = require('./command_v2');
const MongoError = require('../core').MongoError;
const parseIndexOptions = require('../utils').parseIndexOptions;
const maxWireVersion = require('../core/utils').maxWireVersion;
const VALID_INDEX_OPTIONS = new Set([
'background',
'unique',
'name',
'partialFilterExpression',
'sparse',
'expireAfterSeconds',
'storageEngine',
'collation',
// text indexes
'weights',
'default_language',
'language_override',
'textIndexVersion',
// 2d-sphere indexes
'2dsphereIndexVersion',
// 2d indexes
'bits',
'min',
'max',
// geoHaystack Indexes
'bucketSize',
// wildcard indexes
'wildcardProjection'
]);
class CreateIndexesOperation extends CommandOperationV2 {
/**
* @ignore
*/
constructor(parent, collection, indexes, options) {
super(parent, options);
this.collection = collection;
// createIndex can be called with a variety of styles:
// coll.createIndex('a');
// coll.createIndex({ a: 1 });
// coll.createIndex([['a', 1]]);
// createIndexes is always called with an array of index spec objects
if (!Array.isArray(indexes) || Array.isArray(indexes[0])) {
this.onlyReturnNameOfCreatedIndex = true;
// TODO: remove in v4 (breaking change); make createIndex return full response as createIndexes does
const indexParameters = parseIndexOptions(indexes);
// Generate the index name
const name = typeof options.name === 'string' ? options.name : indexParameters.name;
// Set up the index
const indexSpec = { name, key: indexParameters.fieldHash };
// merge valid index options into the index spec
for (let optionName in options) {
if (VALID_INDEX_OPTIONS.has(optionName)) {
indexSpec[optionName] = options[optionName];
}
}
this.indexes = [indexSpec];
return;
}
this.indexes = indexes;
}
/**
* @ignore
*/
execute(server, callback) {
const options = this.options;
const indexes = this.indexes;
const serverWireVersion = maxWireVersion(server);
// Ensure we generate the correct name if the parameter is not set
for (let i = 0; i < indexes.length; i++) {
// Did the user pass in a collation, check if our write server supports it
if (indexes[i].collation && serverWireVersion < 5) {
callback(
new MongoError(
`Server ${server.name}, which reports wire version ${serverWireVersion}, does not support collation`
)
);
return;
}
if (indexes[i].name == null) {
const keys = [];
for (let name in indexes[i].key) {
keys.push(`${name}_${indexes[i].key[name]}`);
}
// Set the name
indexes[i].name = keys.join('_');
}
}
const cmd = { createIndexes: this.collection, indexes };
if (options.commitQuorum != null) {
if (serverWireVersion < 9) {
callback(
new MongoError('`commitQuorum` option for `createIndexes` not supported on servers < 4.4')
);
return;
}
cmd.commitQuorum = options.commitQuorum;
}
// collation is set on each index, it should not be defined at the root
this.options.collation = undefined;
super.executeCommand(server, cmd, (err, result) => {
if (err) {
callback(err);
return;
}
callback(null, this.onlyReturnNameOfCreatedIndex ? indexes[0].name : result);
});
}
}
defineAspects(CreateIndexesOperation, [Aspect.WRITE_OPERATION, Aspect.EXECUTE_WITH_SELECTION]);
module.exports = CreateIndexesOperation;

167
node_modules/mongodb/lib/operations/cursor_ops.js generated vendored Normal file
View File

@@ -0,0 +1,167 @@
'use strict';
const buildCountCommand = require('./collection_ops').buildCountCommand;
const handleCallback = require('../utils').handleCallback;
const MongoError = require('../core').MongoError;
const push = Array.prototype.push;
const CursorState = require('../core/cursor').CursorState;
/**
* Get the count of documents for this cursor.
*
* @method
* @param {Cursor} cursor The Cursor instance on which to count.
* @param {boolean} [applySkipLimit=true] Specifies whether the count command apply limit and skip settings should be applied on the cursor or in the provided options.
* @param {object} [options] Optional settings. See Cursor.prototype.count for a list of options.
* @param {Cursor~countResultCallback} [callback] The result callback.
*/
function count(cursor, applySkipLimit, opts, callback) {
if (applySkipLimit) {
if (typeof cursor.cursorSkip() === 'number') opts.skip = cursor.cursorSkip();
if (typeof cursor.cursorLimit() === 'number') opts.limit = cursor.cursorLimit();
}
// Ensure we have the right read preference inheritance
if (opts.readPreference) {
cursor.setReadPreference(opts.readPreference);
}
if (
typeof opts.maxTimeMS !== 'number' &&
cursor.cmd &&
typeof cursor.cmd.maxTimeMS === 'number'
) {
opts.maxTimeMS = cursor.cmd.maxTimeMS;
}
let options = {};
options.skip = opts.skip;
options.limit = opts.limit;
options.hint = opts.hint;
options.maxTimeMS = opts.maxTimeMS;
// Command
options.collectionName = cursor.namespace.collection;
let command;
try {
command = buildCountCommand(cursor, cursor.cmd.query, options);
} catch (err) {
return callback(err);
}
// Set cursor server to the same as the topology
cursor.server = cursor.topology.s.coreTopology;
// Execute the command
cursor.topology.command(
cursor.namespace.withCollection('$cmd'),
command,
cursor.options,
(err, result) => {
callback(err, result ? result.result.n : null);
}
);
}
/**
* Iterates over all the documents for this cursor. See Cursor.prototype.each for more information.
*
* @method
* @deprecated
* @param {Cursor} cursor The Cursor instance on which to run.
* @param {Cursor~resultCallback} callback The result callback.
*/
function each(cursor, callback) {
if (!callback) throw MongoError.create({ message: 'callback is mandatory', driver: true });
if (cursor.isNotified()) return;
if (cursor.s.state === CursorState.CLOSED || cursor.isDead()) {
return handleCallback(
callback,
MongoError.create({ message: 'Cursor is closed', driver: true })
);
}
if (cursor.s.state === CursorState.INIT) {
cursor.s.state = CursorState.OPEN;
}
// Define function to avoid global scope escape
let fn = null;
// Trampoline all the entries
if (cursor.bufferedCount() > 0) {
while ((fn = loop(cursor, callback))) fn(cursor, callback);
each(cursor, callback);
} else {
cursor.next((err, item) => {
if (err) return handleCallback(callback, err);
if (item == null) {
return cursor.close({ skipKillCursors: true }, () => handleCallback(callback, null, null));
}
if (handleCallback(callback, null, item) === false) return;
each(cursor, callback);
});
}
}
// Trampoline emptying the number of retrieved items
// without incurring a nextTick operation
function loop(cursor, callback) {
// No more items we are done
if (cursor.bufferedCount() === 0) return;
// Get the next document
cursor._next(callback);
// Loop
return loop;
}
/**
* Returns an array of documents. See Cursor.prototype.toArray for more information.
*
* @method
* @param {Cursor} cursor The Cursor instance from which to get the next document.
* @param {Cursor~toArrayResultCallback} [callback] The result callback.
*/
function toArray(cursor, callback) {
const items = [];
// Reset cursor
cursor.rewind();
cursor.s.state = CursorState.INIT;
// Fetch all the documents
const fetchDocs = () => {
cursor._next((err, doc) => {
if (err) {
return handleCallback(callback, err);
}
if (doc == null) {
return cursor.close({ skipKillCursors: true }, () => handleCallback(callback, null, items));
}
// Add doc to items
items.push(doc);
// Get all buffered objects
if (cursor.bufferedCount() > 0) {
let docs = cursor.readBufferedDocuments(cursor.bufferedCount());
// Transform the doc if transform method added
if (cursor.s.transforms && typeof cursor.s.transforms.doc === 'function') {
docs = docs.map(cursor.s.transforms.doc);
}
push.apply(items, docs);
}
// Attempt a fetch
fetchDocs();
});
};
fetchDocs();
}
module.exports = { count, each, toArray };

467
node_modules/mongodb/lib/operations/db_ops.js generated vendored Normal file
View File

@@ -0,0 +1,467 @@
'use strict';
const applyWriteConcern = require('../utils').applyWriteConcern;
const Code = require('../core').BSON.Code;
const debugOptions = require('../utils').debugOptions;
const handleCallback = require('../utils').handleCallback;
const MongoError = require('../core').MongoError;
const parseIndexOptions = require('../utils').parseIndexOptions;
const ReadPreference = require('../core').ReadPreference;
const toError = require('../utils').toError;
const CONSTANTS = require('../constants');
const MongoDBNamespace = require('../utils').MongoDBNamespace;
const debugFields = [
'authSource',
'w',
'wtimeout',
'j',
'native_parser',
'forceServerObjectId',
'serializeFunctions',
'raw',
'promoteLongs',
'promoteValues',
'promoteBuffers',
'bufferMaxEntries',
'numberOfRetries',
'retryMiliSeconds',
'readPreference',
'pkFactory',
'parentDb',
'promiseLibrary',
'noListener'
];
/**
* Creates an index on the db and collection.
* @method
* @param {Db} db The Db instance on which to create an index.
* @param {string} name Name of the collection to create the index on.
* @param {(string|object)} fieldOrSpec Defines the index.
* @param {object} [options] Optional settings. See Db.prototype.createIndex for a list of options.
* @param {Db~resultCallback} [callback] The command result callback
*/
function createIndex(db, name, fieldOrSpec, options, callback) {
// Get the write concern options
let finalOptions = Object.assign({}, { readPreference: ReadPreference.PRIMARY }, options);
finalOptions = applyWriteConcern(finalOptions, { db }, options);
// Ensure we have a callback
if (finalOptions.writeConcern && typeof callback !== 'function') {
throw MongoError.create({
message: 'Cannot use a writeConcern without a provided callback',
driver: true
});
}
// Did the user destroy the topology
if (db.serverConfig && db.serverConfig.isDestroyed())
return callback(new MongoError('topology was destroyed'));
// Attempt to run using createIndexes command
createIndexUsingCreateIndexes(db, name, fieldOrSpec, finalOptions, (err, result) => {
if (err == null) return handleCallback(callback, err, result);
/**
* The following errors mean that the server recognized `createIndex` as a command so we don't need to fallback to an insert:
* 67 = 'CannotCreateIndex' (malformed index options)
* 85 = 'IndexOptionsConflict' (index already exists with different options)
* 86 = 'IndexKeySpecsConflict' (index already exists with the same name)
* 11000 = 'DuplicateKey' (couldn't build unique index because of dupes)
* 11600 = 'InterruptedAtShutdown' (interrupted at shutdown)
* 197 = 'InvalidIndexSpecificationOption' (`_id` with `background: true`)
*/
if (
err.code === 67 ||
err.code === 11000 ||
err.code === 85 ||
err.code === 86 ||
err.code === 11600 ||
err.code === 197
) {
return handleCallback(callback, err, result);
}
// Create command
const doc = createCreateIndexCommand(db, name, fieldOrSpec, options);
// Set no key checking
finalOptions.checkKeys = false;
// Insert document
db.s.topology.insert(
db.s.namespace.withCollection(CONSTANTS.SYSTEM_INDEX_COLLECTION),
doc,
finalOptions,
(err, result) => {
if (callback == null) return;
if (err) return handleCallback(callback, err);
if (result == null) return handleCallback(callback, null, null);
if (result.result.writeErrors)
return handleCallback(callback, MongoError.create(result.result.writeErrors[0]), null);
handleCallback(callback, null, doc.name);
}
);
});
}
// Add listeners to topology
function createListener(db, e, object) {
function listener(err) {
if (object.listeners(e).length > 0) {
object.emit(e, err, db);
// Emit on all associated db's if available
for (let i = 0; i < db.s.children.length; i++) {
db.s.children[i].emit(e, err, db.s.children[i]);
}
}
}
return listener;
}
/**
* Ensures that an index exists. If it does not, creates it.
*
* @method
* @param {Db} db The Db instance on which to ensure the index.
* @param {string} name The index name
* @param {(string|object)} fieldOrSpec Defines the index.
* @param {object} [options] Optional settings. See Db.prototype.ensureIndex for a list of options.
* @param {Db~resultCallback} [callback] The command result callback
*/
function ensureIndex(db, name, fieldOrSpec, options, callback) {
// Get the write concern options
const finalOptions = applyWriteConcern({}, { db }, options);
// Create command
const selector = createCreateIndexCommand(db, name, fieldOrSpec, options);
const index_name = selector.name;
// Did the user destroy the topology
if (db.serverConfig && db.serverConfig.isDestroyed())
return callback(new MongoError('topology was destroyed'));
// Merge primary readPreference
finalOptions.readPreference = ReadPreference.PRIMARY;
// Check if the index already exists
indexInformation(db, name, finalOptions, (err, indexInformation) => {
if (err != null && err.code !== 26) return handleCallback(callback, err, null);
// If the index does not exist, create it
if (indexInformation == null || !indexInformation[index_name]) {
createIndex(db, name, fieldOrSpec, options, callback);
} else {
if (typeof callback === 'function') return handleCallback(callback, null, index_name);
}
});
}
/**
* Evaluate JavaScript on the server
*
* @method
* @param {Db} db The Db instance.
* @param {Code} code JavaScript to execute on server.
* @param {(object|array)} parameters The parameters for the call.
* @param {object} [options] Optional settings. See Db.prototype.eval for a list of options.
* @param {Db~resultCallback} [callback] The results callback
* @deprecated Eval is deprecated on MongoDB 3.2 and forward
*/
function evaluate(db, code, parameters, options, callback) {
let finalCode = code;
let finalParameters = [];
// Did the user destroy the topology
if (db.serverConfig && db.serverConfig.isDestroyed())
return callback(new MongoError('topology was destroyed'));
// If not a code object translate to one
if (!(finalCode && finalCode._bsontype === 'Code')) finalCode = new Code(finalCode);
// Ensure the parameters are correct
if (parameters != null && !Array.isArray(parameters) && typeof parameters !== 'function') {
finalParameters = [parameters];
} else if (parameters != null && Array.isArray(parameters) && typeof parameters !== 'function') {
finalParameters = parameters;
}
// Create execution selector
let cmd = { $eval: finalCode, args: finalParameters };
// Check if the nolock parameter is passed in
if (options['nolock']) {
cmd['nolock'] = options['nolock'];
}
// Set primary read preference
options.readPreference = new ReadPreference(ReadPreference.PRIMARY);
// Execute the command
executeCommand(db, cmd, options, (err, result) => {
if (err) return handleCallback(callback, err, null);
if (result && result.ok === 1) return handleCallback(callback, null, result.retval);
if (result)
return handleCallback(
callback,
MongoError.create({ message: `eval failed: ${result.errmsg}`, driver: true }),
null
);
handleCallback(callback, err, result);
});
}
/**
* Execute a command
*
* @method
* @param {Db} db The Db instance on which to execute the command.
* @param {object} command The command hash
* @param {object} [options] Optional settings. See Db.prototype.command for a list of options.
* @param {Db~resultCallback} [callback] The command result callback
*/
function executeCommand(db, command, options, callback) {
// Did the user destroy the topology
if (db.serverConfig && db.serverConfig.isDestroyed())
return callback(new MongoError('topology was destroyed'));
// Get the db name we are executing against
const dbName = options.dbName || options.authdb || db.databaseName;
// Convert the readPreference if its not a write
options.readPreference = ReadPreference.resolve(db, options);
// Debug information
if (db.s.logger.isDebug())
db.s.logger.debug(
`executing command ${JSON.stringify(
command
)} against ${dbName}.$cmd with options [${JSON.stringify(
debugOptions(debugFields, options)
)}]`
);
// Execute command
db.s.topology.command(db.s.namespace.withCollection('$cmd'), command, options, (err, result) => {
if (err) return handleCallback(callback, err);
if (options.full) return handleCallback(callback, null, result);
handleCallback(callback, null, result.result);
});
}
/**
* Runs a command on the database as admin.
*
* @method
* @param {Db} db The Db instance on which to execute the command.
* @param {object} command The command hash
* @param {object} [options] Optional settings. See Db.prototype.executeDbAdminCommand for a list of options.
* @param {Db~resultCallback} [callback] The command result callback
*/
function executeDbAdminCommand(db, command, options, callback) {
const namespace = new MongoDBNamespace('admin', '$cmd');
db.s.topology.command(namespace, command, options, (err, result) => {
// Did the user destroy the topology
if (db.serverConfig && db.serverConfig.isDestroyed()) {
return callback(new MongoError('topology was destroyed'));
}
if (err) return handleCallback(callback, err);
handleCallback(callback, null, result.result);
});
}
/**
* Retrieves this collections index info.
*
* @method
* @param {Db} db The Db instance on which to retrieve the index info.
* @param {string} name The name of the collection.
* @param {object} [options] Optional settings. See Db.prototype.indexInformation for a list of options.
* @param {Db~resultCallback} [callback] The command result callback
*/
function indexInformation(db, name, options, callback) {
// If we specified full information
const full = options['full'] == null ? false : options['full'];
// Did the user destroy the topology
if (db.serverConfig && db.serverConfig.isDestroyed())
return callback(new MongoError('topology was destroyed'));
// Process all the results from the index command and collection
function processResults(indexes) {
// Contains all the information
let info = {};
// Process all the indexes
for (let i = 0; i < indexes.length; i++) {
const index = indexes[i];
// Let's unpack the object
info[index.name] = [];
for (let name in index.key) {
info[index.name].push([name, index.key[name]]);
}
}
return info;
}
// Get the list of indexes of the specified collection
db.collection(name)
.listIndexes(options)
.toArray((err, indexes) => {
if (err) return callback(toError(err));
if (!Array.isArray(indexes)) return handleCallback(callback, null, []);
if (full) return handleCallback(callback, null, indexes);
handleCallback(callback, null, processResults(indexes));
});
}
/**
* Retrieve the current profiling information for MongoDB
*
* @method
* @param {Db} db The Db instance on which to retrieve the profiling info.
* @param {Object} [options] Optional settings. See Db.protoype.profilingInfo for a list of options.
* @param {Db~resultCallback} [callback] The command result callback.
* @deprecated Query the system.profile collection directly.
*/
function profilingInfo(db, options, callback) {
try {
db.collection('system.profile')
.find({}, options)
.toArray(callback);
} catch (err) {
return callback(err, null);
}
}
// Validate the database name
function validateDatabaseName(databaseName) {
if (typeof databaseName !== 'string')
throw MongoError.create({ message: 'database name must be a string', driver: true });
if (databaseName.length === 0)
throw MongoError.create({ message: 'database name cannot be the empty string', driver: true });
if (databaseName === '$external') return;
const invalidChars = [' ', '.', '$', '/', '\\'];
for (let i = 0; i < invalidChars.length; i++) {
if (databaseName.indexOf(invalidChars[i]) !== -1)
throw MongoError.create({
message: "database names cannot contain the character '" + invalidChars[i] + "'",
driver: true
});
}
}
/**
* Create the command object for Db.prototype.createIndex.
*
* @param {Db} db The Db instance on which to create the command.
* @param {string} name Name of the collection to create the index on.
* @param {(string|object)} fieldOrSpec Defines the index.
* @param {Object} [options] Optional settings. See Db.prototype.createIndex for a list of options.
* @return {Object} The insert command object.
*/
function createCreateIndexCommand(db, name, fieldOrSpec, options) {
const indexParameters = parseIndexOptions(fieldOrSpec);
const fieldHash = indexParameters.fieldHash;
// Generate the index name
const indexName = typeof options.name === 'string' ? options.name : indexParameters.name;
const selector = {
ns: db.s.namespace.withCollection(name).toString(),
key: fieldHash,
name: indexName
};
// Ensure we have a correct finalUnique
const finalUnique = options == null || 'object' === typeof options ? false : options;
// Set up options
options = options == null || typeof options === 'boolean' ? {} : options;
// Add all the options
const keysToOmit = Object.keys(selector);
for (let optionName in options) {
if (keysToOmit.indexOf(optionName) === -1) {
selector[optionName] = options[optionName];
}
}
if (selector['unique'] == null) selector['unique'] = finalUnique;
// Remove any write concern operations
const removeKeys = ['w', 'wtimeout', 'j', 'fsync', 'readPreference', 'session'];
for (let i = 0; i < removeKeys.length; i++) {
delete selector[removeKeys[i]];
}
// Return the command creation selector
return selector;
}
/**
* Create index using the createIndexes command.
*
* @param {Db} db The Db instance on which to execute the command.
* @param {string} name Name of the collection to create the index on.
* @param {(string|object)} fieldOrSpec Defines the index.
* @param {Object} [options] Optional settings. See Db.prototype.createIndex for a list of options.
* @param {Db~resultCallback} [callback] The command result callback.
*/
function createIndexUsingCreateIndexes(db, name, fieldOrSpec, options, callback) {
// Build the index
const indexParameters = parseIndexOptions(fieldOrSpec);
// Generate the index name
const indexName = typeof options.name === 'string' ? options.name : indexParameters.name;
// Set up the index
const indexes = [{ name: indexName, key: indexParameters.fieldHash }];
// merge all the options
const keysToOmit = Object.keys(indexes[0]).concat([
'writeConcern',
'w',
'wtimeout',
'j',
'fsync',
'readPreference',
'session'
]);
for (let optionName in options) {
if (keysToOmit.indexOf(optionName) === -1) {
indexes[0][optionName] = options[optionName];
}
}
// Get capabilities
const capabilities = db.s.topology.capabilities();
// Did the user pass in a collation, check if our write server supports it
if (indexes[0].collation && capabilities && !capabilities.commandsTakeCollation) {
// Create a new error
const error = new MongoError('server/primary/mongos does not support collation');
error.code = 67;
// Return the error
return callback(error);
}
// Create command, apply write concern to command
const cmd = applyWriteConcern({ createIndexes: name, indexes }, { db }, options);
// ReadPreference primary
options.readPreference = ReadPreference.PRIMARY;
// Build the command
executeCommand(db, cmd, options, (err, result) => {
if (err) return handleCallback(callback, err, null);
if (result.ok === 0) return handleCallback(callback, toError(result), null);
// Return the indexName for backward compatibility
handleCallback(callback, null, indexName);
});
}
module.exports = {
createListener,
createIndex,
ensureIndex,
evaluate,
executeCommand,
executeDbAdminCommand,
indexInformation,
profilingInfo,
validateDatabaseName
};

25
node_modules/mongodb/lib/operations/delete_many.js generated vendored Normal file
View File

@@ -0,0 +1,25 @@
'use strict';
const OperationBase = require('./operation').OperationBase;
const deleteCallback = require('./common_functions').deleteCallback;
const removeDocuments = require('./common_functions').removeDocuments;
class DeleteManyOperation extends OperationBase {
constructor(collection, filter, options) {
super(options);
this.collection = collection;
this.filter = filter;
}
execute(callback) {
const coll = this.collection;
const filter = this.filter;
const options = this.options;
options.single = false;
removeDocuments(coll, filter, options, (err, r) => deleteCallback(err, r, callback));
}
}
module.exports = DeleteManyOperation;

25
node_modules/mongodb/lib/operations/delete_one.js generated vendored Normal file
View File

@@ -0,0 +1,25 @@
'use strict';
const OperationBase = require('./operation').OperationBase;
const deleteCallback = require('./common_functions').deleteCallback;
const removeDocuments = require('./common_functions').removeDocuments;
class DeleteOneOperation extends OperationBase {
constructor(collection, filter, options) {
super(options);
this.collection = collection;
this.filter = filter;
}
execute(callback) {
const coll = this.collection;
const filter = this.filter;
const options = this.options;
options.single = true;
removeDocuments(coll, filter, options, (err, r) => deleteCallback(err, r, callback));
}
}
module.exports = DeleteOneOperation;

85
node_modules/mongodb/lib/operations/distinct.js generated vendored Normal file
View File

@@ -0,0 +1,85 @@
'use strict';
const Aspect = require('./operation').Aspect;
const defineAspects = require('./operation').defineAspects;
const CommandOperationV2 = require('./command_v2');
const decorateWithCollation = require('../utils').decorateWithCollation;
const decorateWithReadConcern = require('../utils').decorateWithReadConcern;
/**
* Return a list of distinct values for the given key across a collection.
*
* @class
* @property {Collection} a Collection instance.
* @property {string} key Field of the document to find distinct values for.
* @property {object} query The query for filtering the set of documents to which we apply the distinct filter.
* @property {object} [options] Optional settings. See Collection.prototype.distinct for a list of options.
*/
class DistinctOperation extends CommandOperationV2 {
/**
* Construct a Distinct operation.
*
* @param {Collection} a Collection instance.
* @param {string} key Field of the document to find distinct values for.
* @param {object} query The query for filtering the set of documents to which we apply the distinct filter.
* @param {object} [options] Optional settings. See Collection.prototype.distinct for a list of options.
*/
constructor(collection, key, query, options) {
super(collection, options);
this.collection = collection;
this.key = key;
this.query = query;
}
/**
* Execute the operation.
*
* @param {Collection~resultCallback} [callback] The command result callback
*/
execute(server, callback) {
const coll = this.collection;
const key = this.key;
const query = this.query;
const options = this.options;
// Distinct command
const cmd = {
distinct: coll.collectionName,
key: key,
query: query
};
// Add maxTimeMS if defined
if (typeof options.maxTimeMS === 'number') {
cmd.maxTimeMS = options.maxTimeMS;
}
// Do we have a readConcern specified
decorateWithReadConcern(cmd, coll, options);
// Have we specified collation
try {
decorateWithCollation(cmd, coll, options);
} catch (err) {
return callback(err, null);
}
super.executeCommand(server, cmd, (err, result) => {
if (err) {
callback(err);
return;
}
callback(null, this.options.full ? result : result.values);
});
}
}
defineAspects(DistinctOperation, [
Aspect.READ_OPERATION,
Aspect.RETRYABLE,
Aspect.EXECUTE_WITH_SELECTION
]);
module.exports = DistinctOperation;

53
node_modules/mongodb/lib/operations/drop.js generated vendored Normal file
View File

@@ -0,0 +1,53 @@
'use strict';
const Aspect = require('./operation').Aspect;
const CommandOperation = require('./command');
const defineAspects = require('./operation').defineAspects;
const handleCallback = require('../utils').handleCallback;
class DropOperation extends CommandOperation {
constructor(db, options) {
const finalOptions = Object.assign({}, options, db.s.options);
if (options.session) {
finalOptions.session = options.session;
}
super(db, finalOptions);
}
execute(callback) {
super.execute((err, result) => {
if (err) return handleCallback(callback, err);
if (result.ok) return handleCallback(callback, null, true);
handleCallback(callback, null, false);
});
}
}
defineAspects(DropOperation, Aspect.WRITE_OPERATION);
class DropCollectionOperation extends DropOperation {
constructor(db, name, options) {
super(db, options);
this.name = name;
this.namespace = `${db.namespace}.${name}`;
}
_buildCommand() {
return { drop: this.name };
}
}
class DropDatabaseOperation extends DropOperation {
_buildCommand() {
return { dropDatabase: 1 };
}
}
module.exports = {
DropOperation,
DropCollectionOperation,
DropDatabaseOperation
};

42
node_modules/mongodb/lib/operations/drop_index.js generated vendored Normal file
View File

@@ -0,0 +1,42 @@
'use strict';
const Aspect = require('./operation').Aspect;
const defineAspects = require('./operation').defineAspects;
const CommandOperation = require('./command');
const applyWriteConcern = require('../utils').applyWriteConcern;
const handleCallback = require('../utils').handleCallback;
class DropIndexOperation extends CommandOperation {
constructor(collection, indexName, options) {
super(collection.s.db, options, collection);
this.collection = collection;
this.indexName = indexName;
}
_buildCommand() {
const collection = this.collection;
const indexName = this.indexName;
const options = this.options;
let cmd = { dropIndexes: collection.collectionName, index: indexName };
// Decorate command with writeConcern if supported
cmd = applyWriteConcern(cmd, { db: collection.s.db, collection }, options);
return cmd;
}
execute(callback) {
// Execute command
super.execute((err, result) => {
if (typeof callback !== 'function') return;
if (err) return handleCallback(callback, err, null);
handleCallback(callback, null, result);
});
}
}
defineAspects(DropIndexOperation, Aspect.WRITE_OPERATION);
module.exports = DropIndexOperation;

23
node_modules/mongodb/lib/operations/drop_indexes.js generated vendored Normal file
View File

@@ -0,0 +1,23 @@
'use strict';
const Aspect = require('./operation').Aspect;
const defineAspects = require('./operation').defineAspects;
const DropIndexOperation = require('./drop_index');
const handleCallback = require('../utils').handleCallback;
class DropIndexesOperation extends DropIndexOperation {
constructor(collection, options) {
super(collection, '*', options);
}
execute(callback) {
super.execute(err => {
if (err) return handleCallback(callback, err, false);
handleCallback(callback, null, true);
});
}
}
defineAspects(DropIndexesOperation, Aspect.WRITE_OPERATION);
module.exports = DropIndexesOperation;

Some files were not shown because too many files have changed in this diff Show More